builder: mozilla-central_yosemite-debug_test-mochitest-devtools-chrome-6 slave: t-yosemite-r5-0087 starttime: 1446551545.76 results: success (0) buildid: 20151103025934 builduid: 22bda49f6d054505b678b83f44b7d0db revision: 46dc2b5e7f34e2ed71500fda8256a6588e7b3e6d ========= Started set props: master (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:25.757840) ========= master: http://buildbot-master107.bb.releng.scl3.mozilla.com:8201/ ========= Finished set props: master (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:25.758312) ========= ========= Started set props: basedir (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:25.758640) ========= bash -c pwd in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'pwd'] environment: Apple_PubSub_Socket_Render=/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners TMPDIR=/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.7 XPC_FLAGS=0x0 XPC_SERVICE_NAME=0 __CF_USER_TEXT_ENCODING=0x1C:0x0:0x0 using PTY: False /builds/slave/test program finished with exit code 0 elapsedTime=0.005793 basedir: '/builds/slave/test' ========= master_lag: 0.34 ========= ========= Finished set props: basedir (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.101707) ========= ========= Started downloading to buildprops.json (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.102033) ========= ========= Finished downloading to buildprops.json (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.171467) ========= ========= Started 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.171759) ========= rm -rf properties in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-rf', 'properties'] environment: Apple_PubSub_Socket_Render=/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners TMPDIR=/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.7 XPC_FLAGS=0x0 XPC_SERVICE_NAME=0 __CF_USER_TEXT_ENCODING=0x1C:0x0:0x0 using PTY: False program finished with exit code 0 elapsedTime=0.017742 ========= master_lag: 0.03 ========= ========= Finished 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.221028) ========= ========= Started set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.221377) ========= script_repo_url: https://hg.mozilla.org/build/mozharness ========= Finished set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.221825) ========= ========= Started 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.222169) ========= bash -c 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py' in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py'] environment: Apple_PubSub_Socket_Render=/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners TMPDIR=/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.7 XPC_FLAGS=0x0 XPC_SERVICE_NAME=0 __CF_USER_TEXT_ENCODING=0x1C:0x0:0x0 using PTY: False --2015-11-03 03:52:26-- https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py Resolving hg.mozilla.org... 63.245.215.25, 63.245.215.102, :: Connecting to hg.mozilla.org|63.245.215.25|:443... connected. HTTP request sent, awaiting response... 200 Script output follows Length: 12141 (12K) [text/x-python] Saving to: `archiver_client.py' 0K .......... . 100% 13.2M=0.001s 2015-11-03 03:52:26 (13.2 MB/s) - `archiver_client.py' saved [12141/12141] program finished with exit code 0 elapsedTime=0.157438 ========= master_lag: 0.02 ========= ========= Finished 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.395783) ========= ========= Started 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.396129) ========= rm -rf scripts in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-rf', 'scripts'] environment: Apple_PubSub_Socket_Render=/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners TMPDIR=/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.7 XPC_FLAGS=0x0 XPC_SERVICE_NAME=0 __CF_USER_TEXT_ENCODING=0x1C:0x0:0x0 using PTY: False program finished with exit code 0 elapsedTime=0.152720 ========= master_lag: 0.02 ========= ========= Finished 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.566153) ========= ========= Started 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:26.566607) ========= bash -c 'python archiver_client.py mozharness --repo mozilla-central --rev 46dc2b5e7f34e2ed71500fda8256a6588e7b3e6d --destination scripts --debug' in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', u'python archiver_client.py mozharness --repo mozilla-central --rev 46dc2b5e7f34e2ed71500fda8256a6588e7b3e6d --destination scripts --debug'] environment: Apple_PubSub_Socket_Render=/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners TMPDIR=/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.7 XPC_FLAGS=0x0 XPC_SERVICE_NAME=0 __CF_USER_TEXT_ENCODING=0x1C:0x0:0x0 using PTY: False 2015-11-03 03:52:26,655 truncating revision to first 12 chars 2015-11-03 03:52:26,655 Setting DEBUG logging. 2015-11-03 03:52:26,655 attempt 1/10 2015-11-03 03:52:26,655 Getting archive location from https://api.pub.build.mozilla.org/archiver/hgmo/mozilla-central/46dc2b5e7f34?&preferred_region=us-west-2&suffix=tar.gz&subdir=testing/mozharness 2015-11-03 03:52:26,914 unpacking tar archive at: mozilla-central-46dc2b5e7f34/testing/mozharness/ program finished with exit code 0 elapsedTime=0.519288 ========= master_lag: 0.02 ========= ========= Finished 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:27.102503) ========= ========= Started downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:27.102846) ========= ========= Finished downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:27.119362) ========= ========= Started tinderboxprint_script_revlink (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:27.119749) ========= TinderboxPrint: script_revlink: https://hg.mozilla.org/build/mozharness/rev/production ========= Finished tinderboxprint_script_revlink (results: 0, elapsed: 0 secs) (at 2015-11-03 03:52:27.120243) ========= ========= Started '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' (results: 0, elapsed: 16 mins, 3 secs) (at 2015-11-03 03:52:27.120564) ========= /tools/buildbot/bin/python scripts/scripts/desktop_unittest.py --cfg unittests/mac_unittest.py --mochitest-suite mochitest-devtools-chrome-chunked --total-chunks 8 --this-chunk 6 --blob-upload-branch mozilla-central --download-symbols true in dir /builds/slave/test/. (timeout 1800 secs) (maxTime 4800 secs) watching logfiles {} argv: ['/tools/buildbot/bin/python', 'scripts/scripts/desktop_unittest.py', '--cfg', 'unittests/mac_unittest.py', '--mochitest-suite', 'mochitest-devtools-chrome-chunked', '--total-chunks', '8', '--this-chunk', '6', '--blob-upload-branch', 'mozilla-central', '--download-symbols', 'true'] environment: Apple_PubSub_Socket_Render=/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld MOZ_HIDE_RESULTS_TABLE=1 MOZ_NO_REMOTE=1 NO_EM_RESTART=1 NO_FAIL_ON_TEST_ERRORS=1 PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PROPERTIES_FILE=/builds/slave/test/buildprops.json PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners TMPDIR=/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.7 XPCOM_DEBUG_BREAK=warn XPC_FLAGS=0x0 XPC_SERVICE_NAME=0 __CF_USER_TEXT_ENCODING=0x1C:0x0:0x0 using PTY: False 03:52:27 INFO - MultiFileLogger online at 20151103 03:52:27 in /builds/slave/test 03:52:27 INFO - Run as scripts/scripts/desktop_unittest.py --cfg unittests/mac_unittest.py --mochitest-suite mochitest-devtools-chrome-chunked --total-chunks 8 --this-chunk 6 --blob-upload-branch mozilla-central --download-symbols true 03:52:27 INFO - Dumping config to /builds/slave/test/logs/localconfig.json. 03:52:27 INFO - {'all_cppunittest_suites': {'cppunittest': ('tests/cppunittest',)}, 03:52:27 INFO - 'all_gtest_suites': {'gtest': ()}, 03:52:27 INFO - 'all_jittest_suites': {'jittest': ()}, 03:52:27 INFO - 'all_mochitest_suites': {'a11y': ('--a11y',), 03:52:27 INFO - 'browser-chrome': ('--browser-chrome',), 03:52:27 INFO - 'browser-chrome-addons': ('--browser-chrome', 03:52:27 INFO - '--chunk-by-runtime', 03:52:27 INFO - '--tag=addons'), 03:52:27 INFO - 'browser-chrome-chunked': ('--browser-chrome', 03:52:27 INFO - '--chunk-by-runtime'), 03:52:27 INFO - 'chrome': ('--chrome',), 03:52:27 INFO - 'chrome-chunked': ('--chrome', '--chunk-by-dir=4'), 03:52:27 INFO - 'jetpack-addon': ('--jetpack-addon',), 03:52:27 INFO - 'jetpack-package': ('--jetpack-package',), 03:52:27 INFO - 'mochitest-devtools-chrome': ('--browser-chrome', 03:52:27 INFO - '--subsuite=devtools'), 03:52:27 INFO - 'mochitest-devtools-chrome-chunked': ('--browser-chrome', 03:52:27 INFO - '--subsuite=devtools', 03:52:27 INFO - '--chunk-by-runtime'), 03:52:27 INFO - 'mochitest-gl': ('--subsuite=webgl',), 03:52:27 INFO - 'mochitest-push': ('--subsuite=push',), 03:52:27 INFO - 'plain': (), 03:52:27 INFO - 'plain-chunked': ('--chunk-by-dir=4',)}, 03:52:27 INFO - 'all_mozbase_suites': {'mozbase': ()}, 03:52:27 INFO - 'all_reftest_suites': {'crashtest': {'options': ('--suite=crashtest',), 03:52:27 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)}, 03:52:27 INFO - 'crashtest-ipc': {'options': ('--suite=crashtest', 03:52:27 INFO - '--setpref=browser.tabs.remote=true', 03:52:27 INFO - '--setpref=browser.tabs.remote.autostart=true', 03:52:27 INFO - '--setpref=layers.async-pan-zoom.enabled=true'), 03:52:27 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)}, 03:52:27 INFO - 'jsreftest': {'options': ('--extra-profile-file=tests/jsreftest/tests/user.js',), 03:52:27 INFO - 'tests': ('tests/jsreftest/tests/jstests.list',)}, 03:52:27 INFO - 'reftest': {'options': ('--suite=reftest',), 03:52:27 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest.list',)}, 03:52:27 INFO - 'reftest-ipc': {'options': ('--suite=reftest', 03:52:27 INFO - '--setpref=browser.tabs.remote=true', 03:52:27 INFO - '--setpref=browser.tabs.remote.autostart=true', 03:52:27 INFO - '--setpref=layers.async-pan-zoom.enabled=true'), 03:52:27 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest-sanity/reftest.list',)}}, 03:52:27 INFO - 'all_webapprt_suites': {'chrome': ('--webapprt-chrome', 03:52:27 INFO - '--browser-arg=-test-mode'), 03:52:27 INFO - 'content': ('--webapprt-content',)}, 03:52:27 INFO - 'all_xpcshell_suites': {'xpcshell': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell', 03:52:27 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'), 03:52:27 INFO - 'tests': ()}, 03:52:27 INFO - 'xpcshell-addons': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell', 03:52:27 INFO - '--tag=addons', 03:52:27 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'), 03:52:27 INFO - 'tests': ()}}, 03:52:27 INFO - 'append_to_log': False, 03:52:27 INFO - 'base_work_dir': '/builds/slave/test', 03:52:27 INFO - 'blob_upload_branch': 'mozilla-central', 03:52:27 INFO - 'blob_uploader_auth_file': '/builds/slave/test/oauth.txt', 03:52:27 INFO - 'buildbot_json_path': 'buildprops.json', 03:52:27 INFO - 'buildbot_max_log_size': 52428800, 03:52:27 INFO - 'code_coverage': False, 03:52:27 INFO - 'config_files': ('unittests/mac_unittest.py',), 03:52:27 INFO - 'default_blob_upload_servers': ('https://blobupload.elasticbeanstalk.com',), 03:52:27 INFO - 'download_minidump_stackwalk': True, 03:52:27 INFO - 'download_symbols': 'true', 03:52:27 INFO - 'e10s': False, 03:52:27 INFO - 'exe_suffix': '', 03:52:27 INFO - 'exes': {'python': '/tools/buildbot/bin/python', 03:52:27 INFO - 'tooltool.py': '/tools/tooltool.py', 03:52:27 INFO - 'virtualenv': ('/tools/buildbot/bin/python', 03:52:27 INFO - '/tools/misc-python/virtualenv.py')}, 03:52:27 INFO - 'find_links': ('http://pypi.pvt.build.mozilla.org/pub', 03:52:27 INFO - 'http://pypi.pub.build.mozilla.org/pub'), 03:52:27 INFO - 'installer_path': '/builds/slave/test/installer.dmg', 03:52:27 INFO - 'log_level': 'info', 03:52:27 INFO - 'log_to_console': True, 03:52:27 INFO - 'minidump_save_path': '%(abs_work_dir)s/../minidumps', 03:52:27 INFO - 'minidump_stackwalk_path': 'macosx64-minidump_stackwalk', 03:52:27 INFO - 'minidump_tooltool_manifest_path': 'config/tooltool-manifests/macosx64/releng.manifest', 03:52:27 INFO - 'minimum_tests_zip_dirs': ('bin/*', 03:52:27 INFO - 'certs/*', 03:52:27 INFO - 'modules/*', 03:52:27 INFO - 'mozbase/*', 03:52:27 INFO - 'config/*'), 03:52:27 INFO - 'no_random': False, 03:52:27 INFO - 'opt_config_files': (), 03:52:27 INFO - 'pip_index': False, 03:52:27 INFO - 'preflight_run_cmd_suites': ({'architectures': ('32bit', '64bit'), 03:52:27 INFO - 'cmd': ('xset', 's', 'off', 's', 'reset'), 03:52:27 INFO - 'enabled': False, 03:52:27 INFO - 'halt_on_failure': False, 03:52:27 INFO - 'name': 'disable_screen_saver'}, 03:52:27 INFO - {'architectures': ('32bit',), 03:52:27 INFO - 'cmd': ('python', 03:52:27 INFO - '../scripts/external_tools/mouse_and_screen_resolution.py', 03:52:27 INFO - '--configuration-url', 03:52:27 INFO - 'https://hg.mozilla.org/%(branch)s/raw-file/%(revision)s/testing/machine-configuration.json'), 03:52:27 INFO - 'enabled': False, 03:52:27 INFO - 'halt_on_failure': True, 03:52:27 INFO - 'name': 'run mouse & screen adjustment script'}), 03:52:27 INFO - 'require_test_zip': True, 03:52:27 INFO - 'run_all_suites': False, 03:52:27 INFO - 'run_cmd_checks_enabled': True, 03:52:27 INFO - 'run_file_names': {'cppunittest': 'runcppunittests.py', 03:52:27 INFO - 'gtest': 'rungtests.py', 03:52:27 INFO - 'jittest': 'jit_test.py', 03:52:27 INFO - 'mochitest': 'runtests.py', 03:52:27 INFO - 'mozbase': 'test.py', 03:52:27 INFO - 'mozmill': 'runtestlist.py', 03:52:27 INFO - 'reftest': 'runreftest.py', 03:52:27 INFO - 'webapprt': 'runtests.py', 03:52:27 INFO - 'xpcshell': 'runxpcshelltests.py'}, 03:52:27 INFO - 'specific_tests_zip_dirs': {'cppunittest': ('cppunittest/*',), 03:52:27 INFO - 'gtest': ('gtest/*',), 03:52:27 INFO - 'jittest': ('jit-test/*',), 03:52:27 INFO - 'mochitest': ('mochitest/*',), 03:52:27 INFO - 'mozbase': ('mozbase/*',), 03:52:27 INFO - 'mozmill': ('mozmill/*',), 03:52:27 INFO - 'reftest': ('reftest/*', 'jsreftest/*'), 03:52:27 INFO - 'webapprt': ('mochitest/*',), 03:52:27 INFO - 'xpcshell': ('xpcshell/*',)}, 03:52:27 INFO - 'specified_mochitest_suites': ('mochitest-devtools-chrome-chunked',), 03:52:27 INFO - 'strict_content_sandbox': False, 03:52:27 INFO - 'suite_definitions': {'cppunittest': {'options': ('--symbols-path=%(symbols_path)s', 03:52:27 INFO - '--xre-path=%(abs_res_dir)s'), 03:52:27 INFO - 'run_filename': 'runcppunittests.py', 03:52:27 INFO - 'testsdir': 'cppunittest'}, 03:52:27 INFO - 'gtest': {'options': ('--xre-path=%(abs_res_dir)s', 03:52:27 INFO - '--cwd=%(gtest_dir)s', 03:52:27 INFO - '--symbols-path=%(symbols_path)s', 03:52:27 INFO - '%(binary_path)s'), 03:52:27 INFO - 'run_filename': 'rungtests.py'}, 03:52:27 INFO - 'jittest': {'options': ('tests/bin/js', 03:52:27 INFO - '--no-slow', 03:52:27 INFO - '--no-progress', 03:52:27 INFO - '--format=automation', 03:52:27 INFO - '--jitflags=all'), 03:52:27 INFO - 'run_filename': 'jit_test.py', 03:52:27 INFO - 'testsdir': 'jit-test/jit-test'}, 03:52:27 INFO - 'mochitest': {'options': ('--appname=%(binary_path)s', 03:52:27 INFO - '--utility-path=tests/bin', 03:52:27 INFO - '--extra-profile-file=tests/bin/plugins', 03:52:27 INFO - '--symbols-path=%(symbols_path)s', 03:52:27 INFO - '--certificate-path=tests/certs', 03:52:27 INFO - '--quiet', 03:52:27 INFO - '--log-raw=%(raw_log_file)s', 03:52:27 INFO - '--log-errorsummary=%(error_summary_file)s', 03:52:27 INFO - '--screenshot-on-fail'), 03:52:27 INFO - 'run_filename': 'runtests.py', 03:52:27 INFO - 'testsdir': 'mochitest'}, 03:52:27 INFO - 'mozbase': {'options': ('-b', '%(binary_path)s'), 03:52:27 INFO - 'run_filename': 'test.py', 03:52:27 INFO - 'testsdir': 'mozbase'}, 03:52:27 INFO - 'mozmill': {'options': ('--binary=%(binary_path)s', 03:52:27 INFO - '--testing-modules-dir=test/modules', 03:52:27 INFO - '--symbols-path=%(symbols_path)s'), 03:52:27 INFO - 'run_filename': 'runtestlist.py', 03:52:27 INFO - 'testsdir': 'mozmill'}, 03:52:27 INFO - 'reftest': {'options': ('--appname=%(binary_path)s', 03:52:27 INFO - '--utility-path=tests/bin', 03:52:27 INFO - '--extra-profile-file=tests/bin/plugins', 03:52:27 INFO - '--symbols-path=%(symbols_path)s'), 03:52:27 INFO - 'run_filename': 'runreftest.py', 03:52:27 INFO - 'testsdir': 'reftest'}, 03:52:27 INFO - 'webapprt': {'options': ('--app=%(app_path)s', 03:52:27 INFO - '--xre-path=%(abs_res_dir)s', 03:52:27 INFO - '--utility-path=tests/bin', 03:52:27 INFO - '--extra-profile-file=tests/bin/plugins', 03:52:27 INFO - '--symbols-path=%(symbols_path)s', 03:52:27 INFO - '--certificate-path=tests/certs', 03:52:27 INFO - '--console-level=INFO', 03:52:27 INFO - '--testing-modules-dir=tests/modules', 03:52:27 INFO - '--quiet'), 03:52:27 INFO - 'run_filename': 'runtests.py', 03:52:27 INFO - 'testsdir': 'mochitest'}, 03:52:27 INFO - 'xpcshell': {'options': ('--symbols-path=%(symbols_path)s', 03:52:27 INFO - '--test-plugin-path=%(test_plugin_path)s', 03:52:27 INFO - '--log-raw=%(raw_log_file)s', 03:52:27 INFO - '--log-errorsummary=%(error_summary_file)s', 03:52:27 INFO - '--utility-path=tests/bin'), 03:52:27 INFO - 'run_filename': 'runxpcshelltests.py', 03:52:27 INFO - 'testsdir': 'xpcshell'}}, 03:52:27 INFO - 'this_chunk': '6', 03:52:27 INFO - 'tooltool_cache': '/builds/tooltool_cache', 03:52:27 INFO - 'total_chunks': '8', 03:52:27 INFO - 'vcs_output_timeout': 1000, 03:52:27 INFO - 'virtualenv_path': 'venv', 03:52:27 INFO - 'volatile_config': {'actions': None, 'add_actions': None, 'no_actions': None}, 03:52:27 INFO - 'work_dir': 'build', 03:52:27 INFO - 'xpcshell_name': 'xpcshell'} 03:52:27 INFO - ##### 03:52:27 INFO - ##### Running clobber step. 03:52:27 INFO - ##### 03:52:27 INFO - Running pre-action listener: _resource_record_pre_action 03:52:27 INFO - Running main action method: clobber 03:52:27 INFO - rmtree: /builds/slave/test/build 03:52:27 INFO - retry: Calling rmtree with args: ('/builds/slave/test/build',), kwargs: {}, attempt #1 03:52:30 INFO - Running post-action listener: _resource_record_post_action 03:52:30 INFO - ##### 03:52:30 INFO - ##### Running read-buildbot-config step. 03:52:30 INFO - ##### 03:52:30 INFO - Running pre-action listener: _resource_record_pre_action 03:52:30 INFO - Running main action method: read_buildbot_config 03:52:30 INFO - Using buildbot properties: 03:52:30 INFO - { 03:52:30 INFO - "properties": { 03:52:30 INFO - "buildnumber": 29, 03:52:30 INFO - "product": "firefox", 03:52:30 INFO - "script_repo_revision": "production", 03:52:30 INFO - "branch": "mozilla-central", 03:52:30 INFO - "repository": "", 03:52:30 INFO - "buildername": "Rev5 MacOSX Yosemite 10.10 mozilla-central debug test mochitest-devtools-chrome-6", 03:52:30 INFO - "buildid": "20151103025934", 03:52:30 INFO - "slavename": "t-yosemite-r5-0087", 03:52:30 INFO - "pgo_build": "False", 03:52:30 INFO - "basedir": "/builds/slave/test", 03:52:30 INFO - "project": "", 03:52:30 INFO - "platform": "macosx64", 03:52:30 INFO - "master": "http://buildbot-master107.bb.releng.scl3.mozilla.com:8201/", 03:52:30 INFO - "slavebuilddir": "test", 03:52:30 INFO - "scheduler": "tests-mozilla-central-yosemite-debug-unittest", 03:52:30 INFO - "repo_path": "mozilla-central", 03:52:30 INFO - "moz_repo_path": "", 03:52:30 INFO - "stage_platform": "macosx64", 03:52:30 INFO - "builduid": "22bda49f6d054505b678b83f44b7d0db", 03:52:30 INFO - "revision": "46dc2b5e7f34e2ed71500fda8256a6588e7b3e6d" 03:52:30 INFO - }, 03:52:30 INFO - "sourcestamp": { 03:52:30 INFO - "repository": "", 03:52:30 INFO - "hasPatch": false, 03:52:30 INFO - "project": "", 03:52:30 INFO - "branch": "mozilla-central-macosx64-debug-unittest", 03:52:30 INFO - "changes": [ 03:52:30 INFO - { 03:52:30 INFO - "category": null, 03:52:30 INFO - "files": [ 03:52:30 INFO - { 03:52:30 INFO - "url": null, 03:52:30 INFO - "name": "https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg" 03:52:30 INFO - }, 03:52:30 INFO - { 03:52:30 INFO - "url": null, 03:52:30 INFO - "name": "https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/test_packages.json" 03:52:30 INFO - } 03:52:30 INFO - ], 03:52:30 INFO - "repository": "", 03:52:30 INFO - "rev": "46dc2b5e7f34e2ed71500fda8256a6588e7b3e6d", 03:52:30 INFO - "who": "cbook@mozilla.com", 03:52:30 INFO - "when": 1446551485, 03:52:30 INFO - "number": 6614454, 03:52:30 INFO - "comments": "merge fx-team to mozilla-central a=merge", 03:52:30 INFO - "project": "", 03:52:30 INFO - "at": "Tue 03 Nov 2015 03:51:25", 03:52:30 INFO - "branch": "mozilla-central-macosx64-debug-unittest", 03:52:30 INFO - "revlink": "", 03:52:30 INFO - "properties": [ 03:52:30 INFO - [ 03:52:30 INFO - "buildid", 03:52:30 INFO - "20151103025934", 03:52:30 INFO - "Change" 03:52:30 INFO - ], 03:52:30 INFO - [ 03:52:30 INFO - "builduid", 03:52:30 INFO - "22bda49f6d054505b678b83f44b7d0db", 03:52:30 INFO - "Change" 03:52:30 INFO - ], 03:52:30 INFO - [ 03:52:30 INFO - "pgo_build", 03:52:30 INFO - "False", 03:52:30 INFO - "Change" 03:52:30 INFO - ] 03:52:30 INFO - ], 03:52:30 INFO - "revision": "46dc2b5e7f34e2ed71500fda8256a6588e7b3e6d" 03:52:30 INFO - } 03:52:30 INFO - ], 03:52:30 INFO - "revision": "46dc2b5e7f34e2ed71500fda8256a6588e7b3e6d" 03:52:30 INFO - } 03:52:30 INFO - } 03:52:30 INFO - Found installer url https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg. 03:52:30 INFO - Found a test packages url https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/test_packages.json. 03:52:30 INFO - Running post-action listener: _resource_record_post_action 03:52:30 INFO - ##### 03:52:30 INFO - ##### Running download-and-extract step. 03:52:30 INFO - ##### 03:52:30 INFO - Running pre-action listener: _resource_record_pre_action 03:52:30 INFO - Running main action method: download_and_extract 03:52:30 INFO - mkdir: /builds/slave/test/build/tests 03:52:30 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:52:30 INFO - https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/test_packages.json matches https://queue.taskcluster.net 03:52:30 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/test_packages.json 03:52:30 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/test_packages.json 03:52:30 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/test_packages.json to /builds/slave/test/build/test_packages.json 03:52:30 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/test_packages.json', 'file_name': '/builds/slave/test/build/test_packages.json'}, attempt #1 03:52:55 INFO - Downloaded 1183 bytes. 03:52:55 INFO - Reading from file /builds/slave/test/build/test_packages.json 03:52:55 INFO - Using the following test package requirements: 03:52:55 INFO - {u'common': [u'firefox-45.0a1.en-US.mac64.common.tests.zip'], 03:52:55 INFO - u'cppunittest': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 03:52:55 INFO - u'firefox-45.0a1.en-US.mac64.cppunittest.tests.zip'], 03:52:55 INFO - u'jittest': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 03:52:55 INFO - u'jsshell-mac64.zip'], 03:52:55 INFO - u'mochitest': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 03:52:55 INFO - u'firefox-45.0a1.en-US.mac64.mochitest.tests.zip'], 03:52:55 INFO - u'mozbase': [u'firefox-45.0a1.en-US.mac64.common.tests.zip'], 03:52:55 INFO - u'reftest': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 03:52:55 INFO - u'firefox-45.0a1.en-US.mac64.reftest.tests.zip'], 03:52:55 INFO - u'talos': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 03:52:55 INFO - u'firefox-45.0a1.en-US.mac64.talos.tests.zip'], 03:52:55 INFO - u'web-platform': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 03:52:55 INFO - u'firefox-45.0a1.en-US.mac64.web-platform.tests.zip'], 03:52:55 INFO - u'webapprt': [u'firefox-45.0a1.en-US.mac64.common.tests.zip'], 03:52:55 INFO - u'xpcshell': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 03:52:55 INFO - u'firefox-45.0a1.en-US.mac64.xpcshell.tests.zip']} 03:52:55 INFO - Downloading packages: [u'firefox-45.0a1.en-US.mac64.common.tests.zip', u'firefox-45.0a1.en-US.mac64.mochitest.tests.zip'] for test suite category: mochitest 03:52:55 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:52:55 INFO - https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip matches https://queue.taskcluster.net 03:52:55 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip 03:52:55 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip 03:52:55 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip to /builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip 03:52:55 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip'}, attempt #1 03:53:02 INFO - Downloaded 17350168 bytes. 03:53:02 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] in /builds/slave/test/build/tests 03:53:02 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip bin/* certs/* modules/* mozbase/* config/* mochitest/* 03:53:02 INFO - Calling ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] with output_timeout 1760 03:53:02 INFO - caution: filename not matched: mochitest/* 03:53:02 INFO - Return code: 11 03:53:02 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:02 INFO - https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip matches https://queue.taskcluster.net 03:53:02 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip 03:53:02 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip 03:53:02 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip to /builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip 03:53:02 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip'}, attempt #1 03:53:04 INFO - Downloaded 61905713 bytes. 03:53:04 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] in /builds/slave/test/build/tests 03:53:04 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip bin/* certs/* modules/* mozbase/* config/* mochitest/* 03:53:04 INFO - Calling ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] with output_timeout 1760 03:53:10 INFO - caution: filename not matched: bin/* 03:53:10 INFO - caution: filename not matched: certs/* 03:53:10 INFO - caution: filename not matched: modules/* 03:53:10 INFO - caution: filename not matched: mozbase/* 03:53:10 INFO - caution: filename not matched: config/* 03:53:10 INFO - Return code: 11 03:53:10 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:10 INFO - https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg matches https://queue.taskcluster.net 03:53:10 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg 03:53:10 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg 03:53:10 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg to /builds/slave/test/installer.dmg 03:53:10 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg', 'file_name': '/builds/slave/test/installer.dmg'}, attempt #1 03:53:17 INFO - Downloaded 68514496 bytes. 03:53:17 INFO - Setting buildbot property build_url to https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg 03:53:17 INFO - mkdir: /builds/slave/test/properties 03:53:17 INFO - Writing buildbot properties ['build_url'] to /builds/slave/test/properties/build_url 03:53:17 INFO - Writing to file /builds/slave/test/properties/build_url 03:53:17 INFO - Contents: 03:53:17 INFO - build_url:https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg 03:53:17 INFO - mkdir: /builds/slave/test/build/symbols 03:53:17 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:17 INFO - https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip matches https://queue.taskcluster.net 03:53:17 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 03:53:17 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 03:53:17 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip to /builds/slave/test/build/symbols/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 03:53:17 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip', 'file_name': '/builds/slave/test/build/symbols/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip'}, attempt #1 03:53:18 INFO - Downloaded 54275841 bytes. 03:53:18 INFO - Setting buildbot property symbols_url to https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 03:53:18 INFO - Writing buildbot properties ['symbols_url'] to /builds/slave/test/properties/symbols_url 03:53:18 INFO - Writing to file /builds/slave/test/properties/symbols_url 03:53:18 INFO - Contents: 03:53:18 INFO - symbols_url:https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 03:53:18 INFO - Running command: ['unzip', '-q', '/builds/slave/test/build/symbols/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip'] in /builds/slave/test/build/symbols 03:53:18 INFO - Copy/paste: unzip -q /builds/slave/test/build/symbols/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 03:53:21 INFO - Return code: 0 03:53:21 INFO - Running post-action listener: _resource_record_post_action 03:53:21 INFO - Running post-action listener: set_extra_try_arguments 03:53:21 INFO - ##### 03:53:21 INFO - ##### Running create-virtualenv step. 03:53:21 INFO - ##### 03:53:21 INFO - Running pre-action listener: _install_mozbase 03:53:21 INFO - Running pre-action listener: _pre_create_virtualenv 03:53:21 INFO - Running pre-action listener: _resource_record_pre_action 03:53:21 INFO - Running main action method: create_virtualenv 03:53:21 INFO - Creating virtualenv /builds/slave/test/build/venv 03:53:21 INFO - Running command: ['/tools/buildbot/bin/python', '/tools/misc-python/virtualenv.py', '--no-site-packages', '--distribute', '/builds/slave/test/build/venv'] in /builds/slave/test/build 03:53:21 INFO - Copy/paste: /tools/buildbot/bin/python /tools/misc-python/virtualenv.py --no-site-packages --distribute /builds/slave/test/build/venv 03:53:21 INFO - The --no-site-packages flag is deprecated; it is now the default behavior. 03:53:21 INFO - Using real prefix '/tools/python27' 03:53:21 INFO - New python executable in /builds/slave/test/build/venv/bin/python 03:53:22 INFO - Installing distribute.............................................................................................................................................................................................done. 03:53:25 INFO - Installing pip.................done. 03:53:25 INFO - Return code: 0 03:53:25 INFO - Installing psutil>=0.7.1 into virtualenv /builds/slave/test/build/venv 03:53:25 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:25 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:25 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:25 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:25 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:25 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:25 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:25 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1'] in /builds/slave/test/build 03:53:25 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil>=0.7.1 03:53:25 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:25 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:25 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:25 INFO - 'HOME': '/Users/cltbld', 03:53:25 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:25 INFO - 'LOGNAME': 'cltbld', 03:53:25 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:25 INFO - 'MOZ_NO_REMOTE': '1', 03:53:25 INFO - 'NO_EM_RESTART': '1', 03:53:25 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:25 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:25 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:25 INFO - 'PWD': '/builds/slave/test', 03:53:25 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:25 INFO - 'SHELL': '/bin/bash', 03:53:25 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:25 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:25 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:25 INFO - 'USER': 'cltbld', 03:53:25 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:25 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:25 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:25 INFO - 'XPC_FLAGS': '0x0', 03:53:25 INFO - 'XPC_SERVICE_NAME': '0', 03:53:25 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:27 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:27 INFO - Downloading/unpacking psutil>=0.7.1 03:53:27 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:27 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:27 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:27 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:27 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:27 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:29 INFO - Creating supposed download cache at /builds/slave/test/build/venv/cache 03:53:29 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fpsutil-3.1.1.tar.gz 03:53:29 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/psutil/setup.py) egg_info for package psutil 03:53:29 INFO - warning: no previously-included files matching '*' found under directory 'docs/_build' 03:53:29 INFO - warning: manifest_maker: MANIFEST.in, line 18: 'recursive-include' expects ... 03:53:29 INFO - Installing collected packages: psutil 03:53:29 INFO - Running setup.py install for psutil 03:53:30 INFO - building 'psutil._psutil_osx' extension 03:53:30 INFO - gcc -fno-strict-aliasing -g -O2 -DNDEBUG -g -fwrapv -O3 -Wall -Wstrict-prototypes -DPSUTIL_VERSION=311 -I/tools/python27/include/python2.7 -c psutil/_psutil_osx.c -o build/temp.macosx-10.10-x86_64-2.7/psutil/_psutil_osx.o 03:53:31 INFO - gcc -fno-strict-aliasing -g -O2 -DNDEBUG -g -fwrapv -O3 -Wall -Wstrict-prototypes -DPSUTIL_VERSION=311 -I/tools/python27/include/python2.7 -c psutil/_psutil_common.c -o build/temp.macosx-10.10-x86_64-2.7/psutil/_psutil_common.o 03:53:31 INFO - gcc -fno-strict-aliasing -g -O2 -DNDEBUG -g -fwrapv -O3 -Wall -Wstrict-prototypes -DPSUTIL_VERSION=311 -I/tools/python27/include/python2.7 -c psutil/arch/osx/process_info.c -o build/temp.macosx-10.10-x86_64-2.7/psutil/arch/osx/process_info.o 03:53:32 INFO - gcc -bundle -bundle_loader /tools/python27/bin/python2.7 build/temp.macosx-10.10-x86_64-2.7/psutil/_psutil_osx.o build/temp.macosx-10.10-x86_64-2.7/psutil/_psutil_common.o build/temp.macosx-10.10-x86_64-2.7/psutil/arch/osx/process_info.o -o build/lib.macosx-10.10-x86_64-2.7/psutil/_psutil_osx.so -framework CoreFoundation -framework IOKit 03:53:32 INFO - building 'psutil._psutil_posix' extension 03:53:32 INFO - gcc -fno-strict-aliasing -g -O2 -DNDEBUG -g -fwrapv -O3 -Wall -Wstrict-prototypes -I/tools/python27/include/python2.7 -c psutil/_psutil_posix.c -o build/temp.macosx-10.10-x86_64-2.7/psutil/_psutil_posix.o 03:53:32 WARNING - psutil/_psutil_posix.c:403:11: warning: implicit declaration of function 'ioctl' is invalid in C99 [-Wimplicit-function-declaration] 03:53:32 INFO - ret = ioctl(sock, SIOCGIFFLAGS, &ifr); 03:53:32 INFO - ^ 03:53:32 INFO - 1 warning generated. 03:53:32 INFO - gcc -bundle -bundle_loader /tools/python27/bin/python2.7 build/temp.macosx-10.10-x86_64-2.7/psutil/_psutil_posix.o -o build/lib.macosx-10.10-x86_64-2.7/psutil/_psutil_posix.so 03:53:32 INFO - warning: no previously-included files matching '*' found under directory 'docs/_build' 03:53:32 INFO - warning: manifest_maker: MANIFEST.in, line 18: 'recursive-include' expects ... 03:53:32 INFO - Successfully installed psutil 03:53:32 INFO - Cleaning up... 03:53:32 INFO - Return code: 0 03:53:32 INFO - Installing mozsystemmonitor==0.0.0 into virtualenv /builds/slave/test/build/venv 03:53:32 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:32 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:32 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:32 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:32 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:32 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:32 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:32 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0'] in /builds/slave/test/build 03:53:32 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mozsystemmonitor==0.0.0 03:53:32 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:32 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:32 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:32 INFO - 'HOME': '/Users/cltbld', 03:53:32 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:32 INFO - 'LOGNAME': 'cltbld', 03:53:32 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:32 INFO - 'MOZ_NO_REMOTE': '1', 03:53:32 INFO - 'NO_EM_RESTART': '1', 03:53:32 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:32 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:32 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:32 INFO - 'PWD': '/builds/slave/test', 03:53:32 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:32 INFO - 'SHELL': '/bin/bash', 03:53:32 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:32 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:32 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:32 INFO - 'USER': 'cltbld', 03:53:32 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:32 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:32 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:32 INFO - 'XPC_FLAGS': '0x0', 03:53:32 INFO - 'XPC_SERVICE_NAME': '0', 03:53:32 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:32 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:33 INFO - Downloading/unpacking mozsystemmonitor==0.0.0 03:53:33 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:33 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:33 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:33 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:33 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:33 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:35 INFO - Downloading mozsystemmonitor-0.0.tar.gz 03:53:35 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fmozsystemmonitor-0.0.tar.gz 03:53:35 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mozsystemmonitor/setup.py) egg_info for package mozsystemmonitor 03:53:35 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil>=0.7.1 in ./venv/lib/python2.7/site-packages (from mozsystemmonitor==0.0.0) 03:53:35 INFO - Installing collected packages: mozsystemmonitor 03:53:35 INFO - Running setup.py install for mozsystemmonitor 03:53:35 INFO - Successfully installed mozsystemmonitor 03:53:35 INFO - Cleaning up... 03:53:35 INFO - Return code: 0 03:53:35 INFO - Installing blobuploader==1.2.4 into virtualenv /builds/slave/test/build/venv 03:53:35 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:35 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:35 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:35 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:35 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:35 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:35 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:35 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4'] in /builds/slave/test/build 03:53:35 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub blobuploader==1.2.4 03:53:35 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:35 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:35 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:35 INFO - 'HOME': '/Users/cltbld', 03:53:35 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:35 INFO - 'LOGNAME': 'cltbld', 03:53:35 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:35 INFO - 'MOZ_NO_REMOTE': '1', 03:53:35 INFO - 'NO_EM_RESTART': '1', 03:53:35 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:35 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:35 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:35 INFO - 'PWD': '/builds/slave/test', 03:53:35 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:35 INFO - 'SHELL': '/bin/bash', 03:53:35 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:35 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:35 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:35 INFO - 'USER': 'cltbld', 03:53:35 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:35 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:35 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:35 INFO - 'XPC_FLAGS': '0x0', 03:53:35 INFO - 'XPC_SERVICE_NAME': '0', 03:53:35 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:35 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:35 INFO - Downloading/unpacking blobuploader==1.2.4 03:53:35 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:35 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:35 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:35 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:35 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:35 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:38 INFO - Downloading blobuploader-1.2.4.tar.gz 03:53:38 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fblobuploader-1.2.4.tar.gz 03:53:38 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blobuploader/setup.py) egg_info for package blobuploader 03:53:38 INFO - Downloading/unpacking requests==1.2.3. (from blobuploader==1.2.4) 03:53:38 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:38 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:38 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:38 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:38 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:38 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:38 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Frequests-1.2.3.tar.gz 03:53:38 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/requests/setup.py) egg_info for package requests 03:53:39 INFO - Downloading/unpacking docopt==0.6.1 (from blobuploader==1.2.4) 03:53:39 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:39 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:39 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:39 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:39 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:39 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:39 INFO - Downloading docopt-0.6.1.tar.gz 03:53:39 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fdocopt-0.6.1.tar.gz 03:53:39 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/docopt/setup.py) egg_info for package docopt 03:53:39 INFO - Installing collected packages: blobuploader, requests, docopt 03:53:39 INFO - Running setup.py install for blobuploader 03:53:39 INFO - changing mode of build/scripts-2.7/blobberc.py from 664 to 775 03:53:39 INFO - changing mode of /builds/slave/test/build/venv/bin/blobberc.py to 775 03:53:39 INFO - Running setup.py install for requests 03:53:40 INFO - Running setup.py install for docopt 03:53:40 INFO - Successfully installed blobuploader requests docopt 03:53:40 INFO - Cleaning up... 03:53:40 INFO - Return code: 0 03:53:40 INFO - Installing None into virtualenv /builds/slave/test/build/venv 03:53:40 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:40 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:40 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:40 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:40 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:40 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:40 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:40 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 03:53:40 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 03:53:40 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:40 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:40 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:40 INFO - 'HOME': '/Users/cltbld', 03:53:40 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:40 INFO - 'LOGNAME': 'cltbld', 03:53:40 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:40 INFO - 'MOZ_NO_REMOTE': '1', 03:53:40 INFO - 'NO_EM_RESTART': '1', 03:53:40 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:40 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:40 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:40 INFO - 'PWD': '/builds/slave/test', 03:53:40 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:40 INFO - 'SHELL': '/bin/bash', 03:53:40 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:40 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:40 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:40 INFO - 'USER': 'cltbld', 03:53:40 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:40 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:40 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:40 INFO - 'XPC_FLAGS': '0x0', 03:53:40 INFO - 'XPC_SERVICE_NAME': '0', 03:53:40 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:40 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:40 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 03:53:40 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-2nz2bX-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 03:53:40 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 03:53:40 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-veeZdK-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 03:53:41 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 03:53:41 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-4nv8AQ-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 03:53:41 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 03:53:41 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-_huEUl-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 03:53:41 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 03:53:41 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-IpdYs8-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 03:53:41 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 03:53:41 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-2A_lLi-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 03:53:41 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 03:53:41 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-yEMDdb-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 03:53:41 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 03:53:41 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-FErTul-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 03:53:41 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 03:53:41 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-b95SJv-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 03:53:41 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 03:53:41 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-XEX1sI-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 03:53:42 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 03:53:42 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-NWagKg-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 03:53:42 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 03:53:42 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-_OgCn9-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 03:53:42 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 03:53:42 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-Me8lJR-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 03:53:42 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 03:53:42 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-6aOBlj-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 03:53:42 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 03:53:42 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-RYLG85-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 03:53:42 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 03:53:42 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-T63bdw-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 03:53:42 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 03:53:42 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-JquREF-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 03:53:42 INFO - Installing collected packages: manifestparser, mozcrash, mozdebug, mozdevice, mozfile, mozhttpd, mozinfo, mozInstall, mozleak, mozlog, moznetwork, mozprocess, mozprofile, mozrunner, mozscreenshot, moztest, mozversion 03:53:42 INFO - Running setup.py install for manifestparser 03:53:43 INFO - Installing manifestparser script to /builds/slave/test/build/venv/bin 03:53:43 INFO - Running setup.py install for mozcrash 03:53:43 INFO - Running setup.py install for mozdebug 03:53:43 INFO - Running setup.py install for mozdevice 03:53:43 INFO - Installing sutini script to /builds/slave/test/build/venv/bin 03:53:43 INFO - Installing dm script to /builds/slave/test/build/venv/bin 03:53:43 INFO - Running setup.py install for mozfile 03:53:43 INFO - Running setup.py install for mozhttpd 03:53:43 INFO - Installing mozhttpd script to /builds/slave/test/build/venv/bin 03:53:43 INFO - Running setup.py install for mozinfo 03:53:44 INFO - Installing mozinfo script to /builds/slave/test/build/venv/bin 03:53:44 INFO - Running setup.py install for mozInstall 03:53:44 INFO - Installing moz_remove_from_system script to /builds/slave/test/build/venv/bin 03:53:44 INFO - Installing mozuninstall script to /builds/slave/test/build/venv/bin 03:53:44 INFO - Installing mozinstall script to /builds/slave/test/build/venv/bin 03:53:44 INFO - Installing moz_add_to_system script to /builds/slave/test/build/venv/bin 03:53:44 INFO - Running setup.py install for mozleak 03:53:44 INFO - Running setup.py install for mozlog 03:53:44 INFO - Installing structlog script to /builds/slave/test/build/venv/bin 03:53:44 INFO - Running setup.py install for moznetwork 03:53:44 INFO - Installing moznetwork script to /builds/slave/test/build/venv/bin 03:53:44 INFO - Running setup.py install for mozprocess 03:53:44 INFO - Running setup.py install for mozprofile 03:53:45 INFO - Installing mozprofile script to /builds/slave/test/build/venv/bin 03:53:45 INFO - Installing diff-profiles script to /builds/slave/test/build/venv/bin 03:53:45 INFO - Installing view-profile script to /builds/slave/test/build/venv/bin 03:53:45 INFO - Running setup.py install for mozrunner 03:53:45 INFO - Installing mozrunner script to /builds/slave/test/build/venv/bin 03:53:45 INFO - Running setup.py install for mozscreenshot 03:53:45 INFO - Running setup.py install for moztest 03:53:45 INFO - Running setup.py install for mozversion 03:53:45 INFO - Installing mozversion script to /builds/slave/test/build/venv/bin 03:53:45 INFO - Successfully installed manifestparser mozcrash mozdebug mozdevice mozfile mozhttpd mozinfo mozInstall mozleak mozlog moznetwork mozprocess mozprofile mozrunner mozscreenshot moztest mozversion 03:53:45 INFO - Cleaning up... 03:53:45 INFO - Return code: 0 03:53:45 INFO - Installing None into virtualenv /builds/slave/test/build/venv 03:53:45 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:45 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:45 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:45 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:45 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:45 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:45 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:45 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 03:53:45 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 03:53:45 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:45 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:45 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:45 INFO - 'HOME': '/Users/cltbld', 03:53:45 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:45 INFO - 'LOGNAME': 'cltbld', 03:53:45 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:45 INFO - 'MOZ_NO_REMOTE': '1', 03:53:45 INFO - 'NO_EM_RESTART': '1', 03:53:45 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:45 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:45 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:45 INFO - 'PWD': '/builds/slave/test', 03:53:45 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:45 INFO - 'SHELL': '/bin/bash', 03:53:45 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:45 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:45 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:45 INFO - 'USER': 'cltbld', 03:53:45 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:45 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:45 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:45 INFO - 'XPC_FLAGS': '0x0', 03:53:45 INFO - 'XPC_SERVICE_NAME': '0', 03:53:45 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:46 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 03:53:46 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-nNvkg7-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 03:53:46 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 03:53:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 03:53:46 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-WKx_u9-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 03:53:46 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 03:53:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 03:53:46 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-20Zvt9-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 03:53:46 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 03:53:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 03:53:46 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-rfSq2e-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 03:53:46 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.47 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 03:53:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 03:53:46 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-R9f8Hc-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 03:53:46 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 03:53:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 03:53:46 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-j6_gqb-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 03:53:46 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 03:53:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 03:53:46 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-6V8nkH-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 03:53:47 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 03:53:47 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 03:53:47 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-qACgEo-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 03:53:47 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 03:53:47 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 03:53:47 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-Byubvi-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 03:53:47 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 03:53:47 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 03:53:47 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-6Lpi_t-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 03:53:47 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.0 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 03:53:47 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 03:53:47 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-12aq0a-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 03:53:47 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 03:53:47 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 03:53:47 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-CH_sw0-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 03:53:47 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 03:53:47 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 03:53:47 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-GcZS_s-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 03:53:47 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.27 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 03:53:47 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 03:53:47 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-gmyXJD-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 03:53:47 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 03:53:47 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 03:53:47 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-Fepjbv-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 03:53:48 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 03:53:48 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 03:53:48 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-MSisMP-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 03:53:48 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 03:53:48 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 03:53:48 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-t_29SM-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 03:53:48 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 03:53:48 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 03:53:48 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 03:53:48 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 03:53:48 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 03:53:48 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 03:53:48 INFO - Downloading/unpacking blessings>=1.3 (from mozlog==3.0->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 03:53:48 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:48 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:48 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:48 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:48 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:48 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:50 INFO - Downloading blessings-1.5.1.tar.gz 03:53:50 INFO - Storing download in cache at /builds/slave/test/build/venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fblessings-1.5.1.tar.gz 03:53:50 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blessings/setup.py) egg_info for package blessings 03:53:50 INFO - Installing collected packages: blessings 03:53:50 INFO - Running setup.py install for blessings 03:53:51 INFO - Successfully installed blessings 03:53:51 INFO - Cleaning up... 03:53:51 INFO - Return code: 0 03:53:51 INFO - Installing pip>=1.5 into virtualenv /builds/slave/test/build/venv 03:53:51 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:51 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:51 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:51 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:51 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:51 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:51 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:51 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5'] in /builds/slave/test/build 03:53:51 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub pip>=1.5 03:53:51 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:51 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:51 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:51 INFO - 'HOME': '/Users/cltbld', 03:53:51 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:51 INFO - 'LOGNAME': 'cltbld', 03:53:51 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:51 INFO - 'MOZ_NO_REMOTE': '1', 03:53:51 INFO - 'NO_EM_RESTART': '1', 03:53:51 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:51 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:51 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:51 INFO - 'PWD': '/builds/slave/test', 03:53:51 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:51 INFO - 'SHELL': '/bin/bash', 03:53:51 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:51 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:51 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:51 INFO - 'USER': 'cltbld', 03:53:51 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:51 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:51 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:51 INFO - 'XPC_FLAGS': '0x0', 03:53:51 INFO - 'XPC_SERVICE_NAME': '0', 03:53:51 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:51 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:51 INFO - Requirement already satisfied (use --upgrade to upgrade): pip>=1.5 in ./venv/lib/python2.7/site-packages/pip-1.5.5-py2.7.egg 03:53:51 INFO - Cleaning up... 03:53:51 INFO - Return code: 0 03:53:51 INFO - Installing psutil==3.1.1 into virtualenv /builds/slave/test/build/venv 03:53:51 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:51 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:51 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:51 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:51 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:51 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:51 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:51 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1'] in /builds/slave/test/build 03:53:51 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil==3.1.1 03:53:51 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:51 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:51 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:51 INFO - 'HOME': '/Users/cltbld', 03:53:51 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:51 INFO - 'LOGNAME': 'cltbld', 03:53:51 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:51 INFO - 'MOZ_NO_REMOTE': '1', 03:53:51 INFO - 'NO_EM_RESTART': '1', 03:53:51 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:51 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:51 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:51 INFO - 'PWD': '/builds/slave/test', 03:53:51 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:51 INFO - 'SHELL': '/bin/bash', 03:53:51 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:51 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:51 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:51 INFO - 'USER': 'cltbld', 03:53:51 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:51 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:51 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:51 INFO - 'XPC_FLAGS': '0x0', 03:53:51 INFO - 'XPC_SERVICE_NAME': '0', 03:53:51 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:51 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:51 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil==3.1.1 in ./venv/lib/python2.7/site-packages 03:53:51 INFO - Cleaning up... 03:53:51 INFO - Return code: 0 03:53:51 INFO - Installing mock into virtualenv /builds/slave/test/build/venv 03:53:51 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:51 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:51 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:51 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:51 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:51 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:51 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:51 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock'] in /builds/slave/test/build 03:53:51 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mock 03:53:51 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:51 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:51 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:51 INFO - 'HOME': '/Users/cltbld', 03:53:51 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:51 INFO - 'LOGNAME': 'cltbld', 03:53:51 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:51 INFO - 'MOZ_NO_REMOTE': '1', 03:53:51 INFO - 'NO_EM_RESTART': '1', 03:53:51 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:51 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:51 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:51 INFO - 'PWD': '/builds/slave/test', 03:53:51 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:51 INFO - 'SHELL': '/bin/bash', 03:53:51 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:51 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:51 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:51 INFO - 'USER': 'cltbld', 03:53:51 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:51 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:51 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:51 INFO - 'XPC_FLAGS': '0x0', 03:53:51 INFO - 'XPC_SERVICE_NAME': '0', 03:53:51 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:52 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:52 INFO - Downloading/unpacking mock 03:53:52 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:52 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:52 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:52 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:52 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:52 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:54 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fmock-1.0.1.tar.gz 03:53:54 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mock/setup.py) egg_info for package mock 03:53:54 INFO - warning: no files found matching '*.png' under directory 'docs' 03:53:54 INFO - warning: no files found matching '*.css' under directory 'docs' 03:53:54 INFO - warning: no files found matching '*.html' under directory 'docs' 03:53:54 INFO - warning: no files found matching '*.js' under directory 'docs' 03:53:54 INFO - Installing collected packages: mock 03:53:54 INFO - Running setup.py install for mock 03:53:54 INFO - warning: no files found matching '*.png' under directory 'docs' 03:53:54 INFO - warning: no files found matching '*.css' under directory 'docs' 03:53:54 INFO - warning: no files found matching '*.html' under directory 'docs' 03:53:54 INFO - warning: no files found matching '*.js' under directory 'docs' 03:53:55 INFO - Successfully installed mock 03:53:55 INFO - Cleaning up... 03:53:55 INFO - Return code: 0 03:53:55 INFO - Installing simplejson into virtualenv /builds/slave/test/build/venv 03:53:55 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:55 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:55 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:55 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:55 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:55 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:55 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:55 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson'] in /builds/slave/test/build 03:53:55 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub simplejson 03:53:55 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:55 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:55 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:55 INFO - 'HOME': '/Users/cltbld', 03:53:55 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:55 INFO - 'LOGNAME': 'cltbld', 03:53:55 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:55 INFO - 'MOZ_NO_REMOTE': '1', 03:53:55 INFO - 'NO_EM_RESTART': '1', 03:53:55 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:55 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:55 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:55 INFO - 'PWD': '/builds/slave/test', 03:53:55 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:55 INFO - 'SHELL': '/bin/bash', 03:53:55 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:55 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:55 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:55 INFO - 'USER': 'cltbld', 03:53:55 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:55 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:55 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:55 INFO - 'XPC_FLAGS': '0x0', 03:53:55 INFO - 'XPC_SERVICE_NAME': '0', 03:53:55 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:55 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:55 INFO - Downloading/unpacking simplejson 03:53:55 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:55 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:55 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:55 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 03:53:55 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 03:53:55 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 03:53:57 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fsimplejson-3.3.0.tar.gz 03:53:57 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/simplejson/setup.py) egg_info for package simplejson 03:53:57 INFO - Installing collected packages: simplejson 03:53:57 INFO - Running setup.py install for simplejson 03:53:58 INFO - building 'simplejson._speedups' extension 03:53:58 INFO - gcc -fno-strict-aliasing -g -O2 -DNDEBUG -g -fwrapv -O3 -Wall -Wstrict-prototypes -I/tools/python27/include/python2.7 -c simplejson/_speedups.c -o build/temp.macosx-10.10-x86_64-2.7/simplejson/_speedups.o 03:53:58 INFO - gcc -bundle -bundle_loader /tools/python27/bin/python2.7 build/temp.macosx-10.10-x86_64-2.7/simplejson/_speedups.o -o build/lib.macosx-10.10-x86_64-2.7/simplejson/_speedups.so 03:53:58 INFO - Successfully installed simplejson 03:53:58 INFO - Cleaning up... 03:53:58 INFO - Return code: 0 03:53:58 INFO - Installing None into virtualenv /builds/slave/test/build/venv 03:53:58 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:58 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:53:58 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:58 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:53:58 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:53:58 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:53:58 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:53:58 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 03:53:58 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 03:53:58 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:53:58 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:53:58 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:53:58 INFO - 'HOME': '/Users/cltbld', 03:53:58 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:53:58 INFO - 'LOGNAME': 'cltbld', 03:53:58 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:53:58 INFO - 'MOZ_NO_REMOTE': '1', 03:53:58 INFO - 'NO_EM_RESTART': '1', 03:53:58 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:53:58 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:53:58 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:53:58 INFO - 'PWD': '/builds/slave/test', 03:53:58 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:53:58 INFO - 'SHELL': '/bin/bash', 03:53:58 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:53:58 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:53:58 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:53:58 INFO - 'USER': 'cltbld', 03:53:58 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:53:58 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:53:58 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:53:58 INFO - 'XPC_FLAGS': '0x0', 03:53:58 INFO - 'XPC_SERVICE_NAME': '0', 03:53:58 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:53:59 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:53:59 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 03:53:59 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-cPB4k5-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 03:53:59 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 03:53:59 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 03:53:59 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-CK40aJ-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 03:53:59 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 03:53:59 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 03:53:59 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-pslTat-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 03:53:59 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 03:53:59 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 03:53:59 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-5uCl4y-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 03:53:59 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.47 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 03:53:59 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 03:53:59 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-pAvBjX-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 03:53:59 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 03:53:59 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 03:53:59 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-DwEXqt-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 03:54:00 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 03:54:00 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 03:54:00 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-Db9QDb-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 03:54:00 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 03:54:00 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 03:54:00 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-DYrWo1-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 03:54:00 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 03:54:00 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 03:54:00 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-CgmAsr-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 03:54:00 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 03:54:00 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 03:54:00 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-Oxd669-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 03:54:00 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.0 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 03:54:00 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 03:54:00 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-8MokjP-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 03:54:00 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 03:54:00 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 03:54:00 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-3F6WA7-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 03:54:00 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 03:54:00 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 03:54:00 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-U4AEum-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 03:54:00 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.27 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 03:54:00 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 03:54:00 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-zOSkSN-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 03:54:01 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 03:54:01 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 03:54:01 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-lWW66T-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 03:54:01 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 03:54:01 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 03:54:01 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-CfUxn5-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 03:54:01 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 03:54:01 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 03:54:01 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-SKZRli-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 03:54:01 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 03:54:01 INFO - Cleaning up... 03:54:01 INFO - Return code: 0 03:54:01 INFO - Installing None into virtualenv /builds/slave/test/build/venv 03:54:01 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:54:01 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 03:54:01 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:54:01 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:54:01 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 03:54:01 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 03:54:01 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1035b7030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10360da08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x7ff209477fe0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'XPC_SERVICE_NAME': '0', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.7', 'XPC_FLAGS': '0x0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 03:54:01 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 03:54:01 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 03:54:01 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:54:01 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:54:01 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:54:01 INFO - 'HOME': '/Users/cltbld', 03:54:01 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:54:01 INFO - 'LOGNAME': 'cltbld', 03:54:01 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:54:01 INFO - 'MOZ_NO_REMOTE': '1', 03:54:01 INFO - 'NO_EM_RESTART': '1', 03:54:01 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:54:01 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:54:01 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:54:01 INFO - 'PWD': '/builds/slave/test', 03:54:01 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:54:01 INFO - 'SHELL': '/bin/bash', 03:54:01 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:54:01 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:54:01 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:54:01 INFO - 'USER': 'cltbld', 03:54:01 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:54:01 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:54:01 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:54:01 INFO - 'XPC_FLAGS': '0x0', 03:54:01 INFO - 'XPC_SERVICE_NAME': '0', 03:54:01 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:54:01 INFO - Ignoring indexes: https://pypi.python.org/simple/ 03:54:01 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 03:54:01 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-0evhj0-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 03:54:02 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 03:54:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 03:54:02 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-aBlGC6-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 03:54:02 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 03:54:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 03:54:02 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-3EUyJg-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 03:54:02 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 03:54:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 03:54:02 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-ZR2WRM-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 03:54:02 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.47 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 03:54:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 03:54:02 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-IAsK8O-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 03:54:02 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 03:54:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 03:54:02 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-A5gMDI-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 03:54:02 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 03:54:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 03:54:02 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-Z4jYiY-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 03:54:02 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 03:54:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 03:54:02 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-mqCfYZ-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 03:54:02 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 03:54:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 03:54:02 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-5JHRIH-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 03:54:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 03:54:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 03:54:03 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-YGNO54-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 03:54:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.0 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 03:54:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 03:54:03 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-1EsYCN-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 03:54:03 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 03:54:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 03:54:03 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-8DKLT2-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 03:54:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 03:54:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 03:54:03 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-_AR9H1-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 03:54:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.27 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 03:54:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 03:54:03 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-BEqwns-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 03:54:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 03:54:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 03:54:03 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-YsbK_6-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 03:54:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 03:54:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 03:54:03 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-NixSHl-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 03:54:03 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 03:54:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 03:54:03 INFO - Running setup.py (path:/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/pip-pWn4dY-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 03:54:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 03:54:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 03:54:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 03:54:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 03:54:04 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 03:54:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 03:54:04 INFO - Requirement already satisfied (use --upgrade to upgrade): blessings>=1.3 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozlog==3.0->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 03:54:04 INFO - Cleaning up... 03:54:04 INFO - Return code: 0 03:54:04 INFO - Done creating virtualenv /builds/slave/test/build/venv. 03:54:04 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze'] 03:54:04 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze 03:54:04 INFO - Reading from file tmpfile_stdout 03:54:04 INFO - Current package versions: 03:54:04 INFO - blessings == 1.5.1 03:54:04 INFO - blobuploader == 1.2.4 03:54:04 INFO - docopt == 0.6.1 03:54:04 INFO - manifestparser == 1.1 03:54:04 INFO - mock == 1.0.1 03:54:04 INFO - mozInstall == 1.12 03:54:04 INFO - mozcrash == 0.16 03:54:04 INFO - mozdebug == 0.1 03:54:04 INFO - mozdevice == 0.47 03:54:04 INFO - mozfile == 1.2 03:54:04 INFO - mozhttpd == 0.7 03:54:04 INFO - mozinfo == 0.9 03:54:04 INFO - mozleak == 0.1 03:54:04 INFO - mozlog == 3.0 03:54:04 INFO - moznetwork == 0.27 03:54:04 INFO - mozprocess == 0.22 03:54:04 INFO - mozprofile == 0.27 03:54:04 INFO - mozrunner == 6.11 03:54:04 INFO - mozscreenshot == 0.1 03:54:04 INFO - mozsystemmonitor == 0.0 03:54:04 INFO - moztest == 0.7 03:54:04 INFO - mozversion == 1.4 03:54:04 INFO - psutil == 3.1.1 03:54:04 INFO - requests == 1.2.3 03:54:04 INFO - simplejson == 3.3.0 03:54:04 INFO - wsgiref == 0.1.2 03:54:04 INFO - Running post-action listener: _resource_record_post_action 03:54:04 INFO - Running post-action listener: _start_resource_monitoring 03:54:04 INFO - Starting resource monitoring. 03:54:04 INFO - ##### 03:54:04 INFO - ##### Running install step. 03:54:04 INFO - ##### 03:54:04 INFO - Running pre-action listener: _resource_record_pre_action 03:54:04 INFO - Running main action method: install 03:54:04 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze'] 03:54:04 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze 03:54:04 INFO - Reading from file tmpfile_stdout 03:54:04 INFO - Detecting whether we're running mozinstall >=1.0... 03:54:04 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '-h'] 03:54:04 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall -h 03:54:04 INFO - Reading from file tmpfile_stdout 03:54:04 INFO - Output received: 03:54:04 INFO - Usage: mozinstall [options] installer 03:54:04 INFO - Options: 03:54:04 INFO - -h, --help show this help message and exit 03:54:04 INFO - -d DEST, --destination=DEST 03:54:04 INFO - Directory to install application into. [default: 03:54:04 INFO - "/builds/slave/test"] 03:54:04 INFO - --app=APP Application being installed. [default: firefox] 03:54:04 INFO - mkdir: /builds/slave/test/build/application 03:54:04 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '/builds/slave/test/installer.dmg', '--destination', '/builds/slave/test/build/application'] 03:54:04 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall /builds/slave/test/installer.dmg --destination /builds/slave/test/build/application 03:54:26 INFO - Reading from file tmpfile_stdout 03:54:26 INFO - Output received: 03:54:26 INFO - /builds/slave/test/build/application/NightlyDebug.app/Contents/MacOS/firefox 03:54:26 INFO - Running post-action listener: _resource_record_post_action 03:54:26 INFO - ##### 03:54:26 INFO - ##### Running run-tests step. 03:54:26 INFO - ##### 03:54:26 INFO - Running pre-action listener: _resource_record_pre_action 03:54:26 INFO - Running pre-action listener: _set_gcov_prefix 03:54:26 INFO - Running main action method: run_tests 03:54:26 INFO - #### Running mochitest suites 03:54:26 INFO - grabbing minidump binary from tooltool 03:54:26 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 03:54:26 INFO - retry: Calling run_command with args: (['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/macosx64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'],), kwargs: {'error_list': [{'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10353b2a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x103534030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10360f4e0>, 'level': 'critical'}, {'substr': 'ERROR - ', 'level': 'error'}], 'cwd': '/builds/slave/test/build', 'privileged': False}, attempt #1 03:54:26 INFO - Running command: ['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/macosx64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'] in /builds/slave/test/build 03:54:26 INFO - Copy/paste: /tools/tooltool.py --url https://api.pub.build.mozilla.org/tooltool/ --authentication-file /builds/relengapi.tok fetch -m /builds/slave/test/build/tests/config/tooltool-manifests/macosx64/releng.manifest -o -c /builds/tooltool_cache 03:54:26 INFO - INFO - File macosx64-minidump_stackwalk retrieved from local cache /builds/tooltool_cache 03:54:26 INFO - Return code: 0 03:54:26 INFO - Chmoding /builds/slave/test/build/macosx64-minidump_stackwalk to 0755 03:54:26 INFO - mkdir: /builds/slave/test/build/blobber_upload_dir 03:54:26 INFO - ENV: MOZ_UPLOAD_DIR is now /builds/slave/test/build/blobber_upload_dir 03:54:26 INFO - ENV: MINIDUMP_STACKWALK is now /builds/slave/test/build/macosx64-minidump_stackwalk 03:54:26 INFO - ENV: MINIDUMP_SAVE_PATH is now /builds/slave/test/build/blobber_upload_dir 03:54:26 INFO - Running command: ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--total-chunks', '8', '--this-chunk', '6', '--appname=/builds/slave/test/build/application/NightlyDebug.app/Contents/MacOS/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log', '--screenshot-on-fail', '--browser-chrome', '--subsuite=devtools', '--chunk-by-runtime'] in /builds/slave/test/build 03:54:26 INFO - Copy/paste: /builds/slave/test/build/venv/bin/python -u /builds/slave/test/build/tests/mochitest/runtests.py --total-chunks 8 --this-chunk 6 --appname=/builds/slave/test/build/application/NightlyDebug.app/Contents/MacOS/firefox --utility-path=tests/bin --extra-profile-file=tests/bin/plugins --symbols-path=/builds/slave/test/build/symbols --certificate-path=tests/certs --quiet --log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log --log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log --screenshot-on-fail --browser-chrome --subsuite=devtools --chunk-by-runtime 03:54:26 INFO - Using env: {'Apple_PubSub_Socket_Render': '/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render', 03:54:26 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 03:54:26 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 03:54:26 INFO - 'HOME': '/Users/cltbld', 03:54:26 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 03:54:26 INFO - 'LOGNAME': 'cltbld', 03:54:26 INFO - 'MINIDUMP_SAVE_PATH': '/builds/slave/test/build/blobber_upload_dir', 03:54:26 INFO - 'MINIDUMP_STACKWALK': '/builds/slave/test/build/macosx64-minidump_stackwalk', 03:54:26 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 03:54:26 INFO - 'MOZ_NO_REMOTE': '1', 03:54:26 INFO - 'MOZ_UPLOAD_DIR': '/builds/slave/test/build/blobber_upload_dir', 03:54:26 INFO - 'NO_EM_RESTART': '1', 03:54:26 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 03:54:26 INFO - 'PATH': '/builds/slave/test/build/venv/bin:/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 03:54:26 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 03:54:26 INFO - 'PWD': '/builds/slave/test', 03:54:26 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 03:54:26 INFO - 'SHELL': '/bin/bash', 03:54:26 INFO - 'SSH_AUTH_SOCK': '/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners', 03:54:26 INFO - 'TMPDIR': '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/', 03:54:26 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 03:54:26 INFO - 'USER': 'cltbld', 03:54:26 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 03:54:26 INFO - 'VERSIONER_PYTHON_VERSION': '2.7', 03:54:26 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 03:54:26 INFO - 'XPC_FLAGS': '0x0', 03:54:26 INFO - 'XPC_SERVICE_NAME': '0', 03:54:26 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0x0:0x0'} 03:54:26 INFO - Calling ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--total-chunks', '8', '--this-chunk', '6', '--appname=/builds/slave/test/build/application/NightlyDebug.app/Contents/MacOS/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log', '--screenshot-on-fail', '--browser-chrome', '--subsuite=devtools', '--chunk-by-runtime'] with output_timeout 1000 03:54:26 INFO - /builds/slave/test/build/venv/lib/python2.7/site-packages/mozrunner/utils.py:20: UserWarning: Module moznetwork was already imported from /builds/slave/test/build/tests/mochitest/moznetwork.py, but /builds/slave/test/build/venv/lib/python2.7/site-packages is being added to sys.path 03:54:26 INFO - import pkg_resources 03:54:26 INFO - Checking for orphan ssltunnel processes... 03:54:26 INFO - Checking for orphan xpcshell processes... 03:54:26 INFO - SUITE-START | Running 236 tests 03:54:26 INFO - TEST-START | devtools/client/shadereditor/test/browser_se_bfcache.js 03:54:26 INFO - TEST-SKIP | devtools/client/shadereditor/test/browser_se_bfcache.js | took 0ms 03:54:26 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_623749_ctrl_a_select_all_winnt.js 03:54:26 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_623749_ctrl_a_select_all_winnt.js | took 0ms 03:54:26 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_web_console_warning.js 03:54:26 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_web_console_warning.js | took 0ms 03:54:26 INFO - dir: devtools/client/shadereditor/test 03:54:27 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 03:54:27 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/NightlyDebug.app/Contents/Resources', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/tmpFq_kRF.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 03:54:27 INFO - runtests.py | Server pid: 1704 03:54:27 INFO - runtests.py | Websocket server pid: 1705 03:54:27 INFO - runtests.py | SSL tunnel pid: 1706 03:54:27 INFO - runtests.py | Running tests: start. 03:54:27 INFO - runtests.py | Application pid: 1707 03:54:27 INFO - TEST-INFO | started process Main app process 03:54:27 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/tmpFq_kRF.mozrunner/runtests_leaks.log 03:54:28 INFO - ++DOCSHELL 0x114fc8800 == 1 [pid = 1707] [id = 1] 03:54:28 INFO - ++DOMWINDOW == 1 (0x114f9d800) [pid = 1707] [serial = 1] [outer = 0x0] 03:54:29 INFO - ++DOMWINDOW == 2 (0x115369c00) [pid = 1707] [serial = 2] [outer = 0x114f9d800] 03:54:29 INFO - ++DOCSHELL 0x11edf7800 == 2 [pid = 1707] [id = 2] 03:54:29 INFO - ++DOMWINDOW == 3 (0x114db3c00) [pid = 1707] [serial = 3] [outer = 0x0] 03:54:29 INFO - ++DOMWINDOW == 4 (0x11ee7dc00) [pid = 1707] [serial = 4] [outer = 0x114db3c00] 03:54:30 INFO - [1707] WARNING: Loaded script chrome://global/content/printUtils.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:54:30 INFO - [1707] WARNING: Loaded script chrome://global/content/viewZoomOverlay.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:54:30 INFO - [1707] WARNING: Loaded script chrome://browser/content/places/browserPlacesViews.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:54:30 INFO - [1707] WARNING: Loaded script chrome://browser/content/browser.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:54:30 INFO - [1707] WARNING: Loaded script chrome://browser/content/downloads/downloads.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:54:30 INFO - [1707] WARNING: Loaded script chrome://browser/content/downloads/indicator.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:54:30 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:54:30 INFO - [1707] WARNING: Loaded script chrome://browser/content/customizableui/panelUI.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:54:30 INFO - [1707] WARNING: Loaded script chrome://global/content/viewSourceUtils.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:54:30 INFO - ++DOCSHELL 0x120e35800 == 3 [pid = 1707] [id = 3] 03:54:30 INFO - ++DOMWINDOW == 5 (0x120e64000) [pid = 1707] [serial = 5] [outer = 0x0] 03:54:30 INFO - ++DOCSHELL 0x120e3e000 == 4 [pid = 1707] [id = 4] 03:54:30 INFO - ++DOMWINDOW == 6 (0x120e64800) [pid = 1707] [serial = 6] [outer = 0x0] 03:54:31 INFO - [1707] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:54:31 INFO - [1707] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 03:54:31 INFO - ++DOCSHELL 0x124664800 == 5 [pid = 1707] [id = 5] 03:54:31 INFO - ++DOMWINDOW == 7 (0x120e63c00) [pid = 1707] [serial = 7] [outer = 0x0] 03:54:31 INFO - [1707] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 03:54:31 INFO - ++DOMWINDOW == 8 (0x124734400) [pid = 1707] [serial = 8] [outer = 0x120e63c00] 03:54:31 INFO - ++DOMWINDOW == 9 (0x124a4f800) [pid = 1707] [serial = 9] [outer = 0x120e64000] 03:54:31 INFO - ++DOMWINDOW == 10 (0x124a50000) [pid = 1707] [serial = 10] [outer = 0x120e64800] 03:54:31 INFO - ++DOMWINDOW == 11 (0x124a51c00) [pid = 1707] [serial = 11] [outer = 0x120e63c00] 03:54:32 INFO - [1707] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:54:32 INFO - ++DOMWINDOW == 12 (0x1276cec00) [pid = 1707] [serial = 12] [outer = 0x120e63c00] 03:54:32 INFO - ++DOCSHELL 0x1278a7000 == 6 [pid = 1707] [id = 6] 03:54:32 INFO - ++DOMWINDOW == 13 (0x1278da800) [pid = 1707] [serial = 13] [outer = 0x0] 03:54:32 INFO - ++DOMWINDOW == 14 (0x1278dbc00) [pid = 1707] [serial = 14] [outer = 0x1278da800] 03:54:33 INFO - [1707] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:54:33 INFO - 0 INFO *** Start BrowserChrome Test Results *** 03:54:33 INFO - ++DOCSHELL 0x12bef8000 == 7 [pid = 1707] [id = 7] 03:54:33 INFO - ++DOMWINDOW == 15 (0x12ca7e400) [pid = 1707] [serial = 15] [outer = 0x0] 03:54:33 INFO - ++DOMWINDOW == 16 (0x12ca80800) [pid = 1707] [serial = 16] [outer = 0x12ca7e400] 03:54:34 INFO - 1 INFO checking window state 03:54:34 INFO - 2 INFO TEST-INFO | (browser-test.js) | Console message: [JavaScript Error: "DEPRECATION WARNING: FUEL is deprecated, you should use the add-on SDK instead. 03:54:34 INFO - You may find more details about this deprecation at: https://developer.mozilla.org/Add-ons/SDK/ 03:54:34 INFO - jar:file:///builds/slave/test/build/application/NightlyDebug.app/Contents/Resources/browser/omni.ja!/components/fuelApplication.js 1458 Application 03:54:34 INFO - jar:file:///builds/slave/test/build/application/NightlyDebug.app/Contents/Resources/browser/omni.ja!/components/fuelApplication.js 726 af_ci 03:54:34 INFO - chrome://mochikit/content/browser-test.js 254 Tester_start 03:54:34 INFO - chrome://mochikit/content/browser-harness.xul 255 createTester/%20%20%20%20%20%20%20%20%20%20] 03:54:42 INFO - --DOMWINDOW == 31 (0x124f53800) [pid = 1707] [serial = 45] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:42 INFO - --DOMWINDOW == 30 (0x11480a000) [pid = 1707] [serial = 41] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:54:42 INFO - --DOMWINDOW == 29 (0x114693c00) [pid = 1707] [serial = 29] [outer = 0x0] [url = about:blank] 03:54:42 INFO - --DOMWINDOW == 28 (0x1137ab000) [pid = 1707] [serial = 28] [outer = 0x0] [url = about:blank] 03:54:42 INFO - ++DOMWINDOW == 29 (0x120d8e000) [pid = 1707] [serial = 52] [outer = 0x11e8e9400] 03:54:42 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:42 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:42 INFO - ++DOCSHELL 0x1241b0800 == 11 [pid = 1707] [id = 22] 03:54:42 INFO - ++DOMWINDOW == 30 (0x11f51bc00) [pid = 1707] [serial = 53] [outer = 0x0] 03:54:42 INFO - ++DOMWINDOW == 31 (0x11f51c800) [pid = 1707] [serial = 54] [outer = 0x11f51bc00] 03:54:42 INFO - ++DOMWINDOW == 32 (0x114d31c00) [pid = 1707] [serial = 55] [outer = 0x11f51bc00] 03:54:43 INFO - ++DOCSHELL 0x124675000 == 12 [pid = 1707] [id = 23] 03:54:43 INFO - ++DOMWINDOW == 33 (0x121445000) [pid = 1707] [serial = 56] [outer = 0x0] 03:54:43 INFO - ++DOMWINDOW == 34 (0x121449000) [pid = 1707] [serial = 57] [outer = 0x121445000] 03:54:43 INFO - ++DOMWINDOW == 35 (0x1251c6000) [pid = 1707] [serial = 58] [outer = 0x11e8e9400] 03:54:43 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:54:43 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:43 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:43 INFO - ++DOCSHELL 0x126073000 == 13 [pid = 1707] [id = 24] 03:54:43 INFO - ++DOMWINDOW == 36 (0x11f4ea400) [pid = 1707] [serial = 59] [outer = 0x0] 03:54:43 INFO - ++DOCSHELL 0x126074000 == 14 [pid = 1707] [id = 25] 03:54:43 INFO - ++DOMWINDOW == 37 (0x11ff8bc00) [pid = 1707] [serial = 60] [outer = 0x0] 03:54:43 INFO - ++DOMWINDOW == 38 (0x12015d800) [pid = 1707] [serial = 61] [outer = 0x11f4ea400] 03:54:43 INFO - ++DOMWINDOW == 39 (0x125276000) [pid = 1707] [serial = 62] [outer = 0x11ff8bc00] 03:54:45 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 03:54:45 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:45 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:45 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 03:54:45 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:45 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:46 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have an compiled fragment shader attached. 03:54:46 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:46 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:46 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have an compiled fragment shader attached. 03:54:46 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:46 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:47 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 03:54:47 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:47 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:48 INFO - --DOCSHELL 0x1241b0800 == 13 [pid = 1707] [id = 22] 03:54:48 INFO - --DOCSHELL 0x124675000 == 12 [pid = 1707] [id = 23] 03:54:48 INFO - --DOCSHELL 0x126073000 == 11 [pid = 1707] [id = 24] 03:54:48 INFO - --DOCSHELL 0x126074000 == 10 [pid = 1707] [id = 25] 03:54:48 INFO - --DOCSHELL 0x113760800 == 9 [pid = 1707] [id = 21] 03:54:48 INFO - --DOMWINDOW == 38 (0x124733800) [pid = 1707] [serial = 43] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:54:48 INFO - --DOMWINDOW == 37 (0x11ee8c400) [pid = 1707] [serial = 42] [outer = 0x0] [url = about:blank] 03:54:48 INFO - --DOMWINDOW == 36 (0x124f58c00) [pid = 1707] [serial = 46] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:48 INFO - --DOMWINDOW == 35 (0x12510f800) [pid = 1707] [serial = 47] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:48 INFO - --DOMWINDOW == 34 (0x12d25fc00) [pid = 1707] [serial = 25] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:54:48 INFO - --DOMWINDOW == 33 (0x112eb2400) [pid = 1707] [serial = 34] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:54:48 INFO - MEMORY STAT | vsize 3431MB | residentFast 404MB | heapAllocated 94MB 03:54:48 INFO - 8 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_editors-error-gutter.js | took 6824ms 03:54:48 INFO - ++DOCSHELL 0x100471800 == 10 [pid = 1707] [id = 26] 03:54:48 INFO - ++DOMWINDOW == 34 (0x112087000) [pid = 1707] [serial = 63] [outer = 0x0] 03:54:48 INFO - ++DOMWINDOW == 35 (0x113521000) [pid = 1707] [serial = 64] [outer = 0x112087000] 03:54:48 INFO - 9 INFO TEST-START | devtools/client/shadereditor/test/browser_se_editors-error-tooltip.js 03:54:48 INFO - ++DOCSHELL 0x11f892800 == 11 [pid = 1707] [id = 27] 03:54:48 INFO - ++DOMWINDOW == 36 (0x11e7b7800) [pid = 1707] [serial = 65] [outer = 0x0] 03:54:48 INFO - ++DOMWINDOW == 37 (0x11e8ea800) [pid = 1707] [serial = 66] [outer = 0x11e7b7800] 03:54:49 INFO - --DOCSHELL 0x112b58000 == 10 [pid = 1707] [id = 20] 03:54:49 INFO - --DOMWINDOW == 36 (0x11f51c800) [pid = 1707] [serial = 54] [outer = 0x0] [url = about:blank] 03:54:49 INFO - --DOMWINDOW == 35 (0x114698c00) [pid = 1707] [serial = 48] [outer = 0x0] [url = about:blank] 03:54:49 INFO - --DOMWINDOW == 34 (0x11480c800) [pid = 1707] [serial = 49] [outer = 0x0] [url = about:blank] 03:54:49 INFO - --DOMWINDOW == 33 (0x11ff8bc00) [pid = 1707] [serial = 60] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:49 INFO - --DOMWINDOW == 32 (0x11f4ea400) [pid = 1707] [serial = 59] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:49 INFO - --DOMWINDOW == 31 (0x121445000) [pid = 1707] [serial = 56] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:54:49 INFO - --DOMWINDOW == 30 (0x11e8ed400) [pid = 1707] [serial = 51] [outer = 0x0] [url = about:blank] 03:54:49 INFO - --DOMWINDOW == 29 (0x11e8e9400) [pid = 1707] [serial = 50] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:54:49 INFO - --DOMWINDOW == 28 (0x11e716400) [pid = 1707] [serial = 38] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:54:49 INFO - ++DOMWINDOW == 29 (0x11f625800) [pid = 1707] [serial = 67] [outer = 0x11e7b7800] 03:54:49 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:49 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:49 INFO - ++DOCSHELL 0x120bd9800 == 11 [pid = 1707] [id = 28] 03:54:49 INFO - ++DOMWINDOW == 30 (0x11ee8a800) [pid = 1707] [serial = 68] [outer = 0x0] 03:54:49 INFO - ++DOMWINDOW == 31 (0x11ee8c000) [pid = 1707] [serial = 69] [outer = 0x11ee8a800] 03:54:50 INFO - ++DOMWINDOW == 32 (0x11f080400) [pid = 1707] [serial = 70] [outer = 0x11ee8a800] 03:54:50 INFO - ++DOCSHELL 0x12218e000 == 12 [pid = 1707] [id = 29] 03:54:50 INFO - ++DOMWINDOW == 33 (0x11f4e8400) [pid = 1707] [serial = 71] [outer = 0x0] 03:54:50 INFO - ++DOMWINDOW == 34 (0x11f4eb800) [pid = 1707] [serial = 72] [outer = 0x11f4e8400] 03:54:51 INFO - ++DOMWINDOW == 35 (0x122465000) [pid = 1707] [serial = 73] [outer = 0x11e7b7800] 03:54:51 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:54:51 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:51 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:52 INFO - --DOMWINDOW == 34 (0x120d8e000) [pid = 1707] [serial = 52] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:54:52 INFO - --DOMWINDOW == 33 (0x1251c6000) [pid = 1707] [serial = 58] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:54:52 INFO - ++DOCSHELL 0x120ca9800 == 13 [pid = 1707] [id = 30] 03:54:52 INFO - ++DOMWINDOW == 34 (0x11ed51400) [pid = 1707] [serial = 74] [outer = 0x0] 03:54:52 INFO - ++DOCSHELL 0x120e12000 == 14 [pid = 1707] [id = 31] 03:54:52 INFO - ++DOMWINDOW == 35 (0x11ee23800) [pid = 1707] [serial = 75] [outer = 0x0] 03:54:52 INFO - ++DOMWINDOW == 36 (0x11ee7fc00) [pid = 1707] [serial = 76] [outer = 0x11ed51400] 03:54:52 INFO - ++DOMWINDOW == 37 (0x11ee89c00) [pid = 1707] [serial = 77] [outer = 0x11ee23800] 03:54:53 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 03:54:53 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:53 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:54:53 INFO - [1707] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:54:54 INFO - --DOCSHELL 0x11f892800 == 13 [pid = 1707] [id = 27] 03:54:54 INFO - --DOCSHELL 0x120bd9800 == 12 [pid = 1707] [id = 28] 03:54:54 INFO - --DOCSHELL 0x12218e000 == 11 [pid = 1707] [id = 29] 03:54:54 INFO - --DOCSHELL 0x120ca9800 == 10 [pid = 1707] [id = 30] 03:54:54 INFO - --DOCSHELL 0x120e12000 == 9 [pid = 1707] [id = 31] 03:54:54 INFO - --DOMWINDOW == 36 (0x113527c00) [pid = 1707] [serial = 40] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:54:54 INFO - --DOMWINDOW == 35 (0x121449000) [pid = 1707] [serial = 57] [outer = 0x0] [url = about:blank] 03:54:54 INFO - --DOMWINDOW == 34 (0x125276000) [pid = 1707] [serial = 62] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:54 INFO - --DOMWINDOW == 33 (0x12015d800) [pid = 1707] [serial = 61] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:54 INFO - MEMORY STAT | vsize 3436MB | residentFast 407MB | heapAllocated 94MB 03:54:54 INFO - 10 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_editors-error-tooltip.js | took 5445ms 03:54:54 INFO - ++DOCSHELL 0x112bd8000 == 10 [pid = 1707] [id = 32] 03:54:54 INFO - ++DOMWINDOW == 34 (0x113f4c000) [pid = 1707] [serial = 78] [outer = 0x0] 03:54:54 INFO - ++DOMWINDOW == 35 (0x1146a1400) [pid = 1707] [serial = 79] [outer = 0x113f4c000] 03:54:54 INFO - 11 INFO TEST-START | devtools/client/shadereditor/test/browser_se_editors-lazy-init.js 03:54:54 INFO - ++DOCSHELL 0x12027f000 == 11 [pid = 1707] [id = 33] 03:54:54 INFO - ++DOMWINDOW == 36 (0x11ee1f000) [pid = 1707] [serial = 80] [outer = 0x0] 03:54:54 INFO - ++DOMWINDOW == 37 (0x11ee7e400) [pid = 1707] [serial = 81] [outer = 0x11ee1f000] 03:54:54 INFO - --DOCSHELL 0x100471800 == 10 [pid = 1707] [id = 26] 03:54:55 INFO - --DOMWINDOW == 36 (0x112087000) [pid = 1707] [serial = 63] [outer = 0x0] [url = about:blank] 03:54:55 INFO - --DOMWINDOW == 35 (0x113521000) [pid = 1707] [serial = 64] [outer = 0x0] [url = about:blank] 03:54:55 INFO - --DOMWINDOW == 34 (0x11ee8c000) [pid = 1707] [serial = 69] [outer = 0x0] [url = about:blank] 03:54:55 INFO - --DOMWINDOW == 33 (0x11f51bc00) [pid = 1707] [serial = 53] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:54:55 INFO - --DOMWINDOW == 32 (0x11e8ea800) [pid = 1707] [serial = 66] [outer = 0x0] [url = about:blank] 03:54:55 INFO - --DOMWINDOW == 31 (0x11e7b7800) [pid = 1707] [serial = 65] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:54:55 INFO - --DOMWINDOW == 30 (0x11ed51400) [pid = 1707] [serial = 74] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:55 INFO - --DOMWINDOW == 29 (0x11ee23800) [pid = 1707] [serial = 75] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:55 INFO - --DOMWINDOW == 28 (0x11f4e8400) [pid = 1707] [serial = 71] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:54:55 INFO - ++DOMWINDOW == 29 (0x12219b800) [pid = 1707] [serial = 82] [outer = 0x11ee1f000] 03:54:55 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:55 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:55 INFO - ++DOCSHELL 0x113767000 == 11 [pid = 1707] [id = 34] 03:54:55 INFO - ++DOMWINDOW == 30 (0x11f0f6c00) [pid = 1707] [serial = 83] [outer = 0x0] 03:54:55 INFO - ++DOMWINDOW == 31 (0x11f4e5400) [pid = 1707] [serial = 84] [outer = 0x11f0f6c00] 03:54:55 INFO - ++DOMWINDOW == 32 (0x112081000) [pid = 1707] [serial = 85] [outer = 0x11f0f6c00] 03:54:55 INFO - ++DOCSHELL 0x124416000 == 12 [pid = 1707] [id = 35] 03:54:55 INFO - ++DOMWINDOW == 33 (0x120cf6800) [pid = 1707] [serial = 86] [outer = 0x0] 03:54:55 INFO - ++DOMWINDOW == 34 (0x120cf9c00) [pid = 1707] [serial = 87] [outer = 0x120cf6800] 03:54:56 INFO - ++DOMWINDOW == 35 (0x124f56800) [pid = 1707] [serial = 88] [outer = 0x11ee1f000] 03:54:56 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:54:56 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:56 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:56 INFO - ++DOCSHELL 0x124fc6800 == 13 [pid = 1707] [id = 36] 03:54:56 INFO - ++DOMWINDOW == 36 (0x11ee8c000) [pid = 1707] [serial = 89] [outer = 0x0] 03:54:56 INFO - ++DOMWINDOW == 37 (0x11f4e7c00) [pid = 1707] [serial = 90] [outer = 0x11ee8c000] 03:54:56 INFO - ++DOCSHELL 0x126069000 == 14 [pid = 1707] [id = 37] 03:54:56 INFO - ++DOMWINDOW == 38 (0x124fa9800) [pid = 1707] [serial = 91] [outer = 0x0] 03:54:56 INFO - ++DOMWINDOW == 39 (0x125119400) [pid = 1707] [serial = 92] [outer = 0x124fa9800] 03:54:57 INFO - --DOCSHELL 0x124416000 == 13 [pid = 1707] [id = 35] 03:54:57 INFO - --DOCSHELL 0x124fc6800 == 12 [pid = 1707] [id = 36] 03:54:57 INFO - --DOMWINDOW == 38 (0x11ee89c00) [pid = 1707] [serial = 77] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:57 INFO - --DOMWINDOW == 37 (0x11ee7fc00) [pid = 1707] [serial = 76] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:57 INFO - --DOMWINDOW == 36 (0x11f4eb800) [pid = 1707] [serial = 72] [outer = 0x0] [url = about:blank] 03:54:57 INFO - --DOMWINDOW == 35 (0x114d31c00) [pid = 1707] [serial = 55] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:54:57 INFO - --DOCSHELL 0x126069000 == 11 [pid = 1707] [id = 37] 03:54:57 INFO - --DOMWINDOW == 34 (0x122465000) [pid = 1707] [serial = 73] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:54:57 INFO - --DOMWINDOW == 33 (0x11f625800) [pid = 1707] [serial = 67] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:54:57 INFO - MEMORY STAT | vsize 3444MB | residentFast 407MB | heapAllocated 94MB 03:54:57 INFO - 12 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_editors-lazy-init.js | took 3392ms 03:54:57 INFO - ++DOCSHELL 0x1120a3800 == 12 [pid = 1707] [id = 38] 03:54:57 INFO - ++DOMWINDOW == 34 (0x113521000) [pid = 1707] [serial = 93] [outer = 0x0] 03:54:57 INFO - ++DOMWINDOW == 35 (0x114802800) [pid = 1707] [serial = 94] [outer = 0x113521000] 03:54:57 INFO - 13 INFO TEST-START | devtools/client/shadereditor/test/browser_se_first-run.js 03:54:57 INFO - ++DOCSHELL 0x11f88f000 == 13 [pid = 1707] [id = 39] 03:54:57 INFO - ++DOMWINDOW == 36 (0x11e73e400) [pid = 1707] [serial = 95] [outer = 0x0] 03:54:57 INFO - ++DOMWINDOW == 37 (0x11e8e9400) [pid = 1707] [serial = 96] [outer = 0x11e73e400] 03:54:58 INFO - --DOCSHELL 0x113767000 == 12 [pid = 1707] [id = 34] 03:54:58 INFO - --DOCSHELL 0x112bd8000 == 11 [pid = 1707] [id = 32] 03:54:58 INFO - --DOCSHELL 0x12027f000 == 10 [pid = 1707] [id = 33] 03:54:58 INFO - --DOMWINDOW == 36 (0x113f4c000) [pid = 1707] [serial = 78] [outer = 0x0] [url = about:blank] 03:54:58 INFO - --DOMWINDOW == 35 (0x1146a1400) [pid = 1707] [serial = 79] [outer = 0x0] [url = about:blank] 03:54:58 INFO - --DOMWINDOW == 34 (0x11f4e5400) [pid = 1707] [serial = 84] [outer = 0x0] [url = about:blank] 03:54:58 INFO - --DOMWINDOW == 33 (0x11ee7e400) [pid = 1707] [serial = 81] [outer = 0x0] [url = about:blank] 03:54:58 INFO - --DOMWINDOW == 32 (0x11ee8a800) [pid = 1707] [serial = 68] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:54:58 INFO - --DOMWINDOW == 31 (0x11ee1f000) [pid = 1707] [serial = 80] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:54:58 INFO - --DOMWINDOW == 30 (0x124fa9800) [pid = 1707] [serial = 91] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:58 INFO - --DOMWINDOW == 29 (0x11ee8c000) [pid = 1707] [serial = 89] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:54:58 INFO - --DOMWINDOW == 28 (0x120cf6800) [pid = 1707] [serial = 86] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:54:58 INFO - ++DOMWINDOW == 29 (0x12120f800) [pid = 1707] [serial = 97] [outer = 0x11e73e400] 03:54:58 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:58 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:58 INFO - ++DOCSHELL 0x113728800 == 11 [pid = 1707] [id = 40] 03:54:58 INFO - ++DOMWINDOW == 30 (0x11ee89c00) [pid = 1707] [serial = 98] [outer = 0x0] 03:54:58 INFO - ++DOMWINDOW == 31 (0x11ee8c000) [pid = 1707] [serial = 99] [outer = 0x11ee89c00] 03:54:58 INFO - ++DOMWINDOW == 32 (0x114807000) [pid = 1707] [serial = 100] [outer = 0x11ee89c00] 03:54:59 INFO - ++DOCSHELL 0x124069000 == 12 [pid = 1707] [id = 41] 03:54:59 INFO - ++DOMWINDOW == 33 (0x120d2a000) [pid = 1707] [serial = 101] [outer = 0x0] 03:54:59 INFO - ++DOMWINDOW == 34 (0x120d8b400) [pid = 1707] [serial = 102] [outer = 0x120d2a000] 03:54:59 INFO - ++DOMWINDOW == 35 (0x124735400) [pid = 1707] [serial = 103] [outer = 0x11e73e400] 03:54:59 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:54:59 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:54:59 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:00 INFO - --DOCSHELL 0x124069000 == 11 [pid = 1707] [id = 41] 03:55:00 INFO - --DOMWINDOW == 34 (0x12219b800) [pid = 1707] [serial = 82] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:00 INFO - --DOMWINDOW == 33 (0x11f080400) [pid = 1707] [serial = 70] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:00 INFO - --DOMWINDOW == 32 (0x125119400) [pid = 1707] [serial = 92] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:00 INFO - --DOMWINDOW == 31 (0x124f56800) [pid = 1707] [serial = 88] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:00 INFO - --DOMWINDOW == 30 (0x11f4e7c00) [pid = 1707] [serial = 90] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:00 INFO - --DOMWINDOW == 29 (0x120cf9c00) [pid = 1707] [serial = 87] [outer = 0x0] [url = about:blank] 03:55:00 INFO - MEMORY STAT | vsize 3440MB | residentFast 407MB | heapAllocated 92MB 03:55:00 INFO - 14 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_first-run.js | took 2807ms 03:55:00 INFO - ++DOCSHELL 0x112c60000 == 12 [pid = 1707] [id = 42] 03:55:00 INFO - ++DOMWINDOW == 30 (0x113ff8c00) [pid = 1707] [serial = 104] [outer = 0x0] 03:55:00 INFO - ++DOMWINDOW == 31 (0x1148b7800) [pid = 1707] [serial = 105] [outer = 0x113ff8c00] 03:55:00 INFO - 15 INFO TEST-START | devtools/client/shadereditor/test/browser_se_navigation.js 03:55:00 INFO - ++DOCSHELL 0x12027a800 == 13 [pid = 1707] [id = 43] 03:55:00 INFO - ++DOMWINDOW == 32 (0x11e8ec400) [pid = 1707] [serial = 106] [outer = 0x0] 03:55:00 INFO - ++DOMWINDOW == 33 (0x11ed52800) [pid = 1707] [serial = 107] [outer = 0x11e8ec400] 03:55:01 INFO - --DOCSHELL 0x1120a3800 == 12 [pid = 1707] [id = 38] 03:55:01 INFO - --DOCSHELL 0x113728800 == 11 [pid = 1707] [id = 40] 03:55:01 INFO - --DOCSHELL 0x11f88f000 == 10 [pid = 1707] [id = 39] 03:55:01 INFO - --DOMWINDOW == 32 (0x11ee8c000) [pid = 1707] [serial = 99] [outer = 0x0] [url = about:blank] 03:55:01 INFO - --DOMWINDOW == 31 (0x11e8e9400) [pid = 1707] [serial = 96] [outer = 0x0] [url = about:blank] 03:55:01 INFO - --DOMWINDOW == 30 (0x11e73e400) [pid = 1707] [serial = 95] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:01 INFO - --DOMWINDOW == 29 (0x113521000) [pid = 1707] [serial = 93] [outer = 0x0] [url = about:blank] 03:55:01 INFO - --DOMWINDOW == 28 (0x120d2a000) [pid = 1707] [serial = 101] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:01 INFO - --DOMWINDOW == 27 (0x114802800) [pid = 1707] [serial = 94] [outer = 0x0] [url = about:blank] 03:55:01 INFO - --DOMWINDOW == 26 (0x11f0f6c00) [pid = 1707] [serial = 83] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:01 INFO - ++DOMWINDOW == 27 (0x120cecc00) [pid = 1707] [serial = 108] [outer = 0x11e8ec400] 03:55:01 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:01 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:01 INFO - ++DOCSHELL 0x112bd8000 == 11 [pid = 1707] [id = 44] 03:55:01 INFO - ++DOMWINDOW == 28 (0x11ee8c000) [pid = 1707] [serial = 109] [outer = 0x0] 03:55:01 INFO - ++DOMWINDOW == 29 (0x11f075400) [pid = 1707] [serial = 110] [outer = 0x11ee8c000] 03:55:01 INFO - ++DOMWINDOW == 30 (0x11f076000) [pid = 1707] [serial = 111] [outer = 0x11ee8c000] 03:55:01 INFO - ++DOCSHELL 0x124068000 == 12 [pid = 1707] [id = 45] 03:55:01 INFO - ++DOMWINDOW == 31 (0x120c8b000) [pid = 1707] [serial = 112] [outer = 0x0] 03:55:01 INFO - ++DOMWINDOW == 32 (0x120c93800) [pid = 1707] [serial = 113] [outer = 0x120c8b000] 03:55:02 INFO - ++DOMWINDOW == 33 (0x122d11400) [pid = 1707] [serial = 114] [outer = 0x11e8ec400] 03:55:02 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:02 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:02 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:02 INFO - ++DOCSHELL 0x124ab5000 == 13 [pid = 1707] [id = 46] 03:55:02 INFO - ++DOMWINDOW == 34 (0x11f4e2c00) [pid = 1707] [serial = 115] [outer = 0x0] 03:55:02 INFO - ++DOCSHELL 0x124ab6800 == 14 [pid = 1707] [id = 47] 03:55:02 INFO - ++DOMWINDOW == 35 (0x12457a400) [pid = 1707] [serial = 116] [outer = 0x0] 03:55:02 INFO - ++DOMWINDOW == 36 (0x12472e400) [pid = 1707] [serial = 117] [outer = 0x11f4e2c00] 03:55:02 INFO - ++DOMWINDOW == 37 (0x124921800) [pid = 1707] [serial = 118] [outer = 0x12457a400] 03:55:03 INFO - ++DOMWINDOW == 38 (0x12d12b400) [pid = 1707] [serial = 119] [outer = 0x11e8ec400] 03:55:04 INFO - --DOCSHELL 0x124068000 == 13 [pid = 1707] [id = 45] 03:55:04 INFO - --DOMWINDOW == 37 (0x112081000) [pid = 1707] [serial = 85] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:04 INFO - --DOCSHELL 0x124ab6800 == 12 [pid = 1707] [id = 47] 03:55:04 INFO - --DOCSHELL 0x124ab5000 == 11 [pid = 1707] [id = 46] 03:55:04 INFO - --DOMWINDOW == 36 (0x120d8b400) [pid = 1707] [serial = 102] [outer = 0x0] [url = about:blank] 03:55:04 INFO - --DOMWINDOW == 35 (0x124735400) [pid = 1707] [serial = 103] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:04 INFO - --DOMWINDOW == 34 (0x12120f800) [pid = 1707] [serial = 97] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:04 INFO - MEMORY STAT | vsize 3446MB | residentFast 409MB | heapAllocated 94MB 03:55:04 INFO - 16 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_navigation.js | took 3451ms 03:55:04 INFO - ++DOCSHELL 0x100471800 == 12 [pid = 1707] [id = 48] 03:55:04 INFO - ++DOMWINDOW == 35 (0x11351f000) [pid = 1707] [serial = 120] [outer = 0x0] 03:55:04 INFO - ++DOMWINDOW == 36 (0x114696000) [pid = 1707] [serial = 121] [outer = 0x11351f000] 03:55:04 INFO - 17 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-blackbox-01.js 03:55:04 INFO - ++DOCSHELL 0x120276000 == 13 [pid = 1707] [id = 49] 03:55:04 INFO - ++DOMWINDOW == 37 (0x11e8ec000) [pid = 1707] [serial = 122] [outer = 0x0] 03:55:04 INFO - ++DOMWINDOW == 38 (0x11ed4f800) [pid = 1707] [serial = 123] [outer = 0x11e8ec000] 03:55:04 INFO - --DOCSHELL 0x112c60000 == 12 [pid = 1707] [id = 42] 03:55:04 INFO - --DOCSHELL 0x12027a800 == 11 [pid = 1707] [id = 43] 03:55:04 INFO - --DOCSHELL 0x112bd8000 == 10 [pid = 1707] [id = 44] 03:55:05 INFO - --DOMWINDOW == 37 (0x11f075400) [pid = 1707] [serial = 110] [outer = 0x0] [url = about:blank] 03:55:05 INFO - --DOMWINDOW == 36 (0x11ee89c00) [pid = 1707] [serial = 98] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:05 INFO - --DOMWINDOW == 35 (0x11ed52800) [pid = 1707] [serial = 107] [outer = 0x0] [url = about:blank] 03:55:05 INFO - --DOMWINDOW == 34 (0x11e8ec400) [pid = 1707] [serial = 106] [outer = 0x0] [url = about:blank] 03:55:05 INFO - --DOMWINDOW == 33 (0x11f4e2c00) [pid = 1707] [serial = 115] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:05 INFO - --DOMWINDOW == 32 (0x12457a400) [pid = 1707] [serial = 116] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:05 INFO - --DOMWINDOW == 31 (0x120c8b000) [pid = 1707] [serial = 112] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:05 INFO - --DOMWINDOW == 30 (0x113ff8c00) [pid = 1707] [serial = 104] [outer = 0x0] [url = about:blank] 03:55:05 INFO - --DOMWINDOW == 29 (0x1148b7800) [pid = 1707] [serial = 105] [outer = 0x0] [url = about:blank] 03:55:05 INFO - ++DOMWINDOW == 30 (0x112f99c00) [pid = 1707] [serial = 124] [outer = 0x11e8ec000] 03:55:05 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:05 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:05 INFO - ++DOCSHELL 0x113f42800 == 11 [pid = 1707] [id = 50] 03:55:05 INFO - ++DOMWINDOW == 31 (0x11f4ea400) [pid = 1707] [serial = 125] [outer = 0x0] 03:55:05 INFO - ++DOMWINDOW == 32 (0x11f4ed400) [pid = 1707] [serial = 126] [outer = 0x11f4ea400] 03:55:05 INFO - ++DOMWINDOW == 33 (0x113ff4400) [pid = 1707] [serial = 127] [outer = 0x11f4ea400] 03:55:05 INFO - ++DOCSHELL 0x124407800 == 12 [pid = 1707] [id = 51] 03:55:05 INFO - ++DOMWINDOW == 34 (0x120d8d800) [pid = 1707] [serial = 128] [outer = 0x0] 03:55:05 INFO - ++DOMWINDOW == 35 (0x120d8f400) [pid = 1707] [serial = 129] [outer = 0x120d8d800] 03:55:06 INFO - ++DOMWINDOW == 36 (0x124f50800) [pid = 1707] [serial = 130] [outer = 0x11e8ec000] 03:55:06 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:06 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:06 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:06 INFO - ++DOCSHELL 0x126071800 == 13 [pid = 1707] [id = 52] 03:55:06 INFO - ++DOMWINDOW == 37 (0x124faf400) [pid = 1707] [serial = 131] [outer = 0x0] 03:55:06 INFO - ++DOCSHELL 0x126076000 == 14 [pid = 1707] [id = 53] 03:55:06 INFO - ++DOMWINDOW == 38 (0x125110c00) [pid = 1707] [serial = 132] [outer = 0x0] 03:55:06 INFO - ++DOMWINDOW == 39 (0x127464c00) [pid = 1707] [serial = 133] [outer = 0x124faf400] 03:55:06 INFO - ++DOMWINDOW == 40 (0x1276cc000) [pid = 1707] [serial = 134] [outer = 0x125110c00] 03:55:08 INFO - --DOCSHELL 0x124407800 == 13 [pid = 1707] [id = 51] 03:55:08 INFO - --DOCSHELL 0x126071800 == 12 [pid = 1707] [id = 52] 03:55:08 INFO - --DOCSHELL 0x126076000 == 11 [pid = 1707] [id = 53] 03:55:09 INFO - --DOMWINDOW == 39 (0x114807000) [pid = 1707] [serial = 100] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:09 INFO - --DOMWINDOW == 38 (0x120c93800) [pid = 1707] [serial = 113] [outer = 0x0] [url = about:blank] 03:55:09 INFO - --DOMWINDOW == 37 (0x12472e400) [pid = 1707] [serial = 117] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:09 INFO - --DOMWINDOW == 36 (0x124921800) [pid = 1707] [serial = 118] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:09 INFO - --DOMWINDOW == 35 (0x120cecc00) [pid = 1707] [serial = 108] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:09 INFO - --DOMWINDOW == 34 (0x122d11400) [pid = 1707] [serial = 114] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:09 INFO - --DOMWINDOW == 33 (0x12d12b400) [pid = 1707] [serial = 119] [outer = 0x0] [url = about:blank] 03:55:09 INFO - MEMORY STAT | vsize 3429MB | residentFast 413MB | heapAllocated 98MB 03:55:09 INFO - 18 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-blackbox-01.js | took 4674ms 03:55:09 INFO - ++DOCSHELL 0x112b40000 == 12 [pid = 1707] [id = 54] 03:55:09 INFO - ++DOMWINDOW == 34 (0x113f55400) [pid = 1707] [serial = 135] [outer = 0x0] 03:55:09 INFO - ++DOMWINDOW == 35 (0x114802800) [pid = 1707] [serial = 136] [outer = 0x113f55400] 03:55:09 INFO - 19 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-blackbox-02.js 03:55:09 INFO - ++DOCSHELL 0x11f9c8800 == 13 [pid = 1707] [id = 55] 03:55:09 INFO - ++DOMWINDOW == 36 (0x11e8ec400) [pid = 1707] [serial = 137] [outer = 0x0] 03:55:09 INFO - ++DOMWINDOW == 37 (0x11ebc9000) [pid = 1707] [serial = 138] [outer = 0x11e8ec400] 03:55:09 INFO - ++DOMWINDOW == 38 (0x11f4e5c00) [pid = 1707] [serial = 139] [outer = 0x11e8ec400] 03:55:09 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:09 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:09 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:09 INFO - ++DOCSHELL 0x1241b0800 == 14 [pid = 1707] [id = 56] 03:55:09 INFO - ++DOMWINDOW == 39 (0x11f4e8000) [pid = 1707] [serial = 140] [outer = 0x0] 03:55:09 INFO - ++DOMWINDOW == 40 (0x120cf0400) [pid = 1707] [serial = 141] [outer = 0x11f4e8000] 03:55:09 INFO - ++DOMWINDOW == 41 (0x120cef000) [pid = 1707] [serial = 142] [outer = 0x11f4e8000] 03:55:10 INFO - ++DOCSHELL 0x124426800 == 15 [pid = 1707] [id = 57] 03:55:10 INFO - ++DOMWINDOW == 42 (0x120d22c00) [pid = 1707] [serial = 143] [outer = 0x0] 03:55:10 INFO - ++DOMWINDOW == 43 (0x12120c000) [pid = 1707] [serial = 144] [outer = 0x120d22c00] 03:55:10 INFO - ++DOMWINDOW == 44 (0x125480c00) [pid = 1707] [serial = 145] [outer = 0x11e8ec400] 03:55:10 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:10 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:10 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:10 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:11 INFO - ++DOCSHELL 0x127233000 == 16 [pid = 1707] [id = 58] 03:55:11 INFO - ++DOMWINDOW == 45 (0x12120bc00) [pid = 1707] [serial = 146] [outer = 0x0] 03:55:11 INFO - ++DOCSHELL 0x12723f000 == 17 [pid = 1707] [id = 59] 03:55:11 INFO - ++DOMWINDOW == 46 (0x127a73c00) [pid = 1707] [serial = 147] [outer = 0x0] 03:55:11 INFO - ++DOMWINDOW == 47 (0x127a75400) [pid = 1707] [serial = 148] [outer = 0x12120bc00] 03:55:11 INFO - ++DOMWINDOW == 48 (0x127bc7000) [pid = 1707] [serial = 149] [outer = 0x127a73c00] 03:55:14 INFO - --DOCSHELL 0x113f42800 == 16 [pid = 1707] [id = 50] 03:55:14 INFO - --DOCSHELL 0x120276000 == 15 [pid = 1707] [id = 49] 03:55:14 INFO - --DOCSHELL 0x100471800 == 14 [pid = 1707] [id = 48] 03:55:14 INFO - --DOCSHELL 0x11f9c8800 == 13 [pid = 1707] [id = 55] 03:55:14 INFO - --DOCSHELL 0x1241b0800 == 12 [pid = 1707] [id = 56] 03:55:14 INFO - --DOCSHELL 0x124426800 == 11 [pid = 1707] [id = 57] 03:55:14 INFO - --DOCSHELL 0x127233000 == 10 [pid = 1707] [id = 58] 03:55:14 INFO - --DOCSHELL 0x12723f000 == 9 [pid = 1707] [id = 59] 03:55:14 INFO - MEMORY STAT | vsize 3434MB | residentFast 411MB | heapAllocated 104MB 03:55:14 INFO - 20 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-blackbox-02.js | took 5143ms 03:55:14 INFO - ++DOCSHELL 0x100471800 == 10 [pid = 1707] [id = 60] 03:55:14 INFO - ++DOMWINDOW == 49 (0x112f96000) [pid = 1707] [serial = 150] [outer = 0x0] 03:55:14 INFO - ++DOMWINDOW == 50 (0x11480c800) [pid = 1707] [serial = 151] [outer = 0x112f96000] 03:55:14 INFO - 21 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-cache.js 03:55:14 INFO - ++DOCSHELL 0x120e2c800 == 11 [pid = 1707] [id = 61] 03:55:14 INFO - ++DOMWINDOW == 51 (0x11ee8a400) [pid = 1707] [serial = 152] [outer = 0x0] 03:55:14 INFO - ++DOMWINDOW == 52 (0x11f0f6c00) [pid = 1707] [serial = 153] [outer = 0x11ee8a400] 03:55:15 INFO - --DOCSHELL 0x112b40000 == 10 [pid = 1707] [id = 54] 03:55:15 INFO - --DOMWINDOW == 51 (0x127a73c00) [pid = 1707] [serial = 147] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:15 INFO - --DOMWINDOW == 50 (0x12120bc00) [pid = 1707] [serial = 146] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:15 INFO - --DOMWINDOW == 49 (0x125110c00) [pid = 1707] [serial = 132] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:15 INFO - --DOMWINDOW == 48 (0x124faf400) [pid = 1707] [serial = 131] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:15 INFO - --DOMWINDOW == 47 (0x114802800) [pid = 1707] [serial = 136] [outer = 0x0] [url = about:blank] 03:55:15 INFO - --DOMWINDOW == 46 (0x11e8ec400) [pid = 1707] [serial = 137] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 03:55:15 INFO - --DOMWINDOW == 45 (0x11f4ed400) [pid = 1707] [serial = 126] [outer = 0x0] [url = about:blank] 03:55:15 INFO - --DOMWINDOW == 44 (0x120d22c00) [pid = 1707] [serial = 143] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:15 INFO - --DOMWINDOW == 43 (0x11f4ea400) [pid = 1707] [serial = 125] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:15 INFO - --DOMWINDOW == 42 (0x11ee8c000) [pid = 1707] [serial = 109] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:15 INFO - --DOMWINDOW == 41 (0x120d8d800) [pid = 1707] [serial = 128] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:15 INFO - --DOMWINDOW == 40 (0x11351f000) [pid = 1707] [serial = 120] [outer = 0x0] [url = about:blank] 03:55:15 INFO - --DOMWINDOW == 39 (0x11e8ec000) [pid = 1707] [serial = 122] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:15 INFO - --DOMWINDOW == 38 (0x114696000) [pid = 1707] [serial = 121] [outer = 0x0] [url = about:blank] 03:55:15 INFO - --DOMWINDOW == 37 (0x120cf0400) [pid = 1707] [serial = 141] [outer = 0x0] [url = about:blank] 03:55:15 INFO - --DOMWINDOW == 36 (0x11ebc9000) [pid = 1707] [serial = 138] [outer = 0x0] [url = about:blank] 03:55:15 INFO - --DOMWINDOW == 35 (0x113f55400) [pid = 1707] [serial = 135] [outer = 0x0] [url = about:blank] 03:55:15 INFO - --DOMWINDOW == 34 (0x11ed4f800) [pid = 1707] [serial = 123] [outer = 0x0] [url = about:blank] 03:55:15 INFO - ++DOMWINDOW == 35 (0x120d8f000) [pid = 1707] [serial = 154] [outer = 0x11ee8a400] 03:55:15 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:15 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:15 INFO - ++DOCSHELL 0x114d7a000 == 11 [pid = 1707] [id = 62] 03:55:15 INFO - ++DOMWINDOW == 36 (0x11351f000) [pid = 1707] [serial = 155] [outer = 0x0] 03:55:15 INFO - ++DOMWINDOW == 37 (0x12015ac00) [pid = 1707] [serial = 156] [outer = 0x11351f000] 03:55:15 INFO - ++DOMWINDOW == 38 (0x12015d000) [pid = 1707] [serial = 157] [outer = 0x11351f000] 03:55:15 INFO - ++DOCSHELL 0x124678000 == 12 [pid = 1707] [id = 63] 03:55:15 INFO - ++DOMWINDOW == 39 (0x121444400) [pid = 1707] [serial = 158] [outer = 0x0] 03:55:15 INFO - ++DOMWINDOW == 40 (0x121447c00) [pid = 1707] [serial = 159] [outer = 0x121444400] 03:55:16 INFO - ++DOMWINDOW == 41 (0x124faf800) [pid = 1707] [serial = 160] [outer = 0x11ee8a400] 03:55:16 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:16 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:16 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:16 INFO - ++DOCSHELL 0x129345000 == 13 [pid = 1707] [id = 64] 03:55:16 INFO - ++DOMWINDOW == 42 (0x11ff8ac00) [pid = 1707] [serial = 161] [outer = 0x0] 03:55:16 INFO - ++DOCSHELL 0x12934d800 == 14 [pid = 1707] [id = 65] 03:55:16 INFO - ++DOMWINDOW == 43 (0x125481800) [pid = 1707] [serial = 162] [outer = 0x0] 03:55:16 INFO - ++DOMWINDOW == 44 (0x125483c00) [pid = 1707] [serial = 163] [outer = 0x11ff8ac00] 03:55:17 INFO - ++DOMWINDOW == 45 (0x1272b7400) [pid = 1707] [serial = 164] [outer = 0x125481800] 03:55:18 INFO - --DOCSHELL 0x124678000 == 13 [pid = 1707] [id = 63] 03:55:18 INFO - --DOMWINDOW == 44 (0x11f076000) [pid = 1707] [serial = 111] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:18 INFO - --DOMWINDOW == 43 (0x113ff4400) [pid = 1707] [serial = 127] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:18 INFO - --DOMWINDOW == 42 (0x120d8f400) [pid = 1707] [serial = 129] [outer = 0x0] [url = about:blank] 03:55:18 INFO - --DOMWINDOW == 41 (0x12120c000) [pid = 1707] [serial = 144] [outer = 0x0] [url = about:blank] 03:55:18 INFO - --DOMWINDOW == 40 (0x127a75400) [pid = 1707] [serial = 148] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:18 INFO - --DOMWINDOW == 39 (0x127bc7000) [pid = 1707] [serial = 149] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:18 INFO - --DOMWINDOW == 38 (0x127464c00) [pid = 1707] [serial = 133] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:18 INFO - --DOMWINDOW == 37 (0x1276cc000) [pid = 1707] [serial = 134] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:18 INFO - --DOCSHELL 0x12934d800 == 12 [pid = 1707] [id = 65] 03:55:18 INFO - --DOMWINDOW == 36 (0x125480c00) [pid = 1707] [serial = 145] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 03:55:18 INFO - --DOCSHELL 0x129345000 == 11 [pid = 1707] [id = 64] 03:55:18 INFO - --DOMWINDOW == 35 (0x124f50800) [pid = 1707] [serial = 130] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:18 INFO - --DOMWINDOW == 34 (0x11f4e5c00) [pid = 1707] [serial = 139] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 03:55:18 INFO - --DOMWINDOW == 33 (0x112f99c00) [pid = 1707] [serial = 124] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:18 INFO - MEMORY STAT | vsize 3410MB | residentFast 397MB | heapAllocated 96MB 03:55:18 INFO - 22 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-cache.js | took 3876ms 03:55:18 INFO - ++DOCSHELL 0x1120a3800 == 12 [pid = 1707] [id = 66] 03:55:18 INFO - ++DOMWINDOW == 34 (0x1137aac00) [pid = 1707] [serial = 165] [outer = 0x0] 03:55:18 INFO - ++DOMWINDOW == 35 (0x113ffc000) [pid = 1707] [serial = 166] [outer = 0x1137aac00] 03:55:18 INFO - 23 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-highlight-01.js 03:55:18 INFO - ++DOCSHELL 0x114843800 == 13 [pid = 1707] [id = 67] 03:55:18 INFO - ++DOMWINDOW == 36 (0x11e7b7800) [pid = 1707] [serial = 167] [outer = 0x0] 03:55:18 INFO - ++DOMWINDOW == 37 (0x11ebc1400) [pid = 1707] [serial = 168] [outer = 0x11e7b7800] 03:55:19 INFO - --DOCSHELL 0x114d7a000 == 12 [pid = 1707] [id = 62] 03:55:19 INFO - --DOCSHELL 0x120e2c800 == 11 [pid = 1707] [id = 61] 03:55:19 INFO - --DOCSHELL 0x100471800 == 10 [pid = 1707] [id = 60] 03:55:19 INFO - --DOMWINDOW == 36 (0x12015ac00) [pid = 1707] [serial = 156] [outer = 0x0] [url = about:blank] 03:55:19 INFO - --DOMWINDOW == 35 (0x11f0f6c00) [pid = 1707] [serial = 153] [outer = 0x0] [url = about:blank] 03:55:19 INFO - --DOMWINDOW == 34 (0x11ee8a400) [pid = 1707] [serial = 152] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:19 INFO - --DOMWINDOW == 33 (0x11ff8ac00) [pid = 1707] [serial = 161] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:19 INFO - --DOMWINDOW == 32 (0x125481800) [pid = 1707] [serial = 162] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:19 INFO - --DOMWINDOW == 31 (0x121444400) [pid = 1707] [serial = 158] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:19 INFO - --DOMWINDOW == 30 (0x112f96000) [pid = 1707] [serial = 150] [outer = 0x0] [url = about:blank] 03:55:19 INFO - --DOMWINDOW == 29 (0x11480c800) [pid = 1707] [serial = 151] [outer = 0x0] [url = about:blank] 03:55:19 INFO - --DOMWINDOW == 28 (0x11f4e8000) [pid = 1707] [serial = 140] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:19 INFO - ++DOMWINDOW == 29 (0x120cf1000) [pid = 1707] [serial = 169] [outer = 0x11e7b7800] 03:55:19 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:19 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:19 INFO - ++DOCSHELL 0x112ee0800 == 11 [pid = 1707] [id = 68] 03:55:19 INFO - ++DOMWINDOW == 30 (0x11f0f5c00) [pid = 1707] [serial = 170] [outer = 0x0] 03:55:19 INFO - ++DOMWINDOW == 31 (0x11f4e3c00) [pid = 1707] [serial = 171] [outer = 0x11f0f5c00] 03:55:19 INFO - ++DOMWINDOW == 32 (0x114805c00) [pid = 1707] [serial = 172] [outer = 0x11f0f5c00] 03:55:19 INFO - ++DOCSHELL 0x1241b7000 == 12 [pid = 1707] [id = 69] 03:55:19 INFO - ++DOMWINDOW == 33 (0x120d23400) [pid = 1707] [serial = 173] [outer = 0x0] 03:55:19 INFO - ++DOMWINDOW == 34 (0x120d8b400) [pid = 1707] [serial = 174] [outer = 0x120d23400] 03:55:20 INFO - ++DOMWINDOW == 35 (0x122d10c00) [pid = 1707] [serial = 175] [outer = 0x11e7b7800] 03:55:20 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:20 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:20 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:20 INFO - ++DOCSHELL 0x1254da800 == 13 [pid = 1707] [id = 70] 03:55:20 INFO - ++DOMWINDOW == 36 (0x11f075000) [pid = 1707] [serial = 176] [outer = 0x0] 03:55:20 INFO - ++DOCSHELL 0x1254dd000 == 14 [pid = 1707] [id = 71] 03:55:20 INFO - ++DOMWINDOW == 37 (0x124a52400) [pid = 1707] [serial = 177] [outer = 0x0] 03:55:20 INFO - ++DOMWINDOW == 38 (0x124f4e800) [pid = 1707] [serial = 178] [outer = 0x11f075000] 03:55:20 INFO - ++DOMWINDOW == 39 (0x125110c00) [pid = 1707] [serial = 179] [outer = 0x124a52400] 03:55:22 INFO - --DOCSHELL 0x1241b7000 == 13 [pid = 1707] [id = 69] 03:55:22 INFO - --DOCSHELL 0x1254da800 == 12 [pid = 1707] [id = 70] 03:55:22 INFO - --DOCSHELL 0x1254dd000 == 11 [pid = 1707] [id = 71] 03:55:22 INFO - --DOMWINDOW == 38 (0x120d8f000) [pid = 1707] [serial = 154] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:22 INFO - --DOMWINDOW == 37 (0x124faf800) [pid = 1707] [serial = 160] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:22 INFO - --DOMWINDOW == 36 (0x120cef000) [pid = 1707] [serial = 142] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:22 INFO - --DOMWINDOW == 35 (0x121447c00) [pid = 1707] [serial = 159] [outer = 0x0] [url = about:blank] 03:55:22 INFO - --DOMWINDOW == 34 (0x125483c00) [pid = 1707] [serial = 163] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:22 INFO - --DOMWINDOW == 33 (0x1272b7400) [pid = 1707] [serial = 164] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:22 INFO - MEMORY STAT | vsize 3411MB | residentFast 398MB | heapAllocated 96MB 03:55:22 INFO - 24 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-highlight-01.js | took 4260ms 03:55:22 INFO - ++DOCSHELL 0x112b41000 == 12 [pid = 1707] [id = 72] 03:55:22 INFO - ++DOMWINDOW == 34 (0x112c39400) [pid = 1707] [serial = 180] [outer = 0x0] 03:55:22 INFO - ++DOMWINDOW == 35 (0x113f4c000) [pid = 1707] [serial = 181] [outer = 0x112c39400] 03:55:22 INFO - 25 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-highlight-02.js 03:55:22 INFO - ++DOCSHELL 0x1202e2000 == 13 [pid = 1707] [id = 73] 03:55:22 INFO - ++DOMWINDOW == 36 (0x11e8ec000) [pid = 1707] [serial = 182] [outer = 0x0] 03:55:23 INFO - ++DOMWINDOW == 37 (0x11ebc9c00) [pid = 1707] [serial = 183] [outer = 0x11e8ec000] 03:55:23 INFO - --DOCSHELL 0x114843800 == 12 [pid = 1707] [id = 67] 03:55:23 INFO - --DOCSHELL 0x1120a3800 == 11 [pid = 1707] [id = 66] 03:55:23 INFO - --DOCSHELL 0x112ee0800 == 10 [pid = 1707] [id = 68] 03:55:23 INFO - --DOMWINDOW == 36 (0x11f4e3c00) [pid = 1707] [serial = 171] [outer = 0x0] [url = about:blank] 03:55:23 INFO - --DOMWINDOW == 35 (0x11ebc1400) [pid = 1707] [serial = 168] [outer = 0x0] [url = about:blank] 03:55:23 INFO - --DOMWINDOW == 34 (0x11e7b7800) [pid = 1707] [serial = 167] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:23 INFO - --DOMWINDOW == 33 (0x120cf1000) [pid = 1707] [serial = 169] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:23 INFO - --DOMWINDOW == 32 (0x122d10c00) [pid = 1707] [serial = 175] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:23 INFO - --DOMWINDOW == 31 (0x1137aac00) [pid = 1707] [serial = 165] [outer = 0x0] [url = about:blank] 03:55:23 INFO - --DOMWINDOW == 30 (0x113ffc000) [pid = 1707] [serial = 166] [outer = 0x0] [url = about:blank] 03:55:23 INFO - --DOMWINDOW == 29 (0x11351f000) [pid = 1707] [serial = 155] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:23 INFO - --DOMWINDOW == 28 (0x11f075000) [pid = 1707] [serial = 176] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:23 INFO - --DOMWINDOW == 27 (0x124a52400) [pid = 1707] [serial = 177] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:23 INFO - --DOMWINDOW == 26 (0x120d23400) [pid = 1707] [serial = 173] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:23 INFO - ++DOMWINDOW == 27 (0x120cec400) [pid = 1707] [serial = 184] [outer = 0x11e8ec000] 03:55:23 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:23 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:23 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:24 INFO - ++DOCSHELL 0x113710000 == 11 [pid = 1707] [id = 74] 03:55:24 INFO - ++DOMWINDOW == 28 (0x11ee7fc00) [pid = 1707] [serial = 185] [outer = 0x0] 03:55:24 INFO - ++DOMWINDOW == 29 (0x11ee83000) [pid = 1707] [serial = 186] [outer = 0x11ee7fc00] 03:55:24 INFO - ++DOMWINDOW == 30 (0x113f55400) [pid = 1707] [serial = 187] [outer = 0x11ee7fc00] 03:55:24 INFO - ++DOCSHELL 0x12405f800 == 12 [pid = 1707] [id = 75] 03:55:24 INFO - ++DOMWINDOW == 31 (0x120212800) [pid = 1707] [serial = 188] [outer = 0x0] 03:55:24 INFO - ++DOMWINDOW == 32 (0x12021a400) [pid = 1707] [serial = 189] [outer = 0x120212800] 03:55:24 INFO - ++DOMWINDOW == 33 (0x121208c00) [pid = 1707] [serial = 190] [outer = 0x11e8ec000] 03:55:24 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:24 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:24 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:24 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:25 INFO - ++DOCSHELL 0x124678000 == 13 [pid = 1707] [id = 76] 03:55:25 INFO - ++DOMWINDOW == 34 (0x124312800) [pid = 1707] [serial = 191] [outer = 0x0] 03:55:25 INFO - ++DOCSHELL 0x124679800 == 14 [pid = 1707] [id = 77] 03:55:25 INFO - ++DOMWINDOW == 35 (0x124577000) [pid = 1707] [serial = 192] [outer = 0x0] 03:55:25 INFO - ++DOMWINDOW == 36 (0x12457e400) [pid = 1707] [serial = 193] [outer = 0x124312800] 03:55:25 INFO - ++DOMWINDOW == 37 (0x124a4e800) [pid = 1707] [serial = 194] [outer = 0x124577000] 03:55:26 INFO - --DOCSHELL 0x12405f800 == 13 [pid = 1707] [id = 75] 03:55:26 INFO - --DOCSHELL 0x124678000 == 12 [pid = 1707] [id = 76] 03:55:26 INFO - --DOCSHELL 0x124679800 == 11 [pid = 1707] [id = 77] 03:55:26 INFO - --DOMWINDOW == 36 (0x120d8b400) [pid = 1707] [serial = 174] [outer = 0x0] [url = about:blank] 03:55:26 INFO - --DOMWINDOW == 35 (0x124f4e800) [pid = 1707] [serial = 178] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:26 INFO - --DOMWINDOW == 34 (0x125110c00) [pid = 1707] [serial = 179] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:26 INFO - --DOMWINDOW == 33 (0x12015d000) [pid = 1707] [serial = 157] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:26 INFO - MEMORY STAT | vsize 3406MB | residentFast 398MB | heapAllocated 94MB 03:55:26 INFO - 26 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-highlight-02.js | took 3774ms 03:55:26 INFO - ++DOCSHELL 0x11468e800 == 12 [pid = 1707] [id = 78] 03:55:26 INFO - ++DOMWINDOW == 34 (0x114699400) [pid = 1707] [serial = 195] [outer = 0x0] 03:55:26 INFO - ++DOMWINDOW == 35 (0x114d3b800) [pid = 1707] [serial = 196] [outer = 0x114699400] 03:55:26 INFO - 27 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-list.js 03:55:26 INFO - ++DOCSHELL 0x114828000 == 13 [pid = 1707] [id = 79] 03:55:26 INFO - ++DOMWINDOW == 36 (0x11e8e9800) [pid = 1707] [serial = 197] [outer = 0x0] 03:55:26 INFO - ++DOMWINDOW == 37 (0x11ed4f800) [pid = 1707] [serial = 198] [outer = 0x11e8e9800] 03:55:27 INFO - --DOCSHELL 0x112b41000 == 12 [pid = 1707] [id = 72] 03:55:27 INFO - --DOCSHELL 0x1202e2000 == 11 [pid = 1707] [id = 73] 03:55:27 INFO - --DOCSHELL 0x113710000 == 10 [pid = 1707] [id = 74] 03:55:27 INFO - --DOMWINDOW == 36 (0x11ee83000) [pid = 1707] [serial = 186] [outer = 0x0] [url = about:blank] 03:55:27 INFO - --DOMWINDOW == 35 (0x11ebc9c00) [pid = 1707] [serial = 183] [outer = 0x0] [url = about:blank] 03:55:27 INFO - --DOMWINDOW == 34 (0x11e8ec000) [pid = 1707] [serial = 182] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 03:55:27 INFO - --DOMWINDOW == 33 (0x124312800) [pid = 1707] [serial = 191] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:27 INFO - --DOMWINDOW == 32 (0x124577000) [pid = 1707] [serial = 192] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:27 INFO - --DOMWINDOW == 31 (0x120212800) [pid = 1707] [serial = 188] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:27 INFO - --DOMWINDOW == 30 (0x112c39400) [pid = 1707] [serial = 180] [outer = 0x0] [url = about:blank] 03:55:27 INFO - --DOMWINDOW == 29 (0x113f4c000) [pid = 1707] [serial = 181] [outer = 0x0] [url = about:blank] 03:55:27 INFO - --DOMWINDOW == 28 (0x11f0f5c00) [pid = 1707] [serial = 170] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:27 INFO - ++DOMWINDOW == 29 (0x11ff8c000) [pid = 1707] [serial = 199] [outer = 0x11e8e9800] 03:55:27 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:27 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:27 INFO - ++DOCSHELL 0x11376f000 == 11 [pid = 1707] [id = 80] 03:55:27 INFO - ++DOMWINDOW == 30 (0x11f0f5c00) [pid = 1707] [serial = 200] [outer = 0x0] 03:55:27 INFO - ++DOMWINDOW == 31 (0x11f4e2c00) [pid = 1707] [serial = 201] [outer = 0x11f0f5c00] 03:55:27 INFO - ++DOMWINDOW == 32 (0x11f4eb800) [pid = 1707] [serial = 202] [outer = 0x11f0f5c00] 03:55:28 INFO - ++DOCSHELL 0x124425800 == 12 [pid = 1707] [id = 81] 03:55:28 INFO - ++DOMWINDOW == 33 (0x120d22c00) [pid = 1707] [serial = 203] [outer = 0x0] 03:55:28 INFO - ++DOMWINDOW == 34 (0x120d2a000) [pid = 1707] [serial = 204] [outer = 0x120d22c00] 03:55:28 INFO - ++DOMWINDOW == 35 (0x124a52c00) [pid = 1707] [serial = 205] [outer = 0x11e8e9800] 03:55:28 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:28 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:28 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:29 INFO - ++DOCSHELL 0x127bb1800 == 13 [pid = 1707] [id = 82] 03:55:29 INFO - ++DOMWINDOW == 36 (0x1276cd400) [pid = 1707] [serial = 206] [outer = 0x0] 03:55:29 INFO - ++DOCSHELL 0x127bb4800 == 14 [pid = 1707] [id = 83] 03:55:29 INFO - ++DOMWINDOW == 37 (0x127a7f000) [pid = 1707] [serial = 207] [outer = 0x0] 03:55:29 INFO - ++DOMWINDOW == 38 (0x127bc8c00) [pid = 1707] [serial = 208] [outer = 0x1276cd400] 03:55:29 INFO - ++DOMWINDOW == 39 (0x127cd5400) [pid = 1707] [serial = 209] [outer = 0x127a7f000] 03:55:30 INFO - --DOCSHELL 0x124425800 == 13 [pid = 1707] [id = 81] 03:55:30 INFO - --DOCSHELL 0x127bb1800 == 12 [pid = 1707] [id = 82] 03:55:30 INFO - --DOCSHELL 0x127bb4800 == 11 [pid = 1707] [id = 83] 03:55:30 INFO - --DOMWINDOW == 38 (0x124a4e800) [pid = 1707] [serial = 194] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:30 INFO - --DOMWINDOW == 37 (0x12457e400) [pid = 1707] [serial = 193] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:30 INFO - --DOMWINDOW == 36 (0x12021a400) [pid = 1707] [serial = 189] [outer = 0x0] [url = about:blank] 03:55:30 INFO - --DOMWINDOW == 35 (0x114805c00) [pid = 1707] [serial = 172] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:30 INFO - --DOMWINDOW == 34 (0x120cec400) [pid = 1707] [serial = 184] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 03:55:30 INFO - --DOMWINDOW == 33 (0x121208c00) [pid = 1707] [serial = 190] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 03:55:30 INFO - MEMORY STAT | vsize 3411MB | residentFast 398MB | heapAllocated 96MB 03:55:30 INFO - 28 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-list.js | took 3865ms 03:55:30 INFO - ++DOCSHELL 0x113727800 == 12 [pid = 1707] [id = 84] 03:55:30 INFO - ++DOMWINDOW == 34 (0x113527c00) [pid = 1707] [serial = 210] [outer = 0x0] 03:55:30 INFO - ++DOMWINDOW == 35 (0x114805c00) [pid = 1707] [serial = 211] [outer = 0x113527c00] 03:55:30 INFO - 29 INFO TEST-START | devtools/client/shadereditor/test/browser_se_shaders-edit-01.js 03:55:30 INFO - ++DOCSHELL 0x11ffab800 == 13 [pid = 1707] [id = 85] 03:55:30 INFO - ++DOMWINDOW == 36 (0x11e8ed000) [pid = 1707] [serial = 212] [outer = 0x0] 03:55:30 INFO - ++DOMWINDOW == 37 (0x11ebc9c00) [pid = 1707] [serial = 213] [outer = 0x11e8ed000] 03:55:31 INFO - --DOCSHELL 0x114828000 == 12 [pid = 1707] [id = 79] 03:55:31 INFO - --DOCSHELL 0x11468e800 == 11 [pid = 1707] [id = 78] 03:55:31 INFO - --DOCSHELL 0x11376f000 == 10 [pid = 1707] [id = 80] 03:55:31 INFO - --DOMWINDOW == 36 (0x127a7f000) [pid = 1707] [serial = 207] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:31 INFO - --DOMWINDOW == 35 (0x1276cd400) [pid = 1707] [serial = 206] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:31 INFO - --DOMWINDOW == 34 (0x120d22c00) [pid = 1707] [serial = 203] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:31 INFO - --DOMWINDOW == 33 (0x114699400) [pid = 1707] [serial = 195] [outer = 0x0] [url = about:blank] 03:55:31 INFO - --DOMWINDOW == 32 (0x114d3b800) [pid = 1707] [serial = 196] [outer = 0x0] [url = about:blank] 03:55:31 INFO - --DOMWINDOW == 31 (0x11f4e2c00) [pid = 1707] [serial = 201] [outer = 0x0] [url = about:blank] 03:55:31 INFO - --DOMWINDOW == 30 (0x11ed4f800) [pid = 1707] [serial = 198] [outer = 0x0] [url = about:blank] 03:55:31 INFO - --DOMWINDOW == 29 (0x11e8e9800) [pid = 1707] [serial = 197] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:31 INFO - --DOMWINDOW == 28 (0x11ee7fc00) [pid = 1707] [serial = 185] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:31 INFO - ++DOMWINDOW == 29 (0x120d90400) [pid = 1707] [serial = 214] [outer = 0x11e8ed000] 03:55:31 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:31 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:31 INFO - ++DOCSHELL 0x113761800 == 11 [pid = 1707] [id = 86] 03:55:31 INFO - ++DOMWINDOW == 30 (0x11f0f2800) [pid = 1707] [serial = 215] [outer = 0x0] 03:55:31 INFO - ++DOMWINDOW == 31 (0x11f0f6c00) [pid = 1707] [serial = 216] [outer = 0x11f0f2800] 03:55:31 INFO - ++DOMWINDOW == 32 (0x11f4e1800) [pid = 1707] [serial = 217] [outer = 0x11f0f2800] 03:55:32 INFO - ++DOCSHELL 0x1241bc800 == 12 [pid = 1707] [id = 87] 03:55:32 INFO - ++DOMWINDOW == 33 (0x120e61000) [pid = 1707] [serial = 218] [outer = 0x0] 03:55:32 INFO - ++DOMWINDOW == 34 (0x120e65400) [pid = 1707] [serial = 219] [outer = 0x120e61000] 03:55:32 INFO - ++DOMWINDOW == 35 (0x12547f800) [pid = 1707] [serial = 220] [outer = 0x11e8ed000] 03:55:32 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:32 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:32 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:33 INFO - ++DOCSHELL 0x129360800 == 13 [pid = 1707] [id = 88] 03:55:33 INFO - ++DOMWINDOW == 36 (0x11f523800) [pid = 1707] [serial = 221] [outer = 0x0] 03:55:33 INFO - ++DOCSHELL 0x1296c4000 == 14 [pid = 1707] [id = 89] 03:55:33 INFO - ++DOMWINDOW == 37 (0x124a54800) [pid = 1707] [serial = 222] [outer = 0x0] 03:55:33 INFO - ++DOMWINDOW == 38 (0x124f56800) [pid = 1707] [serial = 223] [outer = 0x11f523800] 03:55:33 INFO - ++DOMWINDOW == 39 (0x12745c400) [pid = 1707] [serial = 224] [outer = 0x124a54800] 03:55:35 INFO - --DOCSHELL 0x1241bc800 == 13 [pid = 1707] [id = 87] 03:55:35 INFO - --DOCSHELL 0x129360800 == 12 [pid = 1707] [id = 88] 03:55:35 INFO - --DOCSHELL 0x1296c4000 == 11 [pid = 1707] [id = 89] 03:55:35 INFO - --DOMWINDOW == 38 (0x127cd5400) [pid = 1707] [serial = 209] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:35 INFO - --DOMWINDOW == 37 (0x127bc8c00) [pid = 1707] [serial = 208] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:35 INFO - --DOMWINDOW == 36 (0x120d2a000) [pid = 1707] [serial = 204] [outer = 0x0] [url = about:blank] 03:55:35 INFO - --DOMWINDOW == 35 (0x113f55400) [pid = 1707] [serial = 187] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:35 INFO - --DOMWINDOW == 34 (0x11ff8c000) [pid = 1707] [serial = 199] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:35 INFO - --DOMWINDOW == 33 (0x124a52c00) [pid = 1707] [serial = 205] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:35 INFO - MEMORY STAT | vsize 3434MB | residentFast 401MB | heapAllocated 97MB 03:55:35 INFO - 30 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_shaders-edit-01.js | took 5086ms 03:55:35 INFO - ++DOCSHELL 0x112e61000 == 12 [pid = 1707] [id = 90] 03:55:35 INFO - ++DOMWINDOW == 34 (0x113f55400) [pid = 1707] [serial = 225] [outer = 0x0] 03:55:35 INFO - ++DOMWINDOW == 35 (0x114807800) [pid = 1707] [serial = 226] [outer = 0x113f55400] 03:55:36 INFO - 31 INFO TEST-START | devtools/client/shadereditor/test/browser_se_shaders-edit-02.js 03:55:36 INFO - ++DOCSHELL 0x113767000 == 13 [pid = 1707] [id = 91] 03:55:36 INFO - ++DOMWINDOW == 36 (0x11ed7f000) [pid = 1707] [serial = 227] [outer = 0x0] 03:55:36 INFO - ++DOMWINDOW == 37 (0x11ee1f800) [pid = 1707] [serial = 228] [outer = 0x11ed7f000] 03:55:36 INFO - --DOCSHELL 0x113727800 == 12 [pid = 1707] [id = 84] 03:55:36 INFO - --DOCSHELL 0x11ffab800 == 11 [pid = 1707] [id = 85] 03:55:36 INFO - --DOCSHELL 0x113761800 == 10 [pid = 1707] [id = 86] 03:55:37 INFO - --DOMWINDOW == 36 (0x11f0f5c00) [pid = 1707] [serial = 200] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:37 INFO - --DOMWINDOW == 35 (0x11f0f6c00) [pid = 1707] [serial = 216] [outer = 0x0] [url = about:blank] 03:55:37 INFO - --DOMWINDOW == 34 (0x11ebc9c00) [pid = 1707] [serial = 213] [outer = 0x0] [url = about:blank] 03:55:37 INFO - --DOMWINDOW == 33 (0x11e8ed000) [pid = 1707] [serial = 212] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:37 INFO - --DOMWINDOW == 32 (0x11f523800) [pid = 1707] [serial = 221] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:37 INFO - --DOMWINDOW == 31 (0x120e61000) [pid = 1707] [serial = 218] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:37 INFO - --DOMWINDOW == 30 (0x113527c00) [pid = 1707] [serial = 210] [outer = 0x0] [url = about:blank] 03:55:37 INFO - --DOMWINDOW == 29 (0x124a54800) [pid = 1707] [serial = 222] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:37 INFO - --DOMWINDOW == 28 (0x114805c00) [pid = 1707] [serial = 211] [outer = 0x0] [url = about:blank] 03:55:37 INFO - ++DOMWINDOW == 29 (0x120d8f400) [pid = 1707] [serial = 229] [outer = 0x11ed7f000] 03:55:37 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:37 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:37 INFO - ++DOCSHELL 0x122e19800 == 11 [pid = 1707] [id = 92] 03:55:37 INFO - ++DOMWINDOW == 30 (0x11f4e8c00) [pid = 1707] [serial = 230] [outer = 0x0] 03:55:37 INFO - ++DOMWINDOW == 31 (0x11f4ed000) [pid = 1707] [serial = 231] [outer = 0x11f4e8c00] 03:55:37 INFO - ++DOMWINDOW == 32 (0x114807000) [pid = 1707] [serial = 232] [outer = 0x11f4e8c00] 03:55:37 INFO - ++DOCSHELL 0x12441c800 == 12 [pid = 1707] [id = 93] 03:55:37 INFO - ++DOMWINDOW == 33 (0x120d92000) [pid = 1707] [serial = 233] [outer = 0x0] 03:55:37 INFO - ++DOMWINDOW == 34 (0x120d99000) [pid = 1707] [serial = 234] [outer = 0x120d92000] 03:55:38 INFO - ++DOMWINDOW == 35 (0x12499dc00) [pid = 1707] [serial = 235] [outer = 0x11ed7f000] 03:55:38 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:38 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:38 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:38 INFO - ++DOCSHELL 0x126074800 == 13 [pid = 1707] [id = 94] 03:55:38 INFO - ++DOMWINDOW == 36 (0x11f075000) [pid = 1707] [serial = 236] [outer = 0x0] 03:55:38 INFO - ++DOCSHELL 0x126077800 == 14 [pid = 1707] [id = 95] 03:55:38 INFO - ++DOMWINDOW == 37 (0x11f62dc00) [pid = 1707] [serial = 237] [outer = 0x0] 03:55:38 INFO - ++DOMWINDOW == 38 (0x11ff87400) [pid = 1707] [serial = 238] [outer = 0x11f075000] 03:55:38 INFO - ++DOMWINDOW == 39 (0x124a54800) [pid = 1707] [serial = 239] [outer = 0x11f62dc00] 03:55:39 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 03:55:39 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:55:39 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:55:40 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have an compiled fragment shader attached. 03:55:40 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:55:40 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:55:42 INFO - --DOCSHELL 0x113767000 == 13 [pid = 1707] [id = 91] 03:55:42 INFO - --DOCSHELL 0x122e19800 == 12 [pid = 1707] [id = 92] 03:55:42 INFO - --DOCSHELL 0x12441c800 == 11 [pid = 1707] [id = 93] 03:55:42 INFO - --DOCSHELL 0x126074800 == 10 [pid = 1707] [id = 94] 03:55:42 INFO - --DOCSHELL 0x126077800 == 9 [pid = 1707] [id = 95] 03:55:42 INFO - --DOMWINDOW == 38 (0x11f4eb800) [pid = 1707] [serial = 202] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:42 INFO - --DOMWINDOW == 37 (0x120e65400) [pid = 1707] [serial = 219] [outer = 0x0] [url = about:blank] 03:55:42 INFO - --DOMWINDOW == 36 (0x124f56800) [pid = 1707] [serial = 223] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:42 INFO - --DOMWINDOW == 35 (0x12745c400) [pid = 1707] [serial = 224] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:42 INFO - --DOMWINDOW == 34 (0x120d90400) [pid = 1707] [serial = 214] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:42 INFO - --DOMWINDOW == 33 (0x12547f800) [pid = 1707] [serial = 220] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:42 INFO - MEMORY STAT | vsize 3437MB | residentFast 403MB | heapAllocated 94MB 03:55:42 INFO - 32 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_shaders-edit-02.js | took 6045ms 03:55:42 INFO - ++DOCSHELL 0x1120a3800 == 10 [pid = 1707] [id = 96] 03:55:42 INFO - ++DOMWINDOW == 34 (0x1137af000) [pid = 1707] [serial = 240] [outer = 0x0] 03:55:42 INFO - ++DOMWINDOW == 35 (0x11480c800) [pid = 1707] [serial = 241] [outer = 0x1137af000] 03:55:42 INFO - 33 INFO TEST-START | devtools/client/shadereditor/test/browser_se_shaders-edit-03.js 03:55:42 INFO - ++DOCSHELL 0x120be3000 == 11 [pid = 1707] [id = 97] 03:55:42 INFO - ++DOMWINDOW == 36 (0x11e8f2000) [pid = 1707] [serial = 242] [outer = 0x0] 03:55:42 INFO - ++DOMWINDOW == 37 (0x11ed52000) [pid = 1707] [serial = 243] [outer = 0x11e8f2000] 03:55:42 INFO - --DOCSHELL 0x112e61000 == 10 [pid = 1707] [id = 90] 03:55:43 INFO - --DOMWINDOW == 36 (0x11ed7f000) [pid = 1707] [serial = 227] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:43 INFO - --DOMWINDOW == 35 (0x113f55400) [pid = 1707] [serial = 225] [outer = 0x0] [url = about:blank] 03:55:43 INFO - --DOMWINDOW == 34 (0x114807800) [pid = 1707] [serial = 226] [outer = 0x0] [url = about:blank] 03:55:43 INFO - --DOMWINDOW == 33 (0x11ee1f800) [pid = 1707] [serial = 228] [outer = 0x0] [url = about:blank] 03:55:43 INFO - --DOMWINDOW == 32 (0x11f4ed000) [pid = 1707] [serial = 231] [outer = 0x0] [url = about:blank] 03:55:43 INFO - --DOMWINDOW == 31 (0x11f0f2800) [pid = 1707] [serial = 215] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:43 INFO - --DOMWINDOW == 30 (0x11f075000) [pid = 1707] [serial = 236] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:43 INFO - --DOMWINDOW == 29 (0x11f62dc00) [pid = 1707] [serial = 237] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:43 INFO - --DOMWINDOW == 28 (0x120d92000) [pid = 1707] [serial = 233] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:43 INFO - ++DOMWINDOW == 29 (0x120c89400) [pid = 1707] [serial = 244] [outer = 0x11e8f2000] 03:55:43 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:43 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:43 INFO - ++DOCSHELL 0x114d8e000 == 11 [pid = 1707] [id = 98] 03:55:43 INFO - ++DOMWINDOW == 30 (0x11f51b800) [pid = 1707] [serial = 245] [outer = 0x0] 03:55:43 INFO - ++DOMWINDOW == 31 (0x11f51d000) [pid = 1707] [serial = 246] [outer = 0x11f51b800] 03:55:43 INFO - ++DOMWINDOW == 32 (0x112084c00) [pid = 1707] [serial = 247] [outer = 0x11f51b800] 03:55:43 INFO - ++DOCSHELL 0x124425000 == 12 [pid = 1707] [id = 99] 03:55:43 INFO - ++DOMWINDOW == 33 (0x120e59800) [pid = 1707] [serial = 248] [outer = 0x0] 03:55:43 INFO - ++DOMWINDOW == 34 (0x120e5c000) [pid = 1707] [serial = 249] [outer = 0x120e59800] 03:55:44 INFO - ++DOMWINDOW == 35 (0x1221a6c00) [pid = 1707] [serial = 250] [outer = 0x11e8f2000] 03:55:44 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:44 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:44 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:44 INFO - ++DOCSHELL 0x129346000 == 13 [pid = 1707] [id = 100] 03:55:44 INFO - ++DOMWINDOW == 36 (0x120e5bc00) [pid = 1707] [serial = 251] [outer = 0x0] 03:55:44 INFO - ++DOCSHELL 0x129349800 == 14 [pid = 1707] [id = 101] 03:55:44 INFO - ++DOMWINDOW == 37 (0x124faf400) [pid = 1707] [serial = 252] [outer = 0x0] 03:55:44 INFO - ++DOMWINDOW == 38 (0x125480000) [pid = 1707] [serial = 253] [outer = 0x120e5bc00] 03:55:44 INFO - ++DOMWINDOW == 39 (0x125483000) [pid = 1707] [serial = 254] [outer = 0x124faf400] 03:55:47 INFO - --DOCSHELL 0x124425000 == 13 [pid = 1707] [id = 99] 03:55:47 INFO - --DOCSHELL 0x129346000 == 12 [pid = 1707] [id = 100] 03:55:47 INFO - --DOCSHELL 0x129349800 == 11 [pid = 1707] [id = 101] 03:55:47 INFO - --DOMWINDOW == 38 (0x11f4e1800) [pid = 1707] [serial = 217] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:47 INFO - --DOMWINDOW == 37 (0x120d99000) [pid = 1707] [serial = 234] [outer = 0x0] [url = about:blank] 03:55:47 INFO - --DOMWINDOW == 36 (0x11ff87400) [pid = 1707] [serial = 238] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:47 INFO - --DOMWINDOW == 35 (0x124a54800) [pid = 1707] [serial = 239] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:47 INFO - --DOMWINDOW == 34 (0x120d8f400) [pid = 1707] [serial = 229] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:47 INFO - --DOMWINDOW == 33 (0x12499dc00) [pid = 1707] [serial = 235] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:47 INFO - MEMORY STAT | vsize 3419MB | residentFast 406MB | heapAllocated 97MB 03:55:47 INFO - 34 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_shaders-edit-03.js | took 4967ms 03:55:47 INFO - ++DOCSHELL 0x112005800 == 12 [pid = 1707] [id = 102] 03:55:47 INFO - ++DOMWINDOW == 34 (0x112cdec00) [pid = 1707] [serial = 255] [outer = 0x0] 03:55:47 INFO - ++DOMWINDOW == 35 (0x113f55400) [pid = 1707] [serial = 256] [outer = 0x112cdec00] 03:55:47 INFO - 35 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-01.js 03:55:47 INFO - ++DOCSHELL 0x120276000 == 13 [pid = 1707] [id = 103] 03:55:47 INFO - ++DOMWINDOW == 36 (0x11e8f3000) [pid = 1707] [serial = 257] [outer = 0x0] 03:55:47 INFO - ++DOMWINDOW == 37 (0x11ee1f000) [pid = 1707] [serial = 258] [outer = 0x11e8f3000] 03:55:48 INFO - --DOCSHELL 0x1120a3800 == 12 [pid = 1707] [id = 96] 03:55:48 INFO - --DOCSHELL 0x120be3000 == 11 [pid = 1707] [id = 97] 03:55:48 INFO - --DOCSHELL 0x114d8e000 == 10 [pid = 1707] [id = 98] 03:55:48 INFO - --DOMWINDOW == 36 (0x11e8f2000) [pid = 1707] [serial = 242] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:48 INFO - --DOMWINDOW == 35 (0x124faf400) [pid = 1707] [serial = 252] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:48 INFO - --DOMWINDOW == 34 (0x11f51d000) [pid = 1707] [serial = 246] [outer = 0x0] [url = about:blank] 03:55:48 INFO - --DOMWINDOW == 33 (0x1137af000) [pid = 1707] [serial = 240] [outer = 0x0] [url = about:blank] 03:55:48 INFO - --DOMWINDOW == 32 (0x11ed52000) [pid = 1707] [serial = 243] [outer = 0x0] [url = about:blank] 03:55:48 INFO - --DOMWINDOW == 31 (0x11480c800) [pid = 1707] [serial = 241] [outer = 0x0] [url = about:blank] 03:55:48 INFO - --DOMWINDOW == 30 (0x120e59800) [pid = 1707] [serial = 248] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 03:55:48 INFO - --DOMWINDOW == 29 (0x11f4e8c00) [pid = 1707] [serial = 230] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:48 INFO - --DOMWINDOW == 28 (0x120e5bc00) [pid = 1707] [serial = 251] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:48 INFO - ++DOMWINDOW == 29 (0x120c8b000) [pid = 1707] [serial = 259] [outer = 0x11e8f3000] 03:55:48 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:48 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:49 INFO - --DOMWINDOW == 28 (0x114807000) [pid = 1707] [serial = 232] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:49 INFO - --DOMWINDOW == 27 (0x1221a6c00) [pid = 1707] [serial = 250] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:49 INFO - --DOMWINDOW == 26 (0x120c89400) [pid = 1707] [serial = 244] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:55:49 INFO - --DOMWINDOW == 25 (0x125480000) [pid = 1707] [serial = 253] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:49 INFO - --DOMWINDOW == 24 (0x120e5c000) [pid = 1707] [serial = 249] [outer = 0x0] [url = about:blank] 03:55:49 INFO - --DOMWINDOW == 23 (0x125483000) [pid = 1707] [serial = 254] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:55:49 INFO - MEMORY STAT | vsize 3418MB | residentFast 401MB | heapAllocated 89MB 03:55:49 INFO - 36 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-01.js | took 1684ms 03:55:49 INFO - ++DOCSHELL 0x100471000 == 11 [pid = 1707] [id = 104] 03:55:49 INFO - ++DOMWINDOW == 24 (0x112c39400) [pid = 1707] [serial = 260] [outer = 0x0] 03:55:49 INFO - ++DOMWINDOW == 25 (0x113f4c000) [pid = 1707] [serial = 261] [outer = 0x112c39400] 03:55:49 INFO - 37 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-02.js 03:55:49 INFO - ++DOCSHELL 0x120ca9800 == 12 [pid = 1707] [id = 105] 03:55:49 INFO - ++DOMWINDOW == 26 (0x11e7be000) [pid = 1707] [serial = 262] [outer = 0x0] 03:55:49 INFO - ++DOMWINDOW == 27 (0x11e8f2000) [pid = 1707] [serial = 263] [outer = 0x11e7be000] 03:55:49 INFO - ++DOMWINDOW == 28 (0x1225e7400) [pid = 1707] [serial = 264] [outer = 0x11e7be000] 03:55:49 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:49 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:49 INFO - ++DOMWINDOW == 29 (0x120cec400) [pid = 1707] [serial = 265] [outer = 0x11e7be000] 03:55:49 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:49 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:49 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:50 INFO - --DOCSHELL 0x112005800 == 11 [pid = 1707] [id = 102] 03:55:50 INFO - --DOCSHELL 0x120276000 == 10 [pid = 1707] [id = 103] 03:55:50 INFO - MEMORY STAT | vsize 3451MB | residentFast 403MB | heapAllocated 92MB 03:55:50 INFO - 38 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-02.js | took 1230ms 03:55:50 INFO - ++DOCSHELL 0x113767800 == 11 [pid = 1707] [id = 106] 03:55:50 INFO - ++DOMWINDOW == 30 (0x113ff7000) [pid = 1707] [serial = 266] [outer = 0x0] 03:55:50 INFO - ++DOMWINDOW == 31 (0x114d2e400) [pid = 1707] [serial = 267] [outer = 0x113ff7000] 03:55:50 INFO - 39 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-03.js 03:55:50 INFO - ++DOCSHELL 0x1241ab800 == 12 [pid = 1707] [id = 107] 03:55:50 INFO - ++DOMWINDOW == 32 (0x11f4ee400) [pid = 1707] [serial = 268] [outer = 0x0] 03:55:50 INFO - ++DOMWINDOW == 33 (0x11f625800) [pid = 1707] [serial = 269] [outer = 0x11f4ee400] 03:55:50 INFO - ++DOMWINDOW == 34 (0x122469000) [pid = 1707] [serial = 270] [outer = 0x11f4ee400] 03:55:50 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:50 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:51 INFO - ++DOMWINDOW == 35 (0x122025000) [pid = 1707] [serial = 271] [outer = 0x11f4ee400] 03:55:51 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:51 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:51 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:51 INFO - MEMORY STAT | vsize 3485MB | residentFast 405MB | heapAllocated 96MB 03:55:51 INFO - 40 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-03.js | took 1232ms 03:55:51 INFO - ++DOCSHELL 0x113716000 == 13 [pid = 1707] [id = 108] 03:55:51 INFO - ++DOMWINDOW == 36 (0x114d67000) [pid = 1707] [serial = 272] [outer = 0x0] 03:55:51 INFO - ++DOMWINDOW == 37 (0x11e8ec000) [pid = 1707] [serial = 273] [outer = 0x114d67000] 03:55:52 INFO - 41 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-04.js 03:55:52 INFO - ++DOCSHELL 0x125256800 == 14 [pid = 1707] [id = 109] 03:55:52 INFO - ++DOMWINDOW == 38 (0x121210000) [pid = 1707] [serial = 274] [outer = 0x0] 03:55:52 INFO - ++DOMWINDOW == 39 (0x121441800) [pid = 1707] [serial = 275] [outer = 0x121210000] 03:55:52 INFO - ++DOMWINDOW == 40 (0x1251c0400) [pid = 1707] [serial = 276] [outer = 0x121210000] 03:55:52 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:52 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:52 INFO - ++DOMWINDOW == 41 (0x1241d3c00) [pid = 1707] [serial = 277] [outer = 0x121210000] 03:55:52 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:52 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:52 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:53 INFO - MEMORY STAT | vsize 3518MB | residentFast 407MB | heapAllocated 100MB 03:55:53 INFO - 42 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-04.js | took 1564ms 03:55:53 INFO - ++DOCSHELL 0x122e03800 == 15 [pid = 1707] [id = 110] 03:55:53 INFO - ++DOMWINDOW == 42 (0x11f4ed000) [pid = 1707] [serial = 278] [outer = 0x0] 03:55:53 INFO - ++DOMWINDOW == 43 (0x120cef400) [pid = 1707] [serial = 279] [outer = 0x11f4ed000] 03:55:53 INFO - 43 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-05.js 03:55:53 INFO - ++DOCSHELL 0x127231800 == 16 [pid = 1707] [id = 111] 03:55:53 INFO - ++DOMWINDOW == 44 (0x1225e5000) [pid = 1707] [serial = 280] [outer = 0x0] 03:55:53 INFO - ++DOMWINDOW == 45 (0x122d05c00) [pid = 1707] [serial = 281] [outer = 0x1225e5000] 03:55:53 INFO - ++DOMWINDOW == 46 (0x127bc8c00) [pid = 1707] [serial = 282] [outer = 0x1225e5000] 03:55:53 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:53 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:54 INFO - ++DOMWINDOW == 47 (0x1278dcc00) [pid = 1707] [serial = 283] [outer = 0x1225e5000] 03:55:54 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:54 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:54 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:55 INFO - MEMORY STAT | vsize 3551MB | residentFast 408MB | heapAllocated 104MB 03:55:55 INFO - 44 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-05.js | took 1319ms 03:55:55 INFO - ++DOCSHELL 0x112bdd800 == 17 [pid = 1707] [id = 112] 03:55:55 INFO - ++DOMWINDOW == 48 (0x120c8c400) [pid = 1707] [serial = 284] [outer = 0x0] 03:55:55 INFO - ++DOMWINDOW == 49 (0x120d21400) [pid = 1707] [serial = 285] [outer = 0x120c8c400] 03:55:55 INFO - 45 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-06.js 03:55:55 INFO - ++DOCSHELL 0x12935a800 == 18 [pid = 1707] [id = 113] 03:55:55 INFO - ++DOMWINDOW == 50 (0x124f53800) [pid = 1707] [serial = 286] [outer = 0x0] 03:55:55 INFO - ++DOMWINDOW == 51 (0x1251c0000) [pid = 1707] [serial = 287] [outer = 0x124f53800] 03:55:55 INFO - ++DOMWINDOW == 52 (0x12a2b8400) [pid = 1707] [serial = 288] [outer = 0x124f53800] 03:55:55 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:55 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:55 INFO - ++DOMWINDOW == 53 (0x1293a5400) [pid = 1707] [serial = 289] [outer = 0x124f53800] 03:55:55 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:55 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:55 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:57 INFO - MEMORY STAT | vsize 3584MB | residentFast 409MB | heapAllocated 105MB 03:55:57 INFO - 46 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-06.js | took 1803ms 03:55:57 INFO - ++DOCSHELL 0x112b58800 == 19 [pid = 1707] [id = 114] 03:55:57 INFO - ++DOMWINDOW == 54 (0x114d31400) [pid = 1707] [serial = 290] [outer = 0x0] 03:55:57 INFO - ++DOMWINDOW == 55 (0x114d5fc00) [pid = 1707] [serial = 291] [outer = 0x114d31400] 03:55:57 INFO - --DOMWINDOW == 54 (0x112cdec00) [pid = 1707] [serial = 255] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 53 (0x1225e5000) [pid = 1707] [serial = 280] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 52 (0x11e7be000) [pid = 1707] [serial = 262] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 51 (0x121210000) [pid = 1707] [serial = 274] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 50 (0x114d67000) [pid = 1707] [serial = 272] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 49 (0x112c39400) [pid = 1707] [serial = 260] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 48 (0x11f4ee400) [pid = 1707] [serial = 268] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 47 (0x113ff7000) [pid = 1707] [serial = 266] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 46 (0x11e8f3000) [pid = 1707] [serial = 257] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 45 (0x112084c00) [pid = 1707] [serial = 247] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:57 INFO - --DOMWINDOW == 44 (0x113f55400) [pid = 1707] [serial = 256] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 43 (0x122d05c00) [pid = 1707] [serial = 281] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 42 (0x11e8f2000) [pid = 1707] [serial = 263] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 41 (0x121441800) [pid = 1707] [serial = 275] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 40 (0x11e8ec000) [pid = 1707] [serial = 273] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 39 (0x113f4c000) [pid = 1707] [serial = 261] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 38 (0x11f625800) [pid = 1707] [serial = 269] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 37 (0x114d2e400) [pid = 1707] [serial = 267] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 36 (0x11ee1f000) [pid = 1707] [serial = 258] [outer = 0x0] [url = about:blank] 03:55:57 INFO - --DOMWINDOW == 35 (0x11f51b800) [pid = 1707] [serial = 245] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:55:57 INFO - 47 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-07.js 03:55:57 INFO - ++DOCSHELL 0x120279800 == 20 [pid = 1707] [id = 115] 03:55:57 INFO - ++DOMWINDOW == 36 (0x11e7b2400) [pid = 1707] [serial = 292] [outer = 0x0] 03:55:57 INFO - ++DOMWINDOW == 37 (0x11ed4f800) [pid = 1707] [serial = 293] [outer = 0x11e7b2400] 03:55:57 INFO - --DOMWINDOW == 36 (0x1241d3c00) [pid = 1707] [serial = 277] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 35 (0x1278dcc00) [pid = 1707] [serial = 283] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 34 (0x1251c0400) [pid = 1707] [serial = 276] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 33 (0x120cec400) [pid = 1707] [serial = 265] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 32 (0x122025000) [pid = 1707] [serial = 271] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 31 (0x1225e7400) [pid = 1707] [serial = 264] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 30 (0x127bc8c00) [pid = 1707] [serial = 282] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 29 (0x122469000) [pid = 1707] [serial = 270] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - --DOMWINDOW == 28 (0x120c8b000) [pid = 1707] [serial = 259] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:55:57 INFO - ++DOMWINDOW == 29 (0x1241ce400) [pid = 1707] [serial = 294] [outer = 0x11e7b2400] 03:55:57 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:57 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:57 INFO - ++DOMWINDOW == 30 (0x120cef800) [pid = 1707] [serial = 295] [outer = 0x11e7b2400] 03:55:57 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:57 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:57 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:58 INFO - --DOCSHELL 0x1241ab800 == 19 [pid = 1707] [id = 107] 03:55:58 INFO - --DOCSHELL 0x113767800 == 18 [pid = 1707] [id = 106] 03:55:58 INFO - --DOCSHELL 0x12935a800 == 17 [pid = 1707] [id = 113] 03:55:58 INFO - --DOCSHELL 0x125256800 == 16 [pid = 1707] [id = 109] 03:55:58 INFO - --DOCSHELL 0x100471000 == 15 [pid = 1707] [id = 104] 03:55:58 INFO - --DOCSHELL 0x127231800 == 14 [pid = 1707] [id = 111] 03:55:58 INFO - --DOCSHELL 0x120ca9800 == 13 [pid = 1707] [id = 105] 03:55:58 INFO - --DOCSHELL 0x122e03800 == 12 [pid = 1707] [id = 110] 03:55:58 INFO - --DOCSHELL 0x112bdd800 == 11 [pid = 1707] [id = 112] 03:55:58 INFO - --DOCSHELL 0x113716000 == 10 [pid = 1707] [id = 108] 03:55:58 INFO - MEMORY STAT | vsize 3474MB | residentFast 406MB | heapAllocated 96MB 03:55:58 INFO - 48 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-07.js | took 1508ms 03:55:58 INFO - ++DOCSHELL 0x100471000 == 11 [pid = 1707] [id = 116] 03:55:58 INFO - ++DOMWINDOW == 31 (0x114d58c00) [pid = 1707] [serial = 296] [outer = 0x0] 03:55:58 INFO - ++DOMWINDOW == 32 (0x114f10800) [pid = 1707] [serial = 297] [outer = 0x114d58c00] 03:55:58 INFO - 49 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-08.js 03:55:58 INFO - ++DOCSHELL 0x12406b800 == 12 [pid = 1707] [id = 117] 03:55:58 INFO - ++DOMWINDOW == 33 (0x11f4e2c00) [pid = 1707] [serial = 298] [outer = 0x0] 03:55:58 INFO - ++DOMWINDOW == 34 (0x11f4eb800) [pid = 1707] [serial = 299] [outer = 0x11f4e2c00] 03:55:59 INFO - ++DOMWINDOW == 35 (0x125483400) [pid = 1707] [serial = 300] [outer = 0x11f4e2c00] 03:55:59 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:59 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:59 INFO - ++DOMWINDOW == 36 (0x12202d800) [pid = 1707] [serial = 301] [outer = 0x11f4e2c00] 03:55:59 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:55:59 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:55:59 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:00 INFO - MEMORY STAT | vsize 3508MB | residentFast 407MB | heapAllocated 100MB 03:56:00 INFO - 50 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-08.js | took 1363ms 03:56:00 INFO - ++DOCSHELL 0x112e62800 == 13 [pid = 1707] [id = 118] 03:56:00 INFO - ++DOMWINDOW == 37 (0x114806800) [pid = 1707] [serial = 302] [outer = 0x0] 03:56:00 INFO - ++DOMWINDOW == 38 (0x114dabc00) [pid = 1707] [serial = 303] [outer = 0x114806800] 03:56:00 INFO - 51 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-09.js 03:56:00 INFO - ++DOCSHELL 0x12026f800 == 14 [pid = 1707] [id = 119] 03:56:00 INFO - ++DOMWINDOW == 39 (0x11ee83800) [pid = 1707] [serial = 304] [outer = 0x0] 03:56:00 INFO - ++DOMWINDOW == 40 (0x11f4e5c00) [pid = 1707] [serial = 305] [outer = 0x11ee83800] 03:56:00 INFO - ++DOMWINDOW == 41 (0x125481800) [pid = 1707] [serial = 306] [outer = 0x11ee83800] 03:56:00 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:00 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:01 INFO - ++DOMWINDOW == 42 (0x12457e400) [pid = 1707] [serial = 307] [outer = 0x11ee83800] 03:56:01 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:01 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:01 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:01 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 03:56:01 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:56:01 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:56:01 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have an compiled fragment shader attached. 03:56:01 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:56:01 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 03:56:02 INFO - --DOCSHELL 0x112b58800 == 13 [pid = 1707] [id = 114] 03:56:02 INFO - --DOCSHELL 0x100471000 == 12 [pid = 1707] [id = 116] 03:56:02 INFO - --DOCSHELL 0x12406b800 == 11 [pid = 1707] [id = 117] 03:56:02 INFO - --DOCSHELL 0x120279800 == 10 [pid = 1707] [id = 115] 03:56:02 INFO - MEMORY STAT | vsize 3541MB | residentFast 408MB | heapAllocated 103MB 03:56:02 INFO - 52 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-09.js | took 2372ms 03:56:02 INFO - ++DOCSHELL 0x122883800 == 11 [pid = 1707] [id = 120] 03:56:02 INFO - ++DOMWINDOW == 43 (0x113ff5000) [pid = 1707] [serial = 308] [outer = 0x0] 03:56:02 INFO - ++DOMWINDOW == 44 (0x11e7b4400) [pid = 1707] [serial = 309] [outer = 0x113ff5000] 03:56:02 INFO - 53 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-10.js 03:56:03 INFO - ++DOCSHELL 0x127bbd800 == 12 [pid = 1707] [id = 121] 03:56:03 INFO - ++DOMWINDOW == 45 (0x120c93c00) [pid = 1707] [serial = 310] [outer = 0x0] 03:56:03 INFO - ++DOMWINDOW == 46 (0x120cf6c00) [pid = 1707] [serial = 311] [outer = 0x120c93c00] 03:56:03 INFO - ++DOMWINDOW == 47 (0x12bd75c00) [pid = 1707] [serial = 312] [outer = 0x120c93c00] 03:56:03 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:03 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:03 INFO - ++DOMWINDOW == 48 (0x1272b4800) [pid = 1707] [serial = 313] [outer = 0x120c93c00] 03:56:03 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:03 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:03 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:03 INFO - ++DOMWINDOW == 49 (0x1293a0400) [pid = 1707] [serial = 314] [outer = 0x120c93c00] 03:56:03 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:03 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:03 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:04 INFO - ++DOMWINDOW == 50 (0x12be2f400) [pid = 1707] [serial = 315] [outer = 0x120c93c00] 03:56:04 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:04 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:04 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:05 INFO - --DOCSHELL 0x112e62800 == 11 [pid = 1707] [id = 118] 03:56:05 INFO - --DOCSHELL 0x12026f800 == 10 [pid = 1707] [id = 119] 03:56:05 INFO - MEMORY STAT | vsize 3605MB | residentFast 409MB | heapAllocated 110MB 03:56:05 INFO - 54 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-10.js | took 2218ms 03:56:05 INFO - ++DOCSHELL 0x100471000 == 11 [pid = 1707] [id = 122] 03:56:05 INFO - ++DOMWINDOW == 51 (0x1148b7800) [pid = 1707] [serial = 316] [outer = 0x0] 03:56:05 INFO - ++DOMWINDOW == 52 (0x11ee24400) [pid = 1707] [serial = 317] [outer = 0x1148b7800] 03:56:05 INFO - 55 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-11.js 03:56:05 INFO - ++DOCSHELL 0x12bef8800 == 12 [pid = 1707] [id = 123] 03:56:05 INFO - ++DOMWINDOW == 53 (0x121445000) [pid = 1707] [serial = 318] [outer = 0x0] 03:56:05 INFO - ++DOMWINDOW == 54 (0x121529400) [pid = 1707] [serial = 319] [outer = 0x121445000] 03:56:05 INFO - ++DOMWINDOW == 55 (0x12bd73800) [pid = 1707] [serial = 320] [outer = 0x121445000] 03:56:05 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:05 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:05 INFO - ++DOMWINDOW == 56 (0x12939e800) [pid = 1707] [serial = 321] [outer = 0x121445000] 03:56:05 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:05 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:05 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:06 INFO - --DOCSHELL 0x127bbd800 == 11 [pid = 1707] [id = 121] 03:56:06 INFO - --DOCSHELL 0x122883800 == 10 [pid = 1707] [id = 120] 03:56:06 INFO - console.error: 03:56:06 INFO - Message: Error: Unexpected packet server1.conn26.webglActor6, {"from":"server1.conn26.webglActor6","error":"noSuchActor","message":"No such actor for ID: server1.conn26.webglActor6"} 03:56:06 INFO - Stack: 03:56:06 INFO - Front<.onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/protocol.js:1218:17 03:56:06 INFO - DebuggerClient.prototype.onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:930:7 03:56:06 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 03:56:06 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:56:06 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:56:06 INFO - Handler function LocalDebuggerTransport instance's this.other.hooks.onPacket threw an exception: Error: Unexpected packet server1.conn26.webglActor6, {"from":"server1.conn26.webglActor6","error":"noSuchActor","message":"No such actor for ID: server1.conn26.webglActor6"} 03:56:06 INFO - Stack: Front<.onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/protocol.js:1218:17 03:56:06 INFO - DebuggerClient.prototype.onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:930:7 03:56:06 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 03:56:06 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:56:06 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:56:06 INFO - Line: 1218, column: 17 03:56:06 INFO - --DOMWINDOW == 55 (0x124f53800) [pid = 1707] [serial = 286] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:06 INFO - --DOMWINDOW == 54 (0x114806800) [pid = 1707] [serial = 302] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 53 (0x11f4ed000) [pid = 1707] [serial = 278] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 52 (0x114d58c00) [pid = 1707] [serial = 296] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 51 (0x114d31400) [pid = 1707] [serial = 290] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 50 (0x11ee83800) [pid = 1707] [serial = 304] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:06 INFO - --DOMWINDOW == 49 (0x120c8c400) [pid = 1707] [serial = 284] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 48 (0x11f4e2c00) [pid = 1707] [serial = 298] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:06 INFO - --DOMWINDOW == 47 (0x11e7b2400) [pid = 1707] [serial = 292] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:06 INFO - --DOMWINDOW == 46 (0x1251c0000) [pid = 1707] [serial = 287] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 45 (0x114dabc00) [pid = 1707] [serial = 303] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 44 (0x120cef400) [pid = 1707] [serial = 279] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 43 (0x114f10800) [pid = 1707] [serial = 297] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 42 (0x114d5fc00) [pid = 1707] [serial = 291] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 41 (0x120d21400) [pid = 1707] [serial = 285] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 40 (0x11f4eb800) [pid = 1707] [serial = 299] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 39 (0x11ed4f800) [pid = 1707] [serial = 293] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 38 (0x120cf6c00) [pid = 1707] [serial = 311] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 37 (0x11f4e5c00) [pid = 1707] [serial = 305] [outer = 0x0] [url = about:blank] 03:56:06 INFO - --DOMWINDOW == 36 (0x120c93c00) [pid = 1707] [serial = 310] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:06 INFO - MEMORY STAT | vsize 3440MB | residentFast 409MB | heapAllocated 92MB 03:56:06 INFO - 56 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-11.js | took 1587ms 03:56:06 INFO - ++DOCSHELL 0x113710000 == 11 [pid = 1707] [id = 124] 03:56:06 INFO - ++DOMWINDOW == 37 (0x114d5a800) [pid = 1707] [serial = 322] [outer = 0x0] 03:56:06 INFO - ++DOMWINDOW == 38 (0x114f11800) [pid = 1707] [serial = 323] [outer = 0x114d5a800] 03:56:07 INFO - Handler function TabActor.prototype.onReload's delayed body threw an exception: TypeError: this.docShell is null 03:56:07 INFO - Stack: TabActor.prototype.webNavigation@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webbrowser.js:860:5 03:56:07 INFO - TabActor.prototype.onReload/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webbrowser.js:1389:7 03:56:07 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:56:07 INFO - Line: 860, column: 5 03:56:07 INFO - --DOMWINDOW == 37 (0x1293a5400) [pid = 1707] [serial = 289] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 36 (0x12a2b8400) [pid = 1707] [serial = 288] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 35 (0x125481800) [pid = 1707] [serial = 306] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 34 (0x12457e400) [pid = 1707] [serial = 307] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 33 (0x12bd75c00) [pid = 1707] [serial = 312] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 32 (0x1272b4800) [pid = 1707] [serial = 313] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 31 (0x1293a0400) [pid = 1707] [serial = 314] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 30 (0x125483400) [pid = 1707] [serial = 300] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 29 (0x12202d800) [pid = 1707] [serial = 301] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 28 (0x12be2f400) [pid = 1707] [serial = 315] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 27 (0x120cef800) [pid = 1707] [serial = 295] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - --DOMWINDOW == 26 (0x1241ce400) [pid = 1707] [serial = 294] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:07 INFO - 57 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-12.js 03:56:07 INFO - ++DOCSHELL 0x120ca1800 == 12 [pid = 1707] [id = 125] 03:56:07 INFO - ++DOMWINDOW == 27 (0x11ee28000) [pid = 1707] [serial = 324] [outer = 0x0] 03:56:07 INFO - ++DOMWINDOW == 28 (0x11ee89800) [pid = 1707] [serial = 325] [outer = 0x11ee28000] 03:56:07 INFO - ++DOMWINDOW == 29 (0x11f4eb800) [pid = 1707] [serial = 326] [outer = 0x11ee28000] 03:56:07 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:07 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:07 INFO - ++DOMWINDOW == 30 (0x120d8f400) [pid = 1707] [serial = 327] [outer = 0x11ee28000] 03:56:07 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:07 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:07 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:08 INFO - MEMORY STAT | vsize 3472MB | residentFast 412MB | heapAllocated 94MB 03:56:08 INFO - 58 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-12.js | took 1242ms 03:56:08 INFO - ++DOCSHELL 0x113728000 == 13 [pid = 1707] [id = 126] 03:56:08 INFO - ++DOMWINDOW == 31 (0x113ffbc00) [pid = 1707] [serial = 328] [outer = 0x0] 03:56:08 INFO - ++DOMWINDOW == 32 (0x1148bd400) [pid = 1707] [serial = 329] [outer = 0x113ffbc00] 03:56:08 INFO - 59 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-13.js 03:56:08 INFO - ++DOCSHELL 0x12406d000 == 14 [pid = 1707] [id = 127] 03:56:08 INFO - ++DOMWINDOW == 33 (0x11f625000) [pid = 1707] [serial = 330] [outer = 0x0] 03:56:08 INFO - ++DOMWINDOW == 34 (0x11ff88400) [pid = 1707] [serial = 331] [outer = 0x11f625000] 03:56:08 INFO - ++DOMWINDOW == 35 (0x120cef000) [pid = 1707] [serial = 332] [outer = 0x11f625000] 03:56:08 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:08 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:08 INFO - ++DOMWINDOW == 36 (0x1225e5000) [pid = 1707] [serial = 333] [outer = 0x11f625000] 03:56:08 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:08 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:08 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:10 INFO - MEMORY STAT | vsize 3486MB | residentFast 412MB | heapAllocated 99MB 03:56:10 INFO - 60 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-13.js | took 2321ms 03:56:10 INFO - ++DOCSHELL 0x113767000 == 15 [pid = 1707] [id = 128] 03:56:10 INFO - ++DOMWINDOW == 37 (0x113f4c000) [pid = 1707] [serial = 334] [outer = 0x0] 03:56:10 INFO - ++DOMWINDOW == 38 (0x114d5a400) [pid = 1707] [serial = 335] [outer = 0x113f4c000] 03:56:10 INFO - 61 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-14.js 03:56:10 INFO - ++DOCSHELL 0x12441d000 == 16 [pid = 1707] [id = 129] 03:56:10 INFO - ++DOMWINDOW == 39 (0x11f075000) [pid = 1707] [serial = 336] [outer = 0x0] 03:56:10 INFO - ++DOMWINDOW == 40 (0x11f4e5400) [pid = 1707] [serial = 337] [outer = 0x11f075000] 03:56:11 INFO - ++DOMWINDOW == 41 (0x125479800) [pid = 1707] [serial = 338] [outer = 0x11f075000] 03:56:11 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:11 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:11 INFO - ++DOMWINDOW == 42 (0x124f50800) [pid = 1707] [serial = 339] [outer = 0x11f075000] 03:56:11 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:11 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:11 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:12 INFO - --DOCSHELL 0x12406d000 == 15 [pid = 1707] [id = 127] 03:56:12 INFO - --DOCSHELL 0x113728000 == 14 [pid = 1707] [id = 126] 03:56:12 INFO - --DOCSHELL 0x113710000 == 13 [pid = 1707] [id = 124] 03:56:12 INFO - --DOCSHELL 0x120ca1800 == 12 [pid = 1707] [id = 125] 03:56:12 INFO - --DOCSHELL 0x12bef8800 == 11 [pid = 1707] [id = 123] 03:56:12 INFO - --DOCSHELL 0x100471000 == 10 [pid = 1707] [id = 122] 03:56:12 INFO - MEMORY STAT | vsize 3499MB | residentFast 411MB | heapAllocated 106MB 03:56:12 INFO - 62 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-14.js | took 1500ms 03:56:12 INFO - ++DOCSHELL 0x120be5000 == 11 [pid = 1707] [id = 130] 03:56:12 INFO - ++DOMWINDOW == 43 (0x11e8f2000) [pid = 1707] [serial = 340] [outer = 0x0] 03:56:12 INFO - ++DOMWINDOW == 44 (0x11f076000) [pid = 1707] [serial = 341] [outer = 0x11e8f2000] 03:56:12 INFO - 63 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-15.js 03:56:12 INFO - ++DOCSHELL 0x12935d800 == 12 [pid = 1707] [id = 131] 03:56:12 INFO - ++DOMWINDOW == 45 (0x112b8d800) [pid = 1707] [serial = 342] [outer = 0x0] 03:56:12 INFO - ++DOMWINDOW == 46 (0x120d91000) [pid = 1707] [serial = 343] [outer = 0x112b8d800] 03:56:12 INFO - ++DOMWINDOW == 47 (0x12a2b4c00) [pid = 1707] [serial = 344] [outer = 0x112b8d800] 03:56:12 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:12 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:13 INFO - ++DOMWINDOW == 48 (0x127cd6c00) [pid = 1707] [serial = 345] [outer = 0x112b8d800] 03:56:13 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:13 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:13 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:13 INFO - ++DOMWINDOW == 49 (0x12bd78000) [pid = 1707] [serial = 346] [outer = 0x112b8d800] 03:56:13 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:13 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:13 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:14 INFO - --DOMWINDOW == 48 (0x113ffbc00) [pid = 1707] [serial = 328] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 47 (0x11f075000) [pid = 1707] [serial = 336] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:14 INFO - --DOMWINDOW == 46 (0x11f625000) [pid = 1707] [serial = 330] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:14 INFO - --DOMWINDOW == 45 (0x114d5a800) [pid = 1707] [serial = 322] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 44 (0x1148b7800) [pid = 1707] [serial = 316] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 43 (0x11ee28000) [pid = 1707] [serial = 324] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_shader-order.html] 03:56:14 INFO - --DOMWINDOW == 42 (0x11e7b4400) [pid = 1707] [serial = 309] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 41 (0x121529400) [pid = 1707] [serial = 319] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 40 (0x1148bd400) [pid = 1707] [serial = 329] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 39 (0x11f4e5400) [pid = 1707] [serial = 337] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 38 (0x11ff88400) [pid = 1707] [serial = 331] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 37 (0x114f11800) [pid = 1707] [serial = 323] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 36 (0x11ee24400) [pid = 1707] [serial = 317] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 35 (0x11ee89800) [pid = 1707] [serial = 325] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 34 (0x113ff5000) [pid = 1707] [serial = 308] [outer = 0x0] [url = about:blank] 03:56:14 INFO - --DOMWINDOW == 33 (0x121445000) [pid = 1707] [serial = 318] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:14 INFO - --DOMWINDOW == 32 (0x11f4eb800) [pid = 1707] [serial = 326] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_shader-order.html] 03:56:16 INFO - --DOMWINDOW == 31 (0x12bd73800) [pid = 1707] [serial = 320] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:16 INFO - --DOMWINDOW == 30 (0x12939e800) [pid = 1707] [serial = 321] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:16 INFO - --DOMWINDOW == 29 (0x120cef000) [pid = 1707] [serial = 332] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:16 INFO - --DOMWINDOW == 28 (0x124f50800) [pid = 1707] [serial = 339] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:16 INFO - --DOMWINDOW == 27 (0x1225e5000) [pid = 1707] [serial = 333] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:16 INFO - --DOMWINDOW == 26 (0x125479800) [pid = 1707] [serial = 338] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:16 INFO - --DOMWINDOW == 25 (0x120d8f400) [pid = 1707] [serial = 327] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_shader-order.html] 03:56:16 INFO - MEMORY STAT | vsize 3449MB | residentFast 410MB | heapAllocated 95MB 03:56:16 INFO - 64 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-15.js | took 3778ms 03:56:16 INFO - ++DOCSHELL 0x113767800 == 13 [pid = 1707] [id = 132] 03:56:16 INFO - ++DOMWINDOW == 26 (0x114807000) [pid = 1707] [serial = 347] [outer = 0x0] 03:56:16 INFO - ++DOMWINDOW == 27 (0x114d5e400) [pid = 1707] [serial = 348] [outer = 0x114807000] 03:56:16 INFO - 65 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-16.js 03:56:16 INFO - ++DOCSHELL 0x120e0e000 == 14 [pid = 1707] [id = 133] 03:56:16 INFO - ++DOMWINDOW == 28 (0x11ed51c00) [pid = 1707] [serial = 349] [outer = 0x0] 03:56:16 INFO - ++DOMWINDOW == 29 (0x11ee1e400) [pid = 1707] [serial = 350] [outer = 0x11ed51c00] 03:56:16 INFO - ++DOMWINDOW == 30 (0x12151d800) [pid = 1707] [serial = 351] [outer = 0x11ed51c00] 03:56:16 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:16 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:16 INFO - ++DOMWINDOW == 31 (0x120d8fc00) [pid = 1707] [serial = 352] [outer = 0x11ed51c00] 03:56:16 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:16 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:16 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:17 INFO - ++DOMWINDOW == 32 (0x121443000) [pid = 1707] [serial = 353] [outer = 0x11ed51c00] 03:56:17 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:17 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:17 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:17 INFO - ++DOMWINDOW == 33 (0x120d23400) [pid = 1707] [serial = 354] [outer = 0x11ed51c00] 03:56:17 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:17 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:17 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:18 INFO - ++DOMWINDOW == 34 (0x1241d0000) [pid = 1707] [serial = 355] [outer = 0x11ed51c00] 03:56:18 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:18 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:18 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:19 INFO - --DOCSHELL 0x113767000 == 13 [pid = 1707] [id = 128] 03:56:19 INFO - --DOCSHELL 0x120be5000 == 12 [pid = 1707] [id = 130] 03:56:20 INFO - --DOCSHELL 0x12935d800 == 11 [pid = 1707] [id = 131] 03:56:20 INFO - --DOCSHELL 0x12441d000 == 10 [pid = 1707] [id = 129] 03:56:20 INFO - MEMORY STAT | vsize 3509MB | residentFast 411MB | heapAllocated 103MB 03:56:20 INFO - 66 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-16.js | took 4149ms 03:56:20 INFO - ++DOCSHELL 0x11343f000 == 11 [pid = 1707] [id = 134] 03:56:20 INFO - ++DOMWINDOW == 35 (0x113ff5000) [pid = 1707] [serial = 356] [outer = 0x0] 03:56:20 INFO - ++DOMWINDOW == 36 (0x11480c800) [pid = 1707] [serial = 357] [outer = 0x113ff5000] 03:56:20 INFO - 67 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-17.js 03:56:20 INFO - ++DOCSHELL 0x12027d000 == 12 [pid = 1707] [id = 135] 03:56:20 INFO - ++DOMWINDOW == 37 (0x11ed4cc00) [pid = 1707] [serial = 358] [outer = 0x0] 03:56:20 INFO - ++DOMWINDOW == 38 (0x11ed7b400) [pid = 1707] [serial = 359] [outer = 0x11ed4cc00] 03:56:20 INFO - ++DOMWINDOW == 39 (0x11ff8ac00) [pid = 1707] [serial = 360] [outer = 0x11ed4cc00] 03:56:20 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:20 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:20 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:21 INFO - ++DOMWINDOW == 40 (0x121211800) [pid = 1707] [serial = 361] [outer = 0x11ed4cc00] 03:56:21 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:21 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:21 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:21 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:22 INFO - --DOCSHELL 0x113767800 == 11 [pid = 1707] [id = 132] 03:56:22 INFO - --DOCSHELL 0x120e0e000 == 10 [pid = 1707] [id = 133] 03:56:22 INFO - MEMORY STAT | vsize 3517MB | residentFast 411MB | heapAllocated 109MB 03:56:22 INFO - 68 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-17.js | took 1626ms 03:56:22 INFO - ++DOCSHELL 0x11482e000 == 11 [pid = 1707] [id = 136] 03:56:22 INFO - ++DOMWINDOW == 41 (0x114f10800) [pid = 1707] [serial = 362] [outer = 0x0] 03:56:22 INFO - ++DOMWINDOW == 42 (0x11ed4f000) [pid = 1707] [serial = 363] [outer = 0x114f10800] 03:56:22 INFO - 69 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-18.js 03:56:22 INFO - ++DOCSHELL 0x12406e800 == 12 [pid = 1707] [id = 137] 03:56:22 INFO - ++DOMWINDOW == 43 (0x11f51c000) [pid = 1707] [serial = 364] [outer = 0x0] 03:56:22 INFO - ++DOMWINDOW == 44 (0x11f630400) [pid = 1707] [serial = 365] [outer = 0x11f51c000] 03:56:22 INFO - ++DOMWINDOW == 45 (0x1276cbc00) [pid = 1707] [serial = 366] [outer = 0x11f51c000] 03:56:22 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:22 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:23 INFO - ++DOMWINDOW == 46 (0x125119c00) [pid = 1707] [serial = 367] [outer = 0x11f51c000] 03:56:23 INFO - [1707] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:23 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:23 INFO - [1707] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 03:56:23 INFO - --DOMWINDOW == 45 (0x120d91000) [pid = 1707] [serial = 343] [outer = 0x0] [url = about:blank] 03:56:23 INFO - --DOMWINDOW == 44 (0x11ed4cc00) [pid = 1707] [serial = 358] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_overlapping-geometry.html] 03:56:23 INFO - --DOMWINDOW == 43 (0x11ed7b400) [pid = 1707] [serial = 359] [outer = 0x0] [url = about:blank] 03:56:23 INFO - --DOMWINDOW == 42 (0x11f076000) [pid = 1707] [serial = 341] [outer = 0x0] [url = about:blank] 03:56:23 INFO - --DOMWINDOW == 41 (0x11ee1e400) [pid = 1707] [serial = 350] [outer = 0x0] [url = about:blank] 03:56:23 INFO - --DOMWINDOW == 40 (0x113f4c000) [pid = 1707] [serial = 334] [outer = 0x0] [url = about:blank] 03:56:23 INFO - --DOMWINDOW == 39 (0x114807000) [pid = 1707] [serial = 347] [outer = 0x0] [url = about:blank] 03:56:23 INFO - --DOMWINDOW == 38 (0x112b8d800) [pid = 1707] [serial = 342] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:23 INFO - --DOMWINDOW == 37 (0x11ed51c00) [pid = 1707] [serial = 349] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:23 INFO - --DOMWINDOW == 36 (0x11e8f2000) [pid = 1707] [serial = 340] [outer = 0x0] [url = about:blank] 03:56:23 INFO - --DOMWINDOW == 35 (0x114d5a400) [pid = 1707] [serial = 335] [outer = 0x0] [url = about:blank] 03:56:23 INFO - --DOMWINDOW == 34 (0x114d5e400) [pid = 1707] [serial = 348] [outer = 0x0] [url = about:blank] 03:56:24 INFO - MEMORY STAT | vsize 3423MB | residentFast 410MB | heapAllocated 93MB 03:56:24 INFO - 70 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-18.js | took 1494ms 03:56:24 INFO - ++DOCSHELL 0x1120a2000 == 13 [pid = 1707] [id = 138] 03:56:24 INFO - ++DOMWINDOW == 35 (0x114d32c00) [pid = 1707] [serial = 368] [outer = 0x0] 03:56:24 INFO - ++DOMWINDOW == 36 (0x114d5f000) [pid = 1707] [serial = 369] [outer = 0x114d32c00] 03:56:24 INFO - --DOMWINDOW == 35 (0x12a2b4c00) [pid = 1707] [serial = 344] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:24 INFO - --DOMWINDOW == 34 (0x127cd6c00) [pid = 1707] [serial = 345] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:24 INFO - --DOMWINDOW == 33 (0x120d8fc00) [pid = 1707] [serial = 352] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:24 INFO - --DOMWINDOW == 32 (0x11ff8ac00) [pid = 1707] [serial = 360] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_overlapping-geometry.html] 03:56:24 INFO - --DOMWINDOW == 31 (0x121211800) [pid = 1707] [serial = 361] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_overlapping-geometry.html] 03:56:24 INFO - --DOMWINDOW == 30 (0x121443000) [pid = 1707] [serial = 353] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:24 INFO - --DOMWINDOW == 29 (0x120d23400) [pid = 1707] [serial = 354] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:24 INFO - --DOMWINDOW == 28 (0x1241d0000) [pid = 1707] [serial = 355] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:24 INFO - --DOMWINDOW == 27 (0x12151d800) [pid = 1707] [serial = 351] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 03:56:24 INFO - --DOMWINDOW == 26 (0x12bd78000) [pid = 1707] [serial = 346] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:24 INFO - ++DOMWINDOW == 27 (0x112eb4c00) [pid = 1707] [serial = 370] [outer = 0x120e64000] 03:56:24 INFO - ++DOMWINDOW == 28 (0x11ebc2c00) [pid = 1707] [serial = 371] [outer = 0x120e64800] 03:56:24 INFO - --DOCSHELL 0x113196000 == 12 [pid = 1707] [id = 13] 03:56:24 INFO - ++DOMWINDOW == 29 (0x114810000) [pid = 1707] [serial = 372] [outer = 0x120e64000] 03:56:24 INFO - ++DOMWINDOW == 30 (0x11e7b1c00) [pid = 1707] [serial = 373] [outer = 0x120e64800] 03:56:25 INFO - --DOCSHELL 0x113721800 == 11 [pid = 1707] [id = 15] 03:56:25 INFO - --DOCSHELL 0x127234800 == 10 [pid = 1707] [id = 8] 03:56:25 INFO - --DOCSHELL 0x11343f000 == 9 [pid = 1707] [id = 134] 03:56:25 INFO - --DOCSHELL 0x12406e800 == 8 [pid = 1707] [id = 137] 03:56:25 INFO - --DOCSHELL 0x12027d000 == 7 [pid = 1707] [id = 135] 03:56:25 INFO - --DOCSHELL 0x11482e000 == 6 [pid = 1707] [id = 136] 03:56:25 INFO - --DOMWINDOW == 29 (0x11ebc2c00) [pid = 1707] [serial = 371] [outer = 0x120e64800] [url = about:blank] 03:56:25 INFO - --DOMWINDOW == 28 (0x124a50000) [pid = 1707] [serial = 10] [outer = 0x120e64800] [url = about:blank] 03:56:25 INFO - --DOMWINDOW == 27 (0x112eb4c00) [pid = 1707] [serial = 370] [outer = 0x120e64000] [url = about:blank] 03:56:25 INFO - --DOMWINDOW == 26 (0x124a4f800) [pid = 1707] [serial = 9] [outer = 0x120e64000] [url = about:blank] 03:56:26 INFO - --DOMWINDOW == 25 (0x12dcb5800) [pid = 1707] [serial = 21] [outer = 0x0] [url = about:newtab] 03:56:26 INFO - --DOMWINDOW == 24 (0x11480c800) [pid = 1707] [serial = 357] [outer = 0x0] [url = about:blank] 03:56:26 INFO - --DOMWINDOW == 23 (0x113ff5000) [pid = 1707] [serial = 356] [outer = 0x0] [url = about:blank] 03:56:26 INFO - --DOMWINDOW == 22 (0x11f51c000) [pid = 1707] [serial = 364] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:26 INFO - --DOMWINDOW == 21 (0x11f630400) [pid = 1707] [serial = 365] [outer = 0x0] [url = about:blank] 03:56:26 INFO - --DOMWINDOW == 20 (0x12a2b6000) [pid = 1707] [serial = 17] [outer = 0x0] [url = about:newtab] 03:56:26 INFO - --DOMWINDOW == 19 (0x112ec0400) [pid = 1707] [serial = 30] [outer = 0x0] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 03:56:26 INFO - --DOMWINDOW == 18 (0x114d66400) [pid = 1707] [serial = 37] [outer = 0x0] [url = about:blank] 03:56:26 INFO - --DOMWINDOW == 17 (0x112f98000) [pid = 1707] [serial = 36] [outer = 0x0] [url = about:blank] 03:56:26 INFO - --DOMWINDOW == 16 (0x113ff6400) [pid = 1707] [serial = 35] [outer = 0x0] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 03:56:26 INFO - --DOMWINDOW == 15 (0x114f10800) [pid = 1707] [serial = 362] [outer = 0x0] [url = about:blank] 03:56:26 INFO - --DOMWINDOW == 14 (0x11ed4f000) [pid = 1707] [serial = 363] [outer = 0x0] [url = about:blank] 03:56:27 INFO - --DOMWINDOW == 13 (0x1276cbc00) [pid = 1707] [serial = 366] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:27 INFO - --DOMWINDOW == 12 (0x125119c00) [pid = 1707] [serial = 367] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 03:56:29 INFO - Completed ShutdownLeaks collections in process 1707 03:56:29 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 208: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 03:56:30 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 03:56:30 INFO - --DOCSHELL 0x1278a7000 == 5 [pid = 1707] [id = 6] 03:56:30 INFO - --DOCSHELL 0x114fc8800 == 4 [pid = 1707] [id = 1] 03:56:30 INFO - --DOCSHELL 0x120e35800 == 3 [pid = 1707] [id = 3] 03:56:30 INFO - --DOCSHELL 0x120e3e000 == 2 [pid = 1707] [id = 4] 03:56:30 INFO - --DOCSHELL 0x1120a2000 == 1 [pid = 1707] [id = 138] 03:56:30 INFO - --DOCSHELL 0x11edf7800 == 0 [pid = 1707] [id = 2] 03:56:30 INFO - [1707] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:56:30 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 492: Error: forget() called twice 03:56:30 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 03:56:30 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 03:56:30 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 03:56:30 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 03:56:30 INFO - [1707] WARNING: nsAppShell::Exit() called redundantly: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsAppShell.mm, line 679 03:56:31 INFO - [1707] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 769 03:56:32 INFO - --DOMWINDOW == 11 (0x11e7b1c00) [pid = 1707] [serial = 373] [outer = 0x120e64800] [url = about:blank] 03:56:32 INFO - --DOMWINDOW == 10 (0x114810000) [pid = 1707] [serial = 372] [outer = 0x120e64000] [url = about:blank] 03:56:32 INFO - --DOMWINDOW == 9 (0x120e64800) [pid = 1707] [serial = 6] [outer = 0x0] [url = about:blank] 03:56:32 INFO - --DOMWINDOW == 8 (0x120e64000) [pid = 1707] [serial = 5] [outer = 0x0] [url = about:blank] 03:56:32 INFO - --DOMWINDOW == 7 (0x11ee7dc00) [pid = 1707] [serial = 4] [outer = 0x0] [url = about:blank] 03:56:32 INFO - --DOMWINDOW == 6 (0x1278dbc00) [pid = 1707] [serial = 14] [outer = 0x0] [url = about:blank] 03:56:32 INFO - --DOMWINDOW == 5 (0x114d5f000) [pid = 1707] [serial = 369] [outer = 0x0] [url = about:blank] 03:56:32 INFO - --DOMWINDOW == 4 (0x114d32c00) [pid = 1707] [serial = 368] [outer = 0x0] [url = about:blank] 03:56:32 INFO - --DOMWINDOW == 3 (0x1278da800) [pid = 1707] [serial = 13] [outer = 0x0] [url = chrome://mochikit/content/browser-harness.xul] 03:56:32 INFO - --DOMWINDOW == 2 (0x115369c00) [pid = 1707] [serial = 2] [outer = 0x0] [url = about:blank] 03:56:32 INFO - --DOMWINDOW == 1 (0x114f9d800) [pid = 1707] [serial = 1] [outer = 0x0] [url = chrome://browser/content/hiddenWindow.xul] 03:56:32 INFO - --DOMWINDOW == 0 (0x114db3c00) [pid = 1707] [serial = 3] [outer = 0x0] [url = chrome://browser/content/browser.xul] 03:56:33 INFO - [1707] WARNING: OOPDeinit() without successful OOPInit(): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/toolkit/crashreporter/nsExceptionHandler.cpp, line 2792 03:56:33 INFO - nsStringStats 03:56:33 INFO - => mAllocCount: 429102 03:56:33 INFO - => mReallocCount: 34241 03:56:33 INFO - => mFreeCount: 429102 03:56:33 INFO - => mShareCount: 508868 03:56:33 INFO - => mAdoptCount: 32486 03:56:33 INFO - => mAdoptFreeCount: 32486 03:56:33 INFO - => Process ID: 1707, Thread ID: 140735086404352 03:56:33 INFO - TEST-INFO | Main app process: exit 0 03:56:33 INFO - runtests.py | Application ran for: 0:02:05.790106 03:56:33 INFO - zombiecheck | Reading PID log: /var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/tmpsclxuCpidlog 03:56:33 INFO - Stopping web server 03:56:33 INFO - Stopping web socket server 03:56:33 INFO - Stopping ssltunnel 03:56:33 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 03:56:33 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 03:56:33 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 03:56:33 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 03:56:33 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 1707 03:56:33 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 03:56:33 INFO - | | Per-Inst Leaked| Total Rem| 03:56:33 INFO - 0 |TOTAL | 21 0|25330052 0| 03:56:33 INFO - nsTraceRefcnt::DumpStatistics: 1384 entries 03:56:33 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 03:56:33 INFO - runtests.py | Running tests: end. 03:56:33 INFO - 71 INFO checking window state 03:56:33 INFO - 72 INFO TEST-START | Shutdown 03:56:33 INFO - 73 INFO Browser Chrome Test Summary 03:56:33 INFO - 74 INFO Passed: 736 03:56:33 INFO - 75 INFO Failed: 0 03:56:33 INFO - 76 INFO Todo: 0 03:56:33 INFO - 77 INFO *** End BrowserChrome Test Results *** 03:56:33 INFO - dir: devtools/client/webconsole/test 03:56:33 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 03:56:33 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/NightlyDebug.app/Contents/Resources', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/tmpXYTZMi.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 03:56:33 INFO - runtests.py | Server pid: 1719 03:56:33 INFO - runtests.py | Websocket server pid: 1720 03:56:33 INFO - runtests.py | SSL tunnel pid: 1721 03:56:33 INFO - runtests.py | Running tests: start. 03:56:33 INFO - runtests.py | Application pid: 1722 03:56:33 INFO - TEST-INFO | started process Main app process 03:56:33 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/tmpXYTZMi.mozrunner/runtests_leaks.log 03:56:35 INFO - ++DOCSHELL 0x114dab000 == 1 [pid = 1722] [id = 1] 03:56:35 INFO - ++DOMWINDOW == 1 (0x114dc1400) [pid = 1722] [serial = 1] [outer = 0x0] 03:56:35 INFO - ++DOMWINDOW == 2 (0x11513ac00) [pid = 1722] [serial = 2] [outer = 0x114dc1400] 03:56:35 INFO - ++DOCSHELL 0x11eec4800 == 2 [pid = 1722] [id = 2] 03:56:35 INFO - ++DOMWINDOW == 3 (0x11eefcc00) [pid = 1722] [serial = 3] [outer = 0x0] 03:56:35 INFO - ++DOMWINDOW == 4 (0x11eefdc00) [pid = 1722] [serial = 4] [outer = 0x11eefcc00] 03:56:36 INFO - [1722] WARNING: Loaded script chrome://global/content/printUtils.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:56:36 INFO - [1722] WARNING: Loaded script chrome://global/content/viewZoomOverlay.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:56:36 INFO - [1722] WARNING: Loaded script chrome://browser/content/places/browserPlacesViews.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:56:36 INFO - [1722] WARNING: Loaded script chrome://browser/content/browser.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:56:36 INFO - [1722] WARNING: Loaded script chrome://browser/content/downloads/downloads.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:56:36 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:36 INFO - [1722] WARNING: Loaded script chrome://browser/content/downloads/indicator.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:56:36 INFO - [1722] WARNING: Loaded script chrome://browser/content/customizableui/panelUI.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:56:36 INFO - [1722] WARNING: Loaded script chrome://global/content/viewSourceUtils.js twice (bug 392650): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 03:56:37 INFO - ++DOCSHELL 0x12184f000 == 3 [pid = 1722] [id = 3] 03:56:37 INFO - ++DOMWINDOW == 5 (0x1215e5c00) [pid = 1722] [serial = 5] [outer = 0x0] 03:56:37 INFO - ++DOCSHELL 0x12188e000 == 4 [pid = 1722] [id = 4] 03:56:37 INFO - ++DOMWINDOW == 6 (0x1215e6400) [pid = 1722] [serial = 6] [outer = 0x0] 03:56:37 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 03:56:37 INFO - ++DOCSHELL 0x124689800 == 5 [pid = 1722] [id = 5] 03:56:37 INFO - ++DOMWINDOW == 7 (0x1215e5800) [pid = 1722] [serial = 7] [outer = 0x0] 03:56:37 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 03:56:37 INFO - ++DOMWINDOW == 8 (0x12477a800) [pid = 1722] [serial = 8] [outer = 0x1215e5800] 03:56:37 INFO - ++DOMWINDOW == 9 (0x124393000) [pid = 1722] [serial = 9] [outer = 0x1215e5c00] 03:56:37 INFO - ++DOMWINDOW == 10 (0x124393800) [pid = 1722] [serial = 10] [outer = 0x1215e6400] 03:56:37 INFO - ++DOMWINDOW == 11 (0x124395400) [pid = 1722] [serial = 11] [outer = 0x1215e5800] 03:56:38 INFO - ++DOMWINDOW == 12 (0x126486400) [pid = 1722] [serial = 12] [outer = 0x1215e5800] 03:56:38 INFO - ++DOCSHELL 0x12663e800 == 6 [pid = 1722] [id = 6] 03:56:38 INFO - ++DOMWINDOW == 13 (0x1266ed800) [pid = 1722] [serial = 13] [outer = 0x0] 03:56:38 INFO - ++DOMWINDOW == 14 (0x1266eec00) [pid = 1722] [serial = 14] [outer = 0x1266ed800] 03:56:39 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:56:39 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:56:39 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:56:39 INFO - ++DOCSHELL 0x11269f000 == 7 [pid = 1722] [id = 7] 03:56:39 INFO - ++DOMWINDOW == 15 (0x12c4dbc00) [pid = 1722] [serial = 15] [outer = 0x0] 03:56:39 INFO - ++DOMWINDOW == 16 (0x12c4ddc00) [pid = 1722] [serial = 16] [outer = 0x12c4dbc00] 03:56:39 INFO - ++DOCSHELL 0x12c251800 == 8 [pid = 1722] [id = 8] 03:56:39 INFO - ++DOMWINDOW == 17 (0x126488c00) [pid = 1722] [serial = 17] [outer = 0x0] 03:56:39 INFO - ++DOMWINDOW == 18 (0x12c4e6c00) [pid = 1722] [serial = 18] [outer = 0x126488c00] 03:56:39 INFO - 78 INFO TEST-START | devtools/client/webconsole/test/browser_bug1045902_console_csp_ignore_reflected_xss_message.js 03:56:39 INFO - ++DOCSHELL 0x114d95000 == 9 [pid = 1722] [id = 9] 03:56:39 INFO - ++DOMWINDOW == 19 (0x12a06f400) [pid = 1722] [serial = 19] [outer = 0x0] 03:56:39 INFO - ++DOMWINDOW == 20 (0x12c3a4c00) [pid = 1722] [serial = 20] [outer = 0x12a06f400] 03:56:39 INFO - ++DOMWINDOW == 21 (0x12c3a9000) [pid = 1722] [serial = 21] [outer = 0x126488c00] 03:56:40 INFO - ++DOCSHELL 0x12d98c800 == 10 [pid = 1722] [id = 10] 03:56:40 INFO - ++DOMWINDOW == 22 (0x11ee19400) [pid = 1722] [serial = 22] [outer = 0x0] 03:56:40 INFO - ++DOMWINDOW == 23 (0x12dd7ec00) [pid = 1722] [serial = 23] [outer = 0x11ee19400] 03:56:40 INFO - ++DOMWINDOW == 24 (0x12f268800) [pid = 1722] [serial = 24] [outer = 0x11ee19400] 03:56:41 INFO - ++DOCSHELL 0x12ee65000 == 11 [pid = 1722] [id = 11] 03:56:41 INFO - ++DOMWINDOW == 25 (0x12f2ca000) [pid = 1722] [serial = 25] [outer = 0x0] 03:56:41 INFO - ++DOMWINDOW == 26 (0x12f2cc400) [pid = 1722] [serial = 26] [outer = 0x12f2ca000] 03:56:42 INFO - [1722] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 03:56:42 INFO - ++DOMWINDOW == 27 (0x130114800) [pid = 1722] [serial = 27] [outer = 0x12a06f400] 03:56:42 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:42 INFO - [1722] WARNING: RasterImage::Init failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/image/ImageFactory.cpp, line 109 03:56:42 INFO - console.log: 03:56:42.248 GET http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html [HTTP/1.1 200 OK 14ms] 03:56:42 INFO - 03:56:42.285 Content Security Policy: Not supporting directive 'reflected-xss'. Directive and values will be ignored.1 03:56:42 INFO - [1722] WARNING: Image width or height is non-positive: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6316 03:56:43 INFO - --DOMWINDOW == 26 (0x12dd7ec00) [pid = 1722] [serial = 23] [outer = 0x0] [url = about:blank] 03:56:43 INFO - --DOMWINDOW == 25 (0x12c4e6c00) [pid = 1722] [serial = 18] [outer = 0x0] [url = about:blank] 03:56:43 INFO - --DOMWINDOW == 24 (0x124395400) [pid = 1722] [serial = 11] [outer = 0x0] [url = about:blank] 03:56:43 INFO - --DOMWINDOW == 23 (0x1215e5800) [pid = 1722] [serial = 7] [outer = 0x0] [url = about:blank] 03:56:43 INFO - --DOMWINDOW == 22 (0x12477a800) [pid = 1722] [serial = 8] [outer = 0x0] [url = about:blank] 03:56:43 INFO - ++DOCSHELL 0x1140c3800 == 12 [pid = 1722] [id = 12] 03:56:43 INFO - ++DOMWINDOW == 23 (0x114bef800) [pid = 1722] [serial = 28] [outer = 0x0] 03:56:43 INFO - ++DOMWINDOW == 24 (0x113e0dc00) [pid = 1722] [serial = 29] [outer = 0x114bef800] 03:56:43 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 03:56:43 INFO - MEMORY STAT | vsize 3289MB | residentFast 381MB | heapAllocated 100MB 03:56:43 INFO - 79 INFO TEST-OK | devtools/client/webconsole/test/browser_bug1045902_console_csp_ignore_reflected_xss_message.js | took 3827ms 03:56:43 INFO - ++DOCSHELL 0x113317000 == 13 [pid = 1722] [id = 13] 03:56:43 INFO - ++DOMWINDOW == 25 (0x114b63000) [pid = 1722] [serial = 30] [outer = 0x0] 03:56:43 INFO - ++DOMWINDOW == 26 (0x113e05800) [pid = 1722] [serial = 31] [outer = 0x114b63000] 03:56:43 INFO - 80 INFO TEST-START | devtools/client/webconsole/test/browser_bug664688_sandbox_update_after_navigation.js 03:56:43 INFO - ++DOCSHELL 0x11eb89000 == 14 [pid = 1722] [id = 14] 03:56:43 INFO - ++DOMWINDOW == 27 (0x11e7ae800) [pid = 1722] [serial = 32] [outer = 0x0] 03:56:43 INFO - ++DOMWINDOW == 28 (0x11ebb6400) [pid = 1722] [serial = 33] [outer = 0x11e7ae800] 03:56:43 INFO - ++DOMWINDOW == 29 (0x11ec9d000) [pid = 1722] [serial = 34] [outer = 0x114bef800] 03:56:43 INFO - ++DOCSHELL 0x112ba4800 == 15 [pid = 1722] [id = 15] 03:56:43 INFO - ++DOMWINDOW == 30 (0x113d20800) [pid = 1722] [serial = 35] [outer = 0x0] 03:56:43 INFO - ++DOMWINDOW == 31 (0x11eef7400) [pid = 1722] [serial = 36] [outer = 0x113d20800] 03:56:43 INFO - ++DOMWINDOW == 32 (0x11ef14800) [pid = 1722] [serial = 37] [outer = 0x11e7ae800] 03:56:44 INFO - ++DOCSHELL 0x11320f800 == 16 [pid = 1722] [id = 16] 03:56:44 INFO - ++DOMWINDOW == 33 (0x11ebb7c00) [pid = 1722] [serial = 38] [outer = 0x0] 03:56:44 INFO - ++DOMWINDOW == 34 (0x11ef49000) [pid = 1722] [serial = 39] [outer = 0x11ebb7c00] 03:56:44 INFO - ++DOMWINDOW == 35 (0x11f713400) [pid = 1722] [serial = 40] [outer = 0x11ebb7c00] 03:56:44 INFO - ++DOCSHELL 0x124880800 == 17 [pid = 1722] [id = 17] 03:56:44 INFO - ++DOMWINDOW == 36 (0x12110ac00) [pid = 1722] [serial = 41] [outer = 0x0] 03:56:44 INFO - ++DOMWINDOW == 37 (0x121114800) [pid = 1722] [serial = 42] [outer = 0x12110ac00] 03:56:45 INFO - ++DOMWINDOW == 38 (0x12dd7e400) [pid = 1722] [serial = 43] [outer = 0x11e7ae800] 03:56:45 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:45 INFO - [1722] WARNING: RasterImage::Init failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/image/ImageFactory.cpp, line 109 03:56:46 INFO - --DOCSHELL 0x12ee65000 == 16 [pid = 1722] [id = 11] 03:56:46 INFO - --DOCSHELL 0x11269f000 == 15 [pid = 1722] [id = 7] 03:56:46 INFO - --DOCSHELL 0x124689800 == 14 [pid = 1722] [id = 5] 03:56:46 INFO - --DOCSHELL 0x114d95000 == 13 [pid = 1722] [id = 9] 03:56:46 INFO - --DOCSHELL 0x12d98c800 == 12 [pid = 1722] [id = 10] 03:56:46 INFO - --DOMWINDOW == 37 (0x126486400) [pid = 1722] [serial = 12] [outer = 0x0] [url = about:blank] 03:56:46 INFO - --DOMWINDOW == 36 (0x11ee19400) [pid = 1722] [serial = 22] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:56:46 INFO - --DOMWINDOW == 35 (0x12c3a4c00) [pid = 1722] [serial = 20] [outer = 0x0] [url = about:blank] 03:56:46 INFO - --DOMWINDOW == 34 (0x113e0dc00) [pid = 1722] [serial = 29] [outer = 0x0] [url = about:blank] 03:56:46 INFO - --DOMWINDOW == 33 (0x11ef49000) [pid = 1722] [serial = 39] [outer = 0x0] [url = about:blank] 03:56:46 INFO - --DOMWINDOW == 32 (0x11ebb6400) [pid = 1722] [serial = 33] [outer = 0x0] [url = about:blank] 03:56:46 INFO - --DOMWINDOW == 31 (0x12c4dbc00) [pid = 1722] [serial = 15] [outer = 0x0] [url = about:blank] 03:56:46 INFO - --DOMWINDOW == 30 (0x12a06f400) [pid = 1722] [serial = 19] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html] 03:56:46 INFO - --DOMWINDOW == 29 (0x12f2ca000) [pid = 1722] [serial = 25] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:56:46 INFO - --DOMWINDOW == 28 (0x130114800) [pid = 1722] [serial = 27] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html] 03:56:46 INFO - MEMORY STAT | vsize 3374MB | residentFast 387MB | heapAllocated 96MB 03:56:46 INFO - 81 INFO TEST-OK | devtools/client/webconsole/test/browser_bug664688_sandbox_update_after_navigation.js | took 2932ms 03:56:46 INFO - ++DOCSHELL 0x113516000 == 13 [pid = 1722] [id = 18] 03:56:46 INFO - ++DOMWINDOW == 29 (0x113e0b800) [pid = 1722] [serial = 44] [outer = 0x0] 03:56:46 INFO - ++DOMWINDOW == 30 (0x113e11400) [pid = 1722] [serial = 45] [outer = 0x113e0b800] 03:56:46 INFO - 82 INFO TEST-START | devtools/client/webconsole/test/browser_bug_638949_copy_link_location.js 03:56:46 INFO - ++DOCSHELL 0x113e4c800 == 14 [pid = 1722] [id = 19] 03:56:46 INFO - ++DOMWINDOW == 31 (0x11ee58c00) [pid = 1722] [serial = 46] [outer = 0x0] 03:56:46 INFO - ++DOMWINDOW == 32 (0x11eefac00) [pid = 1722] [serial = 47] [outer = 0x11ee58c00] 03:56:46 INFO - ++DOMWINDOW == 33 (0x11f10e400) [pid = 1722] [serial = 48] [outer = 0x11ee58c00] 03:56:47 INFO - ++DOCSHELL 0x112ba5000 == 15 [pid = 1722] [id = 20] 03:56:47 INFO - ++DOMWINDOW == 34 (0x120259400) [pid = 1722] [serial = 49] [outer = 0x0] 03:56:47 INFO - ++DOMWINDOW == 35 (0x12025c400) [pid = 1722] [serial = 50] [outer = 0x120259400] 03:56:47 INFO - ++DOMWINDOW == 36 (0x1203e1800) [pid = 1722] [serial = 51] [outer = 0x120259400] 03:56:47 INFO - ++DOCSHELL 0x121885000 == 16 [pid = 1722] [id = 21] 03:56:47 INFO - ++DOMWINDOW == 37 (0x12181c400) [pid = 1722] [serial = 52] [outer = 0x0] 03:56:47 INFO - ++DOMWINDOW == 38 (0x121829000) [pid = 1722] [serial = 53] [outer = 0x12181c400] 03:56:48 INFO - ++DOMWINDOW == 39 (0x127331c00) [pid = 1722] [serial = 54] [outer = 0x11ee58c00] 03:56:48 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:56:49 INFO - --DOCSHELL 0x124880800 == 15 [pid = 1722] [id = 17] 03:56:49 INFO - --DOCSHELL 0x113317000 == 14 [pid = 1722] [id = 13] 03:56:49 INFO - --DOCSHELL 0x11eb89000 == 13 [pid = 1722] [id = 14] 03:56:49 INFO - --DOCSHELL 0x11320f800 == 12 [pid = 1722] [id = 16] 03:56:49 INFO - --DOMWINDOW == 38 (0x12f2cc400) [pid = 1722] [serial = 26] [outer = 0x0] [url = about:blank] 03:56:49 INFO - --DOMWINDOW == 37 (0x12f268800) [pid = 1722] [serial = 24] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:56:49 INFO - --DOMWINDOW == 36 (0x12c4ddc00) [pid = 1722] [serial = 16] [outer = 0x0] [url = about:blank] 03:56:49 INFO - --DOMWINDOW == 35 (0x11eefac00) [pid = 1722] [serial = 47] [outer = 0x0] [url = about:blank] 03:56:49 INFO - --DOMWINDOW == 34 (0x12025c400) [pid = 1722] [serial = 50] [outer = 0x0] [url = about:blank] 03:56:49 INFO - --DOMWINDOW == 33 (0x11ebb7c00) [pid = 1722] [serial = 38] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:56:49 INFO - --DOMWINDOW == 32 (0x11e7ae800) [pid = 1722] [serial = 32] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:56:49 INFO - --DOMWINDOW == 31 (0x114b63000) [pid = 1722] [serial = 30] [outer = 0x0] [url = about:blank] 03:56:49 INFO - --DOMWINDOW == 30 (0x12110ac00) [pid = 1722] [serial = 41] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:56:49 INFO - --DOMWINDOW == 29 (0x12dd7e400) [pid = 1722] [serial = 43] [outer = 0x0] [url = http://example.org/browser/devtools/client/webconsole/test/test-console.html] 03:56:49 INFO - --DOMWINDOW == 28 (0x11ef14800) [pid = 1722] [serial = 37] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:56:49 INFO - MEMORY STAT | vsize 3375MB | residentFast 389MB | heapAllocated 97MB 03:56:49 INFO - 83 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_638949_copy_link_location.js | took 2616ms 03:56:49 INFO - ++DOCSHELL 0x112e24800 == 13 [pid = 1722] [id = 22] 03:56:49 INFO - ++DOMWINDOW == 29 (0x113e02c00) [pid = 1722] [serial = 55] [outer = 0x0] 03:56:49 INFO - ++DOMWINDOW == 30 (0x114b1e400) [pid = 1722] [serial = 56] [outer = 0x113e02c00] 03:56:49 INFO - 84 INFO TEST-START | devtools/client/webconsole/test/browser_bug_862916_console_dir_and_filter_off.js 03:56:49 INFO - ++DOCSHELL 0x11518d800 == 14 [pid = 1722] [id = 23] 03:56:49 INFO - ++DOMWINDOW == 31 (0x11e7ae800) [pid = 1722] [serial = 57] [outer = 0x0] 03:56:49 INFO - ++DOMWINDOW == 32 (0x11eefac00) [pid = 1722] [serial = 58] [outer = 0x11e7ae800] 03:56:49 INFO - ++DOCSHELL 0x11351a800 == 15 [pid = 1722] [id = 24] 03:56:49 INFO - ++DOMWINDOW == 33 (0x11ef18800) [pid = 1722] [serial = 59] [outer = 0x0] 03:56:49 INFO - ++DOMWINDOW == 34 (0x11f71a000) [pid = 1722] [serial = 60] [outer = 0x11ef18800] 03:56:49 INFO - ++DOMWINDOW == 35 (0x1202ee000) [pid = 1722] [serial = 61] [outer = 0x11ef18800] 03:56:49 INFO - ++DOCSHELL 0x121846800 == 16 [pid = 1722] [id = 25] 03:56:49 INFO - ++DOMWINDOW == 36 (0x121599400) [pid = 1722] [serial = 62] [outer = 0x0] 03:56:49 INFO - ++DOMWINDOW == 37 (0x1215dd400) [pid = 1722] [serial = 63] [outer = 0x121599400] 03:56:50 INFO - DevToolsUtils.dbg_assert is deprecated! Use DevToolsUtils.assert instead! 03:56:50 INFO - dbg_assert@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:449:13 03:56:50 INFO - ObjectActor@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:57:1 03:56:50 INFO - WCA_objectGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:451:17 03:56:50 INFO - createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:1913:1 03:56:50 INFO - WCA_createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:410:12 03:56:50 INFO - WCA_prepareConsoleMessageForRemote/result.arguments<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1547:14 03:56:50 INFO - WCA_prepareConsoleMessageForRemote@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1545:24 03:56:50 INFO - WCA_onConsoleAPICall@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1352:16 03:56:50 INFO - CAL_observe@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/utils.js:949:5 03:56:50 INFO - CS_recordEvent@resource://gre/components/ConsoleAPIStorage.js:137:5 03:56:50 INFO - @debugger eval code:1:31 03:56:50 INFO - WCA_evalWithDebugger@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1231:16 03:56:50 INFO - WCA_onEvaluateJS@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:832:20 03:56:50 INFO - WCA_onEvaluateJSAsync@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:802:20 03:56:50 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1606:15 03:56:50 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 03:56:50 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:56:50 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:56:50 INFO - console.warn: DevToolsUtils.dbg_assert is deprecated! Use DevToolsUtils.assert instead! 03:56:50 INFO - dbg_assert@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:449:13 03:56:50 INFO - ObjectActor@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:57:1 03:56:50 INFO - WCA_objectGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:451:17 03:56:50 INFO - createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:1913:1 03:56:50 INFO - WCA_createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:410:12 03:56:50 INFO - WCA_prepareConsoleMessageForRemote/result.arguments<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1547:14 03:56:50 INFO - WCA_prepareConsoleMessageForRemote@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1545:24 03:56:50 INFO - WCA_onConsoleAPICall@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1352:16 03:56:50 INFO - CAL_observe@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/utils.js:949:5 03:56:50 INFO - CS_recordEvent@resource://gre/components/ConsoleAPIStorage.js:137:5 03:56:50 INFO - @debugger eval code:1:31 03:56:50 INFO - WCA_evalWithDebugger@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1231:16 03:56:50 INFO - WCA_onEvaluateJS@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:832:20 03:56:50 INFO - WCA_onEvaluateJSAsync@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:802:20 03:56:50 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1606:15 03:56:50 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 03:56:50 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:56:50 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:56:50 INFO - ++DOCSHELL 0x12570a000 == 17 [pid = 1722] [id = 26] 03:56:50 INFO - ++DOMWINDOW == 38 (0x112929000) [pid = 1722] [serial = 64] [outer = 0x0] 03:56:50 INFO - ++DOMWINDOW == 39 (0x126144c00) [pid = 1722] [serial = 65] [outer = 0x112929000] 03:56:50 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 274 03:56:51 INFO - [1722] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 173 03:56:51 INFO - [1722] WARNING: IndexedDB is not permitted in a third-party window.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/indexedDB/IDBFactory.cpp, line 142 03:56:54 INFO - --DOCSHELL 0x12570a000 == 16 [pid = 1722] [id = 26] 03:56:55 INFO - --DOCSHELL 0x121885000 == 15 [pid = 1722] [id = 21] 03:56:55 INFO - --DOCSHELL 0x113516000 == 14 [pid = 1722] [id = 18] 03:56:55 INFO - --DOCSHELL 0x112ba5000 == 13 [pid = 1722] [id = 20] 03:56:55 INFO - --DOCSHELL 0x11351a800 == 12 [pid = 1722] [id = 24] 03:56:55 INFO - --DOCSHELL 0x121846800 == 11 [pid = 1722] [id = 25] 03:56:55 INFO - --DOCSHELL 0x113e4c800 == 10 [pid = 1722] [id = 19] 03:56:55 INFO - --DOMWINDOW == 38 (0x121114800) [pid = 1722] [serial = 42] [outer = 0x0] [url = about:blank] 03:56:55 INFO - --DOMWINDOW == 37 (0x11f713400) [pid = 1722] [serial = 40] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:56:55 INFO - --DOMWINDOW == 36 (0x11f10e400) [pid = 1722] [serial = 48] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1446551806810] 03:56:55 INFO - --DOMWINDOW == 35 (0x113e05800) [pid = 1722] [serial = 31] [outer = 0x0] [url = about:blank] 03:56:55 INFO - --DOMWINDOW == 34 (0x113e0b800) [pid = 1722] [serial = 44] [outer = 0x0] [url = about:blank] 03:56:55 INFO - --DOMWINDOW == 33 (0x113e11400) [pid = 1722] [serial = 45] [outer = 0x0] [url = about:blank] 03:56:55 INFO - --DOMWINDOW == 32 (0x11f71a000) [pid = 1722] [serial = 60] [outer = 0x0] [url = about:blank] 03:56:55 INFO - --DOMWINDOW == 31 (0x120259400) [pid = 1722] [serial = 49] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:56:55 INFO - --DOMWINDOW == 30 (0x12181c400) [pid = 1722] [serial = 52] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:56:55 INFO - --DOMWINDOW == 29 (0x11ee58c00) [pid = 1722] [serial = 46] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1446551806810] 03:56:55 INFO - --DOMWINDOW == 28 (0x127331c00) [pid = 1722] [serial = 54] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1446551806810] 03:56:55 INFO - MEMORY STAT | vsize 3377MB | residentFast 393MB | heapAllocated 104MB 03:56:55 INFO - 85 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_862916_console_dir_and_filter_off.js | took 6437ms 03:56:55 INFO - ++DOCSHELL 0x11331c000 == 11 [pid = 1722] [id = 27] 03:56:55 INFO - ++DOMWINDOW == 29 (0x113e03000) [pid = 1722] [serial = 66] [outer = 0x0] 03:56:55 INFO - ++DOMWINDOW == 30 (0x113e0bc00) [pid = 1722] [serial = 67] [outer = 0x113e03000] 03:56:56 INFO - 86 INFO TEST-START | devtools/client/webconsole/test/browser_bug_865288_repeat_different_objects.js 03:56:56 INFO - ++DOCSHELL 0x1132a8800 == 12 [pid = 1722] [id = 28] 03:56:56 INFO - ++DOMWINDOW == 31 (0x11ee58c00) [pid = 1722] [serial = 68] [outer = 0x0] 03:56:56 INFO - ++DOMWINDOW == 32 (0x11ef4b400) [pid = 1722] [serial = 69] [outer = 0x11ee58c00] 03:56:56 INFO - ++DOMWINDOW == 33 (0x11f70e000) [pid = 1722] [serial = 70] [outer = 0x11ee58c00] 03:56:56 INFO - ++DOCSHELL 0x112853800 == 13 [pid = 1722] [id = 29] 03:56:56 INFO - ++DOMWINDOW == 34 (0x1203dec00) [pid = 1722] [serial = 71] [outer = 0x0] 03:56:56 INFO - ++DOMWINDOW == 35 (0x1203df800) [pid = 1722] [serial = 72] [outer = 0x1203dec00] 03:56:56 INFO - ++DOMWINDOW == 36 (0x120ff7400) [pid = 1722] [serial = 73] [outer = 0x1203dec00] 03:56:56 INFO - ++DOCSHELL 0x12236b000 == 14 [pid = 1722] [id = 30] 03:56:56 INFO - ++DOMWINDOW == 37 (0x12232cc00) [pid = 1722] [serial = 74] [outer = 0x0] 03:56:56 INFO - ++DOMWINDOW == 38 (0x122330c00) [pid = 1722] [serial = 75] [outer = 0x12232cc00] 03:56:57 INFO - ++DOCSHELL 0x124873800 == 15 [pid = 1722] [id = 31] 03:56:57 INFO - ++DOMWINDOW == 39 (0x12c427800) [pid = 1722] [serial = 76] [outer = 0x0] 03:56:57 INFO - ++DOMWINDOW == 40 (0x12c4e0000) [pid = 1722] [serial = 77] [outer = 0x12c427800] 03:56:58 INFO - --DOCSHELL 0x112e24800 == 14 [pid = 1722] [id = 22] 03:56:58 INFO - --DOCSHELL 0x11518d800 == 13 [pid = 1722] [id = 23] 03:56:58 INFO - --DOCSHELL 0x12236b000 == 12 [pid = 1722] [id = 30] 03:56:58 INFO - --DOCSHELL 0x124873800 == 11 [pid = 1722] [id = 31] 03:56:58 INFO - --DOMWINDOW == 39 (0x121829000) [pid = 1722] [serial = 53] [outer = 0x0] [url = about:blank] 03:56:58 INFO - --DOMWINDOW == 38 (0x1203e1800) [pid = 1722] [serial = 51] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:56:58 INFO - --DOMWINDOW == 37 (0x112929000) [pid = 1722] [serial = 64] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:56:58 INFO - --DOMWINDOW == 36 (0x11e7ae800) [pid = 1722] [serial = 57] [outer = 0x0] [url = data:text/html;charset=utf8,

test%20for%20bug%20862916] 03:56:58 INFO - --DOMWINDOW == 35 (0x1203df800) [pid = 1722] [serial = 72] [outer = 0x0] [url = about:blank] 03:56:58 INFO - --DOMWINDOW == 34 (0x114b1e400) [pid = 1722] [serial = 56] [outer = 0x0] [url = about:blank] 03:56:58 INFO - --DOMWINDOW == 33 (0x113e02c00) [pid = 1722] [serial = 55] [outer = 0x0] [url = about:blank] 03:56:58 INFO - --DOMWINDOW == 32 (0x11ef4b400) [pid = 1722] [serial = 69] [outer = 0x0] [url = about:blank] 03:56:58 INFO - --DOMWINDOW == 31 (0x121599400) [pid = 1722] [serial = 62] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:56:58 INFO - --DOMWINDOW == 30 (0x11ef18800) [pid = 1722] [serial = 59] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:56:58 INFO - MEMORY STAT | vsize 3380MB | residentFast 395MB | heapAllocated 104MB 03:56:58 INFO - 87 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_865288_repeat_different_objects.js | took 2828ms 03:56:58 INFO - ++DOCSHELL 0x113519000 == 12 [pid = 1722] [id = 32] 03:56:58 INFO - ++DOMWINDOW == 31 (0x113e11400) [pid = 1722] [serial = 78] [outer = 0x0] 03:56:58 INFO - ++DOMWINDOW == 32 (0x114bf0c00) [pid = 1722] [serial = 79] [outer = 0x113e11400] 03:56:59 INFO - 88 INFO TEST-START | devtools/client/webconsole/test/browser_bug_865871_variables_view_close_on_esc_key.js 03:56:59 INFO - ++DOCSHELL 0x11e820800 == 13 [pid = 1722] [id = 33] 03:56:59 INFO - ++DOMWINDOW == 33 (0x113e0a800) [pid = 1722] [serial = 80] [outer = 0x0] 03:56:59 INFO - ++DOMWINDOW == 34 (0x11ef4b400) [pid = 1722] [serial = 81] [outer = 0x113e0a800] 03:56:59 INFO - ++DOMWINDOW == 35 (0x11f71a000) [pid = 1722] [serial = 82] [outer = 0x113e0a800] 03:56:59 INFO - ++DOCSHELL 0x113511000 == 14 [pid = 1722] [id = 34] 03:56:59 INFO - ++DOMWINDOW == 36 (0x1203de800) [pid = 1722] [serial = 83] [outer = 0x0] 03:56:59 INFO - ++DOMWINDOW == 37 (0x1203e0800) [pid = 1722] [serial = 84] [outer = 0x1203de800] 03:56:59 INFO - ++DOMWINDOW == 38 (0x120ff8400) [pid = 1722] [serial = 85] [outer = 0x1203de800] 03:56:59 INFO - ++DOCSHELL 0x1228cc000 == 15 [pid = 1722] [id = 35] 03:56:59 INFO - ++DOMWINDOW == 39 (0x1221bb000) [pid = 1722] [serial = 86] [outer = 0x0] 03:56:59 INFO - ++DOMWINDOW == 40 (0x1221bc400) [pid = 1722] [serial = 87] [outer = 0x1221bb000] 03:57:00 INFO - ++DOCSHELL 0x113e45800 == 16 [pid = 1722] [id = 36] 03:57:00 INFO - ++DOMWINDOW == 41 (0x126482c00) [pid = 1722] [serial = 88] [outer = 0x0] 03:57:00 INFO - ++DOMWINDOW == 42 (0x12647f400) [pid = 1722] [serial = 89] [outer = 0x126482c00] 03:57:00 INFO - ++DOCSHELL 0x122382800 == 17 [pid = 1722] [id = 37] 03:57:00 INFO - ++DOMWINDOW == 43 (0x127079400) [pid = 1722] [serial = 90] [outer = 0x0] 03:57:00 INFO - ++DOMWINDOW == 44 (0x127325800) [pid = 1722] [serial = 91] [outer = 0x127079400] 03:57:01 INFO - --DOCSHELL 0x11331c000 == 16 [pid = 1722] [id = 27] 03:57:01 INFO - --DOCSHELL 0x1132a8800 == 15 [pid = 1722] [id = 28] 03:57:01 INFO - --DOCSHELL 0x112853800 == 14 [pid = 1722] [id = 29] 03:57:01 INFO - --DOCSHELL 0x1228cc000 == 13 [pid = 1722] [id = 35] 03:57:01 INFO - --DOCSHELL 0x113e45800 == 12 [pid = 1722] [id = 36] 03:57:01 INFO - --DOCSHELL 0x122382800 == 11 [pid = 1722] [id = 37] 03:57:01 INFO - --DOMWINDOW == 43 (0x11eefac00) [pid = 1722] [serial = 58] [outer = 0x0] [url = about:blank] 03:57:01 INFO - --DOMWINDOW == 42 (0x126144c00) [pid = 1722] [serial = 65] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:01 INFO - --DOMWINDOW == 41 (0x1215dd400) [pid = 1722] [serial = 63] [outer = 0x0] [url = about:blank] 03:57:01 INFO - --DOMWINDOW == 40 (0x1202ee000) [pid = 1722] [serial = 61] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:01 INFO - --DOMWINDOW == 39 (0x11ef4b400) [pid = 1722] [serial = 81] [outer = 0x0] [url = about:blank] 03:57:01 INFO - --DOMWINDOW == 38 (0x113e0bc00) [pid = 1722] [serial = 67] [outer = 0x0] [url = about:blank] 03:57:01 INFO - --DOMWINDOW == 37 (0x12c427800) [pid = 1722] [serial = 76] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:01 INFO - --DOMWINDOW == 36 (0x1203e0800) [pid = 1722] [serial = 84] [outer = 0x0] [url = about:blank] 03:57:01 INFO - --DOMWINDOW == 35 (0x126482c00) [pid = 1722] [serial = 88] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:01 INFO - --DOMWINDOW == 34 (0x12232cc00) [pid = 1722] [serial = 74] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:01 INFO - --DOMWINDOW == 33 (0x1203dec00) [pid = 1722] [serial = 71] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:01 INFO - --DOMWINDOW == 32 (0x11ee58c00) [pid = 1722] [serial = 68] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 03:57:01 INFO - --DOMWINDOW == 31 (0x113e03000) [pid = 1722] [serial = 66] [outer = 0x0] [url = about:blank] 03:57:01 INFO - --DOMWINDOW == 30 (0x11f70e000) [pid = 1722] [serial = 70] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 03:57:01 INFO - MEMORY STAT | vsize 3373MB | residentFast 403MB | heapAllocated 98MB 03:57:01 INFO - 89 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_865871_variables_view_close_on_esc_key.js | took 2732ms 03:57:01 INFO - ++DOCSHELL 0x112e24800 == 12 [pid = 1722] [id = 38] 03:57:01 INFO - ++DOMWINDOW == 31 (0x113e03000) [pid = 1722] [serial = 92] [outer = 0x0] 03:57:01 INFO - ++DOMWINDOW == 32 (0x113e10c00) [pid = 1722] [serial = 93] [outer = 0x113e03000] 03:57:01 INFO - 90 INFO TEST-START | devtools/client/webconsole/test/browser_bug_869003_inspect_cross_domain_object.js 03:57:01 INFO - ++DOCSHELL 0x11518b000 == 13 [pid = 1722] [id = 39] 03:57:01 INFO - ++DOMWINDOW == 33 (0x11ee58c00) [pid = 1722] [serial = 94] [outer = 0x0] 03:57:01 INFO - ++DOMWINDOW == 34 (0x11eefb000) [pid = 1722] [serial = 95] [outer = 0x11ee58c00] 03:57:02 INFO - ++DOCSHELL 0x113519800 == 14 [pid = 1722] [id = 40] 03:57:02 INFO - ++DOMWINDOW == 35 (0x11ef49000) [pid = 1722] [serial = 96] [outer = 0x0] 03:57:02 INFO - ++DOMWINDOW == 36 (0x120155400) [pid = 1722] [serial = 97] [outer = 0x11ef49000] 03:57:02 INFO - ++DOMWINDOW == 37 (0x1203e6800) [pid = 1722] [serial = 98] [outer = 0x11ef49000] 03:57:02 INFO - ++DOCSHELL 0x12236b800 == 15 [pid = 1722] [id = 41] 03:57:02 INFO - ++DOMWINDOW == 38 (0x122115800) [pid = 1722] [serial = 99] [outer = 0x0] 03:57:02 INFO - ++DOMWINDOW == 39 (0x12211d800) [pid = 1722] [serial = 100] [outer = 0x122115800] 03:57:03 INFO - ++DOMWINDOW == 40 (0x129d12c00) [pid = 1722] [serial = 101] [outer = 0x11ee58c00] 03:57:03 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:57:03 INFO - ++DOCSHELL 0x129d3b000 == 16 [pid = 1722] [id = 42] 03:57:03 INFO - ++DOMWINDOW == 41 (0x113d0f800) [pid = 1722] [serial = 102] [outer = 0x0] 03:57:03 INFO - ++DOMWINDOW == 42 (0x12a16b400) [pid = 1722] [serial = 103] [outer = 0x113d0f800] 03:57:03 INFO - ++DOMWINDOW == 43 (0x12dd1a800) [pid = 1722] [serial = 104] [outer = 0x113d0f800] 03:57:03 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:57:03 INFO - ++DOCSHELL 0x121853800 == 17 [pid = 1722] [id = 43] 03:57:03 INFO - ++DOMWINDOW == 44 (0x12dd7e400) [pid = 1722] [serial = 105] [outer = 0x0] 03:57:03 INFO - ++DOMWINDOW == 45 (0x12dd88800) [pid = 1722] [serial = 106] [outer = 0x12dd7e400] 03:57:04 INFO - --DOCSHELL 0x12236b800 == 16 [pid = 1722] [id = 41] 03:57:04 INFO - --DOCSHELL 0x121853800 == 15 [pid = 1722] [id = 43] 03:57:04 INFO - --DOCSHELL 0x113519000 == 14 [pid = 1722] [id = 32] 03:57:04 INFO - --DOCSHELL 0x11e820800 == 13 [pid = 1722] [id = 33] 03:57:04 INFO - --DOCSHELL 0x113511000 == 12 [pid = 1722] [id = 34] 03:57:04 INFO - --DOMWINDOW == 44 (0x12647f400) [pid = 1722] [serial = 89] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:04 INFO - --DOMWINDOW == 43 (0x12c4e0000) [pid = 1722] [serial = 77] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:04 INFO - --DOMWINDOW == 42 (0x122330c00) [pid = 1722] [serial = 75] [outer = 0x0] [url = about:blank] 03:57:04 INFO - --DOMWINDOW == 41 (0x120ff7400) [pid = 1722] [serial = 73] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:04 INFO - --DOMWINDOW == 40 (0x127079400) [pid = 1722] [serial = 90] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:04 INFO - --DOMWINDOW == 39 (0x120155400) [pid = 1722] [serial = 97] [outer = 0x0] [url = about:blank] 03:57:04 INFO - --DOMWINDOW == 38 (0x12a16b400) [pid = 1722] [serial = 103] [outer = 0x0] [url = about:blank] 03:57:04 INFO - --DOMWINDOW == 37 (0x113e11400) [pid = 1722] [serial = 78] [outer = 0x0] [url = about:blank] 03:57:04 INFO - --DOMWINDOW == 36 (0x114bf0c00) [pid = 1722] [serial = 79] [outer = 0x0] [url = about:blank] 03:57:04 INFO - --DOMWINDOW == 35 (0x1203de800) [pid = 1722] [serial = 83] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:04 INFO - --DOMWINDOW == 34 (0x1221bb000) [pid = 1722] [serial = 86] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:04 INFO - --DOMWINDOW == 33 (0x113e0a800) [pid = 1722] [serial = 80] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:57:04 INFO - --DOMWINDOW == 32 (0x11f71a000) [pid = 1722] [serial = 82] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:57:04 INFO - MEMORY STAT | vsize 3373MB | residentFast 403MB | heapAllocated 99MB 03:57:04 INFO - 91 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_869003_inspect_cross_domain_object.js | took 2760ms 03:57:04 INFO - ++DOCSHELL 0x114b7d800 == 13 [pid = 1722] [id = 44] 03:57:04 INFO - ++DOMWINDOW == 33 (0x11e7aac00) [pid = 1722] [serial = 107] [outer = 0x0] 03:57:04 INFO - ++DOMWINDOW == 34 (0x11ee5c800) [pid = 1722] [serial = 108] [outer = 0x11e7aac00] 03:57:04 INFO - 92 INFO TEST-START | devtools/client/webconsole/test/browser_bug_871156_ctrlw_close_tab.js 03:57:04 INFO - ++DOCSHELL 0x11efdc800 == 14 [pid = 1722] [id = 45] 03:57:04 INFO - ++DOMWINDOW == 35 (0x11f5bf800) [pid = 1722] [serial = 109] [outer = 0x0] 03:57:04 INFO - ++DOMWINDOW == 36 (0x11f71a000) [pid = 1722] [serial = 110] [outer = 0x11f5bf800] 03:57:05 INFO - ++DOCSHELL 0x114b70000 == 15 [pid = 1722] [id = 46] 03:57:05 INFO - ++DOMWINDOW == 37 (0x120159000) [pid = 1722] [serial = 111] [outer = 0x0] 03:57:05 INFO - ++DOMWINDOW == 38 (0x1203e0000) [pid = 1722] [serial = 112] [outer = 0x120159000] 03:57:05 INFO - ++DOMWINDOW == 39 (0x121114800) [pid = 1722] [serial = 113] [outer = 0x120159000] 03:57:05 INFO - ++DOCSHELL 0x1246a0800 == 16 [pid = 1722] [id = 47] 03:57:05 INFO - ++DOMWINDOW == 40 (0x1240d0800) [pid = 1722] [serial = 114] [outer = 0x0] 03:57:05 INFO - ++DOMWINDOW == 41 (0x1241da400) [pid = 1722] [serial = 115] [outer = 0x1240d0800] 03:57:06 INFO - --DOCSHELL 0x129d3b000 == 15 [pid = 1722] [id = 42] 03:57:06 INFO - --DOCSHELL 0x11518b000 == 14 [pid = 1722] [id = 39] 03:57:06 INFO - --DOCSHELL 0x1246a0800 == 13 [pid = 1722] [id = 47] 03:57:06 INFO - --DOCSHELL 0x113519800 == 12 [pid = 1722] [id = 40] 03:57:06 INFO - --DOMWINDOW == 40 (0x1221bc400) [pid = 1722] [serial = 87] [outer = 0x0] [url = about:blank] 03:57:06 INFO - --DOMWINDOW == 39 (0x120ff8400) [pid = 1722] [serial = 85] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:06 INFO - --DOMWINDOW == 38 (0x127325800) [pid = 1722] [serial = 91] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:06 INFO - --DOMWINDOW == 37 (0x11eefb000) [pid = 1722] [serial = 95] [outer = 0x0] [url = about:blank] 03:57:06 INFO - --DOMWINDOW == 36 (0x113e10c00) [pid = 1722] [serial = 93] [outer = 0x0] [url = about:blank] 03:57:06 INFO - --DOMWINDOW == 35 (0x1203e0000) [pid = 1722] [serial = 112] [outer = 0x0] [url = about:blank] 03:57:06 INFO - --DOMWINDOW == 34 (0x11f5bf800) [pid = 1722] [serial = 109] [outer = 0x0] [url = data:text/html;charset=utf8,bug871156

hello%20world] 03:57:06 INFO - --DOMWINDOW == 33 (0x11f71a000) [pid = 1722] [serial = 110] [outer = 0x0] [url = about:blank] 03:57:06 INFO - --DOMWINDOW == 32 (0x122115800) [pid = 1722] [serial = 99] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:06 INFO - --DOMWINDOW == 31 (0x11ef49000) [pid = 1722] [serial = 96] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:06 INFO - --DOMWINDOW == 30 (0x12dd7e400) [pid = 1722] [serial = 105] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:06 INFO - --DOMWINDOW == 29 (0x113d0f800) [pid = 1722] [serial = 102] [outer = 0x0] [url = http://example.org/browser/devtools/client/webconsole/test/test-bug-869003-iframe.html] 03:57:06 INFO - --DOMWINDOW == 28 (0x11ee58c00) [pid = 1722] [serial = 94] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-869003-top-window.html] 03:57:06 INFO - --DOMWINDOW == 27 (0x113e03000) [pid = 1722] [serial = 92] [outer = 0x0] [url = about:blank] 03:57:06 INFO - --DOMWINDOW == 26 (0x12dd1a800) [pid = 1722] [serial = 104] [outer = 0x0] [url = http://example.org/browser/devtools/client/webconsole/test/test-bug-869003-iframe.html] 03:57:06 INFO - --DOMWINDOW == 25 (0x129d12c00) [pid = 1722] [serial = 101] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-869003-top-window.html] 03:57:06 INFO - ++DOCSHELL 0x112e21000 == 13 [pid = 1722] [id = 48] 03:57:06 INFO - ++DOMWINDOW == 26 (0x113e11400) [pid = 1722] [serial = 116] [outer = 0x0] 03:57:06 INFO - ++DOMWINDOW == 27 (0x114b2a400) [pid = 1722] [serial = 117] [outer = 0x113e11400] 03:57:07 INFO - MEMORY STAT | vsize 3381MB | residentFast 405MB | heapAllocated 101MB 03:57:07 INFO - 93 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_871156_ctrlw_close_tab.js | took 2381ms 03:57:07 INFO - ++DOCSHELL 0x10036e800 == 14 [pid = 1722] [id = 49] 03:57:07 INFO - ++DOMWINDOW == 28 (0x120d16800) [pid = 1722] [serial = 118] [outer = 0x0] 03:57:07 INFO - ++DOMWINDOW == 29 (0x12110a400) [pid = 1722] [serial = 119] [outer = 0x120d16800] 03:57:07 INFO - 94 INFO TEST-START | devtools/client/webconsole/test/browser_cached_messages.js 03:57:07 INFO - ++DOCSHELL 0x122382000 == 15 [pid = 1722] [id = 50] 03:57:07 INFO - ++DOMWINDOW == 30 (0x1215e9800) [pid = 1722] [serial = 120] [outer = 0x0] 03:57:07 INFO - ++DOMWINDOW == 31 (0x12180d400) [pid = 1722] [serial = 121] [outer = 0x1215e9800] 03:57:07 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:07 INFO - ++DOMWINDOW == 32 (0x1202ed000) [pid = 1722] [serial = 122] [outer = 0x1215e9800] 03:57:07 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html, line 15: TypeError: foo.bazBug611032 is not a function 03:57:07 INFO - ++DOCSHELL 0x113e52800 == 16 [pid = 1722] [id = 51] 03:57:07 INFO - ++DOMWINDOW == 33 (0x1241de000) [pid = 1722] [serial = 123] [outer = 0x0] 03:57:07 INFO - ++DOMWINDOW == 34 (0x1241e0c00) [pid = 1722] [serial = 124] [outer = 0x1241de000] 03:57:07 INFO - ++DOMWINDOW == 35 (0x11ef49c00) [pid = 1722] [serial = 125] [outer = 0x1241de000] 03:57:07 INFO - ++DOCSHELL 0x124874000 == 17 [pid = 1722] [id = 52] 03:57:07 INFO - ++DOMWINDOW == 36 (0x12561dc00) [pid = 1722] [serial = 126] [outer = 0x0] 03:57:07 INFO - ++DOMWINDOW == 37 (0x125621800) [pid = 1722] [serial = 127] [outer = 0x12561dc00] 03:57:09 INFO - --DOCSHELL 0x112e24800 == 16 [pid = 1722] [id = 38] 03:57:09 INFO - --DOCSHELL 0x114b70000 == 15 [pid = 1722] [id = 46] 03:57:09 INFO - --DOCSHELL 0x124874000 == 14 [pid = 1722] [id = 52] 03:57:09 INFO - --DOCSHELL 0x11efdc800 == 13 [pid = 1722] [id = 45] 03:57:09 INFO - --DOMWINDOW == 36 (0x12dd88800) [pid = 1722] [serial = 106] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:09 INFO - --DOMWINDOW == 35 (0x12211d800) [pid = 1722] [serial = 100] [outer = 0x0] [url = about:blank] 03:57:09 INFO - --DOMWINDOW == 34 (0x1203e6800) [pid = 1722] [serial = 98] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:09 INFO - --DOMWINDOW == 33 (0x11ee5c800) [pid = 1722] [serial = 108] [outer = 0x0] [url = about:blank] 03:57:09 INFO - --DOMWINDOW == 32 (0x12180d400) [pid = 1722] [serial = 121] [outer = 0x0] [url = about:blank] 03:57:09 INFO - --DOMWINDOW == 31 (0x1241e0c00) [pid = 1722] [serial = 124] [outer = 0x0] [url = about:blank] 03:57:09 INFO - --DOMWINDOW == 30 (0x1240d0800) [pid = 1722] [serial = 114] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:09 INFO - --DOMWINDOW == 29 (0x120159000) [pid = 1722] [serial = 111] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:09 INFO - --DOMWINDOW == 28 (0x11e7aac00) [pid = 1722] [serial = 107] [outer = 0x0] [url = about:blank] 03:57:09 INFO - ++DOCSHELL 0x112b45800 == 14 [pid = 1722] [id = 53] 03:57:09 INFO - ++DOMWINDOW == 29 (0x112c98400) [pid = 1722] [serial = 128] [outer = 0x0] 03:57:09 INFO - ++DOMWINDOW == 30 (0x112ca2400) [pid = 1722] [serial = 129] [outer = 0x112c98400] 03:57:09 INFO - ++DOMWINDOW == 31 (0x113e0bc00) [pid = 1722] [serial = 130] [outer = 0x112c98400] 03:57:09 INFO - ++DOCSHELL 0x114b7e000 == 15 [pid = 1722] [id = 54] 03:57:09 INFO - ++DOMWINDOW == 32 (0x1203e0800) [pid = 1722] [serial = 131] [outer = 0x0] 03:57:09 INFO - ++DOMWINDOW == 33 (0x1203e4400) [pid = 1722] [serial = 132] [outer = 0x1203e0800] 03:57:10 INFO - --DOCSHELL 0x114b7d800 == 14 [pid = 1722] [id = 44] 03:57:10 INFO - --DOCSHELL 0x112e21000 == 13 [pid = 1722] [id = 48] 03:57:10 INFO - --DOCSHELL 0x114b7e000 == 12 [pid = 1722] [id = 54] 03:57:10 INFO - --DOCSHELL 0x113e52800 == 11 [pid = 1722] [id = 51] 03:57:10 INFO - --DOMWINDOW == 32 (0x1241da400) [pid = 1722] [serial = 115] [outer = 0x0] [url = about:blank] 03:57:10 INFO - --DOMWINDOW == 31 (0x121114800) [pid = 1722] [serial = 113] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:10 INFO - --DOMWINDOW == 30 (0x112ca2400) [pid = 1722] [serial = 129] [outer = 0x0] [url = about:blank] 03:57:10 INFO - --DOMWINDOW == 29 (0x113e11400) [pid = 1722] [serial = 116] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:10 INFO - --DOMWINDOW == 28 (0x1241de000) [pid = 1722] [serial = 123] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:10 INFO - --DOMWINDOW == 27 (0x12561dc00) [pid = 1722] [serial = 126] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:10 INFO - MEMORY STAT | vsize 3371MB | residentFast 403MB | heapAllocated 97MB 03:57:10 INFO - 95 INFO TEST-OK | devtools/client/webconsole/test/browser_cached_messages.js | took 3620ms 03:57:10 INFO - ++DOCSHELL 0x11330a000 == 12 [pid = 1722] [id = 55] 03:57:10 INFO - ++DOMWINDOW == 28 (0x113d05c00) [pid = 1722] [serial = 133] [outer = 0x0] 03:57:10 INFO - ++DOMWINDOW == 29 (0x113e02c00) [pid = 1722] [serial = 134] [outer = 0x113d05c00] 03:57:11 INFO - 96 INFO TEST-START | devtools/client/webconsole/test/browser_console.js 03:57:11 INFO - ++DOCSHELL 0x114b7d800 == 13 [pid = 1722] [id = 56] 03:57:11 INFO - ++DOMWINDOW == 30 (0x11e70b800) [pid = 1722] [serial = 135] [outer = 0x0] 03:57:11 INFO - ++DOMWINDOW == 31 (0x11ee59c00) [pid = 1722] [serial = 136] [outer = 0x11e70b800] 03:57:11 INFO - ++DOMWINDOW == 32 (0x11f70e800) [pid = 1722] [serial = 137] [outer = 0x11e70b800] 03:57:11 INFO - ++DOCSHELL 0x120174000 == 14 [pid = 1722] [id = 57] 03:57:11 INFO - ++DOMWINDOW == 33 (0x120ffec00) [pid = 1722] [serial = 138] [outer = 0x0] 03:57:11 INFO - ++DOMWINDOW == 34 (0x12110c000) [pid = 1722] [serial = 139] [outer = 0x120ffec00] 03:57:11 INFO - JavaScript error: chrome://mochitests/content/browser/devtools/client/webconsole/test/browser_console.js, line 38: ReferenceError: foobarExceptionBug587757 is not defined 03:57:11 INFO - console.log: xhr loaded, status is: 200 03:57:11 INFO - console.log: xhr error loaded, status is: 404 03:57:11 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:12 INFO - MEMORY STAT | vsize 3380MB | residentFast 407MB | heapAllocated 103MB 03:57:12 INFO - 97 INFO TEST-OK | devtools/client/webconsole/test/browser_console.js | took 1250ms 03:57:12 INFO - ++DOCSHELL 0x1252fa000 == 15 [pid = 1722] [id = 58] 03:57:12 INFO - ++DOMWINDOW == 35 (0x124396400) [pid = 1722] [serial = 140] [outer = 0x0] 03:57:12 INFO - ++DOMWINDOW == 36 (0x124778c00) [pid = 1722] [serial = 141] [outer = 0x124396400] 03:57:12 INFO - 98 INFO TEST-START | devtools/client/webconsole/test/browser_console_addonsdk_loader_exception.js 03:57:12 INFO - ++DOCSHELL 0x1135ae000 == 16 [pid = 1722] [id = 59] 03:57:12 INFO - ++DOMWINDOW == 37 (0x121115c00) [pid = 1722] [serial = 142] [outer = 0x0] 03:57:12 INFO - ++DOMWINDOW == 38 (0x12211d800) [pid = 1722] [serial = 143] [outer = 0x121115c00] 03:57:12 INFO - ++DOCSHELL 0x11359a000 == 17 [pid = 1722] [id = 60] 03:57:12 INFO - ++DOMWINDOW == 39 (0x122120c00) [pid = 1722] [serial = 144] [outer = 0x0] 03:57:12 INFO - ++DOMWINDOW == 40 (0x127077800) [pid = 1722] [serial = 145] [outer = 0x122120c00] 03:57:12 INFO - ++DOMWINDOW == 41 (0x127078c00) [pid = 1722] [serial = 146] [outer = 0x122120c00] 03:57:12 INFO - ++DOCSHELL 0x12c255800 == 18 [pid = 1722] [id = 61] 03:57:12 INFO - ++DOMWINDOW == 42 (0x12dd20800) [pid = 1722] [serial = 147] [outer = 0x0] 03:57:12 INFO - ++DOMWINDOW == 43 (0x12dd7c800) [pid = 1722] [serial = 148] [outer = 0x12dd20800] 03:57:13 INFO - ++DOCSHELL 0x124475800 == 19 [pid = 1722] [id = 62] 03:57:13 INFO - ++DOMWINDOW == 44 (0x12efbd800) [pid = 1722] [serial = 149] [outer = 0x0] 03:57:13 INFO - ++DOMWINDOW == 45 (0x12efbfc00) [pid = 1722] [serial = 150] [outer = 0x12efbd800] 03:57:13 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox.js, line 199: TypeError: this._toolPanels is not iterable 03:57:13 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:14 INFO - --DOCSHELL 0x122382000 == 18 [pid = 1722] [id = 50] 03:57:14 INFO - --DOCSHELL 0x112b45800 == 17 [pid = 1722] [id = 53] 03:57:14 INFO - --DOCSHELL 0x10036e800 == 16 [pid = 1722] [id = 49] 03:57:14 INFO - --DOMWINDOW == 44 (0x114b2a400) [pid = 1722] [serial = 117] [outer = 0x0] [url = about:blank] 03:57:14 INFO - --DOMWINDOW == 43 (0x11ef49c00) [pid = 1722] [serial = 125] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:14 INFO - --DOMWINDOW == 42 (0x125621800) [pid = 1722] [serial = 127] [outer = 0x0] [url = about:blank] 03:57:14 INFO - --DOMWINDOW == 41 (0x12110a400) [pid = 1722] [serial = 119] [outer = 0x0] [url = about:blank] 03:57:14 INFO - --DOMWINDOW == 40 (0x113e02c00) [pid = 1722] [serial = 134] [outer = 0x0] [url = about:blank] 03:57:14 INFO - --DOMWINDOW == 39 (0x11ee59c00) [pid = 1722] [serial = 136] [outer = 0x0] [url = about:blank] 03:57:14 INFO - --DOMWINDOW == 38 (0x127077800) [pid = 1722] [serial = 145] [outer = 0x0] [url = about:blank] 03:57:14 INFO - --DOMWINDOW == 37 (0x11e70b800) [pid = 1722] [serial = 135] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?1446551831081] 03:57:14 INFO - --DOMWINDOW == 36 (0x1203e0800) [pid = 1722] [serial = 131] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:14 INFO - --DOMWINDOW == 35 (0x112c98400) [pid = 1722] [serial = 128] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:14 INFO - --DOMWINDOW == 34 (0x120d16800) [pid = 1722] [serial = 118] [outer = 0x0] [url = about:blank] 03:57:14 INFO - --DOMWINDOW == 33 (0x1215e9800) [pid = 1722] [serial = 120] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html] 03:57:14 INFO - --DOMWINDOW == 32 (0x113d05c00) [pid = 1722] [serial = 133] [outer = 0x0] [url = about:blank] 03:57:14 INFO - --DOMWINDOW == 31 (0x1202ed000) [pid = 1722] [serial = 122] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html] 03:57:14 INFO - MEMORY STAT | vsize 3378MB | residentFast 405MB | heapAllocated 100MB 03:57:14 INFO - 99 INFO TEST-OK | devtools/client/webconsole/test/browser_console_addonsdk_loader_exception.js | took 2470ms 03:57:14 INFO - ++DOCSHELL 0x11331c000 == 17 [pid = 1722] [id = 63] 03:57:14 INFO - ++DOMWINDOW == 32 (0x114b1e400) [pid = 1722] [serial = 151] [outer = 0x0] 03:57:14 INFO - ++DOMWINDOW == 33 (0x114bfe000) [pid = 1722] [serial = 152] [outer = 0x114b1e400] 03:57:15 INFO - 100 INFO TEST-START | devtools/client/webconsole/test/browser_console_clear_on_reload.js 03:57:15 INFO - ++DOCSHELL 0x11e825000 == 18 [pid = 1722] [id = 64] 03:57:15 INFO - ++DOMWINDOW == 34 (0x112bc1c00) [pid = 1722] [serial = 153] [outer = 0x0] 03:57:15 INFO - ++DOMWINDOW == 35 (0x11ef55400) [pid = 1722] [serial = 154] [outer = 0x112bc1c00] 03:57:15 INFO - ++DOMWINDOW == 36 (0x12232a400) [pid = 1722] [serial = 155] [outer = 0x112bc1c00] 03:57:15 INFO - ++DOCSHELL 0x11320f800 == 19 [pid = 1722] [id = 65] 03:57:15 INFO - ++DOMWINDOW == 37 (0x11ef57c00) [pid = 1722] [serial = 156] [outer = 0x0] 03:57:15 INFO - ++DOMWINDOW == 38 (0x1203df800) [pid = 1722] [serial = 157] [outer = 0x11ef57c00] 03:57:15 INFO - ++DOMWINDOW == 39 (0x121115000) [pid = 1722] [serial = 158] [outer = 0x11ef57c00] 03:57:15 INFO - ++DOCSHELL 0x124ac8800 == 20 [pid = 1722] [id = 66] 03:57:15 INFO - ++DOMWINDOW == 40 (0x124390400) [pid = 1722] [serial = 159] [outer = 0x0] 03:57:15 INFO - ++DOMWINDOW == 41 (0x124394800) [pid = 1722] [serial = 160] [outer = 0x124390400] 03:57:16 INFO - ++DOCSHELL 0x11f639800 == 21 [pid = 1722] [id = 67] 03:57:16 INFO - ++DOMWINDOW == 42 (0x12d409c00) [pid = 1722] [serial = 161] [outer = 0x0] 03:57:16 INFO - ++DOMWINDOW == 43 (0x120ffcc00) [pid = 1722] [serial = 162] [outer = 0x12d409c00] 03:57:16 INFO - ++DOCSHELL 0x1128cb000 == 22 [pid = 1722] [id = 68] 03:57:16 INFO - ++DOMWINDOW == 44 (0x12e0eb400) [pid = 1722] [serial = 163] [outer = 0x0] 03:57:16 INFO - ++DOMWINDOW == 45 (0x12ee0bc00) [pid = 1722] [serial = 164] [outer = 0x12e0eb400] 03:57:17 INFO - ++DOMWINDOW == 46 (0x12ee0ec00) [pid = 1722] [serial = 165] [outer = 0x112bc1c00] 03:57:17 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:57:17 INFO - --DOCSHELL 0x120174000 == 21 [pid = 1722] [id = 57] 03:57:17 INFO - --DOCSHELL 0x12c255800 == 20 [pid = 1722] [id = 61] 03:57:17 INFO - --DOCSHELL 0x124475800 == 19 [pid = 1722] [id = 62] 03:57:17 INFO - --DOCSHELL 0x11330a000 == 18 [pid = 1722] [id = 55] 03:57:17 INFO - --DOCSHELL 0x1135ae000 == 17 [pid = 1722] [id = 59] 03:57:17 INFO - --DOCSHELL 0x114b7d800 == 16 [pid = 1722] [id = 56] 03:57:17 INFO - --DOCSHELL 0x124ac8800 == 15 [pid = 1722] [id = 66] 03:57:17 INFO - --DOCSHELL 0x1252fa000 == 14 [pid = 1722] [id = 58] 03:57:17 INFO - --DOCSHELL 0x11359a000 == 13 [pid = 1722] [id = 60] 03:57:17 INFO - --DOCSHELL 0x11f639800 == 12 [pid = 1722] [id = 67] 03:57:17 INFO - --DOCSHELL 0x1128cb000 == 11 [pid = 1722] [id = 68] 03:57:17 INFO - --DOMWINDOW == 45 (0x1203e4400) [pid = 1722] [serial = 132] [outer = 0x0] [url = about:blank] 03:57:17 INFO - --DOMWINDOW == 44 (0x113e0bc00) [pid = 1722] [serial = 130] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:17 INFO - --DOMWINDOW == 43 (0x11f70e800) [pid = 1722] [serial = 137] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?1446551831081] 03:57:17 INFO - --DOMWINDOW == 42 (0x121115c00) [pid = 1722] [serial = 142] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20world%20from%20bug%20866950] 03:57:17 INFO - --DOMWINDOW == 41 (0x124396400) [pid = 1722] [serial = 140] [outer = 0x0] [url = about:blank] 03:57:17 INFO - --DOMWINDOW == 40 (0x11ef55400) [pid = 1722] [serial = 154] [outer = 0x0] [url = about:blank] 03:57:17 INFO - --DOMWINDOW == 39 (0x12211d800) [pid = 1722] [serial = 143] [outer = 0x0] [url = about:blank] 03:57:17 INFO - --DOMWINDOW == 38 (0x124778c00) [pid = 1722] [serial = 141] [outer = 0x0] [url = about:blank] 03:57:17 INFO - --DOMWINDOW == 37 (0x1203df800) [pid = 1722] [serial = 157] [outer = 0x0] [url = about:blank] 03:57:17 INFO - --DOMWINDOW == 36 (0x12d409c00) [pid = 1722] [serial = 161] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:17 INFO - --DOMWINDOW == 35 (0x122120c00) [pid = 1722] [serial = 144] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:17 INFO - --DOMWINDOW == 34 (0x12efbd800) [pid = 1722] [serial = 149] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:17 INFO - --DOMWINDOW == 33 (0x120ffec00) [pid = 1722] [serial = 138] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:17 INFO - --DOMWINDOW == 32 (0x12dd20800) [pid = 1722] [serial = 147] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:18 INFO - MEMORY STAT | vsize 3376MB | residentFast 406MB | heapAllocated 103MB 03:57:18 INFO - 101 INFO TEST-OK | devtools/client/webconsole/test/browser_console_clear_on_reload.js | took 3002ms 03:57:18 INFO - ++DOCSHELL 0x113319800 == 12 [pid = 1722] [id = 69] 03:57:18 INFO - ++DOMWINDOW == 33 (0x113e11400) [pid = 1722] [serial = 166] [outer = 0x0] 03:57:18 INFO - ++DOMWINDOW == 34 (0x114bfe400) [pid = 1722] [serial = 167] [outer = 0x113e11400] 03:57:18 INFO - 102 INFO TEST-START | devtools/client/webconsole/test/browser_console_click_focus.js 03:57:18 INFO - ++DOCSHELL 0x11ee49000 == 13 [pid = 1722] [id = 70] 03:57:18 INFO - ++DOMWINDOW == 35 (0x11eefb000) [pid = 1722] [serial = 168] [outer = 0x0] 03:57:18 INFO - ++DOMWINDOW == 36 (0x11ef55400) [pid = 1722] [serial = 169] [outer = 0x11eefb000] 03:57:18 INFO - ++DOMWINDOW == 37 (0x1248e7c00) [pid = 1722] [serial = 170] [outer = 0x11eefb000] 03:57:18 INFO - ++DOCSHELL 0x113512800 == 14 [pid = 1722] [id = 71] 03:57:18 INFO - ++DOMWINDOW == 38 (0x1203e0c00) [pid = 1722] [serial = 171] [outer = 0x0] 03:57:18 INFO - ++DOMWINDOW == 39 (0x1203e5000) [pid = 1722] [serial = 172] [outer = 0x1203e0c00] 03:57:18 INFO - ++DOMWINDOW == 40 (0x12110b400) [pid = 1722] [serial = 173] [outer = 0x1203e0c00] 03:57:18 INFO - ++DOCSHELL 0x124abb800 == 15 [pid = 1722] [id = 72] 03:57:18 INFO - ++DOMWINDOW == 41 (0x1241d8800) [pid = 1722] [serial = 174] [outer = 0x0] 03:57:18 INFO - ++DOMWINDOW == 42 (0x1241dec00) [pid = 1722] [serial = 175] [outer = 0x1241d8800] 03:57:20 INFO - --DOCSHELL 0x11e825000 == 14 [pid = 1722] [id = 64] 03:57:20 INFO - --DOCSHELL 0x11331c000 == 13 [pid = 1722] [id = 63] 03:57:20 INFO - --DOCSHELL 0x124abb800 == 12 [pid = 1722] [id = 72] 03:57:20 INFO - --DOCSHELL 0x11320f800 == 11 [pid = 1722] [id = 65] 03:57:20 INFO - --DOMWINDOW == 41 (0x12dd7c800) [pid = 1722] [serial = 148] [outer = 0x0] [url = about:blank] 03:57:20 INFO - --DOMWINDOW == 40 (0x127078c00) [pid = 1722] [serial = 146] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:20 INFO - --DOMWINDOW == 39 (0x12efbfc00) [pid = 1722] [serial = 150] [outer = 0x0] [url = about:blank] 03:57:20 INFO - --DOMWINDOW == 38 (0x12110c000) [pid = 1722] [serial = 139] [outer = 0x0] [url = about:blank] 03:57:20 INFO - --DOMWINDOW == 37 (0x120ffcc00) [pid = 1722] [serial = 162] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:20 INFO - --DOMWINDOW == 36 (0x11ef55400) [pid = 1722] [serial = 169] [outer = 0x0] [url = about:blank] 03:57:20 INFO - --DOMWINDOW == 35 (0x114bfe000) [pid = 1722] [serial = 152] [outer = 0x0] [url = about:blank] 03:57:20 INFO - --DOMWINDOW == 34 (0x1203e5000) [pid = 1722] [serial = 172] [outer = 0x0] [url = about:blank] 03:57:20 INFO - --DOMWINDOW == 33 (0x12e0eb400) [pid = 1722] [serial = 163] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:20 INFO - --DOMWINDOW == 32 (0x11ef57c00) [pid = 1722] [serial = 156] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:20 INFO - --DOMWINDOW == 31 (0x124390400) [pid = 1722] [serial = 159] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:20 INFO - --DOMWINDOW == 30 (0x112bc1c00) [pid = 1722] [serial = 153] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:57:20 INFO - --DOMWINDOW == 29 (0x114b1e400) [pid = 1722] [serial = 151] [outer = 0x0] [url = about:blank] 03:57:20 INFO - --DOMWINDOW == 28 (0x12ee0ec00) [pid = 1722] [serial = 165] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:57:20 INFO - --DOMWINDOW == 27 (0x12232a400) [pid = 1722] [serial = 155] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:57:20 INFO - MEMORY STAT | vsize 3379MB | residentFast 409MB | heapAllocated 101MB 03:57:20 INFO - 103 INFO TEST-OK | devtools/client/webconsole/test/browser_console_click_focus.js | took 2158ms 03:57:20 INFO - ++DOCSHELL 0x11330a000 == 12 [pid = 1722] [id = 73] 03:57:20 INFO - ++DOMWINDOW == 28 (0x113d0d800) [pid = 1722] [serial = 176] [outer = 0x0] 03:57:20 INFO - ++DOMWINDOW == 29 (0x113e0dc00) [pid = 1722] [serial = 177] [outer = 0x113d0d800] 03:57:20 INFO - 104 INFO TEST-START | devtools/client/webconsole/test/browser_console_consolejsm_output.js 03:57:20 INFO - console.log: bug861338-log-cached 03:57:20 INFO - ++DOCSHELL 0x11ee3e000 == 13 [pid = 1722] [id = 74] 03:57:20 INFO - ++DOMWINDOW == 30 (0x11f710c00) [pid = 1722] [serial = 178] [outer = 0x0] 03:57:20 INFO - ++DOMWINDOW == 31 (0x11f71a000) [pid = 1722] [serial = 179] [outer = 0x11f710c00] 03:57:20 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:20 INFO - console.time: 'foobarTimer' @ Tue Nov 03 2015 03:57:20 GMT-0800 (PST) 03:57:20 INFO - console.log: bug851231-log 03:57:20 INFO - console.info: bug851231-info 03:57:20 INFO - console.warn: bug851231-warn 03:57:20 INFO - console.error: 03:57:20 INFO - bug851231-error 03:57:20 INFO - Object 03:57:20 INFO - - bug851231prop = bug851231value 03:57:20 INFO - console.debug: 03:57:20 INFO - bug851231-debug 03:57:20 INFO - console.dir: 03:57:20 INFO - XULDocument 03:57:20 INFO - - location = Location {"href":"chrome://browser/content/browser.xul","origin":"chrome://browser","protocol":"chrome:","username":"","password":"","host":"browser","hostname":"browser","port":"","pathname":"/content/browser.xul","search":"","hash":""} 03:57:20 INFO - console.trace: 03:57:20 INFO - _onsolejsm_output.js 42 testTrace 03:57:20 INFO - _onsolejsm_output.js 54 03:57:20 INFO - _re/modules/Task.jsm 314 TaskImpl_run 03:57:20 INFO - _/Promise-backend.js 934 Handler.prototype.process 03:57:20 INFO - _/Promise-backend.js 813 this.PromiseWalker.walkerLoop 03:57:20 INFO - console.timeEnd: 'foobarTimer' 24ms 03:57:20 INFO - ++DOCSHELL 0x12469a800 == 14 [pid = 1722] [id = 75] 03:57:20 INFO - ++DOMWINDOW == 32 (0x124391400) [pid = 1722] [serial = 180] [outer = 0x0] 03:57:20 INFO - ++DOMWINDOW == 33 (0x124393c00) [pid = 1722] [serial = 181] [outer = 0x124391400] 03:57:21 INFO - ++DOCSHELL 0x124ac8800 == 15 [pid = 1722] [id = 76] 03:57:21 INFO - ++DOMWINDOW == 34 (0x1203dd400) [pid = 1722] [serial = 182] [outer = 0x0] 03:57:21 INFO - ++DOMWINDOW == 35 (0x126480800) [pid = 1722] [serial = 183] [outer = 0x1203dd400] 03:57:21 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 03:57:22 INFO - console.error: Log Prefix: 03:57:22 INFO - Testing a prefix 03:57:22 INFO - ++DOCSHELL 0x11efdc800 == 16 [pid = 1722] [id = 77] 03:57:22 INFO - ++DOMWINDOW == 36 (0x120d16400) [pid = 1722] [serial = 184] [outer = 0x0] 03:57:22 INFO - ++DOMWINDOW == 37 (0x120d1dc00) [pid = 1722] [serial = 185] [outer = 0x120d16400] 03:57:22 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:22 INFO - console.error: 03:57:22 INFO - Error should be shown 03:57:22 INFO - ++DOCSHELL 0x1252ed800 == 17 [pid = 1722] [id = 78] 03:57:22 INFO - ++DOMWINDOW == 38 (0x1257ce400) [pid = 1722] [serial = 186] [outer = 0x0] 03:57:22 INFO - ++DOMWINDOW == 39 (0x126143000) [pid = 1722] [serial = 187] [outer = 0x1257ce400] 03:57:22 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:22 INFO - console.error: 03:57:22 INFO - Error should be shown 03:57:22 INFO - console.warn: Warn should be shown due to the initial pref value 03:57:22 INFO - console.info: info should be shown due to the pref change being observed 03:57:22 INFO - console.error: 03:57:22 INFO - Should be shown due to defaulting to error 03:57:23 INFO - ++DOCSHELL 0x121885000 == 18 [pid = 1722] [id = 79] 03:57:23 INFO - ++DOMWINDOW == 40 (0x1221ba400) [pid = 1722] [serial = 188] [outer = 0x0] 03:57:23 INFO - ++DOMWINDOW == 41 (0x125740800) [pid = 1722] [serial = 189] [outer = 0x1221ba400] 03:57:23 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:23 INFO - MEMORY STAT | vsize 3390MB | residentFast 411MB | heapAllocated 113MB 03:57:23 INFO - 105 INFO TEST-OK | devtools/client/webconsole/test/browser_console_consolejsm_output.js | took 3079ms 03:57:23 INFO - ++DOCSHELL 0x112ba5000 == 19 [pid = 1722] [id = 80] 03:57:23 INFO - ++DOMWINDOW == 42 (0x126144c00) [pid = 1722] [serial = 190] [outer = 0x0] 03:57:23 INFO - ++DOMWINDOW == 43 (0x12ee12800) [pid = 1722] [serial = 191] [outer = 0x126144c00] 03:57:23 INFO - 106 INFO TEST-START | devtools/client/webconsole/test/browser_console_copy_command.js 03:57:23 INFO - ++DOCSHELL 0x114b80800 == 20 [pid = 1722] [id = 81] 03:57:23 INFO - ++DOMWINDOW == 44 (0x1257d0800) [pid = 1722] [serial = 192] [outer = 0x0] 03:57:23 INFO - ++DOMWINDOW == 45 (0x12e0ec000) [pid = 1722] [serial = 193] [outer = 0x1257d0800] 03:57:23 INFO - ++DOCSHELL 0x12f119800 == 21 [pid = 1722] [id = 82] 03:57:23 INFO - ++DOMWINDOW == 46 (0x12e0f0000) [pid = 1722] [serial = 194] [outer = 0x0] 03:57:23 INFO - ++DOMWINDOW == 47 (0x12f2c0400) [pid = 1722] [serial = 195] [outer = 0x12e0f0000] 03:57:24 INFO - ++DOMWINDOW == 48 (0x12f2c3000) [pid = 1722] [serial = 196] [outer = 0x12e0f0000] 03:57:24 INFO - ++DOCSHELL 0x12c26c800 == 22 [pid = 1722] [id = 83] 03:57:24 INFO - ++DOMWINDOW == 49 (0x12f5a3000) [pid = 1722] [serial = 197] [outer = 0x0] 03:57:24 INFO - ++DOMWINDOW == 50 (0x12f5a4400) [pid = 1722] [serial = 198] [outer = 0x12f5a3000] 03:57:25 INFO - MEMORY STAT | vsize 3388MB | residentFast 414MB | heapAllocated 115MB 03:57:25 INFO - 107 INFO TEST-OK | devtools/client/webconsole/test/browser_console_copy_command.js | took 2147ms 03:57:25 INFO - ++DOCSHELL 0x125714800 == 23 [pid = 1722] [id = 84] 03:57:25 INFO - ++DOMWINDOW == 51 (0x121828800) [pid = 1722] [serial = 199] [outer = 0x0] 03:57:25 INFO - ++DOMWINDOW == 52 (0x12613ec00) [pid = 1722] [serial = 200] [outer = 0x121828800] 03:57:26 INFO - 108 INFO TEST-START | devtools/client/webconsole/test/browser_console_copy_entire_message_context_menu.js 03:57:26 INFO - ++DOCSHELL 0x100386000 == 24 [pid = 1722] [id = 85] 03:57:26 INFO - ++DOMWINDOW == 53 (0x127325800) [pid = 1722] [serial = 201] [outer = 0x0] 03:57:26 INFO - ++DOMWINDOW == 54 (0x12f15a800) [pid = 1722] [serial = 202] [outer = 0x127325800] 03:57:26 INFO - ++DOMWINDOW == 55 (0x12ff1f400) [pid = 1722] [serial = 203] [outer = 0x127325800] 03:57:26 INFO - ++DOCSHELL 0x12f23b800 == 25 [pid = 1722] [id = 86] 03:57:26 INFO - ++DOMWINDOW == 56 (0x12f25c400) [pid = 1722] [serial = 204] [outer = 0x0] 03:57:26 INFO - ++DOMWINDOW == 57 (0x12f59a800) [pid = 1722] [serial = 205] [outer = 0x12f25c400] 03:57:26 INFO - ++DOMWINDOW == 58 (0x121160400) [pid = 1722] [serial = 206] [outer = 0x12f25c400] 03:57:26 INFO - ++DOCSHELL 0x12f90c800 == 26 [pid = 1722] [id = 87] 03:57:26 INFO - ++DOMWINDOW == 59 (0x12ff17400) [pid = 1722] [serial = 207] [outer = 0x0] 03:57:26 INFO - ++DOMWINDOW == 60 (0x12ff18800) [pid = 1722] [serial = 208] [outer = 0x12ff17400] 03:57:28 INFO - --DOCSHELL 0x12469a800 == 25 [pid = 1722] [id = 75] 03:57:28 INFO - --DOCSHELL 0x11ee49000 == 24 [pid = 1722] [id = 70] 03:57:28 INFO - --DOCSHELL 0x113319800 == 23 [pid = 1722] [id = 69] 03:57:28 INFO - --DOCSHELL 0x12c26c800 == 22 [pid = 1722] [id = 83] 03:57:28 INFO - --DOCSHELL 0x113512800 == 21 [pid = 1722] [id = 71] 03:57:28 INFO - --DOCSHELL 0x12f90c800 == 20 [pid = 1722] [id = 87] 03:57:28 INFO - --DOCSHELL 0x124ac8800 == 19 [pid = 1722] [id = 76] 03:57:28 INFO - --DOCSHELL 0x11ee3e000 == 18 [pid = 1722] [id = 74] 03:57:28 INFO - --DOCSHELL 0x11efdc800 == 17 [pid = 1722] [id = 77] 03:57:28 INFO - --DOCSHELL 0x1252ed800 == 16 [pid = 1722] [id = 78] 03:57:28 INFO - --DOCSHELL 0x121885000 == 15 [pid = 1722] [id = 79] 03:57:28 INFO - --DOMWINDOW == 59 (0x12ee0bc00) [pid = 1722] [serial = 164] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:28 INFO - --DOMWINDOW == 58 (0x124394800) [pid = 1722] [serial = 160] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 57 (0x121115000) [pid = 1722] [serial = 158] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:28 INFO - --DOMWINDOW == 56 (0x1203dd400) [pid = 1722] [serial = 182] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:28 INFO - --DOMWINDOW == 55 (0x124391400) [pid = 1722] [serial = 180] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:28 INFO - --DOMWINDOW == 54 (0x11eefb000) [pid = 1722] [serial = 168] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:57:28 INFO - --DOMWINDOW == 53 (0x113e11400) [pid = 1722] [serial = 166] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 52 (0x113d0d800) [pid = 1722] [serial = 176] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 51 (0x126144c00) [pid = 1722] [serial = 190] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 50 (0x12ee12800) [pid = 1722] [serial = 191] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 49 (0x12f2c0400) [pid = 1722] [serial = 195] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 48 (0x1241d8800) [pid = 1722] [serial = 174] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:28 INFO - --DOMWINDOW == 47 (0x1203e0c00) [pid = 1722] [serial = 171] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:28 INFO - --DOMWINDOW == 46 (0x113e0dc00) [pid = 1722] [serial = 177] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 45 (0x114bfe400) [pid = 1722] [serial = 167] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 44 (0x12f59a800) [pid = 1722] [serial = 205] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 43 (0x12f15a800) [pid = 1722] [serial = 202] [outer = 0x0] [url = about:blank] 03:57:28 INFO - --DOMWINDOW == 42 (0x1248e7c00) [pid = 1722] [serial = 170] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:57:28 INFO - MEMORY STAT | vsize 3371MB | residentFast 400MB | heapAllocated 105MB 03:57:28 INFO - 109 INFO TEST-OK | devtools/client/webconsole/test/browser_console_copy_entire_message_context_menu.js | took 2583ms 03:57:28 INFO - ++DOCSHELL 0x11320a000 == 16 [pid = 1722] [id = 88] 03:57:28 INFO - ++DOMWINDOW == 43 (0x114b1e400) [pid = 1722] [serial = 209] [outer = 0x0] 03:57:28 INFO - ++DOMWINDOW == 44 (0x114dbd000) [pid = 1722] [serial = 210] [outer = 0x114b1e400] 03:57:28 INFO - 110 INFO TEST-START | devtools/client/webconsole/test/browser_console_dead_objects.js 03:57:28 INFO - ++DOCSHELL 0x11efda000 == 17 [pid = 1722] [id = 89] 03:57:28 INFO - ++DOMWINDOW == 45 (0x11f109000) [pid = 1722] [serial = 211] [outer = 0x0] 03:57:28 INFO - ++DOMWINDOW == 46 (0x11f70ec00) [pid = 1722] [serial = 212] [outer = 0x11f109000] 03:57:29 INFO - ++DOCSHELL 0x1240c5000 == 18 [pid = 1722] [id = 90] 03:57:29 INFO - ++DOMWINDOW == 47 (0x121115000) [pid = 1722] [serial = 213] [outer = 0x0] 03:57:29 INFO - ++DOMWINDOW == 48 (0x121117c00) [pid = 1722] [serial = 214] [outer = 0x121115000] 03:57:29 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:29 INFO - ++DOCSHELL 0x127346000 == 19 [pid = 1722] [id = 91] 03:57:29 INFO - ++DOMWINDOW == 49 (0x1215a2c00) [pid = 1722] [serial = 215] [outer = 0x0] 03:57:29 INFO - ++DOMWINDOW == 50 (0x126486c00) [pid = 1722] [serial = 216] [outer = 0x1215a2c00] 03:57:29 INFO - MEMORY STAT | vsize 3384MB | residentFast 410MB | heapAllocated 113MB 03:57:29 INFO - 111 INFO TEST-OK | devtools/client/webconsole/test/browser_console_dead_objects.js | took 1286ms 03:57:29 INFO - ++DOCSHELL 0x12468d800 == 20 [pid = 1722] [id = 92] 03:57:29 INFO - ++DOMWINDOW == 51 (0x12504cc00) [pid = 1722] [serial = 217] [outer = 0x0] 03:57:30 INFO - ++DOMWINDOW == 52 (0x1250b0400) [pid = 1722] [serial = 218] [outer = 0x12504cc00] 03:57:30 INFO - 112 INFO TEST-START | devtools/client/webconsole/test/browser_console_error_source_click.js 03:57:30 INFO - ++DOCSHELL 0x114b7c000 == 21 [pid = 1722] [id = 93] 03:57:30 INFO - ++DOMWINDOW == 53 (0x129d12c00) [pid = 1722] [serial = 219] [outer = 0x0] 03:57:30 INFO - ++DOMWINDOW == 54 (0x12a16fc00) [pid = 1722] [serial = 220] [outer = 0x129d12c00] 03:57:30 INFO - ++DOCSHELL 0x11eeb5800 == 22 [pid = 1722] [id = 94] 03:57:30 INFO - ++DOMWINDOW == 55 (0x11f10b800) [pid = 1722] [serial = 221] [outer = 0x0] 03:57:30 INFO - ++DOMWINDOW == 56 (0x121161400) [pid = 1722] [serial = 222] [outer = 0x11f10b800] 03:57:30 INFO - JavaScript error: data:text/html;charset=utf8,

hello%20world%20from%20bug%20877778%20click!, line 1: ReferenceError: foobar is not defined 03:57:30 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:31 INFO - MEMORY STAT | vsize 3380MB | residentFast 404MB | heapAllocated 114MB 03:57:31 INFO - 113 INFO TEST-OK | devtools/client/webconsole/test/browser_console_error_source_click.js | took 1029ms 03:57:31 INFO - ++DOCSHELL 0x113e4a000 == 23 [pid = 1722] [id = 95] 03:57:31 INFO - ++DOMWINDOW == 57 (0x1221bb400) [pid = 1722] [serial = 223] [outer = 0x0] 03:57:31 INFO - ++DOMWINDOW == 58 (0x122336000) [pid = 1722] [serial = 224] [outer = 0x1221bb400] 03:57:31 INFO - 114 INFO TEST-START | devtools/client/webconsole/test/browser_console_filters.js 03:57:31 INFO - ++DOCSHELL 0x12ee6e000 == 24 [pid = 1722] [id = 96] 03:57:31 INFO - ++DOMWINDOW == 59 (0x12504d000) [pid = 1722] [serial = 225] [outer = 0x0] 03:57:31 INFO - ++DOMWINDOW == 60 (0x12d40bc00) [pid = 1722] [serial = 226] [outer = 0x12504d000] 03:57:31 INFO - ++DOCSHELL 0x12ee79800 == 25 [pid = 1722] [id = 97] 03:57:31 INFO - ++DOMWINDOW == 61 (0x127075000) [pid = 1722] [serial = 227] [outer = 0x0] 03:57:31 INFO - ++DOMWINDOW == 62 (0x12e0efc00) [pid = 1722] [serial = 228] [outer = 0x127075000] 03:57:31 INFO - ++DOMWINDOW == 63 (0x12f264000) [pid = 1722] [serial = 229] [outer = 0x127075000] 03:57:31 INFO - ++DOCSHELL 0x12f6ce800 == 26 [pid = 1722] [id = 98] 03:57:31 INFO - ++DOMWINDOW == 64 (0x12f2bdc00) [pid = 1722] [serial = 230] [outer = 0x0] 03:57:31 INFO - ++DOMWINDOW == 65 (0x12f2c0c00) [pid = 1722] [serial = 231] [outer = 0x12f2bdc00] 03:57:33 INFO - --DOCSHELL 0x11330a000 == 25 [pid = 1722] [id = 73] 03:57:33 INFO - --DOCSHELL 0x114b80800 == 24 [pid = 1722] [id = 81] 03:57:33 INFO - --DOCSHELL 0x100386000 == 23 [pid = 1722] [id = 85] 03:57:33 INFO - --DOCSHELL 0x112ba5000 == 22 [pid = 1722] [id = 80] 03:57:33 INFO - --DOCSHELL 0x125714800 == 21 [pid = 1722] [id = 84] 03:57:33 INFO - --DOCSHELL 0x12f6ce800 == 20 [pid = 1722] [id = 98] 03:57:33 INFO - --DOCSHELL 0x12f23b800 == 19 [pid = 1722] [id = 86] 03:57:33 INFO - --DOCSHELL 0x12f119800 == 18 [pid = 1722] [id = 82] 03:57:33 INFO - --DOCSHELL 0x127346000 == 17 [pid = 1722] [id = 91] 03:57:33 INFO - --DOCSHELL 0x1240c5000 == 16 [pid = 1722] [id = 90] 03:57:33 INFO - --DOCSHELL 0x11eeb5800 == 15 [pid = 1722] [id = 94] 03:57:33 INFO - --DOMWINDOW == 64 (0x124393c00) [pid = 1722] [serial = 181] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 63 (0x126480800) [pid = 1722] [serial = 183] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 62 (0x12110b400) [pid = 1722] [serial = 173] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:33 INFO - --DOMWINDOW == 61 (0x1241dec00) [pid = 1722] [serial = 175] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 60 (0x1257d0800) [pid = 1722] [serial = 192] [outer = 0x0] [url = data:text/html;charset=utf-8,%20%20

%20%20%20%20

Testing%20copy%20command

%20%20%20%20

This%20is%20some%20example%20text

%20%20%20%20Lorem%20ipsum%20dolor%20sit%20amet,%20consectetur%20adipisicing%20elit,%20sed%20do%20eiusmod%20tempor%20incididunt%20ut%20labore%20et%20dolore%20magna%20aliqua.%20Ut%20enim%20ad%20minim%20veniam,%20quis%20nostrud%20exercitation%20ullamco%20laboris%20nisi%20ut%20aliquip%20ex%20ea%20commodo%20consequat.%20Duis%20aute%20irure%20dolor%20in%20reprehenderit%20in%20voluptate%20velit%20esse%20cillum%20dolore%20eu%20fugiat%20nulla%20pariatur.%20Excepteur%20sint%20occaecat%20cupidatat%20non%20proident,%20sunt%20in%20culpa%20qui%20officia%20deserunt%20mollit%20anim%20id%20est%20laborum.Tue%20Nov%2003%202015%2003:57:23%20GMT-0800%20(PST)

%20%20
%20%20

] 03:57:33 INFO - --DOMWINDOW == 59 (0x121828800) [pid = 1722] [serial = 199] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 58 (0x127325800) [pid = 1722] [serial = 201] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:57:33 INFO - --DOMWINDOW == 57 (0x114b1e400) [pid = 1722] [serial = 209] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 56 (0x11f109000) [pid = 1722] [serial = 211] [outer = 0x0] [url = data:text/html;charset=utf8,

dead%20objects!] 03:57:33 INFO - --DOMWINDOW == 55 (0x1215a2c00) [pid = 1722] [serial = 215] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:33 INFO - --DOMWINDOW == 54 (0x121115000) [pid = 1722] [serial = 213] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:33 INFO - --DOMWINDOW == 53 (0x12e0efc00) [pid = 1722] [serial = 228] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 52 (0x12ff17400) [pid = 1722] [serial = 207] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:33 INFO - --DOMWINDOW == 51 (0x12e0f0000) [pid = 1722] [serial = 194] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:33 INFO - --DOMWINDOW == 50 (0x12f5a3000) [pid = 1722] [serial = 197] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:33 INFO - --DOMWINDOW == 49 (0x12f25c400) [pid = 1722] [serial = 204] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:33 INFO - --DOMWINDOW == 48 (0x1221ba400) [pid = 1722] [serial = 188] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:33 INFO - --DOMWINDOW == 47 (0x11f710c00) [pid = 1722] [serial = 178] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:33 INFO - --DOMWINDOW == 46 (0x120d16400) [pid = 1722] [serial = 184] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:33 INFO - --DOMWINDOW == 45 (0x1257ce400) [pid = 1722] [serial = 186] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:33 INFO - --DOMWINDOW == 44 (0x129d12c00) [pid = 1722] [serial = 219] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20world%20from%20bug%20877778%20click!] 03:57:33 INFO - --DOMWINDOW == 43 (0x11f10b800) [pid = 1722] [serial = 221] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:33 INFO - --DOMWINDOW == 42 (0x12504cc00) [pid = 1722] [serial = 217] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 41 (0x1250b0400) [pid = 1722] [serial = 218] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 40 (0x12e0ec000) [pid = 1722] [serial = 193] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 39 (0x12613ec00) [pid = 1722] [serial = 200] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 38 (0x114dbd000) [pid = 1722] [serial = 210] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 37 (0x11f70ec00) [pid = 1722] [serial = 212] [outer = 0x0] [url = about:blank] 03:57:33 INFO - --DOMWINDOW == 36 (0x12ff1f400) [pid = 1722] [serial = 203] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:57:33 INFO - ++DOCSHELL 0x113510800 == 16 [pid = 1722] [id = 99] 03:57:33 INFO - ++DOMWINDOW == 37 (0x114b2d400) [pid = 1722] [serial = 232] [outer = 0x0] 03:57:33 INFO - ++DOMWINDOW == 38 (0x114bfe000) [pid = 1722] [serial = 233] [outer = 0x114b2d400] 03:57:34 INFO - MEMORY STAT | vsize 3378MB | residentFast 401MB | heapAllocated 104MB 03:57:34 INFO - 115 INFO TEST-OK | devtools/client/webconsole/test/browser_console_filters.js | took 2927ms 03:57:34 INFO - ++DOCSHELL 0x11ee29800 == 17 [pid = 1722] [id = 100] 03:57:34 INFO - ++DOMWINDOW == 39 (0x12110b000) [pid = 1722] [serial = 234] [outer = 0x0] 03:57:34 INFO - ++DOMWINDOW == 40 (0x1215dd400) [pid = 1722] [serial = 235] [outer = 0x12110b000] 03:57:34 INFO - 116 INFO TEST-START | devtools/client/webconsole/test/browser_console_hide_jsterm_when_devtools_chrome_enabled_false.js 03:57:34 INFO - ++DOCSHELL 0x124867000 == 18 [pid = 1722] [id = 101] 03:57:34 INFO - ++DOMWINDOW == 41 (0x122d42000) [pid = 1722] [serial = 236] [outer = 0x0] 03:57:34 INFO - ++DOMWINDOW == 42 (0x122d44c00) [pid = 1722] [serial = 237] [outer = 0x122d42000] 03:57:34 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:34 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:34 INFO - ++DOCSHELL 0x11eeb5800 == 19 [pid = 1722] [id = 102] 03:57:34 INFO - ++DOMWINDOW == 43 (0x120ff3000) [pid = 1722] [serial = 238] [outer = 0x0] 03:57:34 INFO - ++DOMWINDOW == 44 (0x120ff8800) [pid = 1722] [serial = 239] [outer = 0x120ff3000] 03:57:34 INFO - ++DOCSHELL 0x12a156000 == 20 [pid = 1722] [id = 103] 03:57:34 INFO - ++DOMWINDOW == 45 (0x1266eb800) [pid = 1722] [serial = 240] [outer = 0x0] 03:57:34 INFO - ++DOMWINDOW == 46 (0x127325800) [pid = 1722] [serial = 241] [outer = 0x1266eb800] 03:57:35 INFO - ++DOCSHELL 0x113517800 == 21 [pid = 1722] [id = 104] 03:57:35 INFO - ++DOMWINDOW == 47 (0x1276a6800) [pid = 1722] [serial = 242] [outer = 0x0] 03:57:35 INFO - ++DOMWINDOW == 48 (0x129d07c00) [pid = 1722] [serial = 243] [outer = 0x1276a6800] 03:57:35 INFO - ++DOMWINDOW == 49 (0x12d4f3400) [pid = 1722] [serial = 244] [outer = 0x1276a6800] 03:57:35 INFO - ++DOCSHELL 0x12f239000 == 22 [pid = 1722] [id = 105] 03:57:35 INFO - ++DOMWINDOW == 50 (0x12efb9800) [pid = 1722] [serial = 245] [outer = 0x0] 03:57:35 INFO - ++DOMWINDOW == 51 (0x12efba400) [pid = 1722] [serial = 246] [outer = 0x12efb9800] 03:57:36 INFO - ++DOCSHELL 0x11eb95000 == 23 [pid = 1722] [id = 106] 03:57:36 INFO - ++DOMWINDOW == 52 (0x12f1b5800) [pid = 1722] [serial = 247] [outer = 0x0] 03:57:36 INFO - ++DOMWINDOW == 53 (0x12f263800) [pid = 1722] [serial = 248] [outer = 0x12f1b5800] 03:57:37 INFO - --DOCSHELL 0x11efda000 == 22 [pid = 1722] [id = 89] 03:57:37 INFO - --DOCSHELL 0x114b7c000 == 21 [pid = 1722] [id = 93] 03:57:37 INFO - --DOCSHELL 0x11320a000 == 20 [pid = 1722] [id = 88] 03:57:37 INFO - --DOCSHELL 0x12ee79800 == 19 [pid = 1722] [id = 97] 03:57:37 INFO - --DOCSHELL 0x12468d800 == 18 [pid = 1722] [id = 92] 03:57:37 INFO - --DOMWINDOW == 52 (0x12f2c3000) [pid = 1722] [serial = 196] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:37 INFO - --DOMWINDOW == 51 (0x121160400) [pid = 1722] [serial = 206] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:37 INFO - --DOMWINDOW == 50 (0x11f71a000) [pid = 1722] [serial = 179] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 49 (0x120d1dc00) [pid = 1722] [serial = 185] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 48 (0x121117c00) [pid = 1722] [serial = 214] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 47 (0x126486c00) [pid = 1722] [serial = 216] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 46 (0x12ff18800) [pid = 1722] [serial = 208] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 45 (0x12f5a4400) [pid = 1722] [serial = 198] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 44 (0x126143000) [pid = 1722] [serial = 187] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 43 (0x125740800) [pid = 1722] [serial = 189] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 42 (0x12a16fc00) [pid = 1722] [serial = 220] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 41 (0x121161400) [pid = 1722] [serial = 222] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 40 (0x122336000) [pid = 1722] [serial = 224] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 39 (0x12d40bc00) [pid = 1722] [serial = 226] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 38 (0x129d07c00) [pid = 1722] [serial = 243] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 37 (0x12f2bdc00) [pid = 1722] [serial = 230] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:37 INFO - --DOMWINDOW == 36 (0x127075000) [pid = 1722] [serial = 227] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:37 INFO - --DOMWINDOW == 35 (0x1221bb400) [pid = 1722] [serial = 223] [outer = 0x0] [url = about:blank] 03:57:37 INFO - --DOMWINDOW == 34 (0x12504d000) [pid = 1722] [serial = 225] [outer = 0x0] [url = data:text/html;charset=utf8,

browser%20console%20filters] 03:57:37 INFO - ++DOCSHELL 0x1140c4000 == 19 [pid = 1722] [id = 107] 03:57:37 INFO - ++DOMWINDOW == 35 (0x113e11400) [pid = 1722] [serial = 249] [outer = 0x0] 03:57:37 INFO - ++DOMWINDOW == 36 (0x114b57000) [pid = 1722] [serial = 250] [outer = 0x113e11400] 03:57:37 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:37 INFO - ++DOCSHELL 0x11284d000 == 20 [pid = 1722] [id = 108] 03:57:37 INFO - ++DOMWINDOW == 37 (0x121116000) [pid = 1722] [serial = 251] [outer = 0x0] 03:57:37 INFO - ++DOMWINDOW == 38 (0x121536800) [pid = 1722] [serial = 252] [outer = 0x121116000] 03:57:37 INFO - ++DOCSHELL 0x12469e800 == 21 [pid = 1722] [id = 109] 03:57:37 INFO - ++DOMWINDOW == 39 (0x122335000) [pid = 1722] [serial = 253] [outer = 0x0] 03:57:37 INFO - ++DOMWINDOW == 40 (0x122336800) [pid = 1722] [serial = 254] [outer = 0x122335000] 03:57:38 INFO - ++DOMWINDOW == 41 (0x1223e9400) [pid = 1722] [serial = 255] [outer = 0x122335000] 03:57:38 INFO - ++DOCSHELL 0x12734f800 == 22 [pid = 1722] [id = 110] 03:57:38 INFO - ++DOMWINDOW == 42 (0x125740800) [pid = 1722] [serial = 256] [outer = 0x0] 03:57:38 INFO - ++DOMWINDOW == 43 (0x12574b800) [pid = 1722] [serial = 257] [outer = 0x125740800] 03:57:39 INFO - ++DOCSHELL 0x12f6c1000 == 23 [pid = 1722] [id = 111] 03:57:39 INFO - ++DOMWINDOW == 44 (0x12efbd000) [pid = 1722] [serial = 258] [outer = 0x0] 03:57:39 INFO - ++DOMWINDOW == 45 (0x12f263c00) [pid = 1722] [serial = 259] [outer = 0x12efbd000] 03:57:39 INFO - --DOCSHELL 0x113e4a000 == 22 [pid = 1722] [id = 95] 03:57:39 INFO - --DOCSHELL 0x12ee6e000 == 21 [pid = 1722] [id = 96] 03:57:39 INFO - --DOCSHELL 0x12f239000 == 20 [pid = 1722] [id = 105] 03:57:39 INFO - --DOCSHELL 0x11eb95000 == 19 [pid = 1722] [id = 106] 03:57:39 INFO - --DOCSHELL 0x113510800 == 18 [pid = 1722] [id = 99] 03:57:39 INFO - --DOCSHELL 0x113517800 == 17 [pid = 1722] [id = 104] 03:57:39 INFO - --DOCSHELL 0x11eeb5800 == 16 [pid = 1722] [id = 102] 03:57:39 INFO - --DOCSHELL 0x124867000 == 15 [pid = 1722] [id = 101] 03:57:39 INFO - --DOMWINDOW == 44 (0x12f2c0c00) [pid = 1722] [serial = 231] [outer = 0x0] [url = about:blank] 03:57:39 INFO - --DOMWINDOW == 43 (0x12f264000) [pid = 1722] [serial = 229] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:40 INFO - --DOMWINDOW == 42 (0x120ff3000) [pid = 1722] [serial = 238] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:40 INFO - --DOMWINDOW == 41 (0x12f1b5800) [pid = 1722] [serial = 247] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:40 INFO - --DOMWINDOW == 40 (0x122336800) [pid = 1722] [serial = 254] [outer = 0x0] [url = about:blank] 03:57:40 INFO - --DOMWINDOW == 39 (0x114b2d400) [pid = 1722] [serial = 232] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:40 INFO - MEMORY STAT | vsize 3378MB | residentFast 404MB | heapAllocated 103MB 03:57:40 INFO - 117 INFO TEST-OK | devtools/client/webconsole/test/browser_console_hide_jsterm_when_devtools_chrome_enabled_false.js | took 5954ms 03:57:40 INFO - ++DOCSHELL 0x113e44000 == 16 [pid = 1722] [id = 112] 03:57:40 INFO - ++DOMWINDOW == 40 (0x11eef1c00) [pid = 1722] [serial = 260] [outer = 0x0] 03:57:40 INFO - ++DOMWINDOW == 41 (0x11ef54800) [pid = 1722] [serial = 261] [outer = 0x11eef1c00] 03:57:40 INFO - 118 INFO TEST-START | devtools/client/webconsole/test/browser_console_history_persist.js 03:57:40 INFO - ++DOCSHELL 0x11f646000 == 17 [pid = 1722] [id = 113] 03:57:40 INFO - ++DOMWINDOW == 42 (0x120fe6800) [pid = 1722] [serial = 262] [outer = 0x0] 03:57:40 INFO - ++DOMWINDOW == 43 (0x120ffa400) [pid = 1722] [serial = 263] [outer = 0x120fe6800] 03:57:40 INFO - ++DOCSHELL 0x113e45800 == 18 [pid = 1722] [id = 114] 03:57:40 INFO - ++DOMWINDOW == 44 (0x120ffec00) [pid = 1722] [serial = 264] [outer = 0x0] 03:57:40 INFO - ++DOMWINDOW == 45 (0x12211a400) [pid = 1722] [serial = 265] [outer = 0x120ffec00] 03:57:40 INFO - ++DOMWINDOW == 46 (0x122334000) [pid = 1722] [serial = 266] [outer = 0x120ffec00] 03:57:40 INFO - ++DOCSHELL 0x1252f7000 == 19 [pid = 1722] [id = 115] 03:57:40 INFO - ++DOMWINDOW == 47 (0x12532c800) [pid = 1722] [serial = 267] [outer = 0x0] 03:57:40 INFO - ++DOMWINDOW == 48 (0x12561c800) [pid = 1722] [serial = 268] [outer = 0x12532c800] 03:57:41 INFO - ++DOCSHELL 0x12d42e000 == 20 [pid = 1722] [id = 116] 03:57:41 INFO - ++DOMWINDOW == 49 (0x12ee18000) [pid = 1722] [serial = 269] [outer = 0x0] 03:57:41 INFO - ++DOMWINDOW == 50 (0x12efb9c00) [pid = 1722] [serial = 270] [outer = 0x12ee18000] 03:57:41 INFO - ++DOCSHELL 0x12ee68800 == 21 [pid = 1722] [id = 117] 03:57:41 INFO - ++DOMWINDOW == 51 (0x12a16bc00) [pid = 1722] [serial = 271] [outer = 0x0] 03:57:41 INFO - ++DOMWINDOW == 52 (0x12a16e000) [pid = 1722] [serial = 272] [outer = 0x12a16bc00] 03:57:42 INFO - ++DOMWINDOW == 53 (0x12f4d2800) [pid = 1722] [serial = 273] [outer = 0x12a16bc00] 03:57:42 INFO - ++DOCSHELL 0x12f6d5800 == 22 [pid = 1722] [id = 118] 03:57:42 INFO - ++DOMWINDOW == 54 (0x12f5a4000) [pid = 1722] [serial = 274] [outer = 0x0] 03:57:42 INFO - ++DOMWINDOW == 55 (0x12f78d400) [pid = 1722] [serial = 275] [outer = 0x12f5a4000] 03:57:43 INFO - ++DOCSHELL 0x12faa1800 == 23 [pid = 1722] [id = 119] 03:57:43 INFO - ++DOMWINDOW == 56 (0x12ff49800) [pid = 1722] [serial = 276] [outer = 0x0] 03:57:43 INFO - ++DOMWINDOW == 57 (0x12ff4bc00) [pid = 1722] [serial = 277] [outer = 0x12ff49800] 03:57:43 INFO - ++DOCSHELL 0x12fdc1800 == 24 [pid = 1722] [id = 120] 03:57:43 INFO - ++DOMWINDOW == 58 (0x12fccf800) [pid = 1722] [serial = 278] [outer = 0x0] 03:57:43 INFO - ++DOMWINDOW == 59 (0x12ff1ec00) [pid = 1722] [serial = 279] [outer = 0x12fccf800] 03:57:43 INFO - ++DOMWINDOW == 60 (0x12ffc4800) [pid = 1722] [serial = 280] [outer = 0x12fccf800] 03:57:43 INFO - ++DOCSHELL 0x12ff7d000 == 25 [pid = 1722] [id = 121] 03:57:43 INFO - ++DOMWINDOW == 61 (0x1276adc00) [pid = 1722] [serial = 281] [outer = 0x0] 03:57:43 INFO - ++DOMWINDOW == 62 (0x12ffc6c00) [pid = 1722] [serial = 282] [outer = 0x1276adc00] 03:57:44 INFO - ++DOCSHELL 0x112b45800 == 26 [pid = 1722] [id = 122] 03:57:44 INFO - ++DOMWINDOW == 63 (0x11513a400) [pid = 1722] [serial = 283] [outer = 0x0] 03:57:44 INFO - ++DOMWINDOW == 64 (0x11ee59c00) [pid = 1722] [serial = 284] [outer = 0x11513a400] 03:57:44 INFO - ++DOCSHELL 0x12446e800 == 27 [pid = 1722] [id = 123] 03:57:44 INFO - ++DOMWINDOW == 65 (0x124395800) [pid = 1722] [serial = 285] [outer = 0x0] 03:57:44 INFO - ++DOMWINDOW == 66 (0x1250b3800) [pid = 1722] [serial = 286] [outer = 0x124395800] 03:57:44 INFO - ++DOMWINDOW == 67 (0x126142000) [pid = 1722] [serial = 287] [outer = 0x124395800] 03:57:44 INFO - ++DOCSHELL 0x12f123800 == 28 [pid = 1722] [id = 124] 03:57:44 INFO - ++DOMWINDOW == 68 (0x12c374000) [pid = 1722] [serial = 288] [outer = 0x0] 03:57:44 INFO - ++DOMWINDOW == 69 (0x12ee12400) [pid = 1722] [serial = 289] [outer = 0x12c374000] 03:57:45 INFO - ++DOCSHELL 0x12ff89000 == 29 [pid = 1722] [id = 125] 03:57:45 INFO - ++DOMWINDOW == 70 (0x112982800) [pid = 1722] [serial = 290] [outer = 0x0] 03:57:45 INFO - ++DOMWINDOW == 71 (0x1247c4800) [pid = 1722] [serial = 291] [outer = 0x112982800] 03:57:46 INFO - ++DOCSHELL 0x1301ab800 == 30 [pid = 1722] [id = 126] 03:57:46 INFO - ++DOMWINDOW == 72 (0x12130e000) [pid = 1722] [serial = 292] [outer = 0x0] 03:57:46 INFO - ++DOMWINDOW == 73 (0x12130f000) [pid = 1722] [serial = 293] [outer = 0x12130e000] 03:57:46 INFO - ++DOMWINDOW == 74 (0x121313400) [pid = 1722] [serial = 294] [outer = 0x12130e000] 03:57:46 INFO - ++DOCSHELL 0x130f45800 == 31 [pid = 1722] [id = 127] 03:57:46 INFO - ++DOMWINDOW == 75 (0x113d03800) [pid = 1722] [serial = 295] [outer = 0x0] 03:57:46 INFO - ++DOMWINDOW == 76 (0x130b6bc00) [pid = 1722] [serial = 296] [outer = 0x113d03800] 03:57:47 INFO - --DOCSHELL 0x12734f800 == 30 [pid = 1722] [id = 110] 03:57:47 INFO - --DOCSHELL 0x12f6c1000 == 29 [pid = 1722] [id = 111] 03:57:47 INFO - --DOCSHELL 0x11ee29800 == 28 [pid = 1722] [id = 100] 03:57:47 INFO - --DOCSHELL 0x12469e800 == 27 [pid = 1722] [id = 109] 03:57:47 INFO - --DOCSHELL 0x12a156000 == 26 [pid = 1722] [id = 103] 03:57:47 INFO - --DOCSHELL 0x130f45800 == 25 [pid = 1722] [id = 127] 03:57:47 INFO - --DOCSHELL 0x11284d000 == 24 [pid = 1722] [id = 108] 03:57:47 INFO - --DOCSHELL 0x1140c4000 == 23 [pid = 1722] [id = 107] 03:57:47 INFO - --DOMWINDOW == 75 (0x114bfe000) [pid = 1722] [serial = 233] [outer = 0x0] [url = about:blank] 03:57:47 INFO - --DOMWINDOW == 74 (0x12f263800) [pid = 1722] [serial = 248] [outer = 0x0] [url = about:blank] 03:57:47 INFO - --DOMWINDOW == 73 (0x120ff8800) [pid = 1722] [serial = 239] [outer = 0x0] [url = about:blank] 03:57:48 INFO - --DOMWINDOW == 72 (0x121116000) [pid = 1722] [serial = 251] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:48 INFO - --DOMWINDOW == 71 (0x12efbd000) [pid = 1722] [serial = 258] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:48 INFO - --DOMWINDOW == 70 (0x122335000) [pid = 1722] [serial = 253] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:48 INFO - --DOMWINDOW == 69 (0x125740800) [pid = 1722] [serial = 256] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:48 INFO - --DOMWINDOW == 68 (0x12efb9800) [pid = 1722] [serial = 245] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:48 INFO - --DOMWINDOW == 67 (0x1276a6800) [pid = 1722] [serial = 242] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:48 INFO - --DOMWINDOW == 66 (0x113e11400) [pid = 1722] [serial = 249] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:48 INFO - --DOMWINDOW == 65 (0x122d42000) [pid = 1722] [serial = 236] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:48 INFO - --DOMWINDOW == 64 (0x1266eb800) [pid = 1722] [serial = 240] [outer = 0x0] [url = data:text/html;charset=utf8,hello%20world] 03:57:48 INFO - --DOMWINDOW == 63 (0x12110b000) [pid = 1722] [serial = 234] [outer = 0x0] [url = about:blank] 03:57:48 INFO - --DOMWINDOW == 62 (0x127325800) [pid = 1722] [serial = 241] [outer = 0x0] [url = about:blank] 03:57:48 INFO - --DOMWINDOW == 61 (0x1215dd400) [pid = 1722] [serial = 235] [outer = 0x0] [url = about:blank] 03:57:48 INFO - --DOMWINDOW == 60 (0x12ff1ec00) [pid = 1722] [serial = 279] [outer = 0x0] [url = about:blank] 03:57:48 INFO - --DOMWINDOW == 59 (0x12a16e000) [pid = 1722] [serial = 272] [outer = 0x0] [url = about:blank] 03:57:48 INFO - --DOMWINDOW == 58 (0x12211a400) [pid = 1722] [serial = 265] [outer = 0x0] [url = about:blank] 03:57:48 INFO - --DOMWINDOW == 57 (0x12130f000) [pid = 1722] [serial = 293] [outer = 0x0] [url = about:blank] 03:57:48 INFO - --DOMWINDOW == 56 (0x1250b3800) [pid = 1722] [serial = 286] [outer = 0x0] [url = about:blank] 03:57:48 INFO - --DOCSHELL 0x12f123800 == 22 [pid = 1722] [id = 124] 03:57:48 INFO - --DOCSHELL 0x12ff7d000 == 21 [pid = 1722] [id = 121] 03:57:48 INFO - --DOCSHELL 0x12f6d5800 == 20 [pid = 1722] [id = 118] 03:57:48 INFO - --DOCSHELL 0x1252f7000 == 19 [pid = 1722] [id = 115] 03:57:48 INFO - MEMORY STAT | vsize 3382MB | residentFast 409MB | heapAllocated 111MB 03:57:48 INFO - 119 INFO TEST-OK | devtools/client/webconsole/test/browser_console_history_persist.js | took 8382ms 03:57:48 INFO - ++DOCSHELL 0x120eb0800 == 20 [pid = 1722] [id = 128] 03:57:48 INFO - ++DOMWINDOW == 57 (0x113e0bc00) [pid = 1722] [serial = 297] [outer = 0x0] 03:57:48 INFO - ++DOMWINDOW == 58 (0x114bf0c00) [pid = 1722] [serial = 298] [outer = 0x113e0bc00] 03:57:48 INFO - 120 INFO TEST-START | devtools/client/webconsole/test/browser_console_iframe_messages.js 03:57:48 INFO - ++DOCSHELL 0x124211800 == 21 [pid = 1722] [id = 129] 03:57:48 INFO - ++DOMWINDOW == 59 (0x1202e5c00) [pid = 1722] [serial = 299] [outer = 0x0] 03:57:48 INFO - ++DOMWINDOW == 60 (0x1203e4400) [pid = 1722] [serial = 300] [outer = 0x1202e5c00] 03:57:49 INFO - ++DOMWINDOW == 61 (0x120e30c00) [pid = 1722] [serial = 301] [outer = 0x1202e5c00] 03:57:49 INFO - ++DOCSHELL 0x11320a000 == 22 [pid = 1722] [id = 130] 03:57:49 INFO - ++DOMWINDOW == 62 (0x120e2d000) [pid = 1722] [serial = 302] [outer = 0x0] 03:57:49 INFO - ++DOCSHELL 0x120ea5000 == 23 [pid = 1722] [id = 131] 03:57:49 INFO - ++DOMWINDOW == 63 (0x12110b400) [pid = 1722] [serial = 303] [outer = 0x0] 03:57:49 INFO - ++DOCSHELL 0x125064800 == 24 [pid = 1722] [id = 132] 03:57:49 INFO - ++DOMWINDOW == 64 (0x121113400) [pid = 1722] [serial = 304] [outer = 0x0] 03:57:49 INFO - ++DOMWINDOW == 65 (0x121160000) [pid = 1722] [serial = 305] [outer = 0x120e2d000] 03:57:49 INFO - ++DOMWINDOW == 66 (0x12130a800) [pid = 1722] [serial = 306] [outer = 0x12110b400] 03:57:49 INFO - ++DOMWINDOW == 67 (0x121311400) [pid = 1722] [serial = 307] [outer = 0x121113400] 03:57:49 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html, line 5: ReferenceError: blah is not defined 03:57:49 INFO - ++DOCSHELL 0x125068800 == 25 [pid = 1722] [id = 133] 03:57:49 INFO - ++DOMWINDOW == 68 (0x121312800) [pid = 1722] [serial = 308] [outer = 0x0] 03:57:49 INFO - ++DOMWINDOW == 69 (0x121311c00) [pid = 1722] [serial = 309] [outer = 0x121312800] 03:57:49 INFO - ++DOCSHELL 0x12469d000 == 26 [pid = 1722] [id = 134] 03:57:49 INFO - ++DOMWINDOW == 70 (0x121315400) [pid = 1722] [serial = 310] [outer = 0x0] 03:57:49 INFO - ++DOMWINDOW == 71 (0x121316c00) [pid = 1722] [serial = 311] [outer = 0x121315400] 03:57:49 INFO - ++DOMWINDOW == 72 (0x120159c00) [pid = 1722] [serial = 312] [outer = 0x121315400] 03:57:49 INFO - ++DOCSHELL 0x12f22a800 == 27 [pid = 1722] [id = 135] 03:57:49 INFO - ++DOMWINDOW == 73 (0x1247c2800) [pid = 1722] [serial = 313] [outer = 0x0] 03:57:49 INFO - ++DOMWINDOW == 74 (0x1247c3400) [pid = 1722] [serial = 314] [outer = 0x1247c2800] 03:57:51 INFO - --DOCSHELL 0x113e45800 == 26 [pid = 1722] [id = 114] 03:57:51 INFO - --DOCSHELL 0x12f22a800 == 25 [pid = 1722] [id = 135] 03:57:51 INFO - --DOCSHELL 0x12ff89000 == 24 [pid = 1722] [id = 125] 03:57:51 INFO - --DOCSHELL 0x112b45800 == 23 [pid = 1722] [id = 122] 03:57:51 INFO - --DOCSHELL 0x12446e800 == 22 [pid = 1722] [id = 123] 03:57:51 INFO - --DOCSHELL 0x12fdc1800 == 21 [pid = 1722] [id = 120] 03:57:51 INFO - --DOCSHELL 0x12ee68800 == 20 [pid = 1722] [id = 117] 03:57:51 INFO - --DOCSHELL 0x1301ab800 == 19 [pid = 1722] [id = 126] 03:57:51 INFO - --DOMWINDOW == 73 (0x12f263c00) [pid = 1722] [serial = 259] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 72 (0x121536800) [pid = 1722] [serial = 252] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 71 (0x114b57000) [pid = 1722] [serial = 250] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 70 (0x122d44c00) [pid = 1722] [serial = 237] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 69 (0x12574b800) [pid = 1722] [serial = 257] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 68 (0x12efba400) [pid = 1722] [serial = 246] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 67 (0x12d4f3400) [pid = 1722] [serial = 244] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:51 INFO - --DOMWINDOW == 66 (0x1223e9400) [pid = 1722] [serial = 255] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:51 INFO - --DOMWINDOW == 65 (0x12130e000) [pid = 1722] [serial = 292] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:51 INFO - --DOMWINDOW == 64 (0x113d03800) [pid = 1722] [serial = 295] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:51 INFO - --DOMWINDOW == 63 (0x112982800) [pid = 1722] [serial = 290] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 03:57:51 INFO - --DOMWINDOW == 62 (0x11513a400) [pid = 1722] [serial = 283] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 03:57:51 INFO - --DOMWINDOW == 61 (0x12ff49800) [pid = 1722] [serial = 276] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 03:57:51 INFO - --DOMWINDOW == 60 (0x12ee18000) [pid = 1722] [serial = 269] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 03:57:51 INFO - --DOMWINDOW == 59 (0x120fe6800) [pid = 1722] [serial = 262] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 03:57:51 INFO - --DOMWINDOW == 58 (0x11eef1c00) [pid = 1722] [serial = 260] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 57 (0x121316c00) [pid = 1722] [serial = 311] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 56 (0x1203e4400) [pid = 1722] [serial = 300] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 55 (0x1247c4800) [pid = 1722] [serial = 291] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 54 (0x11ee59c00) [pid = 1722] [serial = 284] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 53 (0x12ff4bc00) [pid = 1722] [serial = 277] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 52 (0x12efb9c00) [pid = 1722] [serial = 270] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 51 (0x120ffa400) [pid = 1722] [serial = 263] [outer = 0x0] [url = about:blank] 03:57:51 INFO - --DOMWINDOW == 50 (0x11ef54800) [pid = 1722] [serial = 261] [outer = 0x0] [url = about:blank] 03:57:51 INFO - ++DOCSHELL 0x113512800 == 20 [pid = 1722] [id = 136] 03:57:51 INFO - ++DOMWINDOW == 51 (0x112f40400) [pid = 1722] [serial = 315] [outer = 0x0] 03:57:51 INFO - ++DOMWINDOW == 52 (0x112f41800) [pid = 1722] [serial = 316] [outer = 0x112f40400] 03:57:52 INFO - MEMORY STAT | vsize 3392MB | residentFast 412MB | heapAllocated 109MB 03:57:52 INFO - 121 INFO TEST-OK | devtools/client/webconsole/test/browser_console_iframe_messages.js | took 3223ms 03:57:52 INFO - ++DOCSHELL 0x113e3a800 == 21 [pid = 1722] [id = 137] 03:57:52 INFO - ++DOMWINDOW == 53 (0x11eeef000) [pid = 1722] [serial = 317] [outer = 0x0] 03:57:52 INFO - ++DOMWINDOW == 54 (0x12015a800) [pid = 1722] [serial = 318] [outer = 0x11eeef000] 03:57:52 INFO - 122 INFO TEST-START | devtools/client/webconsole/test/browser_console_keyboard_accessibility.js 03:57:52 INFO - ++DOCSHELL 0x12468d000 == 22 [pid = 1722] [id = 138] 03:57:52 INFO - ++DOMWINDOW == 55 (0x121317000) [pid = 1722] [serial = 319] [outer = 0x0] 03:57:52 INFO - ++DOMWINDOW == 56 (0x121319800) [pid = 1722] [serial = 320] [outer = 0x121317000] 03:57:52 INFO - ++DOMWINDOW == 57 (0x126482400) [pid = 1722] [serial = 321] [outer = 0x121317000] 03:57:52 INFO - ++DOCSHELL 0x113516000 == 23 [pid = 1722] [id = 139] 03:57:52 INFO - ++DOMWINDOW == 58 (0x122336c00) [pid = 1722] [serial = 322] [outer = 0x0] 03:57:52 INFO - ++DOMWINDOW == 59 (0x1223e9400) [pid = 1722] [serial = 323] [outer = 0x122336c00] 03:57:52 INFO - ++DOMWINDOW == 60 (0x122d44c00) [pid = 1722] [serial = 324] [outer = 0x122336c00] 03:57:52 INFO - ++DOCSHELL 0x12d99d000 == 24 [pid = 1722] [id = 140] 03:57:52 INFO - ++DOMWINDOW == 61 (0x12504cc00) [pid = 1722] [serial = 325] [outer = 0x0] 03:57:52 INFO - ++DOMWINDOW == 62 (0x12504e000) [pid = 1722] [serial = 326] [outer = 0x12504cc00] 03:57:53 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:57:55 INFO - --DOCSHELL 0x113e44000 == 23 [pid = 1722] [id = 112] 03:57:55 INFO - --DOCSHELL 0x11f646000 == 22 [pid = 1722] [id = 113] 03:57:55 INFO - --DOCSHELL 0x12d99d000 == 21 [pid = 1722] [id = 140] 03:57:55 INFO - --DOCSHELL 0x12d42e000 == 20 [pid = 1722] [id = 116] 03:57:55 INFO - --DOCSHELL 0x12faa1800 == 19 [pid = 1722] [id = 119] 03:57:55 INFO - --DOCSHELL 0x12469d000 == 18 [pid = 1722] [id = 134] 03:57:55 INFO - --DOMWINDOW == 61 (0x130b6bc00) [pid = 1722] [serial = 296] [outer = 0x0] [url = about:blank] 03:57:55 INFO - --DOMWINDOW == 60 (0x121313400) [pid = 1722] [serial = 294] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:55 INFO - --DOMWINDOW == 59 (0x1276adc00) [pid = 1722] [serial = 281] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:55 INFO - --DOMWINDOW == 58 (0x1247c2800) [pid = 1722] [serial = 313] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:55 INFO - --DOMWINDOW == 57 (0x12fccf800) [pid = 1722] [serial = 278] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:55 INFO - --DOMWINDOW == 56 (0x120ffec00) [pid = 1722] [serial = 264] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:55 INFO - --DOMWINDOW == 55 (0x124395800) [pid = 1722] [serial = 285] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:55 INFO - --DOMWINDOW == 54 (0x12a16bc00) [pid = 1722] [serial = 271] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:55 INFO - --DOMWINDOW == 53 (0x12c374000) [pid = 1722] [serial = 288] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:55 INFO - --DOMWINDOW == 52 (0x121315400) [pid = 1722] [serial = 310] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:55 INFO - --DOMWINDOW == 51 (0x12532c800) [pid = 1722] [serial = 267] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:55 INFO - --DOMWINDOW == 50 (0x12f5a4000) [pid = 1722] [serial = 274] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:55 INFO - --DOMWINDOW == 49 (0x113e0bc00) [pid = 1722] [serial = 297] [outer = 0x0] [url = about:blank] 03:57:55 INFO - --DOMWINDOW == 48 (0x1202e5c00) [pid = 1722] [serial = 299] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-consoleiframes.html] 03:57:55 INFO - --DOMWINDOW == 47 (0x120e2d000) [pid = 1722] [serial = 302] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html] 03:57:55 INFO - --DOMWINDOW == 46 (0x121113400) [pid = 1722] [serial = 304] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe3.html] 03:57:55 INFO - --DOMWINDOW == 45 (0x121312800) [pid = 1722] [serial = 308] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html] 03:57:55 INFO - --DOMWINDOW == 44 (0x12110b400) [pid = 1722] [serial = 303] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html] 03:57:55 INFO - --DOMWINDOW == 43 (0x114bf0c00) [pid = 1722] [serial = 298] [outer = 0x0] [url = about:blank] 03:57:55 INFO - --DOMWINDOW == 42 (0x120e30c00) [pid = 1722] [serial = 301] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-consoleiframes.html] 03:57:55 INFO - --DOMWINDOW == 41 (0x121160000) [pid = 1722] [serial = 305] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html] 03:57:55 INFO - --DOMWINDOW == 40 (0x121311400) [pid = 1722] [serial = 307] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe3.html] 03:57:55 INFO - --DOMWINDOW == 39 (0x121311c00) [pid = 1722] [serial = 309] [outer = 0x0] [url = about:blank] 03:57:55 INFO - --DOMWINDOW == 38 (0x121319800) [pid = 1722] [serial = 320] [outer = 0x0] [url = about:blank] 03:57:55 INFO - --DOMWINDOW == 37 (0x1223e9400) [pid = 1722] [serial = 323] [outer = 0x0] [url = about:blank] 03:57:55 INFO - MEMORY STAT | vsize 3382MB | residentFast 406MB | heapAllocated 108MB 03:57:55 INFO - 123 INFO TEST-OK | devtools/client/webconsole/test/browser_console_keyboard_accessibility.js | took 3190ms 03:57:55 INFO - ++DOCSHELL 0x113212800 == 19 [pid = 1722] [id = 141] 03:57:55 INFO - ++DOMWINDOW == 38 (0x11297e800) [pid = 1722] [serial = 327] [outer = 0x0] 03:57:55 INFO - ++DOMWINDOW == 39 (0x112c96000) [pid = 1722] [serial = 328] [outer = 0x11297e800] 03:57:55 INFO - 124 INFO TEST-START | devtools/client/webconsole/test/browser_console_log_inspectable_object.js 03:57:55 INFO - ++DOCSHELL 0x114b70000 == 20 [pid = 1722] [id = 142] 03:57:55 INFO - ++DOMWINDOW == 40 (0x112f49400) [pid = 1722] [serial = 329] [outer = 0x0] 03:57:55 INFO - ++DOMWINDOW == 41 (0x112f4bc00) [pid = 1722] [serial = 330] [outer = 0x112f49400] 03:57:55 INFO - ++DOCSHELL 0x1135ae000 == 21 [pid = 1722] [id = 143] 03:57:55 INFO - ++DOMWINDOW == 42 (0x112f4cc00) [pid = 1722] [serial = 331] [outer = 0x0] 03:57:55 INFO - ++DOMWINDOW == 43 (0x1135efc00) [pid = 1722] [serial = 332] [outer = 0x112f4cc00] 03:57:55 INFO - ++DOMWINDOW == 44 (0x11eef3c00) [pid = 1722] [serial = 333] [outer = 0x112f4cc00] 03:57:55 INFO - ++DOCSHELL 0x120eb1000 == 22 [pid = 1722] [id = 144] 03:57:55 INFO - ++DOMWINDOW == 45 (0x120e2c800) [pid = 1722] [serial = 334] [outer = 0x0] 03:57:55 INFO - ++DOMWINDOW == 46 (0x120e2d800) [pid = 1722] [serial = 335] [outer = 0x120e2c800] 03:57:56 INFO - ++DOCSHELL 0x120178800 == 23 [pid = 1722] [id = 145] 03:57:56 INFO - ++DOMWINDOW == 47 (0x124396000) [pid = 1722] [serial = 336] [outer = 0x0] 03:57:56 INFO - ++DOMWINDOW == 48 (0x12130ec00) [pid = 1722] [serial = 337] [outer = 0x124396000] 03:57:57 INFO - --DOCSHELL 0x113512800 == 22 [pid = 1722] [id = 136] 03:57:57 INFO - --DOCSHELL 0x120eb0800 == 21 [pid = 1722] [id = 128] 03:57:57 INFO - --DOCSHELL 0x124211800 == 20 [pid = 1722] [id = 129] 03:57:57 INFO - --DOCSHELL 0x125064800 == 19 [pid = 1722] [id = 132] 03:57:57 INFO - --DOCSHELL 0x11320a000 == 18 [pid = 1722] [id = 130] 03:57:57 INFO - --DOCSHELL 0x125068800 == 17 [pid = 1722] [id = 133] 03:57:57 INFO - --DOCSHELL 0x120ea5000 == 16 [pid = 1722] [id = 131] 03:57:57 INFO - --DOCSHELL 0x113e3a800 == 15 [pid = 1722] [id = 137] 03:57:57 INFO - --DOCSHELL 0x12468d000 == 14 [pid = 1722] [id = 138] 03:57:57 INFO - --DOCSHELL 0x120eb1000 == 13 [pid = 1722] [id = 144] 03:57:57 INFO - --DOCSHELL 0x120178800 == 12 [pid = 1722] [id = 145] 03:57:57 INFO - --DOCSHELL 0x113516000 == 11 [pid = 1722] [id = 139] 03:57:57 INFO - --DOMWINDOW == 47 (0x12ffc6c00) [pid = 1722] [serial = 282] [outer = 0x0] [url = about:blank] 03:57:57 INFO - --DOMWINDOW == 46 (0x1247c3400) [pid = 1722] [serial = 314] [outer = 0x0] [url = about:blank] 03:57:57 INFO - --DOMWINDOW == 45 (0x12ffc4800) [pid = 1722] [serial = 280] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:57 INFO - --DOMWINDOW == 44 (0x122334000) [pid = 1722] [serial = 266] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:57 INFO - --DOMWINDOW == 43 (0x126142000) [pid = 1722] [serial = 287] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:57 INFO - --DOMWINDOW == 42 (0x12130a800) [pid = 1722] [serial = 306] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html] 03:57:57 INFO - --DOMWINDOW == 41 (0x12f4d2800) [pid = 1722] [serial = 273] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:57 INFO - --DOMWINDOW == 40 (0x12ee12400) [pid = 1722] [serial = 289] [outer = 0x0] [url = about:blank] 03:57:57 INFO - --DOMWINDOW == 39 (0x120159c00) [pid = 1722] [serial = 312] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:57 INFO - --DOMWINDOW == 38 (0x12561c800) [pid = 1722] [serial = 268] [outer = 0x0] [url = about:blank] 03:57:57 INFO - --DOMWINDOW == 37 (0x12f78d400) [pid = 1722] [serial = 275] [outer = 0x0] [url = about:blank] 03:57:57 INFO - --DOMWINDOW == 36 (0x12015a800) [pid = 1722] [serial = 318] [outer = 0x0] [url = about:blank] 03:57:57 INFO - --DOMWINDOW == 35 (0x124396000) [pid = 1722] [serial = 336] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:57:57 INFO - --DOMWINDOW == 34 (0x1135efc00) [pid = 1722] [serial = 332] [outer = 0x0] [url = about:blank] 03:57:57 INFO - --DOMWINDOW == 33 (0x112f40400) [pid = 1722] [serial = 315] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:57 INFO - --DOMWINDOW == 32 (0x12504cc00) [pid = 1722] [serial = 325] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:57:57 INFO - --DOMWINDOW == 31 (0x122336c00) [pid = 1722] [serial = 322] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:57:57 INFO - --DOMWINDOW == 30 (0x121317000) [pid = 1722] [serial = 319] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:57:57 INFO - --DOMWINDOW == 29 (0x11eeef000) [pid = 1722] [serial = 317] [outer = 0x0] [url = about:blank] 03:57:57 INFO - --DOMWINDOW == 28 (0x126482400) [pid = 1722] [serial = 321] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:57:57 INFO - MEMORY STAT | vsize 3378MB | residentFast 403MB | heapAllocated 106MB 03:57:57 INFO - 125 INFO TEST-OK | devtools/client/webconsole/test/browser_console_log_inspectable_object.js | took 2291ms 03:57:57 INFO - ++DOCSHELL 0x1132a9000 == 12 [pid = 1722] [id = 146] 03:57:57 INFO - ++DOMWINDOW == 29 (0x112663400) [pid = 1722] [serial = 338] [outer = 0x0] 03:57:57 INFO - ++DOMWINDOW == 30 (0x112ca2400) [pid = 1722] [serial = 339] [outer = 0x112663400] 03:57:57 INFO - 126 INFO TEST-START | devtools/client/webconsole/test/browser_console_native_getters.js 03:57:58 INFO - ++DOCSHELL 0x11ee35800 == 13 [pid = 1722] [id = 147] 03:57:58 INFO - ++DOMWINDOW == 31 (0x112f4c800) [pid = 1722] [serial = 340] [outer = 0x0] 03:57:58 INFO - ++DOMWINDOW == 32 (0x11315bc00) [pid = 1722] [serial = 341] [outer = 0x112f4c800] 03:57:58 INFO - ++DOCSHELL 0x112e21800 == 14 [pid = 1722] [id = 148] 03:57:58 INFO - ++DOMWINDOW == 33 (0x112f46000) [pid = 1722] [serial = 342] [outer = 0x0] 03:57:58 INFO - ++DOMWINDOW == 34 (0x113d0fc00) [pid = 1722] [serial = 343] [outer = 0x112f46000] 03:57:58 INFO - ++DOMWINDOW == 35 (0x11ef49c00) [pid = 1722] [serial = 344] [outer = 0x112f46000] 03:57:58 INFO - ++DOCSHELL 0x120eba800 == 15 [pid = 1722] [id = 149] 03:57:58 INFO - ++DOMWINDOW == 36 (0x120e2a400) [pid = 1722] [serial = 345] [outer = 0x0] 03:57:58 INFO - ++DOMWINDOW == 37 (0x120e2b800) [pid = 1722] [serial = 346] [outer = 0x120e2a400] 03:57:59 INFO - ++DOCSHELL 0x124694800 == 16 [pid = 1722] [id = 150] 03:57:59 INFO - ++DOMWINDOW == 38 (0x120e31400) [pid = 1722] [serial = 347] [outer = 0x0] 03:57:59 INFO - ++DOMWINDOW == 39 (0x120e32c00) [pid = 1722] [serial = 348] [outer = 0x120e31400] 03:57:59 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 03:58:01 INFO - ++DOCSHELL 0x1246a0000 == 17 [pid = 1722] [id = 151] 03:58:01 INFO - ++DOMWINDOW == 40 (0x1247c1000) [pid = 1722] [serial = 349] [outer = 0x0] 03:58:01 INFO - ++DOMWINDOW == 41 (0x12561b000) [pid = 1722] [serial = 350] [outer = 0x1247c1000] 03:58:04 INFO - --DOCSHELL 0x114b70000 == 16 [pid = 1722] [id = 142] 03:58:04 INFO - --DOCSHELL 0x112e21800 == 15 [pid = 1722] [id = 148] 03:58:04 INFO - --DOCSHELL 0x113212800 == 14 [pid = 1722] [id = 141] 03:58:04 INFO - --DOCSHELL 0x120eba800 == 13 [pid = 1722] [id = 149] 03:58:04 INFO - --DOCSHELL 0x1135ae000 == 12 [pid = 1722] [id = 143] 03:58:04 INFO - --DOCSHELL 0x124694800 == 11 [pid = 1722] [id = 150] 03:58:04 INFO - --DOCSHELL 0x1246a0000 == 10 [pid = 1722] [id = 151] 03:58:04 INFO - --DOMWINDOW == 40 (0x112f41800) [pid = 1722] [serial = 316] [outer = 0x0] [url = about:blank] 03:58:04 INFO - --DOMWINDOW == 39 (0x12504e000) [pid = 1722] [serial = 326] [outer = 0x0] [url = about:blank] 03:58:04 INFO - --DOMWINDOW == 38 (0x122d44c00) [pid = 1722] [serial = 324] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:04 INFO - --DOMWINDOW == 37 (0x12130ec00) [pid = 1722] [serial = 337] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:04 INFO - --DOMWINDOW == 36 (0x112f49400) [pid = 1722] [serial = 329] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20bug%20676722%20-%20inspectable%20objects%20for%20window.console] 03:58:04 INFO - --DOMWINDOW == 35 (0x11297e800) [pid = 1722] [serial = 327] [outer = 0x0] [url = about:blank] 03:58:04 INFO - --DOMWINDOW == 34 (0x120e31400) [pid = 1722] [serial = 347] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:04 INFO - --DOMWINDOW == 33 (0x112f4cc00) [pid = 1722] [serial = 331] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:04 INFO - --DOMWINDOW == 32 (0x120e2c800) [pid = 1722] [serial = 334] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:04 INFO - --DOMWINDOW == 31 (0x112f4bc00) [pid = 1722] [serial = 330] [outer = 0x0] [url = about:blank] 03:58:04 INFO - --DOMWINDOW == 30 (0x112c96000) [pid = 1722] [serial = 328] [outer = 0x0] [url = about:blank] 03:58:04 INFO - --DOMWINDOW == 29 (0x113d0fc00) [pid = 1722] [serial = 343] [outer = 0x0] [url = about:blank] 03:58:05 INFO - MEMORY STAT | vsize 3380MB | residentFast 404MB | heapAllocated 113MB 03:58:05 INFO - 127 INFO TEST-OK | devtools/client/webconsole/test/browser_console_native_getters.js | took 7059ms 03:58:05 INFO - ++DOCSHELL 0x11320a800 == 11 [pid = 1722] [id = 152] 03:58:05 INFO - ++DOMWINDOW == 30 (0x112662000) [pid = 1722] [serial = 351] [outer = 0x0] 03:58:05 INFO - ++DOMWINDOW == 31 (0x112f41000) [pid = 1722] [serial = 352] [outer = 0x112662000] 03:58:05 INFO - 128 INFO TEST-START | devtools/client/webconsole/test/browser_console_navigation_marker.js 03:58:05 INFO - ++DOCSHELL 0x11ee43800 == 12 [pid = 1722] [id = 153] 03:58:05 INFO - ++DOMWINDOW == 32 (0x112f4d800) [pid = 1722] [serial = 353] [outer = 0x0] 03:58:05 INFO - ++DOMWINDOW == 33 (0x1132e1c00) [pid = 1722] [serial = 354] [outer = 0x112f4d800] 03:58:05 INFO - ++DOMWINDOW == 34 (0x121108400) [pid = 1722] [serial = 355] [outer = 0x112f4d800] 03:58:05 INFO - ++DOCSHELL 0x113510000 == 13 [pid = 1722] [id = 154] 03:58:05 INFO - ++DOMWINDOW == 35 (0x11ee4dc00) [pid = 1722] [serial = 356] [outer = 0x0] 03:58:05 INFO - ++DOMWINDOW == 36 (0x11ee55800) [pid = 1722] [serial = 357] [outer = 0x11ee4dc00] 03:58:05 INFO - ++DOMWINDOW == 37 (0x12025bc00) [pid = 1722] [serial = 358] [outer = 0x11ee4dc00] 03:58:05 INFO - ++DOCSHELL 0x1246a0000 == 14 [pid = 1722] [id = 155] 03:58:05 INFO - ++DOMWINDOW == 38 (0x120ff7400) [pid = 1722] [serial = 359] [outer = 0x0] 03:58:05 INFO - ++DOMWINDOW == 39 (0x120ffa400) [pid = 1722] [serial = 360] [outer = 0x120ff7400] 03:58:06 INFO - ++DOMWINDOW == 40 (0x12613fc00) [pid = 1722] [serial = 361] [outer = 0x112f4d800] 03:58:06 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:58:07 INFO - --DOCSHELL 0x1132a9000 == 13 [pid = 1722] [id = 146] 03:58:07 INFO - --DOCSHELL 0x11ee35800 == 12 [pid = 1722] [id = 147] 03:58:07 INFO - --DOMWINDOW == 39 (0x11eef3c00) [pid = 1722] [serial = 333] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:07 INFO - --DOMWINDOW == 38 (0x120e2d800) [pid = 1722] [serial = 335] [outer = 0x0] [url = about:blank] 03:58:07 INFO - --DOMWINDOW == 37 (0x120e32c00) [pid = 1722] [serial = 348] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:07 INFO - --DOMWINDOW == 36 (0x112f46000) [pid = 1722] [serial = 342] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:07 INFO - --DOMWINDOW == 35 (0x112f4c800) [pid = 1722] [serial = 340] [outer = 0x0] [url = data:text/html;charset=utf8,bug870220

hello%20world

native%20getters!] 03:58:07 INFO - --DOMWINDOW == 34 (0x11ee55800) [pid = 1722] [serial = 357] [outer = 0x0] [url = about:blank] 03:58:07 INFO - --DOMWINDOW == 33 (0x1132e1c00) [pid = 1722] [serial = 354] [outer = 0x0] [url = about:blank] 03:58:07 INFO - --DOMWINDOW == 32 (0x112663400) [pid = 1722] [serial = 338] [outer = 0x0] [url = about:blank] 03:58:07 INFO - --DOMWINDOW == 31 (0x1247c1000) [pid = 1722] [serial = 349] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:07 INFO - --DOMWINDOW == 30 (0x120e2a400) [pid = 1722] [serial = 345] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:07 INFO - MEMORY STAT | vsize 3380MB | residentFast 405MB | heapAllocated 109MB 03:58:07 INFO - 129 INFO TEST-OK | devtools/client/webconsole/test/browser_console_navigation_marker.js | took 2622ms 03:58:07 INFO - ++DOCSHELL 0x11e350000 == 13 [pid = 1722] [id = 156] 03:58:07 INFO - ++DOMWINDOW == 31 (0x112f46000) [pid = 1722] [serial = 362] [outer = 0x0] 03:58:07 INFO - ++DOMWINDOW == 32 (0x112f4b400) [pid = 1722] [serial = 363] [outer = 0x112f46000] 03:58:07 INFO - 130 INFO TEST-START | devtools/client/webconsole/test/browser_console_nsiconsolemessage.js 03:58:07 INFO - ++DOCSHELL 0x11efdc000 == 14 [pid = 1722] [id = 157] 03:58:07 INFO - ++DOMWINDOW == 33 (0x113d03800) [pid = 1722] [serial = 364] [outer = 0x0] 03:58:07 INFO - ++DOMWINDOW == 34 (0x113d0f800) [pid = 1722] [serial = 365] [outer = 0x113d03800] 03:58:08 INFO - ++DOCSHELL 0x11350d000 == 15 [pid = 1722] [id = 158] 03:58:08 INFO - ++DOMWINDOW == 35 (0x113e0a000) [pid = 1722] [serial = 366] [outer = 0x0] 03:58:08 INFO - ++DOMWINDOW == 36 (0x11eeef000) [pid = 1722] [serial = 367] [outer = 0x113e0a000] 03:58:08 INFO - ++DOMWINDOW == 37 (0x1202ecc00) [pid = 1722] [serial = 368] [outer = 0x113e0a000] 03:58:08 INFO - ++DOCSHELL 0x12469f800 == 16 [pid = 1722] [id = 159] 03:58:08 INFO - ++DOMWINDOW == 38 (0x120ff3000) [pid = 1722] [serial = 369] [outer = 0x0] 03:58:08 INFO - ++DOMWINDOW == 39 (0x120ff8c00) [pid = 1722] [serial = 370] [outer = 0x120ff3000] 03:58:09 INFO - --DOCSHELL 0x1246a0000 == 15 [pid = 1722] [id = 155] 03:58:09 INFO - --DOCSHELL 0x11ee43800 == 14 [pid = 1722] [id = 153] 03:58:09 INFO - --DOCSHELL 0x113510000 == 13 [pid = 1722] [id = 154] 03:58:09 INFO - --DOMWINDOW == 38 (0x120e2b800) [pid = 1722] [serial = 346] [outer = 0x0] [url = about:blank] 03:58:09 INFO - --DOMWINDOW == 37 (0x11ef49c00) [pid = 1722] [serial = 344] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:09 INFO - --DOMWINDOW == 36 (0x12561b000) [pid = 1722] [serial = 350] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:09 INFO - --DOMWINDOW == 35 (0x11315bc00) [pid = 1722] [serial = 341] [outer = 0x0] [url = about:blank] 03:58:09 INFO - --DOMWINDOW == 34 (0x121108400) [pid = 1722] [serial = 355] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:58:09 INFO - --DOMWINDOW == 33 (0x112ca2400) [pid = 1722] [serial = 339] [outer = 0x0] [url = about:blank] 03:58:09 INFO - --DOMWINDOW == 32 (0x11ee4dc00) [pid = 1722] [serial = 356] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:09 INFO - --DOMWINDOW == 31 (0x112f4d800) [pid = 1722] [serial = 353] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:58:09 INFO - --DOMWINDOW == 30 (0x11eeef000) [pid = 1722] [serial = 367] [outer = 0x0] [url = about:blank] 03:58:09 INFO - --DOMWINDOW == 29 (0x112662000) [pid = 1722] [serial = 351] [outer = 0x0] [url = about:blank] 03:58:09 INFO - --DOMWINDOW == 28 (0x120ff7400) [pid = 1722] [serial = 359] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:09 INFO - --DOMWINDOW == 27 (0x12613fc00) [pid = 1722] [serial = 361] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 03:58:09 INFO - ++DOCSHELL 0x113510000 == 14 [pid = 1722] [id = 160] 03:58:09 INFO - ++DOMWINDOW == 28 (0x112936800) [pid = 1722] [serial = 371] [outer = 0x0] 03:58:09 INFO - ++DOMWINDOW == 29 (0x1129be800) [pid = 1722] [serial = 372] [outer = 0x112936800] 03:58:10 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:58:10 INFO - MEMORY STAT | vsize 3390MB | residentFast 407MB | heapAllocated 109MB 03:58:10 INFO - 131 INFO TEST-OK | devtools/client/webconsole/test/browser_console_nsiconsolemessage.js | took 2541ms 03:58:10 INFO - ++DOCSHELL 0x112b45000 == 15 [pid = 1722] [id = 161] 03:58:10 INFO - ++DOMWINDOW == 30 (0x11ef4b400) [pid = 1722] [serial = 373] [outer = 0x0] 03:58:10 INFO - ++DOMWINDOW == 31 (0x11f109000) [pid = 1722] [serial = 374] [outer = 0x11ef4b400] 03:58:10 INFO - 132 INFO TEST-START | devtools/client/webconsole/test/browser_console_open_or_focus.js 03:58:10 INFO - ++DOCSHELL 0x12468a800 == 16 [pid = 1722] [id = 162] 03:58:10 INFO - ++DOMWINDOW == 32 (0x120fe6400) [pid = 1722] [serial = 375] [outer = 0x0] 03:58:10 INFO - ++DOMWINDOW == 33 (0x120fef800) [pid = 1722] [serial = 376] [outer = 0x120fe6400] 03:58:10 INFO - console.log: testmessage 03:58:10 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:58:11 INFO - MEMORY STAT | vsize 3392MB | residentFast 409MB | heapAllocated 111MB 03:58:11 INFO - 133 INFO TEST-OK | devtools/client/webconsole/test/browser_console_open_or_focus.js | took 633ms 03:58:11 INFO - ++DOCSHELL 0x124aae000 == 17 [pid = 1722] [id = 163] 03:58:11 INFO - ++DOMWINDOW == 34 (0x120ffa800) [pid = 1722] [serial = 377] [outer = 0x0] 03:58:11 INFO - ++DOMWINDOW == 35 (0x1221bc000) [pid = 1722] [serial = 378] [outer = 0x120ffa800] 03:58:11 INFO - 134 INFO TEST-START | devtools/client/webconsole/test/browser_console_optimized_out_vars.js 03:58:11 INFO - ++DOCSHELL 0x1252f5000 == 18 [pid = 1722] [id = 164] 03:58:11 INFO - ++DOMWINDOW == 36 (0x1245b0c00) [pid = 1722] [serial = 379] [outer = 0x0] 03:58:11 INFO - ++DOMWINDOW == 37 (0x1247bec00) [pid = 1722] [serial = 380] [outer = 0x1245b0c00] 03:58:11 INFO - ++DOMWINDOW == 38 (0x12211b400) [pid = 1722] [serial = 381] [outer = 0x1245b0c00] 03:58:11 INFO - ++DOCSHELL 0x12d425000 == 19 [pid = 1722] [id = 165] 03:58:11 INFO - ++DOMWINDOW == 39 (0x110d51000) [pid = 1722] [serial = 382] [outer = 0x0] 03:58:11 INFO - ++DOMWINDOW == 40 (0x1247ca000) [pid = 1722] [serial = 383] [outer = 0x110d51000] 03:58:11 INFO - ++DOMWINDOW == 41 (0x11ee20c00) [pid = 1722] [serial = 384] [outer = 0x110d51000] 03:58:11 INFO - ++DOCSHELL 0x12f224800 == 20 [pid = 1722] [id = 166] 03:58:11 INFO - ++DOMWINDOW == 42 (0x1276ac000) [pid = 1722] [serial = 385] [outer = 0x0] 03:58:11 INFO - ++DOMWINDOW == 43 (0x1276adc00) [pid = 1722] [serial = 386] [outer = 0x1276ac000] 03:58:12 INFO - ++DOCSHELL 0x124ac9000 == 21 [pid = 1722] [id = 167] 03:58:12 INFO - ++DOMWINDOW == 44 (0x12180d400) [pid = 1722] [serial = 387] [outer = 0x0] 03:58:12 INFO - ++DOMWINDOW == 45 (0x12211a400) [pid = 1722] [serial = 388] [outer = 0x12180d400] 03:58:13 INFO - ++DOCSHELL 0x1301a1800 == 22 [pid = 1722] [id = 168] 03:58:13 INFO - ++DOMWINDOW == 46 (0x12fcc6800) [pid = 1722] [serial = 389] [outer = 0x0] 03:58:13 INFO - ++DOMWINDOW == 47 (0x12fcd2c00) [pid = 1722] [serial = 390] [outer = 0x12fcc6800] 03:58:15 INFO - --DOCSHELL 0x12469f800 == 21 [pid = 1722] [id = 159] 03:58:15 INFO - --DOCSHELL 0x112b45000 == 20 [pid = 1722] [id = 161] 03:58:15 INFO - --DOCSHELL 0x11e350000 == 19 [pid = 1722] [id = 156] 03:58:15 INFO - --DOCSHELL 0x11320a800 == 18 [pid = 1722] [id = 152] 03:58:15 INFO - --DOCSHELL 0x11efdc000 == 17 [pid = 1722] [id = 157] 03:58:15 INFO - --DOCSHELL 0x11350d000 == 16 [pid = 1722] [id = 158] 03:58:15 INFO - --DOCSHELL 0x113510000 == 15 [pid = 1722] [id = 160] 03:58:15 INFO - --DOCSHELL 0x12468a800 == 14 [pid = 1722] [id = 162] 03:58:15 INFO - --DOMWINDOW == 46 (0x12025bc00) [pid = 1722] [serial = 358] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:15 INFO - --DOMWINDOW == 45 (0x120ffa400) [pid = 1722] [serial = 360] [outer = 0x0] [url = about:blank] 03:58:15 INFO - --DOMWINDOW == 44 (0x112f41000) [pid = 1722] [serial = 352] [outer = 0x0] [url = about:blank] 03:58:15 INFO - --DOCSHELL 0x1301a1800 == 13 [pid = 1722] [id = 168] 03:58:15 INFO - --DOCSHELL 0x124ac9000 == 12 [pid = 1722] [id = 167] 03:58:15 INFO - --DOCSHELL 0x12f224800 == 11 [pid = 1722] [id = 166] 03:58:16 INFO - --DOCSHELL 0x12d425000 == 10 [pid = 1722] [id = 165] 03:58:16 INFO - --DOMWINDOW == 43 (0x120fe6400) [pid = 1722] [serial = 375] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:16 INFO - --DOMWINDOW == 42 (0x112936800) [pid = 1722] [serial = 371] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:16 INFO - --DOMWINDOW == 41 (0x12fcc6800) [pid = 1722] [serial = 389] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:58:16 INFO - --DOMWINDOW == 40 (0x120ff3000) [pid = 1722] [serial = 369] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:16 INFO - --DOMWINDOW == 39 (0x113e0a000) [pid = 1722] [serial = 366] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:16 INFO - --DOMWINDOW == 38 (0x112f46000) [pid = 1722] [serial = 362] [outer = 0x0] [url = about:blank] 03:58:16 INFO - --DOMWINDOW == 37 (0x113d03800) [pid = 1722] [serial = 364] [outer = 0x0] [url = data:text/html;charset=utf8,bug859756

hello%20world

nsIConsoleMessages%20ftw!] 03:58:16 INFO - --DOMWINDOW == 36 (0x11ef4b400) [pid = 1722] [serial = 373] [outer = 0x0] [url = about:blank] 03:58:16 INFO - --DOMWINDOW == 35 (0x1247ca000) [pid = 1722] [serial = 383] [outer = 0x0] [url = about:blank] 03:58:16 INFO - --DOMWINDOW == 34 (0x112f4b400) [pid = 1722] [serial = 363] [outer = 0x0] [url = about:blank] 03:58:16 INFO - --DOMWINDOW == 33 (0x113d0f800) [pid = 1722] [serial = 365] [outer = 0x0] [url = about:blank] 03:58:16 INFO - --DOMWINDOW == 32 (0x11f109000) [pid = 1722] [serial = 374] [outer = 0x0] [url = about:blank] 03:58:16 INFO - --DOMWINDOW == 31 (0x1247bec00) [pid = 1722] [serial = 380] [outer = 0x0] [url = about:blank] 03:58:16 INFO - MEMORY STAT | vsize 3379MB | residentFast 403MB | heapAllocated 112MB 03:58:16 INFO - 135 INFO TEST-OK | devtools/client/webconsole/test/browser_console_optimized_out_vars.js | took 5127ms 03:58:16 INFO - ++DOCSHELL 0x112b32800 == 11 [pid = 1722] [id = 169] 03:58:16 INFO - ++DOMWINDOW == 32 (0x112f45c00) [pid = 1722] [serial = 391] [outer = 0x0] 03:58:16 INFO - ++DOMWINDOW == 33 (0x112f49000) [pid = 1722] [serial = 392] [outer = 0x112f45c00] 03:58:16 INFO - 136 INFO TEST-START | devtools/client/webconsole/test/browser_console_private_browsing.js 03:58:16 INFO - ++DOCSHELL 0x11e820800 == 12 [pid = 1722] [id = 170] 03:58:16 INFO - ++DOMWINDOW == 34 (0x113d04c00) [pid = 1722] [serial = 393] [outer = 0x0] 03:58:16 INFO - ++DOMWINDOW == 35 (0x113e05800) [pid = 1722] [serial = 394] [outer = 0x113d04c00] 03:58:16 INFO - ++DOCSHELL 0x11efdb000 == 13 [pid = 1722] [id = 171] 03:58:16 INFO - ++DOMWINDOW == 36 (0x11ee57c00) [pid = 1722] [serial = 395] [outer = 0x0] 03:58:16 INFO - ++DOMWINDOW == 37 (0x11ef53400) [pid = 1722] [serial = 396] [outer = 0x11ee57c00] 03:58:16 INFO - ++DOCSHELL 0x120e0d800 == 14 [pid = 1722] [id = 172] 03:58:16 INFO - ++DOMWINDOW == 38 (0x1203e6000) [pid = 1722] [serial = 397] [outer = 0x0] 03:58:16 INFO - ++DOCSHELL 0x120e0e000 == 15 [pid = 1722] [id = 173] 03:58:16 INFO - ++DOMWINDOW == 39 (0x1203e8800) [pid = 1722] [serial = 398] [outer = 0x0] 03:58:16 INFO - ++DOMWINDOW == 40 (0x120d1b000) [pid = 1722] [serial = 399] [outer = 0x1203e8800] 03:58:16 INFO - ++DOCSHELL 0x120ead800 == 16 [pid = 1722] [id = 174] 03:58:16 INFO - ++DOMWINDOW == 41 (0x1203e5000) [pid = 1722] [serial = 400] [outer = 0x0] 03:58:16 INFO - ++DOMWINDOW == 42 (0x121311400) [pid = 1722] [serial = 401] [outer = 0x1203e5000] 03:58:17 INFO - ++DOMWINDOW == 43 (0x121315000) [pid = 1722] [serial = 402] [outer = 0x1203e6000] 03:58:17 INFO - ++DOMWINDOW == 44 (0x121318c00) [pid = 1722] [serial = 403] [outer = 0x1203e8800] 03:58:17 INFO - ++DOMWINDOW == 45 (0x12152f400) [pid = 1722] [serial = 404] [outer = 0x1203e5000] 03:58:17 INFO - ++DOMWINDOW == 46 (0x12532c800) [pid = 1722] [serial = 405] [outer = 0x1203e5000] 03:58:17 INFO - ++DOCSHELL 0x12f241800 == 17 [pid = 1722] [id = 175] 03:58:17 INFO - ++DOMWINDOW == 47 (0x122115800) [pid = 1722] [serial = 406] [outer = 0x0] 03:58:17 INFO - ++DOMWINDOW == 48 (0x12648b800) [pid = 1722] [serial = 407] [outer = 0x122115800] 03:58:17 INFO - ++DOCSHELL 0x1305a3800 == 18 [pid = 1722] [id = 176] 03:58:17 INFO - ++DOMWINDOW == 49 (0x1276b1000) [pid = 1722] [serial = 408] [outer = 0x0] 03:58:17 INFO - ++DOMWINDOW == 50 (0x1276b3400) [pid = 1722] [serial = 409] [outer = 0x1276b1000] 03:58:17 INFO - [1722] WARNING: attempt to modify an immutable nsStandardURL: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/netwerk/base/nsStandardURL.cpp, line 1300 03:58:17 INFO - ++DOCSHELL 0x121883800 == 19 [pid = 1722] [id = 177] 03:58:17 INFO - ++DOMWINDOW == 51 (0x121531000) [pid = 1722] [serial = 410] [outer = 0x0] 03:58:17 INFO - ++DOMWINDOW == 52 (0x12dd7f400) [pid = 1722] [serial = 411] [outer = 0x121531000] 03:58:18 INFO - ++DOMWINDOW == 53 (0x12ee18000) [pid = 1722] [serial = 412] [outer = 0x121531000] 03:58:18 INFO - [1722] WARNING: attempt to modify an immutable nsStandardURL: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/netwerk/base/nsStandardURL.cpp, line 1300 03:58:18 INFO - ++DOMWINDOW == 54 (0x12f59a800) [pid = 1722] [serial = 413] [outer = 0x1276b1000] 03:58:18 INFO - ++DOCSHELL 0x12fdc4000 == 20 [pid = 1722] [id = 178] 03:58:18 INFO - ++DOMWINDOW == 55 (0x12ff22000) [pid = 1722] [serial = 414] [outer = 0x0] 03:58:18 INFO - ++DOMWINDOW == 56 (0x12ff23000) [pid = 1722] [serial = 415] [outer = 0x12ff22000] 03:58:18 INFO - JavaScript error: data:text/html;charset=utf8,

hello%20world!%20bug%20874061click, line 1: ReferenceError: fooBazBaz is not defined 03:58:18 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:58:19 INFO - --DOCSHELL 0x124aae000 == 19 [pid = 1722] [id = 163] 03:58:19 INFO - --DOCSHELL 0x1252f5000 == 18 [pid = 1722] [id = 164] 03:58:19 INFO - --DOCSHELL 0x12fdc4000 == 17 [pid = 1722] [id = 178] 03:58:19 INFO - --DOMWINDOW == 55 (0x1202ecc00) [pid = 1722] [serial = 368] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:19 INFO - --DOMWINDOW == 54 (0x120ff8c00) [pid = 1722] [serial = 370] [outer = 0x0] [url = about:blank] 03:58:19 INFO - --DOMWINDOW == 53 (0x1129be800) [pid = 1722] [serial = 372] [outer = 0x0] [url = about:blank] 03:58:19 INFO - --DOMWINDOW == 52 (0x120fef800) [pid = 1722] [serial = 376] [outer = 0x0] [url = about:blank] 03:58:19 INFO - --DOMWINDOW == 51 (0x12fcd2c00) [pid = 1722] [serial = 390] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:58:19 INFO - --DOMWINDOW == 50 (0x120d1b000) [pid = 1722] [serial = 399] [outer = 0x1203e8800] [url = about:blank] 03:58:19 INFO - ++DOCSHELL 0x112cb9000 == 18 [pid = 1722] [id = 179] 03:58:19 INFO - ++DOMWINDOW == 51 (0x110d53c00) [pid = 1722] [serial = 416] [outer = 0x0] 03:58:19 INFO - ++DOMWINDOW == 52 (0x110d56000) [pid = 1722] [serial = 417] [outer = 0x110d53c00] 03:58:19 INFO - --DOMWINDOW == 51 (0x121311400) [pid = 1722] [serial = 401] [outer = 0x0] [url = about:blank] 03:58:19 INFO - --DOMWINDOW == 50 (0x12152f400) [pid = 1722] [serial = 404] [outer = 0x0] [url = about:blank] 03:58:19 INFO - --DOMWINDOW == 49 (0x12dd7f400) [pid = 1722] [serial = 411] [outer = 0x0] [url = about:blank] 03:58:19 INFO - --DOMWINDOW == 48 (0x1221bc000) [pid = 1722] [serial = 378] [outer = 0x0] [url = about:blank] 03:58:19 INFO - --DOMWINDOW == 47 (0x1276b3400) [pid = 1722] [serial = 409] [outer = 0x0] [url = about:blank] 03:58:19 INFO - --DOMWINDOW == 46 (0x12180d400) [pid = 1722] [serial = 387] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 03:58:19 INFO - --DOMWINDOW == 45 (0x1276ac000) [pid = 1722] [serial = 385] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:19 INFO - --DOMWINDOW == 44 (0x110d51000) [pid = 1722] [serial = 382] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:19 INFO - --DOMWINDOW == 43 (0x120ffa800) [pid = 1722] [serial = 377] [outer = 0x0] [url = about:blank] 03:58:19 INFO - --DOMWINDOW == 42 (0x1245b0c00) [pid = 1722] [serial = 379] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-closure-optimized-out.html] 03:58:19 INFO - --DOMWINDOW == 41 (0x12211b400) [pid = 1722] [serial = 381] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-closure-optimized-out.html] 03:58:19 INFO - ++DOMWINDOW == 42 (0x112f49400) [pid = 1722] [serial = 418] [outer = 0x110d53c00] 03:58:20 INFO - ++DOCSHELL 0x113e34800 == 19 [pid = 1722] [id = 180] 03:58:20 INFO - ++DOMWINDOW == 43 (0x11f10c800) [pid = 1722] [serial = 419] [outer = 0x0] 03:58:20 INFO - ++DOMWINDOW == 44 (0x11f5cd400) [pid = 1722] [serial = 420] [outer = 0x11f10c800] 03:58:21 INFO - --DOCSHELL 0x113e34800 == 18 [pid = 1722] [id = 180] 03:58:21 INFO - --DOCSHELL 0x1305a3800 == 17 [pid = 1722] [id = 176] 03:58:21 INFO - --DOMWINDOW == 43 (0x12211a400) [pid = 1722] [serial = 388] [outer = 0x0] [url = about:blank] 03:58:21 INFO - --DOMWINDOW == 42 (0x1276adc00) [pid = 1722] [serial = 386] [outer = 0x0] [url = about:blank] 03:58:21 INFO - --DOMWINDOW == 41 (0x11ee20c00) [pid = 1722] [serial = 384] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:21 INFO - --DOMWINDOW == 40 (0x110d56000) [pid = 1722] [serial = 417] [outer = 0x0] [url = about:blank] 03:58:21 INFO - ++DOCSHELL 0x112cc6000 == 18 [pid = 1722] [id = 181] 03:58:21 INFO - ++DOMWINDOW == 41 (0x112f47000) [pid = 1722] [serial = 421] [outer = 0x0] 03:58:21 INFO - ++DOMWINDOW == 42 (0x112f4c800) [pid = 1722] [serial = 422] [outer = 0x112f47000] 03:58:21 INFO - JavaScript error: data:text/html;charset=utf8,

hello%20world!%20bug%20874061click, line 1: ReferenceError: fooBazBaz is not defined 03:58:21 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:58:22 INFO - ++DOCSHELL 0x112cc8800 == 19 [pid = 1722] [id = 182] 03:58:22 INFO - ++DOMWINDOW == 43 (0x1202e6000) [pid = 1722] [serial = 423] [outer = 0x0] 03:58:22 INFO - ++DOMWINDOW == 44 (0x1203dec00) [pid = 1722] [serial = 424] [outer = 0x1202e6000] 03:58:22 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 03:58:23 INFO - MEMORY STAT | vsize 3391MB | residentFast 414MB | heapAllocated 112MB 03:58:23 INFO - 137 INFO TEST-OK | devtools/client/webconsole/test/browser_console_private_browsing.js | took 6510ms 03:58:23 INFO - ++DOCSHELL 0x112968800 == 20 [pid = 1722] [id = 183] 03:58:23 INFO - ++DOMWINDOW == 45 (0x120262800) [pid = 1722] [serial = 425] [outer = 0x0] 03:58:23 INFO - ++DOMWINDOW == 46 (0x1203e6800) [pid = 1722] [serial = 426] [outer = 0x120262800] 03:58:23 INFO - 138 INFO TEST-START | devtools/client/webconsole/test/browser_console_server_logging.js 03:58:23 INFO - ++DOCSHELL 0x12d426000 == 21 [pid = 1722] [id = 184] 03:58:23 INFO - ++DOMWINDOW == 47 (0x121117c00) [pid = 1722] [serial = 427] [outer = 0x0] 03:58:23 INFO - ++DOMWINDOW == 48 (0x121314800) [pid = 1722] [serial = 428] [outer = 0x121117c00] 03:58:23 INFO - ++DOMWINDOW == 49 (0x121316800) [pid = 1722] [serial = 429] [outer = 0x121117c00] 03:58:23 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:58:23 INFO - ++DOCSHELL 0x113510800 == 22 [pid = 1722] [id = 185] 03:58:23 INFO - ++DOMWINDOW == 50 (0x124341000) [pid = 1722] [serial = 430] [outer = 0x0] 03:58:23 INFO - ++DOMWINDOW == 51 (0x124390400) [pid = 1722] [serial = 431] [outer = 0x124341000] 03:58:23 INFO - ++DOMWINDOW == 52 (0x1223f3400) [pid = 1722] [serial = 432] [outer = 0x124341000] 03:58:23 INFO - ++DOCSHELL 0x12f5a8000 == 23 [pid = 1722] [id = 186] 03:58:23 INFO - ++DOMWINDOW == 53 (0x124393c00) [pid = 1722] [serial = 433] [outer = 0x0] 03:58:23 INFO - ++DOMWINDOW == 54 (0x124396000) [pid = 1722] [serial = 434] [outer = 0x124393c00] 03:58:24 INFO - ++DOMWINDOW == 55 (0x12f25c000) [pid = 1722] [serial = 435] [outer = 0x121117c00] 03:58:24 INFO - [1722] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsDocument.cpp, line 4754 03:58:24 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:58:25 INFO - --DOCSHELL 0x11e820800 == 22 [pid = 1722] [id = 170] 03:58:25 INFO - --DOCSHELL 0x12f5a8000 == 21 [pid = 1722] [id = 186] 03:58:25 INFO - --DOCSHELL 0x112cb9000 == 20 [pid = 1722] [id = 179] 03:58:25 INFO - --DOMWINDOW == 54 (0x121315000) [pid = 1722] [serial = 402] [outer = 0x1203e6000] [url = about:blank] 03:58:25 INFO - --DOMWINDOW == 53 (0x121318c00) [pid = 1722] [serial = 403] [outer = 0x1203e8800] [url = about:blank] 03:58:25 INFO - --DOMWINDOW == 52 (0x1203e8800) [pid = 1722] [serial = 398] [outer = 0x0] [url = about:blank] 03:58:25 INFO - --DOMWINDOW == 51 (0x1203e6000) [pid = 1722] [serial = 397] [outer = 0x0] [url = about:blank] 03:58:25 INFO - --DOMWINDOW == 50 (0x1203e5000) [pid = 1722] [serial = 400] [outer = 0x0] [url = about:privatebrowsing] 03:58:25 INFO - --DOMWINDOW == 49 (0x121531000) [pid = 1722] [serial = 410] [outer = 0x0] [url = about:privatebrowsing] 03:58:25 INFO - --DOMWINDOW == 48 (0x12ff22000) [pid = 1722] [serial = 414] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:25 INFO - --DOMWINDOW == 47 (0x1276b1000) [pid = 1722] [serial = 408] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:25 INFO - --DOMWINDOW == 46 (0x11f10c800) [pid = 1722] [serial = 419] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:25 INFO - --DOMWINDOW == 45 (0x110d53c00) [pid = 1722] [serial = 416] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:25 INFO - --DOMWINDOW == 44 (0x112f45c00) [pid = 1722] [serial = 391] [outer = 0x0] [url = about:blank] 03:58:25 INFO - --DOMWINDOW == 43 (0x113d04c00) [pid = 1722] [serial = 393] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20world!%20I%20am%20not%20private!] 03:58:25 INFO - --DOMWINDOW == 42 (0x124390400) [pid = 1722] [serial = 431] [outer = 0x0] [url = about:blank] 03:58:25 INFO - --DOMWINDOW == 41 (0x112f49000) [pid = 1722] [serial = 392] [outer = 0x0] [url = about:blank] 03:58:25 INFO - --DOMWINDOW == 40 (0x113e05800) [pid = 1722] [serial = 394] [outer = 0x0] [url = about:blank] 03:58:25 INFO - --DOMWINDOW == 39 (0x121314800) [pid = 1722] [serial = 428] [outer = 0x0] [url = about:blank] 03:58:25 INFO - --DOMWINDOW == 38 (0x121316800) [pid = 1722] [serial = 429] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs] 03:58:25 INFO - MEMORY STAT | vsize 3385MB | residentFast 409MB | heapAllocated 110MB 03:58:25 INFO - 139 INFO TEST-OK | devtools/client/webconsole/test/browser_console_server_logging.js | took 2457ms 03:58:25 INFO - ++DOCSHELL 0x112cc6800 == 21 [pid = 1722] [id = 187] 03:58:25 INFO - ++DOMWINDOW == 39 (0x112f44000) [pid = 1722] [serial = 436] [outer = 0x0] 03:58:25 INFO - ++DOMWINDOW == 40 (0x112f49800) [pid = 1722] [serial = 437] [outer = 0x112f44000] 03:58:25 INFO - 140 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view.js 03:58:25 INFO - ++DOCSHELL 0x11e34d000 == 22 [pid = 1722] [id = 188] 03:58:25 INFO - ++DOMWINDOW == 41 (0x113d04c00) [pid = 1722] [serial = 438] [outer = 0x0] 03:58:25 INFO - ++DOMWINDOW == 42 (0x113e0ac00) [pid = 1722] [serial = 439] [outer = 0x113d04c00] 03:58:25 INFO - ++DOMWINDOW == 43 (0x1221b7000) [pid = 1722] [serial = 440] [outer = 0x113d04c00] 03:58:26 INFO - ++DOCSHELL 0x11e840800 == 23 [pid = 1722] [id = 189] 03:58:26 INFO - ++DOMWINDOW == 44 (0x11ef55c00) [pid = 1722] [serial = 441] [outer = 0x0] 03:58:26 INFO - ++DOMWINDOW == 45 (0x11f10bc00) [pid = 1722] [serial = 442] [outer = 0x11ef55c00] 03:58:26 INFO - ++DOMWINDOW == 46 (0x120e23800) [pid = 1722] [serial = 443] [outer = 0x11ef55c00] 03:58:26 INFO - ++DOCSHELL 0x12d99a800 == 24 [pid = 1722] [id = 190] 03:58:26 INFO - ++DOMWINDOW == 47 (0x1214b0400) [pid = 1722] [serial = 444] [outer = 0x0] 03:58:26 INFO - ++DOMWINDOW == 48 (0x121531000) [pid = 1722] [serial = 445] [outer = 0x1214b0400] 03:58:27 INFO - ++DOCSHELL 0x120e18800 == 25 [pid = 1722] [id = 191] 03:58:27 INFO - ++DOMWINDOW == 49 (0x121318000) [pid = 1722] [serial = 446] [outer = 0x0] 03:58:27 INFO - ++DOMWINDOW == 50 (0x121319c00) [pid = 1722] [serial = 447] [outer = 0x121318000] 03:58:28 INFO - --DOCSHELL 0x121883800 == 24 [pid = 1722] [id = 177] 03:58:28 INFO - --DOCSHELL 0x120e0d800 == 23 [pid = 1722] [id = 172] 03:58:28 INFO - --DOCSHELL 0x120e0e000 == 22 [pid = 1722] [id = 173] 03:58:28 INFO - --DOCSHELL 0x120ead800 == 21 [pid = 1722] [id = 174] 03:58:28 INFO - --DOCSHELL 0x112cc6000 == 20 [pid = 1722] [id = 181] 03:58:28 INFO - --DOCSHELL 0x11efdb000 == 19 [pid = 1722] [id = 171] 03:58:28 INFO - --DOCSHELL 0x12f241800 == 18 [pid = 1722] [id = 175] 03:58:28 INFO - --DOCSHELL 0x112b32800 == 17 [pid = 1722] [id = 169] 03:58:28 INFO - --DOCSHELL 0x112cc8800 == 16 [pid = 1722] [id = 182] 03:58:28 INFO - --DOCSHELL 0x112968800 == 15 [pid = 1722] [id = 183] 03:58:28 INFO - --DOCSHELL 0x12d426000 == 14 [pid = 1722] [id = 184] 03:58:28 INFO - --DOCSHELL 0x12d99a800 == 13 [pid = 1722] [id = 190] 03:58:28 INFO - --DOCSHELL 0x113510800 == 12 [pid = 1722] [id = 185] 03:58:28 INFO - --DOCSHELL 0x120e18800 == 11 [pid = 1722] [id = 191] 03:58:28 INFO - --DOMWINDOW == 49 (0x11f5cd400) [pid = 1722] [serial = 420] [outer = 0x0] [url = about:blank] 03:58:28 INFO - --DOMWINDOW == 48 (0x112f49400) [pid = 1722] [serial = 418] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:28 INFO - --DOMWINDOW == 47 (0x12ff23000) [pid = 1722] [serial = 415] [outer = 0x0] [url = about:blank] 03:58:28 INFO - --DOMWINDOW == 46 (0x12f59a800) [pid = 1722] [serial = 413] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:28 INFO - --DOMWINDOW == 45 (0x12532c800) [pid = 1722] [serial = 405] [outer = 0x0] [url = about:privatebrowsing] 03:58:28 INFO - --DOMWINDOW == 44 (0x12ee18000) [pid = 1722] [serial = 412] [outer = 0x0] [url = about:privatebrowsing] 03:58:28 INFO - --DOMWINDOW == 43 (0x122115800) [pid = 1722] [serial = 406] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20world!%20bug%20874061click] 03:58:28 INFO - --DOMWINDOW == 42 (0x121117c00) [pid = 1722] [serial = 427] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs] 03:58:28 INFO - --DOMWINDOW == 41 (0x120262800) [pid = 1722] [serial = 425] [outer = 0x0] [url = about:blank] 03:58:28 INFO - --DOMWINDOW == 40 (0x113e0ac00) [pid = 1722] [serial = 439] [outer = 0x0] [url = about:blank] 03:58:28 INFO - --DOMWINDOW == 39 (0x1203e6800) [pid = 1722] [serial = 426] [outer = 0x0] [url = about:blank] 03:58:28 INFO - --DOMWINDOW == 38 (0x11f10bc00) [pid = 1722] [serial = 442] [outer = 0x0] [url = about:blank] 03:58:28 INFO - --DOMWINDOW == 37 (0x124341000) [pid = 1722] [serial = 430] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:28 INFO - --DOMWINDOW == 36 (0x124393c00) [pid = 1722] [serial = 433] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:28 INFO - --DOMWINDOW == 35 (0x1202e6000) [pid = 1722] [serial = 423] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:28 INFO - --DOMWINDOW == 34 (0x112f47000) [pid = 1722] [serial = 421] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:28 INFO - --DOMWINDOW == 33 (0x11ee57c00) [pid = 1722] [serial = 395] [outer = 0x0] [url = chrome://browser/content/browser.xul] 03:58:28 INFO - --DOMWINDOW == 32 (0x12f25c000) [pid = 1722] [serial = 435] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs] 03:58:28 INFO - MEMORY STAT | vsize 3380MB | residentFast 409MB | heapAllocated 107MB 03:58:28 INFO - 141 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view.js | took 3077ms 03:58:28 INFO - ++DOCSHELL 0x112cc2000 == 12 [pid = 1722] [id = 192] 03:58:28 INFO - ++DOMWINDOW == 33 (0x112bc1800) [pid = 1722] [serial = 448] [outer = 0x0] 03:58:28 INFO - ++DOMWINDOW == 34 (0x112f46400) [pid = 1722] [serial = 449] [outer = 0x112bc1800] 03:58:28 INFO - 142 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_dom_nodes.js 03:58:29 INFO - ++DOCSHELL 0x113e3a800 == 13 [pid = 1722] [id = 193] 03:58:29 INFO - ++DOMWINDOW == 35 (0x1132e4c00) [pid = 1722] [serial = 450] [outer = 0x0] 03:58:29 INFO - ++DOMWINDOW == 36 (0x1135e7400) [pid = 1722] [serial = 451] [outer = 0x1132e4c00] 03:58:29 INFO - ++DOCSHELL 0x112cb7800 == 14 [pid = 1722] [id = 194] 03:58:29 INFO - ++DOMWINDOW == 37 (0x1135f3400) [pid = 1722] [serial = 452] [outer = 0x0] 03:58:29 INFO - ++DOMWINDOW == 38 (0x11e7aac00) [pid = 1722] [serial = 453] [outer = 0x1135f3400] 03:58:29 INFO - ++DOMWINDOW == 39 (0x11f5bf800) [pid = 1722] [serial = 454] [outer = 0x1135f3400] 03:58:29 INFO - ++DOCSHELL 0x120eaa000 == 15 [pid = 1722] [id = 195] 03:58:29 INFO - ++DOMWINDOW == 40 (0x12130b400) [pid = 1722] [serial = 455] [outer = 0x0] 03:58:29 INFO - ++DOMWINDOW == 41 (0x12130d800) [pid = 1722] [serial = 456] [outer = 0x12130b400] 03:58:30 INFO - ++DOCSHELL 0x12d42a000 == 16 [pid = 1722] [id = 196] 03:58:30 INFO - ++DOMWINDOW == 42 (0x121317800) [pid = 1722] [serial = 457] [outer = 0x0] 03:58:30 INFO - ++DOMWINDOW == 43 (0x121319800) [pid = 1722] [serial = 458] [outer = 0x121317800] 03:58:31 INFO - --DOCSHELL 0x112cc6800 == 15 [pid = 1722] [id = 187] 03:58:31 INFO - --DOCSHELL 0x11e34d000 == 14 [pid = 1722] [id = 188] 03:58:31 INFO - --DOCSHELL 0x11e840800 == 13 [pid = 1722] [id = 189] 03:58:31 INFO - --DOCSHELL 0x120eaa000 == 12 [pid = 1722] [id = 195] 03:58:31 INFO - --DOCSHELL 0x12d42a000 == 11 [pid = 1722] [id = 196] 03:58:31 INFO - --DOMWINDOW == 42 (0x1203dec00) [pid = 1722] [serial = 424] [outer = 0x0] [url = about:blank] 03:58:31 INFO - --DOMWINDOW == 41 (0x112f4c800) [pid = 1722] [serial = 422] [outer = 0x0] [url = about:blank] 03:58:31 INFO - --DOMWINDOW == 40 (0x11ef53400) [pid = 1722] [serial = 396] [outer = 0x0] [url = about:blank] 03:58:31 INFO - --DOMWINDOW == 39 (0x124396000) [pid = 1722] [serial = 434] [outer = 0x0] [url = about:blank] 03:58:31 INFO - --DOMWINDOW == 38 (0x1223f3400) [pid = 1722] [serial = 432] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:31 INFO - --DOMWINDOW == 37 (0x12648b800) [pid = 1722] [serial = 407] [outer = 0x0] [url = about:blank] 03:58:31 INFO - --DOMWINDOW == 36 (0x112f49800) [pid = 1722] [serial = 437] [outer = 0x0] [url = about:blank] 03:58:31 INFO - --DOMWINDOW == 35 (0x11e7aac00) [pid = 1722] [serial = 453] [outer = 0x0] [url = about:blank] 03:58:31 INFO - --DOMWINDOW == 34 (0x121318000) [pid = 1722] [serial = 446] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:31 INFO - --DOMWINDOW == 33 (0x113d04c00) [pid = 1722] [serial = 438] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:58:31 INFO - --DOMWINDOW == 32 (0x112f44000) [pid = 1722] [serial = 436] [outer = 0x0] [url = about:blank] 03:58:31 INFO - --DOMWINDOW == 31 (0x1221b7000) [pid = 1722] [serial = 440] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:58:31 INFO - MEMORY STAT | vsize 3380MB | residentFast 409MB | heapAllocated 106MB 03:58:31 INFO - 143 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_dom_nodes.js | took 2359ms 03:58:31 INFO - ++DOCSHELL 0x112cbc000 == 12 [pid = 1722] [id = 197] 03:58:31 INFO - ++DOMWINDOW == 32 (0x112c94c00) [pid = 1722] [serial = 459] [outer = 0x0] 03:58:31 INFO - ++DOMWINDOW == 33 (0x112f45000) [pid = 1722] [serial = 460] [outer = 0x112c94c00] 03:58:31 INFO - 144 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_dont_sort_non_sortable_classes_properties.js 03:58:31 INFO - ++DOCSHELL 0x113512800 == 13 [pid = 1722] [id = 198] 03:58:31 INFO - ++DOMWINDOW == 34 (0x113399000) [pid = 1722] [serial = 461] [outer = 0x0] 03:58:31 INFO - ++DOMWINDOW == 35 (0x113d0b800) [pid = 1722] [serial = 462] [outer = 0x113399000] 03:58:31 INFO - ++DOCSHELL 0x112cc3800 == 14 [pid = 1722] [id = 199] 03:58:31 INFO - ++DOMWINDOW == 36 (0x113e05800) [pid = 1722] [serial = 463] [outer = 0x0] 03:58:31 INFO - ++DOMWINDOW == 37 (0x11ef1f400) [pid = 1722] [serial = 464] [outer = 0x113e05800] 03:58:31 INFO - ++DOMWINDOW == 38 (0x1202ed000) [pid = 1722] [serial = 465] [outer = 0x113e05800] 03:58:31 INFO - ++DOCSHELL 0x120ea3000 == 15 [pid = 1722] [id = 200] 03:58:31 INFO - ++DOMWINDOW == 39 (0x12115b000) [pid = 1722] [serial = 466] [outer = 0x0] 03:58:31 INFO - ++DOMWINDOW == 40 (0x12115cc00) [pid = 1722] [serial = 467] [outer = 0x12115b000] 03:58:32 INFO - ++DOCSHELL 0x12506f000 == 16 [pid = 1722] [id = 201] 03:58:32 INFO - ++DOMWINDOW == 41 (0x121316c00) [pid = 1722] [serial = 468] [outer = 0x0] 03:58:32 INFO - ++DOMWINDOW == 42 (0x1214a8400) [pid = 1722] [serial = 469] [outer = 0x121316c00] 03:58:37 INFO - --DOCSHELL 0x112cc2000 == 15 [pid = 1722] [id = 192] 03:58:37 INFO - --DOCSHELL 0x112cc3800 == 14 [pid = 1722] [id = 199] 03:58:37 INFO - --DOCSHELL 0x120ea3000 == 13 [pid = 1722] [id = 200] 03:58:37 INFO - --DOCSHELL 0x112cb7800 == 12 [pid = 1722] [id = 194] 03:58:37 INFO - --DOCSHELL 0x113e3a800 == 11 [pid = 1722] [id = 193] 03:58:37 INFO - --DOCSHELL 0x12506f000 == 10 [pid = 1722] [id = 201] 03:58:37 INFO - --DOMWINDOW == 41 (0x121319c00) [pid = 1722] [serial = 447] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:37 INFO - --DOMWINDOW == 40 (0x121317800) [pid = 1722] [serial = 457] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:37 INFO - --DOMWINDOW == 39 (0x1214b0400) [pid = 1722] [serial = 444] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:37 INFO - --DOMWINDOW == 38 (0x12130b400) [pid = 1722] [serial = 455] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:37 INFO - --DOMWINDOW == 37 (0x1135f3400) [pid = 1722] [serial = 452] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:37 INFO - --DOMWINDOW == 36 (0x1132e4c00) [pid = 1722] [serial = 450] [outer = 0x0] [url = data:text/html;charset=utf-8,%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20Test%20for%20DOM%20nodes%20in%20variables%20view%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%] 03:58:37 INFO - --DOMWINDOW == 35 (0x112bc1800) [pid = 1722] [serial = 448] [outer = 0x0] [url = about:blank] 03:58:37 INFO - --DOMWINDOW == 34 (0x11ef55c00) [pid = 1722] [serial = 441] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:37 INFO - --DOMWINDOW == 33 (0x11ef1f400) [pid = 1722] [serial = 464] [outer = 0x0] [url = about:blank] 03:58:37 INFO - --DOMWINDOW == 32 (0x1135e7400) [pid = 1722] [serial = 451] [outer = 0x0] [url = about:blank] 03:58:37 INFO - --DOMWINDOW == 31 (0x112f46400) [pid = 1722] [serial = 449] [outer = 0x0] [url = about:blank] 03:58:37 INFO - MEMORY STAT | vsize 3378MB | residentFast 408MB | heapAllocated 111MB 03:58:37 INFO - 145 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_dont_sort_non_sortable_classes_properties.js | took 6122ms 03:58:37 INFO - ++DOCSHELL 0x112cc3800 == 11 [pid = 1722] [id = 202] 03:58:37 INFO - ++DOMWINDOW == 32 (0x112bc1800) [pid = 1722] [serial = 470] [outer = 0x0] 03:58:37 INFO - ++DOMWINDOW == 33 (0x112f46c00) [pid = 1722] [serial = 471] [outer = 0x112bc1800] 03:58:37 INFO - 146 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_filter.js 03:58:37 INFO - ++DOCSHELL 0x11e350000 == 12 [pid = 1722] [id = 203] 03:58:37 INFO - ++DOMWINDOW == 34 (0x1135f3400) [pid = 1722] [serial = 472] [outer = 0x0] 03:58:37 INFO - ++DOMWINDOW == 35 (0x113e0a000) [pid = 1722] [serial = 473] [outer = 0x1135f3400] 03:58:37 INFO - ++DOCSHELL 0x112959000 == 13 [pid = 1722] [id = 204] 03:58:37 INFO - ++DOMWINDOW == 36 (0x112982800) [pid = 1722] [serial = 474] [outer = 0x0] 03:58:37 INFO - ++DOMWINDOW == 37 (0x11f109000) [pid = 1722] [serial = 475] [outer = 0x112982800] 03:58:38 INFO - ++DOMWINDOW == 38 (0x1203e3000) [pid = 1722] [serial = 476] [outer = 0x112982800] 03:58:38 INFO - ++DOCSHELL 0x120eab800 == 14 [pid = 1722] [id = 205] 03:58:38 INFO - ++DOMWINDOW == 39 (0x12130c400) [pid = 1722] [serial = 477] [outer = 0x0] 03:58:38 INFO - ++DOMWINDOW == 40 (0x12130dc00) [pid = 1722] [serial = 478] [outer = 0x12130c400] 03:58:38 INFO - ++DOCSHELL 0x12f5b2800 == 15 [pid = 1722] [id = 206] 03:58:38 INFO - ++DOMWINDOW == 41 (0x12504d400) [pid = 1722] [serial = 479] [outer = 0x0] 03:58:38 INFO - ++DOMWINDOW == 42 (0x1250af400) [pid = 1722] [serial = 480] [outer = 0x12504d400] 03:58:40 INFO - --DOCSHELL 0x120eab800 == 14 [pid = 1722] [id = 205] 03:58:40 INFO - --DOCSHELL 0x112cbc000 == 13 [pid = 1722] [id = 197] 03:58:40 INFO - --DOCSHELL 0x12f5b2800 == 12 [pid = 1722] [id = 206] 03:58:40 INFO - --DOCSHELL 0x113512800 == 11 [pid = 1722] [id = 198] 03:58:40 INFO - --DOMWINDOW == 41 (0x121319800) [pid = 1722] [serial = 458] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:40 INFO - --DOMWINDOW == 40 (0x12130d800) [pid = 1722] [serial = 456] [outer = 0x0] [url = about:blank] 03:58:40 INFO - --DOMWINDOW == 39 (0x11f5bf800) [pid = 1722] [serial = 454] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:40 INFO - --DOMWINDOW == 38 (0x121531000) [pid = 1722] [serial = 445] [outer = 0x0] [url = about:blank] 03:58:40 INFO - --DOMWINDOW == 37 (0x120e23800) [pid = 1722] [serial = 443] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:40 INFO - --DOMWINDOW == 36 (0x121316c00) [pid = 1722] [serial = 468] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:40 INFO - --DOMWINDOW == 35 (0x113399000) [pid = 1722] [serial = 461] [outer = 0x0] [url = data:text/html;charset=utf-8,%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20Test%20document%20for%20bug%20977500%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20

%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20
%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20
%20%20%20%20%] 03:58:40 INFO - --DOMWINDOW == 34 (0x11f109000) [pid = 1722] [serial = 475] [outer = 0x0] [url = about:blank] 03:58:40 INFO - --DOMWINDOW == 33 (0x112c94c00) [pid = 1722] [serial = 459] [outer = 0x0] [url = about:blank] 03:58:40 INFO - --DOMWINDOW == 32 (0x112f45000) [pid = 1722] [serial = 460] [outer = 0x0] [url = about:blank] 03:58:40 INFO - --DOMWINDOW == 31 (0x113e05800) [pid = 1722] [serial = 463] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:40 INFO - --DOMWINDOW == 30 (0x12115b000) [pid = 1722] [serial = 466] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:40 INFO - --DOMWINDOW == 29 (0x113d0b800) [pid = 1722] [serial = 462] [outer = 0x0] [url = about:blank] 03:58:40 INFO - MEMORY STAT | vsize 3378MB | residentFast 408MB | heapAllocated 106MB 03:58:40 INFO - 147 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_filter.js | took 2774ms 03:58:40 INFO - ++DOCSHELL 0x112cc2800 == 12 [pid = 1722] [id = 207] 03:58:40 INFO - ++DOMWINDOW == 30 (0x1129b9800) [pid = 1722] [serial = 481] [outer = 0x0] 03:58:40 INFO - ++DOMWINDOW == 31 (0x112f42400) [pid = 1722] [serial = 482] [outer = 0x1129b9800] 03:58:40 INFO - 148 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_highlighter.js 03:58:40 INFO - ++DOCSHELL 0x113e45000 == 13 [pid = 1722] [id = 208] 03:58:40 INFO - ++DOMWINDOW == 32 (0x11339c000) [pid = 1722] [serial = 483] [outer = 0x0] 03:58:40 INFO - ++DOMWINDOW == 33 (0x113d0b800) [pid = 1722] [serial = 484] [outer = 0x11339c000] 03:58:40 INFO - ++DOMWINDOW == 34 (0x11e7ae800) [pid = 1722] [serial = 485] [outer = 0x11339c000] 03:58:40 INFO - ++DOCSHELL 0x120e09000 == 14 [pid = 1722] [id = 209] 03:58:40 INFO - ++DOMWINDOW == 35 (0x110d5b400) [pid = 1722] [serial = 486] [outer = 0x0] 03:58:40 INFO - ++DOMWINDOW == 36 (0x11f10e400) [pid = 1722] [serial = 487] [outer = 0x110d5b400] 03:58:40 INFO - ++DOMWINDOW == 37 (0x120d16800) [pid = 1722] [serial = 488] [outer = 0x110d5b400] 03:58:41 INFO - ++DOCSHELL 0x122384000 == 15 [pid = 1722] [id = 210] 03:58:41 INFO - ++DOMWINDOW == 38 (0x12130c000) [pid = 1722] [serial = 489] [outer = 0x0] 03:58:41 INFO - ++DOMWINDOW == 39 (0x12130ec00) [pid = 1722] [serial = 490] [outer = 0x12130c000] 03:58:42 INFO - ++DOCSHELL 0x11330a000 == 16 [pid = 1722] [id = 211] 03:58:42 INFO - ++DOMWINDOW == 40 (0x1247c3000) [pid = 1722] [serial = 491] [outer = 0x0] 03:58:42 INFO - ++DOMWINDOW == 41 (0x1247ca000) [pid = 1722] [serial = 492] [outer = 0x1247c3000] 03:58:42 INFO - ++DOCSHELL 0x12f5be000 == 17 [pid = 1722] [id = 212] 03:58:42 INFO - ++DOMWINDOW == 42 (0x129d10c00) [pid = 1722] [serial = 493] [outer = 0x0] 03:58:42 INFO - ++DOMWINDOW == 43 (0x12a06f400) [pid = 1722] [serial = 494] [outer = 0x129d10c00] 03:58:42 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:42 INFO - ++DOCSHELL 0x12fdcd000 == 18 [pid = 1722] [id = 213] 03:58:42 INFO - ++DOMWINDOW == 44 (0x12f1b3400) [pid = 1722] [serial = 495] [outer = 0x0] 03:58:42 INFO - ++DOMWINDOW == 45 (0x12f1c0c00) [pid = 1722] [serial = 496] [outer = 0x12f1b3400] 03:58:42 INFO - ++DOCSHELL 0x12ff81800 == 19 [pid = 1722] [id = 214] 03:58:42 INFO - ++DOMWINDOW == 46 (0x12f265c00) [pid = 1722] [serial = 497] [outer = 0x0] 03:58:42 INFO - ++DOCSHELL 0x12ff83000 == 20 [pid = 1722] [id = 215] 03:58:42 INFO - ++DOMWINDOW == 47 (0x12f2bec00) [pid = 1722] [serial = 498] [outer = 0x0] 03:58:42 INFO - ++DOCSHELL 0x12ff84800 == 21 [pid = 1722] [id = 216] 03:58:42 INFO - ++DOMWINDOW == 48 (0x12f2bf800) [pid = 1722] [serial = 499] [outer = 0x0] 03:58:42 INFO - ++DOCSHELL 0x12ff86800 == 22 [pid = 1722] [id = 217] 03:58:42 INFO - ++DOMWINDOW == 49 (0x12f2ca000) [pid = 1722] [serial = 500] [outer = 0x0] 03:58:42 INFO - ++DOCSHELL 0x1128cb000 == 23 [pid = 1722] [id = 218] 03:58:42 INFO - ++DOMWINDOW == 50 (0x12f2cbc00) [pid = 1722] [serial = 501] [outer = 0x0] 03:58:42 INFO - ++DOMWINDOW == 51 (0x12f598c00) [pid = 1722] [serial = 502] [outer = 0x12f265c00] 03:58:42 INFO - ++DOMWINDOW == 52 (0x12f59a000) [pid = 1722] [serial = 503] [outer = 0x12f2bec00] 03:58:42 INFO - ++DOMWINDOW == 53 (0x12fcc6800) [pid = 1722] [serial = 504] [outer = 0x12f2bf800] 03:58:42 INFO - ++DOMWINDOW == 54 (0x12fcc9000) [pid = 1722] [serial = 505] [outer = 0x12f2ca000] 03:58:42 INFO - ++DOMWINDOW == 55 (0x12fcd4400) [pid = 1722] [serial = 506] [outer = 0x12f2cbc00] 03:58:42 INFO - ++DOCSHELL 0x124f04800 == 24 [pid = 1722] [id = 219] 03:58:42 INFO - ++DOMWINDOW == 56 (0x12ffc6400) [pid = 1722] [serial = 507] [outer = 0x0] 03:58:42 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:42 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:43 INFO - ++DOMWINDOW == 57 (0x12f25d000) [pid = 1722] [serial = 508] [outer = 0x12ffc6400] 03:58:43 INFO - console.warn: Asynchronous operation was aborted as selection changed. 03:58:43 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:43 INFO - ++DOCSHELL 0x130599000 == 25 [pid = 1722] [id = 220] 03:58:43 INFO - ++DOMWINDOW == 58 (0x13010fc00) [pid = 1722] [serial = 509] [outer = 0x0] 03:58:43 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:43 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:43 INFO - ++DOCSHELL 0x1293c4800 == 26 [pid = 1722] [id = 221] 03:58:43 INFO - ++DOMWINDOW == 59 (0x1273e3400) [pid = 1722] [serial = 510] [outer = 0x0] 03:58:43 INFO - ++DOCSHELL 0x1293c5000 == 27 [pid = 1722] [id = 222] 03:58:43 INFO - ++DOMWINDOW == 60 (0x13052cc00) [pid = 1722] [serial = 511] [outer = 0x0] 03:58:43 INFO - ++DOCSHELL 0x1293c5800 == 28 [pid = 1722] [id = 223] 03:58:43 INFO - ++DOMWINDOW == 61 (0x13052d400) [pid = 1722] [serial = 512] [outer = 0x0] 03:58:43 INFO - ++DOCSHELL 0x1293c6000 == 29 [pid = 1722] [id = 224] 03:58:43 INFO - ++DOMWINDOW == 62 (0x13052dc00) [pid = 1722] [serial = 513] [outer = 0x0] 03:58:43 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:43 INFO - ++DOCSHELL 0x1293c7000 == 30 [pid = 1722] [id = 225] 03:58:43 INFO - ++DOMWINDOW == 63 (0x130537800) [pid = 1722] [serial = 514] [outer = 0x0] 03:58:43 INFO - ++DOMWINDOW == 64 (0x130b65400) [pid = 1722] [serial = 515] [outer = 0x130537800] 03:58:43 INFO - ++DOMWINDOW == 65 (0x124c34000) [pid = 1722] [serial = 516] [outer = 0x13010fc00] 03:58:43 INFO - ++DOMWINDOW == 66 (0x124c35000) [pid = 1722] [serial = 517] [outer = 0x1273e3400] 03:58:43 INFO - ++DOMWINDOW == 67 (0x124c36000) [pid = 1722] [serial = 518] [outer = 0x13052cc00] 03:58:43 INFO - ++DOMWINDOW == 68 (0x124c37000) [pid = 1722] [serial = 519] [outer = 0x13052d400] 03:58:43 INFO - ++DOMWINDOW == 69 (0x124c38000) [pid = 1722] [serial = 520] [outer = 0x13052dc00] 03:58:43 INFO - ++DOMWINDOW == 70 (0x124c39000) [pid = 1722] [serial = 521] [outer = 0x130537800] 03:58:44 INFO - Exported SkiaGL extensions: GL_EXT_packed_depth_stencil GL_EXT_bgra 03:58:44 INFO - Determined SkiaGL cache limits: Size 100663296, Items: 256 03:58:44 INFO - [GFX2-]: Using SkiaGL canvas. 03:58:47 INFO - --DOCSHELL 0x1293c5000 == 29 [pid = 1722] [id = 222] 03:58:47 INFO - --DOCSHELL 0x1293c5800 == 28 [pid = 1722] [id = 223] 03:58:47 INFO - --DOCSHELL 0x1293c4800 == 27 [pid = 1722] [id = 221] 03:58:47 INFO - --DOCSHELL 0x1293c6000 == 26 [pid = 1722] [id = 224] 03:58:47 INFO - --DOCSHELL 0x130599000 == 25 [pid = 1722] [id = 220] 03:58:47 INFO - --DOCSHELL 0x124f04800 == 24 [pid = 1722] [id = 219] 03:58:48 INFO - --DOCSHELL 0x1293c7000 == 23 [pid = 1722] [id = 225] 03:58:48 INFO - --DOCSHELL 0x11e350000 == 22 [pid = 1722] [id = 203] 03:58:48 INFO - --DOCSHELL 0x122384000 == 21 [pid = 1722] [id = 210] 03:58:48 INFO - --DOCSHELL 0x11330a000 == 20 [pid = 1722] [id = 211] 03:58:48 INFO - --DOCSHELL 0x12f5be000 == 19 [pid = 1722] [id = 212] 03:58:48 INFO - --DOCSHELL 0x12fdcd000 == 18 [pid = 1722] [id = 213] 03:58:48 INFO - --DOCSHELL 0x112cc3800 == 17 [pid = 1722] [id = 202] 03:58:48 INFO - --DOCSHELL 0x112959000 == 16 [pid = 1722] [id = 204] 03:58:48 INFO - --DOCSHELL 0x12ff81800 == 15 [pid = 1722] [id = 214] 03:58:48 INFO - --DOCSHELL 0x12ff83000 == 14 [pid = 1722] [id = 215] 03:58:48 INFO - --DOCSHELL 0x12ff84800 == 13 [pid = 1722] [id = 216] 03:58:48 INFO - --DOCSHELL 0x12ff86800 == 12 [pid = 1722] [id = 217] 03:58:48 INFO - --DOCSHELL 0x1128cb000 == 11 [pid = 1722] [id = 218] 03:58:48 INFO - --DOMWINDOW == 69 (0x1202ed000) [pid = 1722] [serial = 465] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:48 INFO - --DOMWINDOW == 68 (0x12115cc00) [pid = 1722] [serial = 467] [outer = 0x0] [url = about:blank] 03:58:48 INFO - --DOMWINDOW == 67 (0x1214a8400) [pid = 1722] [serial = 469] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:49 INFO - --DOMWINDOW == 66 (0x12504d400) [pid = 1722] [serial = 479] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:49 INFO - --DOMWINDOW == 65 (0x124c39000) [pid = 1722] [serial = 521] [outer = 0x0] [url = data:text/html,] 03:58:49 INFO - --DOMWINDOW == 64 (0x112982800) [pid = 1722] [serial = 474] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:49 INFO - --DOMWINDOW == 63 (0x12130c400) [pid = 1722] [serial = 477] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:49 INFO - --DOMWINDOW == 62 (0x1135f3400) [pid = 1722] [serial = 472] [outer = 0x0] [url = data:text/html;charset=utf-8,webconsole-filter] 03:58:49 INFO - --DOMWINDOW == 61 (0x112bc1800) [pid = 1722] [serial = 470] [outer = 0x0] [url = about:blank] 03:58:49 INFO - --DOMWINDOW == 60 (0x13052dc00) [pid = 1722] [serial = 513] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 03:58:49 INFO - --DOMWINDOW == 59 (0x112f46c00) [pid = 1722] [serial = 471] [outer = 0x0] [url = about:blank] 03:58:49 INFO - --DOMWINDOW == 58 (0x130b65400) [pid = 1722] [serial = 515] [outer = 0x0] [url = about:blank] 03:58:49 INFO - --DOMWINDOW == 57 (0x1247c3000) [pid = 1722] [serial = 491] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:49 INFO - --DOMWINDOW == 56 (0x12f2ca000) [pid = 1722] [serial = 500] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 03:58:49 INFO - --DOMWINDOW == 55 (0x12f2bf800) [pid = 1722] [serial = 499] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 03:58:49 INFO - --DOMWINDOW == 54 (0x130537800) [pid = 1722] [serial = 514] [outer = 0x0] [url = data:text/html,] 03:58:49 INFO - --DOMWINDOW == 53 (0x11f10e400) [pid = 1722] [serial = 487] [outer = 0x0] [url = about:blank] 03:58:49 INFO - --DOMWINDOW == 52 (0x12ffc6400) [pid = 1722] [serial = 507] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:58:49 INFO - --DOMWINDOW == 51 (0x13052cc00) [pid = 1722] [serial = 511] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 03:58:49 INFO - --DOMWINDOW == 50 (0x13052d400) [pid = 1722] [serial = 512] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 03:58:49 INFO - --DOMWINDOW == 49 (0x113e0a000) [pid = 1722] [serial = 473] [outer = 0x0] [url = about:blank] 03:58:49 INFO - --DOMWINDOW == 48 (0x113d0b800) [pid = 1722] [serial = 484] [outer = 0x0] [url = about:blank] 03:58:49 INFO - --DOMWINDOW == 47 (0x12fcc6800) [pid = 1722] [serial = 504] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 03:58:49 INFO - MEMORY STAT | vsize 3383MB | residentFast 411MB | heapAllocated 111MB 03:58:49 INFO - 149 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_highlighter.js | took 8670ms 03:58:49 INFO - ++DOCSHELL 0x112cbe800 == 12 [pid = 1722] [id = 226] 03:58:49 INFO - ++DOMWINDOW == 48 (0x112982800) [pid = 1722] [serial = 522] [outer = 0x0] 03:58:49 INFO - ++DOMWINDOW == 49 (0x112f43800) [pid = 1722] [serial = 523] [outer = 0x112982800] 03:58:49 INFO - 150 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_while_debugging.js 03:58:49 INFO - ++DOCSHELL 0x112e85000 == 13 [pid = 1722] [id = 227] 03:58:49 INFO - ++DOMWINDOW == 50 (0x113e11000) [pid = 1722] [serial = 524] [outer = 0x0] 03:58:49 INFO - ++DOMWINDOW == 51 (0x114b2bc00) [pid = 1722] [serial = 525] [outer = 0x113e11000] 03:58:49 INFO - ++DOMWINDOW == 52 (0x120e30800) [pid = 1722] [serial = 526] [outer = 0x113e11000] 03:58:49 INFO - ++DOCSHELL 0x113518000 == 14 [pid = 1722] [id = 228] 03:58:49 INFO - ++DOMWINDOW == 53 (0x110d53400) [pid = 1722] [serial = 527] [outer = 0x0] 03:58:49 INFO - ++DOMWINDOW == 54 (0x1203de800) [pid = 1722] [serial = 528] [outer = 0x110d53400] 03:58:49 INFO - ++DOMWINDOW == 55 (0x120e25400) [pid = 1722] [serial = 529] [outer = 0x110d53400] 03:58:49 INFO - ++DOCSHELL 0x114b7f000 == 15 [pid = 1722] [id = 229] 03:58:49 INFO - ++DOMWINDOW == 56 (0x121316800) [pid = 1722] [serial = 530] [outer = 0x0] 03:58:49 INFO - ++DOMWINDOW == 57 (0x121317400) [pid = 1722] [serial = 531] [outer = 0x121316800] 03:58:50 INFO - ++DOCSHELL 0x120e9e800 == 16 [pid = 1722] [id = 230] 03:58:50 INFO - ++DOMWINDOW == 58 (0x120e31800) [pid = 1722] [serial = 532] [outer = 0x0] 03:58:50 INFO - ++DOMWINDOW == 59 (0x1247c6400) [pid = 1722] [serial = 533] [outer = 0x120e31800] 03:58:50 INFO - ++DOCSHELL 0x120e9f800 == 17 [pid = 1722] [id = 231] 03:58:50 INFO - ++DOMWINDOW == 60 (0x127078400) [pid = 1722] [serial = 534] [outer = 0x0] 03:58:50 INFO - ++DOMWINDOW == 61 (0x127331c00) [pid = 1722] [serial = 535] [outer = 0x127078400] 03:58:52 INFO - ++DOCSHELL 0x129369800 == 18 [pid = 1722] [id = 232] 03:58:52 INFO - ++DOMWINDOW == 62 (0x12ee15c00) [pid = 1722] [serial = 536] [outer = 0x0] 03:58:52 INFO - ++DOMWINDOW == 63 (0x12efbb800) [pid = 1722] [serial = 537] [outer = 0x12ee15c00] 03:58:53 INFO - --DOCSHELL 0x114b7f000 == 17 [pid = 1722] [id = 229] 03:58:53 INFO - --DOCSHELL 0x120e9e800 == 16 [pid = 1722] [id = 230] 03:58:53 INFO - --DOCSHELL 0x120e9f800 == 15 [pid = 1722] [id = 231] 03:58:53 INFO - --DOCSHELL 0x113e45000 == 14 [pid = 1722] [id = 208] 03:58:53 INFO - --DOCSHELL 0x112cc2800 == 13 [pid = 1722] [id = 207] 03:58:53 INFO - --DOCSHELL 0x129369800 == 12 [pid = 1722] [id = 232] 03:58:53 INFO - --DOCSHELL 0x120e09000 == 11 [pid = 1722] [id = 209] 03:58:53 INFO - --DOMWINDOW == 62 (0x1203e3000) [pid = 1722] [serial = 476] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:53 INFO - --DOMWINDOW == 61 (0x1247ca000) [pid = 1722] [serial = 492] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:53 INFO - --DOMWINDOW == 60 (0x12130dc00) [pid = 1722] [serial = 478] [outer = 0x0] [url = about:blank] 03:58:53 INFO - --DOMWINDOW == 59 (0x1250af400) [pid = 1722] [serial = 480] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:58:53 INFO - --DOMWINDOW == 58 (0x12fcc9000) [pid = 1722] [serial = 505] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 03:58:53 INFO - --DOMWINDOW == 57 (0x12f25d000) [pid = 1722] [serial = 508] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:58:53 INFO - --DOMWINDOW == 56 (0x124c36000) [pid = 1722] [serial = 518] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 03:58:53 INFO - --DOMWINDOW == 55 (0x124c37000) [pid = 1722] [serial = 519] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 03:58:53 INFO - --DOMWINDOW == 54 (0x124c38000) [pid = 1722] [serial = 520] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 03:58:53 INFO - --DOMWINDOW == 53 (0x12f2cbc00) [pid = 1722] [serial = 501] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 03:58:53 INFO - --DOMWINDOW == 52 (0x1129b9800) [pid = 1722] [serial = 481] [outer = 0x0] [url = about:blank] 03:58:53 INFO - --DOMWINDOW == 51 (0x11339c000) [pid = 1722] [serial = 483] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-952277-highlight-nodes-in-vview.html] 03:58:53 INFO - --DOMWINDOW == 50 (0x1273e3400) [pid = 1722] [serial = 510] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 03:58:53 INFO - --DOMWINDOW == 49 (0x13010fc00) [pid = 1722] [serial = 509] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 03:58:53 INFO - --DOMWINDOW == 48 (0x12f2bec00) [pid = 1722] [serial = 498] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 03:58:53 INFO - --DOMWINDOW == 47 (0x12f265c00) [pid = 1722] [serial = 497] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 03:58:53 INFO - --DOMWINDOW == 46 (0x12f1b3400) [pid = 1722] [serial = 495] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 03:58:53 INFO - --DOMWINDOW == 45 (0x1203de800) [pid = 1722] [serial = 528] [outer = 0x0] [url = about:blank] 03:58:53 INFO - --DOMWINDOW == 44 (0x112f42400) [pid = 1722] [serial = 482] [outer = 0x0] [url = about:blank] 03:58:53 INFO - --DOMWINDOW == 43 (0x114b2bc00) [pid = 1722] [serial = 525] [outer = 0x0] [url = about:blank] 03:58:53 INFO - --DOMWINDOW == 42 (0x110d5b400) [pid = 1722] [serial = 486] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:53 INFO - --DOMWINDOW == 41 (0x129d10c00) [pid = 1722] [serial = 493] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 03:58:53 INFO - --DOMWINDOW == 40 (0x12130c000) [pid = 1722] [serial = 489] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:58:53 INFO - --DOMWINDOW == 39 (0x12fcd4400) [pid = 1722] [serial = 506] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 03:58:53 INFO - --DOMWINDOW == 38 (0x11e7ae800) [pid = 1722] [serial = 485] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-952277-highlight-nodes-in-vview.html] 03:58:53 INFO - MEMORY STAT | vsize 3391MB | residentFast 414MB | heapAllocated 117MB 03:58:53 INFO - 151 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_while_debugging.js | took 4295ms 03:58:53 INFO - ++DOCSHELL 0x112cd2800 == 12 [pid = 1722] [id = 233] 03:58:53 INFO - ++DOMWINDOW == 39 (0x112f45000) [pid = 1722] [serial = 538] [outer = 0x0] 03:58:53 INFO - ++DOMWINDOW == 40 (0x11315bc00) [pid = 1722] [serial = 539] [outer = 0x112f45000] 03:58:53 INFO - 152 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_while_debugging_and_inspecting.js 03:58:53 INFO - ++DOCSHELL 0x1132a9000 == 13 [pid = 1722] [id = 234] 03:58:53 INFO - ++DOMWINDOW == 41 (0x114b20000) [pid = 1722] [serial = 540] [outer = 0x0] 03:58:53 INFO - ++DOMWINDOW == 42 (0x114b62c00) [pid = 1722] [serial = 541] [outer = 0x114b20000] 03:58:53 INFO - ++DOMWINDOW == 43 (0x12159f000) [pid = 1722] [serial = 542] [outer = 0x114b20000] 03:58:54 INFO - ++DOCSHELL 0x112cc8000 == 14 [pid = 1722] [id = 235] 03:58:54 INFO - ++DOMWINDOW == 44 (0x11f5cd000) [pid = 1722] [serial = 543] [outer = 0x0] 03:58:54 INFO - ++DOMWINDOW == 45 (0x1203db800) [pid = 1722] [serial = 544] [outer = 0x11f5cd000] 03:58:54 INFO - ++DOMWINDOW == 46 (0x120e23400) [pid = 1722] [serial = 545] [outer = 0x11f5cd000] 03:58:54 INFO - ++DOCSHELL 0x11ee2e800 == 15 [pid = 1722] [id = 236] 03:58:54 INFO - ++DOMWINDOW == 47 (0x1214acc00) [pid = 1722] [serial = 546] [outer = 0x0] 03:58:54 INFO - ++DOMWINDOW == 48 (0x1214b5400) [pid = 1722] [serial = 547] [outer = 0x1214acc00] 03:58:55 INFO - ++DOCSHELL 0x11ee45800 == 16 [pid = 1722] [id = 237] 03:58:55 INFO - ++DOMWINDOW == 49 (0x112bc1800) [pid = 1722] [serial = 548] [outer = 0x0] 03:58:55 INFO - ++DOMWINDOW == 50 (0x1215dd400) [pid = 1722] [serial = 549] [outer = 0x112bc1800] 03:58:55 INFO - ++DOCSHELL 0x121897000 == 17 [pid = 1722] [id = 238] 03:58:55 INFO - ++DOMWINDOW == 51 (0x1264adc00) [pid = 1722] [serial = 550] [outer = 0x0] 03:58:55 INFO - ++DOMWINDOW == 52 (0x1264b2c00) [pid = 1722] [serial = 551] [outer = 0x1264adc00] 03:58:55 INFO - ++DOCSHELL 0x12936a000 == 18 [pid = 1722] [id = 239] 03:58:55 INFO - ++DOMWINDOW == 53 (0x12ff45c00) [pid = 1722] [serial = 552] [outer = 0x0] 03:58:55 INFO - ++DOMWINDOW == 54 (0x12ff47c00) [pid = 1722] [serial = 553] [outer = 0x12ff45c00] 03:58:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:56 INFO - ++DOCSHELL 0x12937e000 == 19 [pid = 1722] [id = 240] 03:58:56 INFO - ++DOMWINDOW == 55 (0x12ffc7000) [pid = 1722] [serial = 554] [outer = 0x0] 03:58:56 INFO - ++DOMWINDOW == 56 (0x12ffc8400) [pid = 1722] [serial = 555] [outer = 0x12ffc7000] 03:58:56 INFO - ++DOCSHELL 0x129388000 == 20 [pid = 1722] [id = 241] 03:58:56 INFO - ++DOMWINDOW == 57 (0x12ffca400) [pid = 1722] [serial = 556] [outer = 0x0] 03:58:56 INFO - ++DOCSHELL 0x129388800 == 21 [pid = 1722] [id = 242] 03:58:56 INFO - ++DOMWINDOW == 58 (0x12ffcac00) [pid = 1722] [serial = 557] [outer = 0x0] 03:58:56 INFO - ++DOCSHELL 0x1293c2800 == 22 [pid = 1722] [id = 243] 03:58:56 INFO - ++DOMWINDOW == 59 (0x12ffcbc00) [pid = 1722] [serial = 558] [outer = 0x0] 03:58:56 INFO - ++DOCSHELL 0x1293c3800 == 23 [pid = 1722] [id = 244] 03:58:56 INFO - ++DOMWINDOW == 60 (0x12ffccc00) [pid = 1722] [serial = 559] [outer = 0x0] 03:58:56 INFO - ++DOCSHELL 0x1293c5000 == 24 [pid = 1722] [id = 245] 03:58:56 INFO - ++DOMWINDOW == 61 (0x12ffce400) [pid = 1722] [serial = 560] [outer = 0x0] 03:58:56 INFO - ++DOMWINDOW == 62 (0x130417800) [pid = 1722] [serial = 561] [outer = 0x12ffca400] 03:58:56 INFO - ++DOMWINDOW == 63 (0x13052a000) [pid = 1722] [serial = 562] [outer = 0x12ffcac00] 03:58:56 INFO - ++DOMWINDOW == 64 (0x13052d000) [pid = 1722] [serial = 563] [outer = 0x12ffcbc00] 03:58:56 INFO - ++DOMWINDOW == 65 (0x13052f400) [pid = 1722] [serial = 564] [outer = 0x12ffccc00] 03:58:56 INFO - ++DOMWINDOW == 66 (0x130b66800) [pid = 1722] [serial = 565] [outer = 0x12ffce400] 03:58:56 INFO - ++DOCSHELL 0x12966c000 == 25 [pid = 1722] [id = 246] 03:58:56 INFO - ++DOMWINDOW == 67 (0x130bfd000) [pid = 1722] [serial = 566] [outer = 0x0] 03:58:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:56 INFO - ++DOCSHELL 0x129d32800 == 26 [pid = 1722] [id = 247] 03:58:56 INFO - ++DOMWINDOW == 68 (0x12623d000) [pid = 1722] [serial = 567] [outer = 0x0] 03:58:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:56 INFO - ++DOMWINDOW == 69 (0x126241800) [pid = 1722] [serial = 568] [outer = 0x130bfd000] 03:58:56 INFO - [1722] WARNING: We should have hit the document element...: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175 03:58:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:56 INFO - ++DOCSHELL 0x12c3d0000 == 27 [pid = 1722] [id = 248] 03:58:56 INFO - ++DOMWINDOW == 70 (0x1283ed800) [pid = 1722] [serial = 569] [outer = 0x0] 03:58:56 INFO - ++DOCSHELL 0x12c3d2000 == 28 [pid = 1722] [id = 249] 03:58:56 INFO - ++DOMWINDOW == 71 (0x1283ee400) [pid = 1722] [serial = 570] [outer = 0x0] 03:58:56 INFO - ++DOCSHELL 0x12c447000 == 29 [pid = 1722] [id = 250] 03:58:56 INFO - ++DOMWINDOW == 72 (0x1283eec00) [pid = 1722] [serial = 571] [outer = 0x0] 03:58:56 INFO - ++DOCSHELL 0x12c447800 == 30 [pid = 1722] [id = 251] 03:58:56 INFO - ++DOMWINDOW == 73 (0x1283efc00) [pid = 1722] [serial = 572] [outer = 0x0] 03:58:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:58:56 INFO - ++DOCSHELL 0x12c448000 == 31 [pid = 1722] [id = 252] 03:58:56 INFO - ++DOMWINDOW == 74 (0x1283f0800) [pid = 1722] [serial = 573] [outer = 0x0] 03:58:56 INFO - ++DOMWINDOW == 75 (0x1283f1000) [pid = 1722] [serial = 574] [outer = 0x1283f0800] 03:58:56 INFO - ++DOMWINDOW == 76 (0x113444800) [pid = 1722] [serial = 575] [outer = 0x12623d000] 03:58:56 INFO - [1722] WARNING: Image width or height is non-positive: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6316 03:58:56 INFO - [1722] WARNING: Image width or height is non-positive: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6316 03:58:56 INFO - [1722] WARNING: Image width or height is non-positive: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6316 03:58:56 INFO - [1722] WARNING: Image width or height is non-positive: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6316 03:58:56 INFO - ++DOMWINDOW == 77 (0x11344dc00) [pid = 1722] [serial = 576] [outer = 0x1283ed800] 03:58:56 INFO - ++DOMWINDOW == 78 (0x11344ec00) [pid = 1722] [serial = 577] [outer = 0x1283ee400] 03:58:56 INFO - ++DOMWINDOW == 79 (0x11344fc00) [pid = 1722] [serial = 578] [outer = 0x1283eec00] 03:58:56 INFO - ++DOMWINDOW == 80 (0x113450c00) [pid = 1722] [serial = 579] [outer = 0x1283efc00] 03:58:56 INFO - ++DOMWINDOW == 81 (0x113452400) [pid = 1722] [serial = 580] [outer = 0x1283f0800] 03:58:57 INFO - ++DOCSHELL 0x112cc1800 == 32 [pid = 1722] [id = 253] 03:58:57 INFO - ++DOMWINDOW == 82 (0x114dbec00) [pid = 1722] [serial = 581] [outer = 0x0] 03:58:57 INFO - ++DOMWINDOW == 83 (0x110d5b400) [pid = 1722] [serial = 582] [outer = 0x114dbec00] 03:58:58 INFO - --DOCSHELL 0x12c448000 == 31 [pid = 1722] [id = 252] 03:58:58 INFO - --DOCSHELL 0x112cbe800 == 30 [pid = 1722] [id = 226] 03:58:58 INFO - --DOCSHELL 0x112e85000 == 29 [pid = 1722] [id = 227] 03:58:58 INFO - --DOCSHELL 0x113518000 == 28 [pid = 1722] [id = 228] 03:58:58 INFO - --DOMWINDOW == 82 (0x120d16800) [pid = 1722] [serial = 488] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:58:58 INFO - --DOMWINDOW == 81 (0x12130ec00) [pid = 1722] [serial = 490] [outer = 0x0] [url = about:blank] 03:58:58 INFO - --DOMWINDOW == 80 (0x12a06f400) [pid = 1722] [serial = 494] [outer = 0x0] [url = about:blank] 03:58:58 INFO - --DOMWINDOW == 79 (0x12f1c0c00) [pid = 1722] [serial = 496] [outer = 0x0] [url = about:blank] 03:58:58 INFO - --DOMWINDOW == 78 (0x12f598c00) [pid = 1722] [serial = 502] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 03:58:58 INFO - --DOMWINDOW == 77 (0x12f59a000) [pid = 1722] [serial = 503] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 03:58:58 INFO - --DOMWINDOW == 76 (0x124c34000) [pid = 1722] [serial = 516] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 03:58:58 INFO - --DOMWINDOW == 75 (0x124c35000) [pid = 1722] [serial = 517] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 03:58:59 INFO - --DOCSHELL 0x121897000 == 27 [pid = 1722] [id = 238] 03:58:59 INFO - --DOCSHELL 0x12c3d2000 == 26 [pid = 1722] [id = 249] 03:58:59 INFO - --DOCSHELL 0x12c447000 == 25 [pid = 1722] [id = 250] 03:58:59 INFO - --DOCSHELL 0x12c3d0000 == 24 [pid = 1722] [id = 248] 03:58:59 INFO - --DOCSHELL 0x12c447800 == 23 [pid = 1722] [id = 251] 03:58:59 INFO - --DOCSHELL 0x129d32800 == 22 [pid = 1722] [id = 247] 03:58:59 INFO - --DOCSHELL 0x12966c000 == 21 [pid = 1722] [id = 246] 03:58:59 INFO - --DOCSHELL 0x12937e000 == 20 [pid = 1722] [id = 240] 03:58:59 INFO - --DOCSHELL 0x12936a000 == 19 [pid = 1722] [id = 239] 03:58:59 INFO - --DOCSHELL 0x11ee45800 == 18 [pid = 1722] [id = 237] 03:58:59 INFO - --DOCSHELL 0x11ee2e800 == 17 [pid = 1722] [id = 236] 03:58:59 INFO - --DOCSHELL 0x112cc1800 == 16 [pid = 1722] [id = 253] 03:58:59 INFO - --DOCSHELL 0x129388000 == 15 [pid = 1722] [id = 241] 03:58:59 INFO - --DOCSHELL 0x129388800 == 14 [pid = 1722] [id = 242] 03:58:59 INFO - --DOCSHELL 0x1293c2800 == 13 [pid = 1722] [id = 243] 03:58:59 INFO - --DOCSHELL 0x1293c3800 == 12 [pid = 1722] [id = 244] 03:58:59 INFO - --DOCSHELL 0x1293c5000 == 11 [pid = 1722] [id = 245] 03:58:59 INFO - --DOCSHELL 0x112cc8000 == 10 [pid = 1722] [id = 235] 03:59:00 INFO - --DOMWINDOW == 74 (0x127078400) [pid = 1722] [serial = 534] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:00 INFO - --DOMWINDOW == 73 (0x12ffcbc00) [pid = 1722] [serial = 558] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 03:59:00 INFO - --DOMWINDOW == 72 (0x12ffcac00) [pid = 1722] [serial = 557] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 03:59:00 INFO - --DOMWINDOW == 71 (0x12623d000) [pid = 1722] [serial = 567] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 03:59:00 INFO - --DOMWINDOW == 70 (0x12ffca400) [pid = 1722] [serial = 556] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 03:59:00 INFO - --DOMWINDOW == 69 (0x1283efc00) [pid = 1722] [serial = 572] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 03:59:00 INFO - --DOMWINDOW == 68 (0x1283ed800) [pid = 1722] [serial = 569] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 03:59:00 INFO - --DOMWINDOW == 67 (0x1283eec00) [pid = 1722] [serial = 571] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 03:59:00 INFO - --DOMWINDOW == 66 (0x1283ee400) [pid = 1722] [serial = 570] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 03:59:00 INFO - --DOMWINDOW == 65 (0x121316800) [pid = 1722] [serial = 530] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:00 INFO - --DOMWINDOW == 64 (0x120e31800) [pid = 1722] [serial = 532] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 03:59:00 INFO - --DOMWINDOW == 63 (0x110d53400) [pid = 1722] [serial = 527] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:00 INFO - --DOMWINDOW == 62 (0x12ee15c00) [pid = 1722] [serial = 536] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:59:00 INFO - --DOMWINDOW == 61 (0x112982800) [pid = 1722] [serial = 522] [outer = 0x0] [url = about:blank] 03:59:00 INFO - --DOMWINDOW == 60 (0x113e11000) [pid = 1722] [serial = 524] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:59:00 INFO - --DOMWINDOW == 59 (0x1283f0800) [pid = 1722] [serial = 573] [outer = 0x0] [url = data:text/html,] 03:59:00 INFO - --DOMWINDOW == 58 (0x113452400) [pid = 1722] [serial = 580] [outer = 0x0] [url = data:text/html,] 03:59:00 INFO - --DOMWINDOW == 57 (0x130bfd000) [pid = 1722] [serial = 566] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:00 INFO - --DOMWINDOW == 56 (0x1264adc00) [pid = 1722] [serial = 550] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:00 INFO - --DOMWINDOW == 55 (0x12ffccc00) [pid = 1722] [serial = 559] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 03:59:00 INFO - --DOMWINDOW == 54 (0x1203db800) [pid = 1722] [serial = 544] [outer = 0x0] [url = about:blank] 03:59:00 INFO - --DOMWINDOW == 53 (0x112f43800) [pid = 1722] [serial = 523] [outer = 0x0] [url = about:blank] 03:59:00 INFO - --DOMWINDOW == 52 (0x114b62c00) [pid = 1722] [serial = 541] [outer = 0x0] [url = about:blank] 03:59:00 INFO - --DOMWINDOW == 51 (0x1283f1000) [pid = 1722] [serial = 574] [outer = 0x0] [url = about:blank] 03:59:00 INFO - --DOMWINDOW == 50 (0x13052d000) [pid = 1722] [serial = 563] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 03:59:00 INFO - --DOMWINDOW == 49 (0x120e30800) [pid = 1722] [serial = 526] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:59:00 INFO - MEMORY STAT | vsize 3403MB | residentFast 417MB | heapAllocated 120MB 03:59:00 INFO - 153 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_while_debugging_and_inspecting.js | took 6591ms 03:59:00 INFO - ++DOCSHELL 0x112cd4000 == 11 [pid = 1722] [id = 254] 03:59:00 INFO - ++DOMWINDOW == 50 (0x112f42800) [pid = 1722] [serial = 583] [outer = 0x0] 03:59:00 INFO - ++DOMWINDOW == 51 (0x112f4b000) [pid = 1722] [serial = 584] [outer = 0x112f42800] 03:59:00 INFO - 154 INFO TEST-START | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe.js 03:59:00 INFO - ++DOCSHELL 0x1135a7800 == 12 [pid = 1722] [id = 255] 03:59:00 INFO - ++DOMWINDOW == 52 (0x11344b400) [pid = 1722] [serial = 585] [outer = 0x0] 03:59:00 INFO - ++DOMWINDOW == 53 (0x113451c00) [pid = 1722] [serial = 586] [outer = 0x11344b400] 03:59:00 INFO - ++DOMWINDOW == 54 (0x121312400) [pid = 1722] [serial = 587] [outer = 0x11344b400] 03:59:00 INFO - ++DOCSHELL 0x11518d800 == 13 [pid = 1722] [id = 256] 03:59:00 INFO - ++DOMWINDOW == 55 (0x11265a800) [pid = 1722] [serial = 588] [outer = 0x0] 03:59:00 INFO - ++DOMWINDOW == 56 (0x11f719400) [pid = 1722] [serial = 589] [outer = 0x11265a800] 03:59:00 INFO - ++DOMWINDOW == 57 (0x120d16c00) [pid = 1722] [serial = 590] [outer = 0x11265a800] 03:59:00 INFO - ++DOCSHELL 0x11efc3000 == 14 [pid = 1722] [id = 257] 03:59:00 INFO - ++DOMWINDOW == 58 (0x121314800) [pid = 1722] [serial = 591] [outer = 0x0] 03:59:00 INFO - ++DOMWINDOW == 59 (0x121315c00) [pid = 1722] [serial = 592] [outer = 0x121314800] 03:59:01 INFO - ++DOCSHELL 0x120ea7800 == 15 [pid = 1722] [id = 258] 03:59:01 INFO - ++DOMWINDOW == 60 (0x120d1b000) [pid = 1722] [serial = 593] [outer = 0x0] 03:59:01 INFO - ++DOMWINDOW == 61 (0x124349400) [pid = 1722] [serial = 594] [outer = 0x120d1b000] 03:59:02 INFO - ++DOCSHELL 0x124f21000 == 16 [pid = 1722] [id = 259] 03:59:02 INFO - ++DOMWINDOW == 62 (0x126238c00) [pid = 1722] [serial = 595] [outer = 0x0] 03:59:02 INFO - ++DOMWINDOW == 63 (0x11d46c400) [pid = 1722] [serial = 596] [outer = 0x126238c00] 03:59:04 INFO - --DOCSHELL 0x1132a9000 == 15 [pid = 1722] [id = 234] 03:59:04 INFO - --DOCSHELL 0x112cd2800 == 14 [pid = 1722] [id = 233] 03:59:04 INFO - --DOMWINDOW == 62 (0x120e25400) [pid = 1722] [serial = 529] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:04 INFO - --DOMWINDOW == 61 (0x121317400) [pid = 1722] [serial = 531] [outer = 0x0] [url = about:blank] 03:59:04 INFO - --DOMWINDOW == 60 (0x1247c6400) [pid = 1722] [serial = 533] [outer = 0x0] [url = about:blank] 03:59:04 INFO - --DOMWINDOW == 59 (0x1264b2c00) [pid = 1722] [serial = 551] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:04 INFO - --DOMWINDOW == 58 (0x127331c00) [pid = 1722] [serial = 535] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:04 INFO - --DOMWINDOW == 57 (0x12efbb800) [pid = 1722] [serial = 537] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:59:04 INFO - --DOMWINDOW == 56 (0x126241800) [pid = 1722] [serial = 568] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:04 INFO - --DOMWINDOW == 55 (0x113444800) [pid = 1722] [serial = 575] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 03:59:04 INFO - --DOMWINDOW == 54 (0x130417800) [pid = 1722] [serial = 561] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 03:59:04 INFO - --DOMWINDOW == 53 (0x11344dc00) [pid = 1722] [serial = 576] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 03:59:04 INFO - --DOMWINDOW == 52 (0x13052a000) [pid = 1722] [serial = 562] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 03:59:04 INFO - --DOMWINDOW == 51 (0x113450c00) [pid = 1722] [serial = 579] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 03:59:04 INFO - --DOMWINDOW == 50 (0x13052f400) [pid = 1722] [serial = 564] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 03:59:04 INFO - --DOMWINDOW == 49 (0x11344ec00) [pid = 1722] [serial = 577] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 03:59:04 INFO - --DOMWINDOW == 48 (0x11344fc00) [pid = 1722] [serial = 578] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 03:59:04 INFO - --DOCSHELL 0x124f21000 == 13 [pid = 1722] [id = 259] 03:59:04 INFO - --DOCSHELL 0x120ea7800 == 12 [pid = 1722] [id = 258] 03:59:04 INFO - --DOCSHELL 0x11efc3000 == 11 [pid = 1722] [id = 257] 03:59:05 INFO - --DOCSHELL 0x11518d800 == 10 [pid = 1722] [id = 256] 03:59:05 INFO - --DOMWINDOW == 47 (0x12ffc7000) [pid = 1722] [serial = 554] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 03:59:05 INFO - --DOMWINDOW == 46 (0x126238c00) [pid = 1722] [serial = 595] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:05 INFO - --DOMWINDOW == 45 (0x112bc1800) [pid = 1722] [serial = 548] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 03:59:05 INFO - --DOMWINDOW == 44 (0x114dbec00) [pid = 1722] [serial = 581] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:59:05 INFO - --DOMWINDOW == 43 (0x1214acc00) [pid = 1722] [serial = 546] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:05 INFO - --DOMWINDOW == 42 (0x11f5cd000) [pid = 1722] [serial = 543] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:05 INFO - --DOMWINDOW == 41 (0x12ff45c00) [pid = 1722] [serial = 552] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 03:59:05 INFO - --DOMWINDOW == 40 (0x12ffce400) [pid = 1722] [serial = 560] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 03:59:05 INFO - --DOMWINDOW == 39 (0x112f45000) [pid = 1722] [serial = 538] [outer = 0x0] [url = about:blank] 03:59:05 INFO - --DOMWINDOW == 38 (0x114b20000) [pid = 1722] [serial = 540] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:59:05 INFO - --DOMWINDOW == 37 (0x11f719400) [pid = 1722] [serial = 589] [outer = 0x0] [url = about:blank] 03:59:05 INFO - --DOMWINDOW == 36 (0x11315bc00) [pid = 1722] [serial = 539] [outer = 0x0] [url = about:blank] 03:59:05 INFO - --DOMWINDOW == 35 (0x113451c00) [pid = 1722] [serial = 586] [outer = 0x0] [url = about:blank] 03:59:05 INFO - --DOMWINDOW == 34 (0x130b66800) [pid = 1722] [serial = 565] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 03:59:05 INFO - --DOMWINDOW == 33 (0x12159f000) [pid = 1722] [serial = 542] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:59:05 INFO - MEMORY STAT | vsize 3425MB | residentFast 433MB | heapAllocated 123MB 03:59:05 INFO - 155 INFO TEST-OK | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe.js | took 5278ms 03:59:05 INFO - ++DOCSHELL 0x112cc5000 == 11 [pid = 1722] [id = 260] 03:59:05 INFO - ++DOMWINDOW == 34 (0x112f42000) [pid = 1722] [serial = 597] [outer = 0x0] 03:59:05 INFO - ++DOMWINDOW == 35 (0x112f49000) [pid = 1722] [serial = 598] [outer = 0x112f42000] 03:59:05 INFO - 156 INFO TEST-START | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe2.js 03:59:05 INFO - ++DOCSHELL 0x112e8f800 == 12 [pid = 1722] [id = 261] 03:59:05 INFO - ++DOMWINDOW == 36 (0x11344a400) [pid = 1722] [serial = 599] [outer = 0x0] 03:59:05 INFO - ++DOMWINDOW == 37 (0x11344cc00) [pid = 1722] [serial = 600] [outer = 0x11344a400] 03:59:06 INFO - ++DOMWINDOW == 38 (0x12115ac00) [pid = 1722] [serial = 601] [outer = 0x11344a400] 03:59:06 INFO - ++DOCSHELL 0x112cb8800 == 13 [pid = 1722] [id = 262] 03:59:06 INFO - ++DOMWINDOW == 39 (0x115145400) [pid = 1722] [serial = 602] [outer = 0x0] 03:59:06 INFO - ++DOMWINDOW == 40 (0x115146800) [pid = 1722] [serial = 603] [outer = 0x115145400] 03:59:06 INFO - ++DOMWINDOW == 41 (0x11ef13000) [pid = 1722] [serial = 604] [outer = 0x115145400] 03:59:06 INFO - ++DOCSHELL 0x11e820800 == 14 [pid = 1722] [id = 263] 03:59:06 INFO - ++DOMWINDOW == 42 (0x12110b400) [pid = 1722] [serial = 605] [outer = 0x0] 03:59:06 INFO - ++DOMWINDOW == 43 (0x121113400) [pid = 1722] [serial = 606] [outer = 0x12110b400] 03:59:07 INFO - ++DOCSHELL 0x120175000 == 15 [pid = 1722] [id = 264] 03:59:07 INFO - ++DOMWINDOW == 44 (0x11f5cc800) [pid = 1722] [serial = 607] [outer = 0x0] 03:59:07 INFO - ++DOMWINDOW == 45 (0x122124800) [pid = 1722] [serial = 608] [outer = 0x11f5cc800] 03:59:07 INFO - ++DOCSHELL 0x121897800 == 16 [pid = 1722] [id = 265] 03:59:07 INFO - ++DOMWINDOW == 46 (0x122e9f800) [pid = 1722] [serial = 609] [outer = 0x0] 03:59:07 INFO - ++DOMWINDOW == 47 (0x122ea2800) [pid = 1722] [serial = 610] [outer = 0x122e9f800] 03:59:09 INFO - --DOCSHELL 0x112cd4000 == 15 [pid = 1722] [id = 254] 03:59:09 INFO - --DOCSHELL 0x11e820800 == 14 [pid = 1722] [id = 263] 03:59:09 INFO - --DOCSHELL 0x120175000 == 13 [pid = 1722] [id = 264] 03:59:09 INFO - --DOCSHELL 0x121897800 == 12 [pid = 1722] [id = 265] 03:59:09 INFO - --DOCSHELL 0x1135a7800 == 11 [pid = 1722] [id = 255] 03:59:09 INFO - --DOMWINDOW == 46 (0x110d5b400) [pid = 1722] [serial = 582] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:59:09 INFO - --DOMWINDOW == 45 (0x1215dd400) [pid = 1722] [serial = 549] [outer = 0x0] [url = about:blank] 03:59:09 INFO - --DOMWINDOW == 44 (0x11d46c400) [pid = 1722] [serial = 596] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:09 INFO - --DOMWINDOW == 43 (0x1214b5400) [pid = 1722] [serial = 547] [outer = 0x0] [url = about:blank] 03:59:09 INFO - --DOMWINDOW == 42 (0x120e23400) [pid = 1722] [serial = 545] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:09 INFO - --DOMWINDOW == 41 (0x12ffc8400) [pid = 1722] [serial = 555] [outer = 0x0] [url = about:blank] 03:59:09 INFO - --DOMWINDOW == 40 (0x12ff47c00) [pid = 1722] [serial = 553] [outer = 0x0] [url = about:blank] 03:59:09 INFO - --DOMWINDOW == 39 (0x11344cc00) [pid = 1722] [serial = 600] [outer = 0x0] [url = about:blank] 03:59:09 INFO - --DOMWINDOW == 38 (0x112f4b000) [pid = 1722] [serial = 584] [outer = 0x0] [url = about:blank] 03:59:09 INFO - --DOMWINDOW == 37 (0x115146800) [pid = 1722] [serial = 603] [outer = 0x0] [url = about:blank] 03:59:09 INFO - --DOMWINDOW == 36 (0x11265a800) [pid = 1722] [serial = 588] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:09 INFO - --DOMWINDOW == 35 (0x120d1b000) [pid = 1722] [serial = 593] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 03:59:09 INFO - --DOMWINDOW == 34 (0x121314800) [pid = 1722] [serial = 591] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:09 INFO - --DOMWINDOW == 33 (0x11344b400) [pid = 1722] [serial = 585] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:59:09 INFO - --DOMWINDOW == 32 (0x112f42800) [pid = 1722] [serial = 583] [outer = 0x0] [url = about:blank] 03:59:09 INFO - --DOMWINDOW == 31 (0x121312400) [pid = 1722] [serial = 587] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:59:09 INFO - MEMORY STAT | vsize 3461MB | residentFast 458MB | heapAllocated 134MB 03:59:09 INFO - 157 INFO TEST-OK | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe2.js | took 3923ms 03:59:09 INFO - ++DOCSHELL 0x112cc7000 == 12 [pid = 1722] [id = 266] 03:59:09 INFO - ++DOMWINDOW == 32 (0x112f41400) [pid = 1722] [serial = 611] [outer = 0x0] 03:59:09 INFO - ++DOMWINDOW == 33 (0x112f49400) [pid = 1722] [serial = 612] [outer = 0x112f41400] 03:59:09 INFO - 158 INFO TEST-START | devtools/client/webconsole/test/browser_jsterm_inspect.js 03:59:09 INFO - ++DOCSHELL 0x113317000 == 13 [pid = 1722] [id = 267] 03:59:09 INFO - ++DOMWINDOW == 34 (0x113449400) [pid = 1722] [serial = 613] [outer = 0x0] 03:59:10 INFO - ++DOMWINDOW == 35 (0x11344d000) [pid = 1722] [serial = 614] [outer = 0x113449400] 03:59:10 INFO - ++DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 268] 03:59:10 INFO - ++DOMWINDOW == 36 (0x11344e800) [pid = 1722] [serial = 615] [outer = 0x0] 03:59:10 INFO - ++DOMWINDOW == 37 (0x113e11400) [pid = 1722] [serial = 616] [outer = 0x11344e800] 03:59:10 INFO - ++DOMWINDOW == 38 (0x11ef14800) [pid = 1722] [serial = 617] [outer = 0x11344e800] 03:59:10 INFO - ++DOCSHELL 0x11e81b800 == 15 [pid = 1722] [id = 269] 03:59:10 INFO - ++DOMWINDOW == 39 (0x12110ac00) [pid = 1722] [serial = 618] [outer = 0x0] 03:59:10 INFO - ++DOMWINDOW == 40 (0x121115000) [pid = 1722] [serial = 619] [outer = 0x12110ac00] 03:59:11 INFO - ++DOCSHELL 0x112cca800 == 16 [pid = 1722] [id = 270] 03:59:11 INFO - ++DOMWINDOW == 41 (0x121319800) [pid = 1722] [serial = 620] [outer = 0x0] 03:59:11 INFO - ++DOMWINDOW == 42 (0x1214a9000) [pid = 1722] [serial = 621] [outer = 0x121319800] 03:59:11 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 274 03:59:11 INFO - [1722] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 173 03:59:11 INFO - [1722] WARNING: IndexedDB is not permitted in a third-party window.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/indexedDB/IDBFactory.cpp, line 142 03:59:17 INFO - --DOCSHELL 0x112cc5000 == 15 [pid = 1722] [id = 260] 03:59:17 INFO - --DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 268] 03:59:17 INFO - --DOCSHELL 0x112e8f800 == 13 [pid = 1722] [id = 261] 03:59:17 INFO - --DOCSHELL 0x11e81b800 == 12 [pid = 1722] [id = 269] 03:59:17 INFO - --DOCSHELL 0x112cca800 == 11 [pid = 1722] [id = 270] 03:59:17 INFO - --DOCSHELL 0x112cb8800 == 10 [pid = 1722] [id = 262] 03:59:17 INFO - --DOMWINDOW == 41 (0x124349400) [pid = 1722] [serial = 594] [outer = 0x0] [url = about:blank] 03:59:17 INFO - --DOMWINDOW == 40 (0x121315c00) [pid = 1722] [serial = 592] [outer = 0x0] [url = about:blank] 03:59:17 INFO - --DOMWINDOW == 39 (0x120d16c00) [pid = 1722] [serial = 590] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:18 INFO - --DOMWINDOW == 38 (0x122e9f800) [pid = 1722] [serial = 609] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:18 INFO - --DOMWINDOW == 37 (0x11344a400) [pid = 1722] [serial = 599] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:59:18 INFO - --DOMWINDOW == 36 (0x112f42000) [pid = 1722] [serial = 597] [outer = 0x0] [url = about:blank] 03:59:18 INFO - --DOMWINDOW == 35 (0x11f5cc800) [pid = 1722] [serial = 607] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 03:59:18 INFO - --DOMWINDOW == 34 (0x12110b400) [pid = 1722] [serial = 605] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:18 INFO - --DOMWINDOW == 33 (0x115145400) [pid = 1722] [serial = 602] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:18 INFO - --DOMWINDOW == 32 (0x113e11400) [pid = 1722] [serial = 616] [outer = 0x0] [url = about:blank] 03:59:18 INFO - --DOMWINDOW == 31 (0x12110ac00) [pid = 1722] [serial = 618] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:18 INFO - --DOMWINDOW == 30 (0x121319800) [pid = 1722] [serial = 620] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:59:18 INFO - --DOMWINDOW == 29 (0x112f49000) [pid = 1722] [serial = 598] [outer = 0x0] [url = about:blank] 03:59:18 INFO - --DOMWINDOW == 28 (0x12115ac00) [pid = 1722] [serial = 601] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 03:59:18 INFO - MEMORY STAT | vsize 3442MB | residentFast 459MB | heapAllocated 119MB 03:59:18 INFO - 159 INFO TEST-OK | devtools/client/webconsole/test/browser_jsterm_inspect.js | took 8403ms 03:59:18 INFO - ++DOCSHELL 0x112cc1800 == 11 [pid = 1722] [id = 271] 03:59:18 INFO - ++DOMWINDOW == 29 (0x112f48800) [pid = 1722] [serial = 622] [outer = 0x0] 03:59:18 INFO - ++DOMWINDOW == 30 (0x112f4cc00) [pid = 1722] [serial = 623] [outer = 0x112f48800] 03:59:18 INFO - 160 INFO TEST-START | devtools/client/webconsole/test/browser_longstring_hang.js 03:59:18 INFO - ++DOCSHELL 0x112e98000 == 12 [pid = 1722] [id = 272] 03:59:18 INFO - ++DOMWINDOW == 31 (0x11344d800) [pid = 1722] [serial = 624] [outer = 0x0] 03:59:18 INFO - ++DOMWINDOW == 32 (0x113452000) [pid = 1722] [serial = 625] [outer = 0x11344d800] 03:59:18 INFO - ++DOMWINDOW == 33 (0x114b1fc00) [pid = 1722] [serial = 626] [outer = 0x11344d800] 03:59:18 INFO - ++DOCSHELL 0x110edd000 == 13 [pid = 1722] [id = 273] 03:59:18 INFO - ++DOMWINDOW == 34 (0x11ef16000) [pid = 1722] [serial = 627] [outer = 0x0] 03:59:18 INFO - ++DOMWINDOW == 35 (0x11ef54800) [pid = 1722] [serial = 628] [outer = 0x11ef16000] 03:59:18 INFO - ++DOMWINDOW == 36 (0x1203e1800) [pid = 1722] [serial = 629] [outer = 0x11ef16000] 03:59:19 INFO - ++DOCSHELL 0x11ec5d800 == 14 [pid = 1722] [id = 274] 03:59:19 INFO - ++DOMWINDOW == 37 (0x12130b000) [pid = 1722] [serial = 630] [outer = 0x0] 03:59:19 INFO - ++DOMWINDOW == 38 (0x12130c000) [pid = 1722] [serial = 631] [outer = 0x12130b000] 03:59:19 INFO - Block(span)(3)@12d2ad388: Init: bad caller: width WAS 79406600(0x4bba608) 03:59:19 INFO - Block(span)(0)@12d2b06b0: Init: bad caller: width WAS 79400000(0x4bb8c40) 03:59:19 INFO - nsLineLayout: Text(0)"foobaraaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa"@12d2b0b30 metrics=79400000,840! 03:59:19 INFO - nsLineLayout: Inline(span)(0)@12d2b0ab8 metrics=79400000,840! 03:59:19 INFO - nsBlockReflowContext: FlexContainer(span)(0)@12d2ad718 metrics=79406600,840! 03:59:19 INFO - nsBlockReflowContext: Block(span)(0)@12d2c5b68 metrics=79406600,840! 03:59:19 INFO - Block(span)(3)@12d2ad388: Init: bad caller: width WAS 79406600(0x4bba608) 03:59:19 INFO - nsBlockReflowContext: Block(span)(0)@12d2c5b68 metrics=79406600,840! 03:59:20 INFO - nsBlockReflowContext: Block(span)(0)@12d2c5b68 metrics=79406600,840! 03:59:20 INFO - Block(span)(3)@11401e1f8: Init: bad caller: width WAS 79406600(0x4bba608) 03:59:20 INFO - nsBlockReflowContext: Block(span)(0)@12d2c5b68 metrics=79406600,840! 03:59:20 INFO - --DOCSHELL 0x11ec5d800 == 13 [pid = 1722] [id = 274] 03:59:20 INFO - --DOCSHELL 0x112cc7000 == 12 [pid = 1722] [id = 266] 03:59:20 INFO - --DOCSHELL 0x113317000 == 11 [pid = 1722] [id = 267] 03:59:20 INFO - --DOMWINDOW == 37 (0x122ea2800) [pid = 1722] [serial = 610] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:20 INFO - --DOMWINDOW == 36 (0x1214a9000) [pid = 1722] [serial = 621] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:59:20 INFO - --DOMWINDOW == 35 (0x122124800) [pid = 1722] [serial = 608] [outer = 0x0] [url = about:blank] 03:59:20 INFO - --DOMWINDOW == 34 (0x121115000) [pid = 1722] [serial = 619] [outer = 0x0] [url = about:blank] 03:59:20 INFO - --DOMWINDOW == 33 (0x121113400) [pid = 1722] [serial = 606] [outer = 0x0] [url = about:blank] 03:59:20 INFO - --DOMWINDOW == 32 (0x11ef13000) [pid = 1722] [serial = 604] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:20 INFO - --DOMWINDOW == 31 (0x113452000) [pid = 1722] [serial = 625] [outer = 0x0] [url = about:blank] 03:59:20 INFO - --DOMWINDOW == 30 (0x112f49400) [pid = 1722] [serial = 612] [outer = 0x0] [url = about:blank] 03:59:20 INFO - --DOMWINDOW == 29 (0x11ef54800) [pid = 1722] [serial = 628] [outer = 0x0] [url = about:blank] 03:59:20 INFO - --DOMWINDOW == 28 (0x11344e800) [pid = 1722] [serial = 615] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:20 INFO - --DOMWINDOW == 27 (0x112f41400) [pid = 1722] [serial = 611] [outer = 0x0] [url = about:blank] 03:59:20 INFO - --DOMWINDOW == 26 (0x113449400) [pid = 1722] [serial = 613] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20bug%20869981] 03:59:20 INFO - MEMORY STAT | vsize 3451MB | residentFast 462MB | heapAllocated 119MB 03:59:20 INFO - 161 INFO TEST-OK | devtools/client/webconsole/test/browser_longstring_hang.js | took 2489ms 03:59:21 INFO - ++DOCSHELL 0x112cc3800 == 12 [pid = 1722] [id = 275] 03:59:21 INFO - ++DOMWINDOW == 27 (0x112f41800) [pid = 1722] [serial = 632] [outer = 0x0] 03:59:21 INFO - ++DOMWINDOW == 28 (0x112f49400) [pid = 1722] [serial = 633] [outer = 0x112f41800] 03:59:21 INFO - 162 INFO TEST-START | devtools/client/webconsole/test/browser_netmonitor_shows_reqs_in_webconsole.js 03:59:21 INFO - ++DOCSHELL 0x11320b000 == 13 [pid = 1722] [id = 276] 03:59:21 INFO - ++DOMWINDOW == 29 (0x113448c00) [pid = 1722] [serial = 634] [outer = 0x0] 03:59:21 INFO - ++DOMWINDOW == 30 (0x11344c800) [pid = 1722] [serial = 635] [outer = 0x113448c00] 03:59:21 INFO - ++DOCSHELL 0x112e88000 == 14 [pid = 1722] [id = 277] 03:59:21 INFO - ++DOMWINDOW == 31 (0x11344ec00) [pid = 1722] [serial = 636] [outer = 0x0] 03:59:21 INFO - ++DOMWINDOW == 32 (0x114dbec00) [pid = 1722] [serial = 637] [outer = 0x11344ec00] 03:59:21 INFO - ++DOMWINDOW == 33 (0x11eefb000) [pid = 1722] [serial = 638] [outer = 0x11344ec00] 03:59:21 INFO - ++DOCSHELL 0x11eb8a800 == 15 [pid = 1722] [id = 278] 03:59:21 INFO - ++DOMWINDOW == 34 (0x120ffcc00) [pid = 1722] [serial = 639] [outer = 0x0] 03:59:21 INFO - ++DOMWINDOW == 35 (0x121109000) [pid = 1722] [serial = 640] [outer = 0x120ffcc00] 03:59:22 INFO - ++DOMWINDOW == 36 (0x1264b2400) [pid = 1722] [serial = 641] [outer = 0x113448c00] 03:59:22 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:59:22 INFO - ++DOCSHELL 0x122371000 == 16 [pid = 1722] [id = 279] 03:59:22 INFO - ++DOMWINDOW == 37 (0x11ef13000) [pid = 1722] [serial = 642] [outer = 0x0] 03:59:22 INFO - ++DOMWINDOW == 38 (0x1245afc00) [pid = 1722] [serial = 643] [outer = 0x11ef13000] 03:59:22 INFO - ++DOCSHELL 0x124f18000 == 17 [pid = 1722] [id = 280] 03:59:22 INFO - ++DOMWINDOW == 39 (0x126236c00) [pid = 1722] [serial = 644] [outer = 0x0] 03:59:22 INFO - ++DOMWINDOW == 40 (0x126402c00) [pid = 1722] [serial = 645] [outer = 0x126236c00] 03:59:22 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 03:59:23 INFO - --DOCSHELL 0x124f18000 == 16 [pid = 1722] [id = 280] 03:59:23 INFO - MEMORY STAT | vsize 3454MB | residentFast 465MB | heapAllocated 128MB 03:59:23 INFO - 163 INFO TEST-OK | devtools/client/webconsole/test/browser_netmonitor_shows_reqs_in_webconsole.js | took 2149ms 03:59:23 INFO - ++DOCSHELL 0x112e24800 == 17 [pid = 1722] [id = 281] 03:59:23 INFO - ++DOMWINDOW == 41 (0x120262800) [pid = 1722] [serial = 646] [outer = 0x0] 03:59:23 INFO - ++DOMWINDOW == 42 (0x1203dd400) [pid = 1722] [serial = 647] [outer = 0x120262800] 03:59:23 INFO - 164 INFO TEST-START | devtools/client/webconsole/test/browser_output_breaks_after_console_dir_uninspectable.js 03:59:23 INFO - ++DOCSHELL 0x11e350000 == 18 [pid = 1722] [id = 282] 03:59:23 INFO - ++DOMWINDOW == 43 (0x120e31800) [pid = 1722] [serial = 648] [outer = 0x0] 03:59:23 INFO - ++DOMWINDOW == 44 (0x121108400) [pid = 1722] [serial = 649] [outer = 0x120e31800] 03:59:23 INFO - ++DOCSHELL 0x120e04800 == 19 [pid = 1722] [id = 283] 03:59:23 INFO - ++DOMWINDOW == 45 (0x1215dd800) [pid = 1722] [serial = 650] [outer = 0x0] 03:59:23 INFO - ++DOMWINDOW == 46 (0x121810c00) [pid = 1722] [serial = 651] [outer = 0x1215dd800] 03:59:23 INFO - ++DOMWINDOW == 47 (0x122121400) [pid = 1722] [serial = 652] [outer = 0x1215dd800] 03:59:23 INFO - ++DOCSHELL 0x124f05800 == 20 [pid = 1722] [id = 284] 03:59:23 INFO - ++DOMWINDOW == 48 (0x122e9f800) [pid = 1722] [serial = 653] [outer = 0x0] 03:59:23 INFO - ++DOMWINDOW == 49 (0x122ea2c00) [pid = 1722] [serial = 654] [outer = 0x122e9f800] 03:59:24 INFO - ++DOCSHELL 0x1293c5800 == 21 [pid = 1722] [id = 285] 03:59:24 INFO - ++DOMWINDOW == 50 (0x124c3d800) [pid = 1722] [serial = 655] [outer = 0x0] 03:59:24 INFO - ++DOMWINDOW == 51 (0x12648b800) [pid = 1722] [serial = 656] [outer = 0x124c3d800] 03:59:24 INFO - --DOCSHELL 0x1293c5800 == 20 [pid = 1722] [id = 285] 03:59:25 INFO - --DOCSHELL 0x112cc3800 == 19 [pid = 1722] [id = 275] 03:59:25 INFO - --DOCSHELL 0x11320b000 == 18 [pid = 1722] [id = 276] 03:59:25 INFO - --DOCSHELL 0x112e88000 == 17 [pid = 1722] [id = 277] 03:59:25 INFO - --DOCSHELL 0x11eb8a800 == 16 [pid = 1722] [id = 278] 03:59:25 INFO - --DOCSHELL 0x122371000 == 15 [pid = 1722] [id = 279] 03:59:25 INFO - --DOCSHELL 0x120e04800 == 14 [pid = 1722] [id = 283] 03:59:25 INFO - --DOCSHELL 0x124f05800 == 13 [pid = 1722] [id = 284] 03:59:25 INFO - --DOCSHELL 0x110edd000 == 12 [pid = 1722] [id = 273] 03:59:25 INFO - --DOCSHELL 0x112cc1800 == 11 [pid = 1722] [id = 271] 03:59:25 INFO - --DOCSHELL 0x112e98000 == 10 [pid = 1722] [id = 272] 03:59:25 INFO - --DOMWINDOW == 50 (0x11ef14800) [pid = 1722] [serial = 617] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:25 INFO - --DOMWINDOW == 49 (0x11344d000) [pid = 1722] [serial = 614] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 48 (0x126236c00) [pid = 1722] [serial = 644] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 47 (0x112f48800) [pid = 1722] [serial = 622] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 46 (0x11344d800) [pid = 1722] [serial = 624] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-859170-longstring-hang.html] 03:59:25 INFO - --DOMWINDOW == 45 (0x112f41800) [pid = 1722] [serial = 632] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 44 (0x113448c00) [pid = 1722] [serial = 634] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 03:59:25 INFO - --DOMWINDOW == 43 (0x124c3d800) [pid = 1722] [serial = 655] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:59:25 INFO - --DOMWINDOW == 42 (0x11ef13000) [pid = 1722] [serial = 642] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 03:59:25 INFO - --DOMWINDOW == 41 (0x120ffcc00) [pid = 1722] [serial = 639] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:25 INFO - --DOMWINDOW == 40 (0x12130b000) [pid = 1722] [serial = 630] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:25 INFO - --DOMWINDOW == 39 (0x11344ec00) [pid = 1722] [serial = 636] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:25 INFO - --DOMWINDOW == 38 (0x11ef16000) [pid = 1722] [serial = 627] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:25 INFO - --DOMWINDOW == 37 (0x121810c00) [pid = 1722] [serial = 651] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 36 (0x114dbec00) [pid = 1722] [serial = 637] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 35 (0x126402c00) [pid = 1722] [serial = 645] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 34 (0x112f4cc00) [pid = 1722] [serial = 623] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 33 (0x112f49400) [pid = 1722] [serial = 633] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 32 (0x11344c800) [pid = 1722] [serial = 635] [outer = 0x0] [url = about:blank] 03:59:25 INFO - --DOMWINDOW == 31 (0x114b1fc00) [pid = 1722] [serial = 626] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-859170-longstring-hang.html] 03:59:25 INFO - --DOMWINDOW == 30 (0x1264b2400) [pid = 1722] [serial = 641] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 03:59:25 INFO - MEMORY STAT | vsize 3450MB | residentFast 461MB | heapAllocated 119MB 03:59:25 INFO - 165 INFO TEST-OK | devtools/client/webconsole/test/browser_output_breaks_after_console_dir_uninspectable.js | took 2415ms 03:59:25 INFO - ++DOCSHELL 0x112ccf800 == 11 [pid = 1722] [id = 286] 03:59:25 INFO - ++DOMWINDOW == 31 (0x112f48800) [pid = 1722] [serial = 657] [outer = 0x0] 03:59:25 INFO - ++DOMWINDOW == 32 (0x112f4ec00) [pid = 1722] [serial = 658] [outer = 0x112f48800] 03:59:25 INFO - 166 INFO TEST-START | devtools/client/webconsole/test/browser_output_longstring_expand.js 03:59:25 INFO - ++DOCSHELL 0x113511800 == 12 [pid = 1722] [id = 287] 03:59:25 INFO - ++DOMWINDOW == 33 (0x11344cc00) [pid = 1722] [serial = 659] [outer = 0x0] 03:59:25 INFO - ++DOMWINDOW == 34 (0x11344fc00) [pid = 1722] [serial = 660] [outer = 0x11344cc00] 03:59:26 INFO - ++DOCSHELL 0x112e88800 == 13 [pid = 1722] [id = 288] 03:59:26 INFO - ++DOMWINDOW == 35 (0x113451800) [pid = 1722] [serial = 661] [outer = 0x0] 03:59:26 INFO - ++DOMWINDOW == 36 (0x114b24400) [pid = 1722] [serial = 662] [outer = 0x113451800] 03:59:26 INFO - ++DOMWINDOW == 37 (0x11eeef000) [pid = 1722] [serial = 663] [outer = 0x113451800] 03:59:26 INFO - ++DOCSHELL 0x11ee3e000 == 14 [pid = 1722] [id = 289] 03:59:26 INFO - ++DOMWINDOW == 38 (0x121114800) [pid = 1722] [serial = 664] [outer = 0x0] 03:59:26 INFO - ++DOMWINDOW == 39 (0x12115b800) [pid = 1722] [serial = 665] [outer = 0x121114800] 03:59:27 INFO - --DOCSHELL 0x11ee3e000 == 13 [pid = 1722] [id = 289] 03:59:27 INFO - --DOCSHELL 0x112e24800 == 12 [pid = 1722] [id = 281] 03:59:27 INFO - --DOCSHELL 0x11e350000 == 11 [pid = 1722] [id = 282] 03:59:28 INFO - --DOMWINDOW == 38 (0x12130c000) [pid = 1722] [serial = 631] [outer = 0x0] [url = about:blank] 03:59:28 INFO - --DOMWINDOW == 37 (0x1203e1800) [pid = 1722] [serial = 629] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:28 INFO - --DOMWINDOW == 36 (0x121109000) [pid = 1722] [serial = 640] [outer = 0x0] [url = about:blank] 03:59:28 INFO - --DOMWINDOW == 35 (0x11eefb000) [pid = 1722] [serial = 638] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:28 INFO - --DOMWINDOW == 34 (0x12648b800) [pid = 1722] [serial = 656] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 03:59:28 INFO - --DOMWINDOW == 33 (0x1245afc00) [pid = 1722] [serial = 643] [outer = 0x0] [url = about:blank] 03:59:28 INFO - --DOMWINDOW == 32 (0x1203dd400) [pid = 1722] [serial = 647] [outer = 0x0] [url = about:blank] 03:59:28 INFO - --DOMWINDOW == 31 (0x114b24400) [pid = 1722] [serial = 662] [outer = 0x0] [url = about:blank] 03:59:28 INFO - --DOMWINDOW == 30 (0x121108400) [pid = 1722] [serial = 649] [outer = 0x0] [url = about:blank] 03:59:28 INFO - --DOMWINDOW == 29 (0x1215dd800) [pid = 1722] [serial = 650] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:28 INFO - --DOMWINDOW == 28 (0x122e9f800) [pid = 1722] [serial = 653] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:28 INFO - --DOMWINDOW == 27 (0x120262800) [pid = 1722] [serial = 646] [outer = 0x0] [url = about:blank] 03:59:28 INFO - --DOMWINDOW == 26 (0x120e31800) [pid = 1722] [serial = 648] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20bug%20773466] 03:59:28 INFO - MEMORY STAT | vsize 3451MB | residentFast 462MB | heapAllocated 117MB 03:59:28 INFO - 167 INFO TEST-OK | devtools/client/webconsole/test/browser_output_longstring_expand.js | took 2279ms 03:59:28 INFO - ++DOCSHELL 0x112b43000 == 12 [pid = 1722] [id = 290] 03:59:28 INFO - ++DOMWINDOW == 27 (0x112f45000) [pid = 1722] [serial = 666] [outer = 0x0] 03:59:28 INFO - ++DOMWINDOW == 28 (0x112f4ac00) [pid = 1722] [serial = 667] [outer = 0x112f45000] 03:59:28 INFO - 168 INFO TEST-START | devtools/client/webconsole/test/browser_repeated_messages_accuracy.js 03:59:28 INFO - ++DOCSHELL 0x11320d800 == 13 [pid = 1722] [id = 291] 03:59:28 INFO - ++DOMWINDOW == 29 (0x11344ac00) [pid = 1722] [serial = 668] [outer = 0x0] 03:59:28 INFO - ++DOMWINDOW == 30 (0x11344e800) [pid = 1722] [serial = 669] [outer = 0x11344ac00] 03:59:28 INFO - ++DOMWINDOW == 31 (0x120ff7400) [pid = 1722] [serial = 670] [outer = 0x11344ac00] 03:59:28 INFO - ++DOCSHELL 0x11331c000 == 14 [pid = 1722] [id = 292] 03:59:28 INFO - ++DOMWINDOW == 32 (0x113451000) [pid = 1722] [serial = 671] [outer = 0x0] 03:59:28 INFO - ++DOMWINDOW == 33 (0x11e7a4800) [pid = 1722] [serial = 672] [outer = 0x113451000] 03:59:28 INFO - ++DOMWINDOW == 34 (0x1202ee000) [pid = 1722] [serial = 673] [outer = 0x113451000] 03:59:28 INFO - ++DOCSHELL 0x11eec3000 == 15 [pid = 1722] [id = 293] 03:59:28 INFO - ++DOMWINDOW == 35 (0x121161800) [pid = 1722] [serial = 674] [outer = 0x0] 03:59:28 INFO - ++DOMWINDOW == 36 (0x121319000) [pid = 1722] [serial = 675] [outer = 0x121161800] 03:59:29 INFO - ++DOMWINDOW == 37 (0x122ea6000) [pid = 1722] [serial = 676] [outer = 0x11344ac00] 03:59:29 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:59:30 INFO - --DOCSHELL 0x112e88800 == 14 [pid = 1722] [id = 288] 03:59:30 INFO - --DOCSHELL 0x11eec3000 == 13 [pid = 1722] [id = 293] 03:59:30 INFO - --DOCSHELL 0x113511800 == 12 [pid = 1722] [id = 287] 03:59:30 INFO - --DOCSHELL 0x112ccf800 == 11 [pid = 1722] [id = 286] 03:59:30 INFO - --DOMWINDOW == 36 (0x122ea2c00) [pid = 1722] [serial = 654] [outer = 0x0] [url = about:blank] 03:59:30 INFO - --DOMWINDOW == 35 (0x122121400) [pid = 1722] [serial = 652] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:30 INFO - --DOMWINDOW == 34 (0x11e7a4800) [pid = 1722] [serial = 672] [outer = 0x0] [url = about:blank] 03:59:30 INFO - --DOMWINDOW == 33 (0x11344e800) [pid = 1722] [serial = 669] [outer = 0x0] [url = about:blank] 03:59:30 INFO - --DOMWINDOW == 32 (0x11344fc00) [pid = 1722] [serial = 660] [outer = 0x0] [url = about:blank] 03:59:30 INFO - --DOMWINDOW == 31 (0x112f4ec00) [pid = 1722] [serial = 658] [outer = 0x0] [url = about:blank] 03:59:30 INFO - --DOMWINDOW == 30 (0x121114800) [pid = 1722] [serial = 664] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:30 INFO - --DOMWINDOW == 29 (0x113451800) [pid = 1722] [serial = 661] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:30 INFO - --DOMWINDOW == 28 (0x11344cc00) [pid = 1722] [serial = 659] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20bug%20787981%20-%20check%20that%20long%20strings%20can%20be%20expanded%20in%20the%20output.] 03:59:30 INFO - --DOMWINDOW == 27 (0x112f48800) [pid = 1722] [serial = 657] [outer = 0x0] [url = about:blank] 03:59:30 INFO - --DOMWINDOW == 26 (0x120ff7400) [pid = 1722] [serial = 670] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 03:59:30 INFO - MEMORY STAT | vsize 3453MB | residentFast 465MB | heapAllocated 118MB 03:59:30 INFO - 169 INFO TEST-OK | devtools/client/webconsole/test/browser_repeated_messages_accuracy.js | took 2561ms 03:59:30 INFO - ++DOCSHELL 0x112ccb000 == 12 [pid = 1722] [id = 294] 03:59:30 INFO - ++DOMWINDOW == 27 (0x112f4cc00) [pid = 1722] [serial = 677] [outer = 0x0] 03:59:30 INFO - ++DOMWINDOW == 28 (0x113448c00) [pid = 1722] [serial = 678] [outer = 0x112f4cc00] 03:59:31 INFO - 170 INFO TEST-START | devtools/client/webconsole/test/browser_result_format_as_string.js 03:59:31 INFO - ++DOCSHELL 0x113e3a000 == 13 [pid = 1722] [id = 295] 03:59:31 INFO - ++DOMWINDOW == 29 (0x11344a800) [pid = 1722] [serial = 679] [outer = 0x0] 03:59:31 INFO - ++DOMWINDOW == 30 (0x113e03400) [pid = 1722] [serial = 680] [outer = 0x11344a800] 03:59:31 INFO - ++DOMWINDOW == 31 (0x114b63000) [pid = 1722] [serial = 681] [outer = 0x11344a800] 03:59:31 INFO - ++DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 296] 03:59:31 INFO - ++DOMWINDOW == 32 (0x11eef7800) [pid = 1722] [serial = 682] [outer = 0x0] 03:59:31 INFO - ++DOMWINDOW == 33 (0x11f70ec00) [pid = 1722] [serial = 683] [outer = 0x11eef7800] 03:59:31 INFO - ++DOMWINDOW == 34 (0x120e29400) [pid = 1722] [serial = 684] [outer = 0x11eef7800] 03:59:31 INFO - ++DOCSHELL 0x11efcd000 == 15 [pid = 1722] [id = 297] 03:59:31 INFO - ++DOMWINDOW == 35 (0x1214b0800) [pid = 1722] [serial = 685] [outer = 0x0] 03:59:31 INFO - ++DOMWINDOW == 36 (0x1214b7400) [pid = 1722] [serial = 686] [outer = 0x1214b0800] 03:59:33 INFO - --DOCSHELL 0x11331c000 == 14 [pid = 1722] [id = 292] 03:59:33 INFO - --DOCSHELL 0x11320d800 == 13 [pid = 1722] [id = 291] 03:59:33 INFO - --DOCSHELL 0x11efcd000 == 12 [pid = 1722] [id = 297] 03:59:33 INFO - --DOMWINDOW == 35 (0x12115b800) [pid = 1722] [serial = 665] [outer = 0x0] [url = about:blank] 03:59:33 INFO - --DOMWINDOW == 34 (0x11eeef000) [pid = 1722] [serial = 663] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:33 INFO - --DOMWINDOW == 33 (0x113e03400) [pid = 1722] [serial = 680] [outer = 0x0] [url = about:blank] 03:59:33 INFO - --DOMWINDOW == 32 (0x112f4ac00) [pid = 1722] [serial = 667] [outer = 0x0] [url = about:blank] 03:59:33 INFO - --DOMWINDOW == 31 (0x11f70ec00) [pid = 1722] [serial = 683] [outer = 0x0] [url = about:blank] 03:59:33 INFO - --DOMWINDOW == 30 (0x121161800) [pid = 1722] [serial = 674] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:33 INFO - --DOMWINDOW == 29 (0x113451000) [pid = 1722] [serial = 671] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:33 INFO - --DOMWINDOW == 28 (0x11344ac00) [pid = 1722] [serial = 668] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 03:59:33 INFO - --DOMWINDOW == 27 (0x112f45000) [pid = 1722] [serial = 666] [outer = 0x0] [url = about:blank] 03:59:33 INFO - --DOMWINDOW == 26 (0x122ea6000) [pid = 1722] [serial = 676] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 03:59:33 INFO - MEMORY STAT | vsize 3454MB | residentFast 465MB | heapAllocated 118MB 03:59:33 INFO - 171 INFO TEST-OK | devtools/client/webconsole/test/browser_result_format_as_string.js | took 2373ms 03:59:33 INFO - ++DOCSHELL 0x112cce800 == 13 [pid = 1722] [id = 298] 03:59:33 INFO - ++DOMWINDOW == 27 (0x112f47000) [pid = 1722] [serial = 687] [outer = 0x0] 03:59:33 INFO - ++DOMWINDOW == 28 (0x112f4d400) [pid = 1722] [serial = 688] [outer = 0x112f47000] 03:59:33 INFO - 172 INFO TEST-START | devtools/client/webconsole/test/browser_warn_user_about_replaced_api.js 03:59:33 INFO - ++DOCSHELL 0x1135aa000 == 14 [pid = 1722] [id = 299] 03:59:33 INFO - ++DOMWINDOW == 29 (0x11344f000) [pid = 1722] [serial = 689] [outer = 0x0] 03:59:33 INFO - ++DOMWINDOW == 30 (0x113d05c00) [pid = 1722] [serial = 690] [outer = 0x11344f000] 03:59:33 INFO - ++DOMWINDOW == 31 (0x114b62c00) [pid = 1722] [serial = 691] [outer = 0x11344f000] 03:59:33 INFO - ++DOCSHELL 0x11350c000 == 15 [pid = 1722] [id = 300] 03:59:33 INFO - ++DOMWINDOW == 32 (0x11eefac00) [pid = 1722] [serial = 692] [outer = 0x0] 03:59:33 INFO - ++DOMWINDOW == 33 (0x11ef16000) [pid = 1722] [serial = 693] [outer = 0x11eefac00] 03:59:33 INFO - ++DOMWINDOW == 34 (0x120e26400) [pid = 1722] [serial = 694] [outer = 0x11eefac00] 03:59:34 INFO - ++DOCSHELL 0x11f63d000 == 16 [pid = 1722] [id = 301] 03:59:34 INFO - ++DOMWINDOW == 35 (0x1214b2400) [pid = 1722] [serial = 695] [outer = 0x0] 03:59:34 INFO - ++DOMWINDOW == 36 (0x1214b4c00) [pid = 1722] [serial = 696] [outer = 0x1214b2400] 03:59:34 INFO - ++DOMWINDOW == 37 (0x124349400) [pid = 1722] [serial = 697] [outer = 0x11344f000] 03:59:34 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:59:35 INFO - --DOCSHELL 0x113e3a000 == 15 [pid = 1722] [id = 295] 03:59:35 INFO - --DOCSHELL 0x11f63d000 == 14 [pid = 1722] [id = 301] 03:59:35 INFO - --DOCSHELL 0x112cc6800 == 13 [pid = 1722] [id = 296] 03:59:35 INFO - --DOCSHELL 0x112b43000 == 12 [pid = 1722] [id = 290] 03:59:35 INFO - --DOCSHELL 0x112ccb000 == 11 [pid = 1722] [id = 294] 03:59:35 INFO - --DOMWINDOW == 36 (0x121319000) [pid = 1722] [serial = 675] [outer = 0x0] [url = about:blank] 03:59:35 INFO - --DOMWINDOW == 35 (0x1202ee000) [pid = 1722] [serial = 673] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:35 INFO - --DOMWINDOW == 34 (0x113d05c00) [pid = 1722] [serial = 690] [outer = 0x0] [url = about:blank] 03:59:35 INFO - --DOMWINDOW == 33 (0x113448c00) [pid = 1722] [serial = 678] [outer = 0x0] [url = about:blank] 03:59:35 INFO - --DOMWINDOW == 32 (0x11ef16000) [pid = 1722] [serial = 693] [outer = 0x0] [url = about:blank] 03:59:35 INFO - --DOMWINDOW == 31 (0x114b62c00) [pid = 1722] [serial = 691] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/testscript.js] 03:59:35 INFO - --DOMWINDOW == 30 (0x11eef7800) [pid = 1722] [serial = 682] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:35 INFO - --DOMWINDOW == 29 (0x1214b0800) [pid = 1722] [serial = 685] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:35 INFO - --DOMWINDOW == 28 (0x11344a800) [pid = 1722] [serial = 679] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-result-format-as-string.html] 03:59:35 INFO - --DOMWINDOW == 27 (0x112f4cc00) [pid = 1722] [serial = 677] [outer = 0x0] [url = about:blank] 03:59:35 INFO - --DOMWINDOW == 26 (0x114b63000) [pid = 1722] [serial = 681] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-result-format-as-string.html] 03:59:35 INFO - ++DOMWINDOW == 27 (0x112c94c00) [pid = 1722] [serial = 698] [outer = 0x11344f000] 03:59:35 INFO - ++DOCSHELL 0x112e91000 == 12 [pid = 1722] [id = 302] 03:59:35 INFO - ++DOMWINDOW == 28 (0x113446800) [pid = 1722] [serial = 699] [outer = 0x0] 03:59:35 INFO - ++DOMWINDOW == 29 (0x113447c00) [pid = 1722] [serial = 700] [outer = 0x113446800] 03:59:36 INFO - ++DOMWINDOW == 30 (0x113e11000) [pid = 1722] [serial = 701] [outer = 0x113446800] 03:59:36 INFO - ++DOCSHELL 0x11e81c800 == 13 [pid = 1722] [id = 303] 03:59:36 INFO - ++DOMWINDOW == 31 (0x120e32800) [pid = 1722] [serial = 702] [outer = 0x0] 03:59:36 INFO - ++DOMWINDOW == 32 (0x120ff8400) [pid = 1722] [serial = 703] [outer = 0x120e32800] 03:59:36 INFO - ++DOMWINDOW == 33 (0x1223e7000) [pid = 1722] [serial = 704] [outer = 0x11344f000] 03:59:36 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 03:59:37 INFO - --DOCSHELL 0x11e81c800 == 12 [pid = 1722] [id = 303] 03:59:37 INFO - --DOCSHELL 0x11350c000 == 11 [pid = 1722] [id = 300] 03:59:37 INFO - --DOMWINDOW == 32 (0x1214b7400) [pid = 1722] [serial = 686] [outer = 0x0] [url = about:blank] 03:59:37 INFO - --DOMWINDOW == 31 (0x120e29400) [pid = 1722] [serial = 684] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:37 INFO - --DOMWINDOW == 30 (0x113447c00) [pid = 1722] [serial = 700] [outer = 0x0] [url = about:blank] 03:59:37 INFO - --DOMWINDOW == 29 (0x112c94c00) [pid = 1722] [serial = 698] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html] 03:59:37 INFO - MEMORY STAT | vsize 3454MB | residentFast 466MB | heapAllocated 117MB 03:59:37 INFO - 173 INFO TEST-OK | devtools/client/webconsole/test/browser_warn_user_about_replaced_api.js | took 4358ms 03:59:37 INFO - ++DOCSHELL 0x112cc9000 == 12 [pid = 1722] [id = 304] 03:59:37 INFO - ++DOMWINDOW == 30 (0x112f48800) [pid = 1722] [serial = 705] [outer = 0x0] 03:59:37 INFO - ++DOMWINDOW == 31 (0x113444800) [pid = 1722] [serial = 706] [outer = 0x112f48800] 03:59:38 INFO - 174 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_abbreviate_source_url.js 03:59:38 INFO - MEMORY STAT | vsize 3454MB | residentFast 466MB | heapAllocated 118MB 03:59:38 INFO - 175 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_abbreviate_source_url.js | took 97ms 03:59:38 INFO - ++DOCSHELL 0x112cb7800 == 13 [pid = 1722] [id = 305] 03:59:38 INFO - ++DOMWINDOW == 32 (0x113e0b400) [pid = 1722] [serial = 707] [outer = 0x0] 03:59:38 INFO - ++DOMWINDOW == 33 (0x114b22800) [pid = 1722] [serial = 708] [outer = 0x113e0b400] 03:59:38 INFO - 176 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_allow_mixedcontent_securityerrors.js 03:59:38 INFO - ++DOCSHELL 0x114b7c000 == 14 [pid = 1722] [id = 306] 03:59:38 INFO - ++DOMWINDOW == 34 (0x11f719400) [pid = 1722] [serial = 709] [outer = 0x0] 03:59:38 INFO - ++DOMWINDOW == 35 (0x1202ee000) [pid = 1722] [serial = 710] [outer = 0x11f719400] 03:59:38 INFO - ++DOMWINDOW == 36 (0x120e2d800) [pid = 1722] [serial = 711] [outer = 0x11f719400] 03:59:38 INFO - ++DOCSHELL 0x11ee49800 == 15 [pid = 1722] [id = 307] 03:59:38 INFO - ++DOMWINDOW == 37 (0x12115b000) [pid = 1722] [serial = 712] [outer = 0x0] 03:59:38 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 03:59:38 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 03:59:38 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 03:59:38 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 03:59:38 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 03:59:38 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 03:59:39 INFO - ++DOMWINDOW == 38 (0x12232a800) [pid = 1722] [serial = 713] [outer = 0x12115b000] 03:59:39 INFO - ++DOCSHELL 0x124ac0000 == 16 [pid = 1722] [id = 308] 03:59:39 INFO - ++DOMWINDOW == 39 (0x11d466000) [pid = 1722] [serial = 714] [outer = 0x0] 03:59:39 INFO - ++DOMWINDOW == 40 (0x120fe4400) [pid = 1722] [serial = 715] [outer = 0x11d466000] 03:59:39 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 03:59:39 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 03:59:39 INFO - ++DOMWINDOW == 41 (0x122e9f000) [pid = 1722] [serial = 716] [outer = 0x11d466000] 03:59:39 INFO - ++DOCSHELL 0x124f1c800 == 17 [pid = 1722] [id = 309] 03:59:39 INFO - ++DOMWINDOW == 42 (0x124c32c00) [pid = 1722] [serial = 717] [outer = 0x0] 03:59:39 INFO - ++DOMWINDOW == 43 (0x124c34c00) [pid = 1722] [serial = 718] [outer = 0x124c32c00] 03:59:39 INFO - [1722] WARNING: RasterImage::Init failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/image/ImageFactory.cpp, line 109 03:59:39 INFO - [1722] WARNING: Image width or height is non-positive: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6316 03:59:40 INFO - --DOCSHELL 0x1135aa000 == 16 [pid = 1722] [id = 299] 03:59:40 INFO - --DOCSHELL 0x112cce800 == 15 [pid = 1722] [id = 298] 03:59:40 INFO - --DOCSHELL 0x112e91000 == 14 [pid = 1722] [id = 302] 03:59:40 INFO - --DOCSHELL 0x124f1c800 == 13 [pid = 1722] [id = 309] 03:59:41 INFO - --DOMWINDOW == 42 (0x120fe4400) [pid = 1722] [serial = 715] [outer = 0x0] [url = about:blank] 03:59:41 INFO - --DOMWINDOW == 41 (0x112f4d400) [pid = 1722] [serial = 688] [outer = 0x0] [url = about:blank] 03:59:41 INFO - --DOMWINDOW == 40 (0x124349400) [pid = 1722] [serial = 697] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/testscript.js] 03:59:41 INFO - --DOMWINDOW == 39 (0x113444800) [pid = 1722] [serial = 706] [outer = 0x0] [url = about:blank] 03:59:41 INFO - --DOMWINDOW == 38 (0x1202ee000) [pid = 1722] [serial = 710] [outer = 0x0] [url = about:blank] 03:59:41 INFO - --DOMWINDOW == 37 (0x1214b2400) [pid = 1722] [serial = 695] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:41 INFO - --DOMWINDOW == 36 (0x120e32800) [pid = 1722] [serial = 702] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:41 INFO - --DOMWINDOW == 35 (0x113446800) [pid = 1722] [serial = 699] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:41 INFO - --DOMWINDOW == 34 (0x11eefac00) [pid = 1722] [serial = 692] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:41 INFO - --DOMWINDOW == 33 (0x112f47000) [pid = 1722] [serial = 687] [outer = 0x0] [url = about:blank] 03:59:41 INFO - --DOMWINDOW == 32 (0x11344f000) [pid = 1722] [serial = 689] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html] 03:59:41 INFO - --DOMWINDOW == 31 (0x112f48800) [pid = 1722] [serial = 705] [outer = 0x0] [url = about:blank] 03:59:41 INFO - --DOMWINDOW == 30 (0x1223e7000) [pid = 1722] [serial = 704] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html] 03:59:41 INFO - MEMORY STAT | vsize 3465MB | residentFast 468MB | heapAllocated 121MB 03:59:41 INFO - 177 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_allow_mixedcontent_securityerrors.js | took 2957ms 03:59:41 INFO - ++DOCSHELL 0x112e84000 == 14 [pid = 1722] [id = 310] 03:59:41 INFO - ++DOMWINDOW == 31 (0x113161800) [pid = 1722] [serial = 719] [outer = 0x0] 03:59:41 INFO - ++DOMWINDOW == 32 (0x113446800) [pid = 1722] [serial = 720] [outer = 0x113161800] 03:59:41 INFO - 178 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_assert.js 03:59:41 INFO - ++DOCSHELL 0x11e351800 == 15 [pid = 1722] [id = 311] 03:59:41 INFO - ++DOMWINDOW == 33 (0x113451000) [pid = 1722] [serial = 721] [outer = 0x0] 03:59:41 INFO - ++DOMWINDOW == 34 (0x113e02c00) [pid = 1722] [serial = 722] [outer = 0x113451000] 03:59:41 INFO - ++DOMWINDOW == 35 (0x11e712400) [pid = 1722] [serial = 723] [outer = 0x113451000] 03:59:41 INFO - ++DOCSHELL 0x112e8b000 == 16 [pid = 1722] [id = 312] 03:59:41 INFO - ++DOMWINDOW == 36 (0x1203e2400) [pid = 1722] [serial = 724] [outer = 0x0] 03:59:41 INFO - ++DOMWINDOW == 37 (0x120d25000) [pid = 1722] [serial = 725] [outer = 0x1203e2400] 03:59:41 INFO - ++DOMWINDOW == 38 (0x120ff3800) [pid = 1722] [serial = 726] [outer = 0x1203e2400] 03:59:41 INFO - ++DOCSHELL 0x124ac9000 == 17 [pid = 1722] [id = 313] 03:59:41 INFO - ++DOMWINDOW == 39 (0x122e99400) [pid = 1722] [serial = 727] [outer = 0x0] 03:59:41 INFO - ++DOMWINDOW == 40 (0x122e9c000) [pid = 1722] [serial = 728] [outer = 0x122e99400] 03:59:43 INFO - --DOCSHELL 0x11ee49800 == 16 [pid = 1722] [id = 307] 03:59:43 INFO - --DOCSHELL 0x112cc9000 == 15 [pid = 1722] [id = 304] 03:59:43 INFO - --DOCSHELL 0x114b7c000 == 14 [pid = 1722] [id = 306] 03:59:43 INFO - --DOCSHELL 0x112cb7800 == 13 [pid = 1722] [id = 305] 03:59:43 INFO - --DOCSHELL 0x124ac9000 == 12 [pid = 1722] [id = 313] 03:59:43 INFO - --DOCSHELL 0x124ac0000 == 11 [pid = 1722] [id = 308] 03:59:43 INFO - --DOMWINDOW == 39 (0x113e11000) [pid = 1722] [serial = 701] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:43 INFO - --DOMWINDOW == 38 (0x120ff8400) [pid = 1722] [serial = 703] [outer = 0x0] [url = about:blank] 03:59:43 INFO - --DOMWINDOW == 37 (0x120e26400) [pid = 1722] [serial = 694] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:43 INFO - --DOMWINDOW == 36 (0x1214b4c00) [pid = 1722] [serial = 696] [outer = 0x0] [url = about:blank] 03:59:43 INFO - --DOMWINDOW == 35 (0x120d25000) [pid = 1722] [serial = 725] [outer = 0x0] [url = about:blank] 03:59:43 INFO - --DOMWINDOW == 34 (0x114b22800) [pid = 1722] [serial = 708] [outer = 0x0] [url = about:blank] 03:59:43 INFO - --DOMWINDOW == 33 (0x12232a800) [pid = 1722] [serial = 713] [outer = 0x0] [url = http://example.com/] 03:59:43 INFO - --DOMWINDOW == 32 (0x113e02c00) [pid = 1722] [serial = 722] [outer = 0x0] [url = about:blank] 03:59:43 INFO - --DOMWINDOW == 31 (0x124c32c00) [pid = 1722] [serial = 717] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:43 INFO - --DOMWINDOW == 30 (0x11d466000) [pid = 1722] [serial = 714] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:43 INFO - --DOMWINDOW == 29 (0x113e0b400) [pid = 1722] [serial = 707] [outer = 0x0] [url = about:blank] 03:59:43 INFO - --DOMWINDOW == 28 (0x11f719400) [pid = 1722] [serial = 709] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 03:59:43 INFO - --DOMWINDOW == 27 (0x12115b000) [pid = 1722] [serial = 712] [outer = 0x0] [url = http://example.com/] 03:59:43 INFO - --DOMWINDOW == 26 (0x120e2d800) [pid = 1722] [serial = 711] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 03:59:43 INFO - MEMORY STAT | vsize 3465MB | residentFast 468MB | heapAllocated 120MB 03:59:43 INFO - 179 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_assert.js | took 2270ms 03:59:43 INFO - ++DOCSHELL 0x112cc6800 == 12 [pid = 1722] [id = 314] 03:59:43 INFO - ++DOMWINDOW == 27 (0x112f48800) [pid = 1722] [serial = 729] [outer = 0x0] 03:59:43 INFO - ++DOMWINDOW == 28 (0x113444800) [pid = 1722] [serial = 730] [outer = 0x112f48800] 03:59:43 INFO - 180 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete-properties-with-non-alphanumeric-names.js 03:59:43 INFO - ++DOCSHELL 0x113516000 == 13 [pid = 1722] [id = 315] 03:59:43 INFO - ++DOMWINDOW == 29 (0x113d0a800) [pid = 1722] [serial = 731] [outer = 0x0] 03:59:43 INFO - ++DOMWINDOW == 30 (0x113e0ac00) [pid = 1722] [serial = 732] [outer = 0x113d0a800] 03:59:43 INFO - ++DOCSHELL 0x112bb2800 == 14 [pid = 1722] [id = 316] 03:59:43 INFO - ++DOMWINDOW == 31 (0x113e0dc00) [pid = 1722] [serial = 733] [outer = 0x0] 03:59:43 INFO - ++DOMWINDOW == 32 (0x11e713c00) [pid = 1722] [serial = 734] [outer = 0x113e0dc00] 03:59:44 INFO - ++DOMWINDOW == 33 (0x120e30800) [pid = 1722] [serial = 735] [outer = 0x113e0dc00] 03:59:44 INFO - ++DOCSHELL 0x120e09800 == 15 [pid = 1722] [id = 317] 03:59:44 INFO - ++DOMWINDOW == 34 (0x12211f800) [pid = 1722] [serial = 736] [outer = 0x0] 03:59:44 INFO - ++DOMWINDOW == 35 (0x1221b4000) [pid = 1722] [serial = 737] [outer = 0x12211f800] 03:59:46 INFO - --DOCSHELL 0x112e84000 == 14 [pid = 1722] [id = 310] 03:59:46 INFO - --DOCSHELL 0x11e351800 == 13 [pid = 1722] [id = 311] 03:59:46 INFO - --DOCSHELL 0x112e8b000 == 12 [pid = 1722] [id = 312] 03:59:46 INFO - --DOCSHELL 0x120e09800 == 11 [pid = 1722] [id = 317] 03:59:46 INFO - --DOMWINDOW == 34 (0x124c34c00) [pid = 1722] [serial = 718] [outer = 0x0] [url = about:blank] 03:59:46 INFO - --DOMWINDOW == 33 (0x122e9f000) [pid = 1722] [serial = 716] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:46 INFO - --DOMWINDOW == 32 (0x113446800) [pid = 1722] [serial = 720] [outer = 0x0] [url = about:blank] 03:59:46 INFO - --DOMWINDOW == 31 (0x11e713c00) [pid = 1722] [serial = 734] [outer = 0x0] [url = about:blank] 03:59:46 INFO - --DOMWINDOW == 30 (0x1203e2400) [pid = 1722] [serial = 724] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:46 INFO - --DOMWINDOW == 29 (0x122e99400) [pid = 1722] [serial = 727] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:46 INFO - --DOMWINDOW == 28 (0x113451000) [pid = 1722] [serial = 721] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-assert.html] 03:59:46 INFO - --DOMWINDOW == 27 (0x113161800) [pid = 1722] [serial = 719] [outer = 0x0] [url = about:blank] 03:59:46 INFO - --DOMWINDOW == 26 (0x11e712400) [pid = 1722] [serial = 723] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-assert.html] 03:59:46 INFO - MEMORY STAT | vsize 3463MB | residentFast 466MB | heapAllocated 119MB 03:59:46 INFO - 181 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete-properties-with-non-alphanumeric-names.js | took 2553ms 03:59:46 INFO - ++DOCSHELL 0x112cc7000 == 12 [pid = 1722] [id = 318] 03:59:46 INFO - ++DOMWINDOW == 27 (0x112f4b000) [pid = 1722] [serial = 738] [outer = 0x0] 03:59:46 INFO - ++DOMWINDOW == 28 (0x113446800) [pid = 1722] [serial = 739] [outer = 0x112f4b000] 03:59:46 INFO - 182 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_and_selfxss.js 03:59:46 INFO - ++DOCSHELL 0x113e4a000 == 13 [pid = 1722] [id = 319] 03:59:46 INFO - ++DOMWINDOW == 29 (0x113451800) [pid = 1722] [serial = 740] [outer = 0x0] 03:59:46 INFO - ++DOMWINDOW == 30 (0x113e0cc00) [pid = 1722] [serial = 741] [outer = 0x113451800] 03:59:46 INFO - ++DOCSHELL 0x112cce800 == 14 [pid = 1722] [id = 320] 03:59:46 INFO - ++DOMWINDOW == 31 (0x114b21800) [pid = 1722] [serial = 742] [outer = 0x0] 03:59:46 INFO - ++DOMWINDOW == 32 (0x11e712400) [pid = 1722] [serial = 743] [outer = 0x114b21800] 03:59:46 INFO - ++DOMWINDOW == 33 (0x120e25000) [pid = 1722] [serial = 744] [outer = 0x114b21800] 03:59:46 INFO - ++DOCSHELL 0x120e0f000 == 15 [pid = 1722] [id = 321] 03:59:46 INFO - ++DOMWINDOW == 34 (0x121805800) [pid = 1722] [serial = 745] [outer = 0x0] 03:59:46 INFO - ++DOMWINDOW == 35 (0x122124800) [pid = 1722] [serial = 746] [outer = 0x121805800] 03:59:47 INFO - [1722] WARNING: We should have hit the document element...: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175 03:59:48 INFO - --DOCSHELL 0x113516000 == 14 [pid = 1722] [id = 315] 03:59:48 INFO - --DOCSHELL 0x112cc6800 == 13 [pid = 1722] [id = 314] 03:59:48 INFO - --DOCSHELL 0x120e0f000 == 12 [pid = 1722] [id = 321] 03:59:48 INFO - --DOCSHELL 0x112bb2800 == 11 [pid = 1722] [id = 316] 03:59:48 INFO - --DOMWINDOW == 34 (0x122e9c000) [pid = 1722] [serial = 728] [outer = 0x0] [url = about:blank] 03:59:48 INFO - --DOMWINDOW == 33 (0x120ff3800) [pid = 1722] [serial = 726] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:48 INFO - --DOMWINDOW == 32 (0x11e712400) [pid = 1722] [serial = 743] [outer = 0x0] [url = about:blank] 03:59:48 INFO - --DOMWINDOW == 31 (0x113e0ac00) [pid = 1722] [serial = 732] [outer = 0x0] [url = about:blank] 03:59:48 INFO - --DOMWINDOW == 30 (0x113444800) [pid = 1722] [serial = 730] [outer = 0x0] [url = about:blank] 03:59:48 INFO - --DOMWINDOW == 29 (0x113e0dc00) [pid = 1722] [serial = 733] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:48 INFO - --DOMWINDOW == 28 (0x12211f800) [pid = 1722] [serial = 736] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:48 INFO - --DOMWINDOW == 27 (0x113d0a800) [pid = 1722] [serial = 731] [outer = 0x0] [url = data:text/html;charset=utf8,test%20autocompletion%20with%20$%20or%20_] 03:59:48 INFO - --DOMWINDOW == 26 (0x112f48800) [pid = 1722] [serial = 729] [outer = 0x0] [url = about:blank] 03:59:48 INFO - MEMORY STAT | vsize 3463MB | residentFast 467MB | heapAllocated 120MB 03:59:48 INFO - 183 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_and_selfxss.js | took 2405ms 03:59:48 INFO - ++DOCSHELL 0x112cc1000 == 12 [pid = 1722] [id = 322] 03:59:48 INFO - ++DOMWINDOW == 27 (0x112f47400) [pid = 1722] [serial = 747] [outer = 0x0] 03:59:48 INFO - ++DOMWINDOW == 28 (0x113446c00) [pid = 1722] [serial = 748] [outer = 0x112f47400] 03:59:48 INFO - 184 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js 03:59:48 INFO - ++DOCSHELL 0x113e37800 == 13 [pid = 1722] [id = 323] 03:59:48 INFO - ++DOMWINDOW == 29 (0x113e10c00) [pid = 1722] [serial = 749] [outer = 0x0] 03:59:48 INFO - ++DOMWINDOW == 30 (0x114dc0400) [pid = 1722] [serial = 750] [outer = 0x113e10c00] 03:59:49 INFO - ++DOMWINDOW == 31 (0x11e797800) [pid = 1722] [serial = 751] [outer = 0x113e10c00] 03:59:49 INFO - ++DOCSHELL 0x112ba5000 == 14 [pid = 1722] [id = 324] 03:59:49 INFO - ++DOMWINDOW == 32 (0x110d53c00) [pid = 1722] [serial = 752] [outer = 0x0] 03:59:49 INFO - ++DOMWINDOW == 33 (0x11ec9b400) [pid = 1722] [serial = 753] [outer = 0x110d53c00] 03:59:49 INFO - ++DOCSHELL 0x112ccd000 == 15 [pid = 1722] [id = 325] 03:59:49 INFO - ++DOMWINDOW == 34 (0x1202ed000) [pid = 1722] [serial = 754] [outer = 0x0] 03:59:49 INFO - ++DOMWINDOW == 35 (0x1203df400) [pid = 1722] [serial = 755] [outer = 0x1202ed000] 03:59:49 INFO - ++DOMWINDOW == 36 (0x120e2e800) [pid = 1722] [serial = 756] [outer = 0x1202ed000] 03:59:49 INFO - ++DOCSHELL 0x12446f800 == 16 [pid = 1722] [id = 326] 03:59:49 INFO - ++DOMWINDOW == 37 (0x122124c00) [pid = 1722] [serial = 757] [outer = 0x0] 03:59:49 INFO - ++DOMWINDOW == 38 (0x1221be000) [pid = 1722] [serial = 758] [outer = 0x122124c00] 03:59:50 INFO - getProperty threw an exception: Error: Permission denied to access property "document" 03:59:50 INFO - Stack: getProperty@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:300:20 03:59:50 INFO - JSPropertyProvider@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:253:13 03:59:50 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:59:50 INFO - WCA_onAutocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:908:18 03:59:50 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1606:15 03:59:50 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 03:59:50 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:59:50 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:59:50 INFO - Line: 0, column: 0 03:59:51 INFO - --DOCSHELL 0x113e4a000 == 15 [pid = 1722] [id = 319] 03:59:51 INFO - --DOCSHELL 0x112cce800 == 14 [pid = 1722] [id = 320] 03:59:51 INFO - --DOCSHELL 0x112cc7000 == 13 [pid = 1722] [id = 318] 03:59:51 INFO - --DOCSHELL 0x12446f800 == 12 [pid = 1722] [id = 326] 03:59:51 INFO - --DOMWINDOW == 37 (0x1221b4000) [pid = 1722] [serial = 737] [outer = 0x0] [url = about:blank] 03:59:51 INFO - --DOMWINDOW == 36 (0x120e30800) [pid = 1722] [serial = 735] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:51 INFO - --DOMWINDOW == 35 (0x1203df400) [pid = 1722] [serial = 755] [outer = 0x0] [url = about:blank] 03:59:51 INFO - --DOMWINDOW == 34 (0x114dc0400) [pid = 1722] [serial = 750] [outer = 0x0] [url = about:blank] 03:59:51 INFO - --DOMWINDOW == 33 (0x113e0cc00) [pid = 1722] [serial = 741] [outer = 0x0] [url = about:blank] 03:59:51 INFO - --DOMWINDOW == 32 (0x113446800) [pid = 1722] [serial = 739] [outer = 0x0] [url = about:blank] 03:59:51 INFO - --DOMWINDOW == 31 (0x121805800) [pid = 1722] [serial = 745] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:51 INFO - --DOMWINDOW == 30 (0x114b21800) [pid = 1722] [serial = 742] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:51 INFO - --DOMWINDOW == 29 (0x113451800) [pid = 1722] [serial = 740] [outer = 0x0] [url = data:text/html;charset=utf-8,

test%20for%20bug%20642615] 03:59:51 INFO - --DOMWINDOW == 28 (0x112f4b000) [pid = 1722] [serial = 738] [outer = 0x0] [url = about:blank] 03:59:51 INFO - MEMORY STAT | vsize 3463MB | residentFast 467MB | heapAllocated 119MB 03:59:51 INFO - 185 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js | took 2438ms 03:59:51 INFO - ++DOCSHELL 0x112cb9800 == 13 [pid = 1722] [id = 327] 03:59:51 INFO - ++DOMWINDOW == 29 (0x11315bc00) [pid = 1722] [serial = 759] [outer = 0x0] 03:59:51 INFO - ++DOMWINDOW == 30 (0x113447c00) [pid = 1722] [serial = 760] [outer = 0x11315bc00] 03:59:51 INFO - 186 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js 03:59:51 INFO - ++DOCSHELL 0x114b80800 == 14 [pid = 1722] [id = 328] 03:59:51 INFO - ++DOMWINDOW == 31 (0x113e08400) [pid = 1722] [serial = 761] [outer = 0x0] 03:59:51 INFO - ++DOMWINDOW == 32 (0x114b22800) [pid = 1722] [serial = 762] [outer = 0x113e08400] 03:59:51 INFO - ++DOMWINDOW == 33 (0x11e714800) [pid = 1722] [serial = 763] [outer = 0x113e08400] 03:59:51 INFO - ++DOCSHELL 0x113e4b000 == 15 [pid = 1722] [id = 329] 03:59:51 INFO - ++DOMWINDOW == 34 (0x11ebbdc00) [pid = 1722] [serial = 764] [outer = 0x0] 03:59:51 INFO - ++DOMWINDOW == 35 (0x11ec95000) [pid = 1722] [serial = 765] [outer = 0x11ebbdc00] 03:59:51 INFO - ++DOMWINDOW == 36 (0x1203de800) [pid = 1722] [serial = 766] [outer = 0x11ebbdc00] 03:59:52 INFO - ++DOCSHELL 0x124691000 == 16 [pid = 1722] [id = 330] 03:59:52 INFO - ++DOMWINDOW == 37 (0x1214b7800) [pid = 1722] [serial = 767] [outer = 0x0] 03:59:52 INFO - ++DOMWINDOW == 38 (0x12211a800) [pid = 1722] [serial = 768] [outer = 0x1214b7800] 03:59:53 INFO - ++DOCSHELL 0x124f1c000 == 17 [pid = 1722] [id = 331] 03:59:53 INFO - ++DOMWINDOW == 39 (0x1203e0800) [pid = 1722] [serial = 769] [outer = 0x0] 03:59:53 INFO - ++DOMWINDOW == 40 (0x12623c800) [pid = 1722] [serial = 770] [outer = 0x1203e0800] 03:59:53 INFO - ++DOCSHELL 0x129385800 == 18 [pid = 1722] [id = 332] 03:59:53 INFO - ++DOMWINDOW == 41 (0x1264ab000) [pid = 1722] [serial = 771] [outer = 0x0] 03:59:53 INFO - ++DOMWINDOW == 42 (0x1264ae400) [pid = 1722] [serial = 772] [outer = 0x1264ab000] 03:59:55 INFO - Handler function JSPropertyProvider threw an exception: TypeError: aName is not an identifier 03:59:55 INFO - Stack: DebuggerEnvironmentSupport.getProperty@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:512:18 03:59:55 INFO - getExactMatch_impl@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:444:16 03:59:55 INFO - getVariableInEnvironment@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:340:10 03:59:55 INFO - JSPropertyProvider@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:232:11 03:59:55 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:59:55 INFO - WCA_onAutocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:908:18 03:59:55 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1606:15 03:59:55 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 03:59:55 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:59:55 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 03:59:55 INFO - EventLoop.prototype.enter@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:347:5 03:59:55 INFO - ThreadActor.prototype._pushThreadPause@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:544:5 03:59:55 INFO - ThreadActor.prototype._pauseAndRespond@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:747:7 03:59:55 INFO - ThreadActor.prototype.onDebuggerStatement@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:1819:9 03:59:55 INFO - secondCall@http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html:43:9 03:59:55 INFO - firstCall@http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html:30:9 03:59:55 INFO - debuggerOpened/<@chrome://mochitests/content/browser/devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js:231:5 03:59:55 INFO - testScope/test_executeSoon/<.run@chrome://mochikit/content/browser-test.js:966:9 03:59:55 INFO - Line: 512, column: 18 03:59:56 INFO - --DOCSHELL 0x112ba5000 == 17 [pid = 1722] [id = 324] 03:59:56 INFO - --DOCSHELL 0x112cc1000 == 16 [pid = 1722] [id = 322] 03:59:56 INFO - --DOCSHELL 0x112ccd000 == 15 [pid = 1722] [id = 325] 03:59:56 INFO - --DOCSHELL 0x113e37800 == 14 [pid = 1722] [id = 323] 03:59:56 INFO - --DOCSHELL 0x113e4b000 == 13 [pid = 1722] [id = 329] 03:59:56 INFO - --DOCSHELL 0x124691000 == 12 [pid = 1722] [id = 330] 03:59:56 INFO - --DOCSHELL 0x124f1c000 == 11 [pid = 1722] [id = 331] 03:59:56 INFO - --DOCSHELL 0x129385800 == 10 [pid = 1722] [id = 332] 03:59:56 INFO - --DOMWINDOW == 41 (0x122124800) [pid = 1722] [serial = 746] [outer = 0x0] [url = about:blank] 03:59:56 INFO - --DOMWINDOW == 40 (0x120e25000) [pid = 1722] [serial = 744] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:56 INFO - --DOMWINDOW == 39 (0x1264ab000) [pid = 1722] [serial = 771] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 03:59:56 INFO - --DOMWINDOW == 38 (0x122124c00) [pid = 1722] [serial = 757] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 03:59:56 INFO - --DOMWINDOW == 37 (0x1202ed000) [pid = 1722] [serial = 754] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 03:59:56 INFO - --DOMWINDOW == 36 (0x110d53c00) [pid = 1722] [serial = 752] [outer = 0x0] [url = http://mochi.test:8888/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 03:59:56 INFO - --DOMWINDOW == 35 (0x113e10c00) [pid = 1722] [serial = 749] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-989025-iframe-parent.html] 03:59:56 INFO - --DOMWINDOW == 34 (0x112f47400) [pid = 1722] [serial = 747] [outer = 0x0] [url = about:blank] 03:59:56 INFO - --DOMWINDOW == 33 (0x114b22800) [pid = 1722] [serial = 762] [outer = 0x0] [url = about:blank] 03:59:56 INFO - --DOMWINDOW == 32 (0x113446c00) [pid = 1722] [serial = 748] [outer = 0x0] [url = about:blank] 03:59:56 INFO - --DOMWINDOW == 31 (0x11ec95000) [pid = 1722] [serial = 765] [outer = 0x0] [url = about:blank] 03:59:56 INFO - --DOMWINDOW == 30 (0x11ec9b400) [pid = 1722] [serial = 753] [outer = 0x0] [url = http://mochi.test:8888/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 03:59:56 INFO - --DOMWINDOW == 29 (0x11e797800) [pid = 1722] [serial = 751] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-989025-iframe-parent.html] 03:59:56 INFO - MEMORY STAT | vsize 3462MB | residentFast 466MB | heapAllocated 124MB 03:59:56 INFO - 187 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js | took 5456ms 03:59:56 INFO - ++DOCSHELL 0x112cce800 == 11 [pid = 1722] [id = 333] 03:59:56 INFO - ++DOMWINDOW == 30 (0x112f42000) [pid = 1722] [serial = 773] [outer = 0x0] 03:59:57 INFO - ++DOMWINDOW == 31 (0x112f4d400) [pid = 1722] [serial = 774] [outer = 0x112f42000] 03:59:57 INFO - 188 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_popup_close_on_tab_switch.js 03:59:57 INFO - ++DOCSHELL 0x114b7d000 == 12 [pid = 1722] [id = 334] 03:59:57 INFO - ++DOMWINDOW == 32 (0x11e78a000) [pid = 1722] [serial = 775] [outer = 0x0] 03:59:57 INFO - ++DOMWINDOW == 33 (0x11e7ab800) [pid = 1722] [serial = 776] [outer = 0x11e78a000] 03:59:57 INFO - ++DOCSHELL 0x112ccb000 == 13 [pid = 1722] [id = 335] 03:59:57 INFO - ++DOMWINDOW == 34 (0x11e7b0c00) [pid = 1722] [serial = 777] [outer = 0x0] 03:59:57 INFO - ++DOMWINDOW == 35 (0x11ee55800) [pid = 1722] [serial = 778] [outer = 0x11e7b0c00] 03:59:57 INFO - ++DOMWINDOW == 36 (0x120d1a000) [pid = 1722] [serial = 779] [outer = 0x11e7b0c00] 03:59:57 INFO - ++DOCSHELL 0x120eb2800 == 14 [pid = 1722] [id = 336] 03:59:57 INFO - ++DOMWINDOW == 37 (0x121312800) [pid = 1722] [serial = 780] [outer = 0x0] 03:59:57 INFO - ++DOMWINDOW == 38 (0x121314c00) [pid = 1722] [serial = 781] [outer = 0x121312800] 03:59:58 INFO - ++DOCSHELL 0x120e07800 == 15 [pid = 1722] [id = 337] 03:59:58 INFO - ++DOMWINDOW == 39 (0x120e23400) [pid = 1722] [serial = 782] [outer = 0x0] 03:59:58 INFO - ++DOMWINDOW == 40 (0x120e32800) [pid = 1722] [serial = 783] [outer = 0x120e23400] 03:59:59 INFO - MEMORY STAT | vsize 3464MB | residentFast 468MB | heapAllocated 129MB 03:59:59 INFO - 189 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_popup_close_on_tab_switch.js | took 1953ms 03:59:59 INFO - ++DOCSHELL 0x112cb8800 == 16 [pid = 1722] [id = 338] 03:59:59 INFO - ++DOMWINDOW == 41 (0x120e23800) [pid = 1722] [serial = 784] [outer = 0x0] 03:59:59 INFO - ++DOMWINDOW == 42 (0x120ffa800) [pid = 1722] [serial = 785] [outer = 0x120e23800] 03:59:59 INFO - 190 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_basic_net_logging.js 03:59:59 INFO - ++DOCSHELL 0x12570e000 == 17 [pid = 1722] [id = 339] 03:59:59 INFO - ++DOMWINDOW == 43 (0x110d5a400) [pid = 1722] [serial = 786] [outer = 0x0] 03:59:59 INFO - ++DOMWINDOW == 44 (0x122ea0000) [pid = 1722] [serial = 787] [outer = 0x110d5a400] 03:59:59 INFO - ++DOCSHELL 0x1293cb000 == 18 [pid = 1722] [id = 340] 03:59:59 INFO - ++DOMWINDOW == 45 (0x122ea1400) [pid = 1722] [serial = 788] [outer = 0x0] 03:59:59 INFO - ++DOMWINDOW == 46 (0x12623a400) [pid = 1722] [serial = 789] [outer = 0x122ea1400] 03:59:59 INFO - ++DOMWINDOW == 47 (0x122ea7000) [pid = 1722] [serial = 790] [outer = 0x122ea1400] 03:59:59 INFO - ++DOCSHELL 0x12966d800 == 19 [pid = 1722] [id = 341] 03:59:59 INFO - ++DOMWINDOW == 48 (0x122ea2400) [pid = 1722] [serial = 791] [outer = 0x0] 03:59:59 INFO - ++DOMWINDOW == 49 (0x1264a8400) [pid = 1722] [serial = 792] [outer = 0x122ea2400] 04:00:00 INFO - ++DOMWINDOW == 50 (0x1300a6400) [pid = 1722] [serial = 793] [outer = 0x110d5a400] 04:00:00 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:00:01 INFO - --DOCSHELL 0x112cce800 == 18 [pid = 1722] [id = 333] 04:00:01 INFO - --DOCSHELL 0x114b7d000 == 17 [pid = 1722] [id = 334] 04:00:01 INFO - --DOCSHELL 0x112ccb000 == 16 [pid = 1722] [id = 335] 04:00:01 INFO - --DOCSHELL 0x120eb2800 == 15 [pid = 1722] [id = 336] 04:00:01 INFO - --DOCSHELL 0x112cb9800 == 14 [pid = 1722] [id = 327] 04:00:01 INFO - --DOCSHELL 0x120e07800 == 13 [pid = 1722] [id = 337] 04:00:01 INFO - --DOCSHELL 0x1293cb000 == 12 [pid = 1722] [id = 340] 04:00:01 INFO - --DOCSHELL 0x12966d800 == 11 [pid = 1722] [id = 341] 04:00:01 INFO - --DOCSHELL 0x114b80800 == 10 [pid = 1722] [id = 328] 04:00:01 INFO - --DOMWINDOW == 49 (0x120e2e800) [pid = 1722] [serial = 756] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:01 INFO - --DOMWINDOW == 48 (0x1221be000) [pid = 1722] [serial = 758] [outer = 0x0] [url = about:blank] 04:00:01 INFO - --DOMWINDOW == 47 (0x1264ae400) [pid = 1722] [serial = 772] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 04:00:01 INFO - --DOMWINDOW == 46 (0x11e7b0c00) [pid = 1722] [serial = 777] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:01 INFO - --DOMWINDOW == 45 (0x1214b7800) [pid = 1722] [serial = 767] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:01 INFO - --DOMWINDOW == 44 (0x1203e0800) [pid = 1722] [serial = 769] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 04:00:01 INFO - --DOMWINDOW == 43 (0x11ebbdc00) [pid = 1722] [serial = 764] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:01 INFO - --DOMWINDOW == 42 (0x11315bc00) [pid = 1722] [serial = 759] [outer = 0x0] [url = about:blank] 04:00:01 INFO - --DOMWINDOW == 41 (0x113e08400) [pid = 1722] [serial = 761] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html] 04:00:01 INFO - --DOMWINDOW == 40 (0x112f42000) [pid = 1722] [serial = 773] [outer = 0x0] [url = about:blank] 04:00:01 INFO - --DOMWINDOW == 39 (0x11e78a000) [pid = 1722] [serial = 775] [outer = 0x0] [url = data:text/html;charset=utf-8,

bug%20900448%20-%20autocomplete%20popup%20closes%20on%20tab%20switch] 04:00:01 INFO - --DOMWINDOW == 38 (0x120e23400) [pid = 1722] [serial = 782] [outer = 0x0] [url = data:text/html;charset=utf-8,

testing%20autocomplete%20closes] 04:00:01 INFO - --DOMWINDOW == 37 (0x11ee55800) [pid = 1722] [serial = 778] [outer = 0x0] [url = about:blank] 04:00:01 INFO - --DOMWINDOW == 36 (0x113447c00) [pid = 1722] [serial = 760] [outer = 0x0] [url = about:blank] 04:00:01 INFO - --DOMWINDOW == 35 (0x112f4d400) [pid = 1722] [serial = 774] [outer = 0x0] [url = about:blank] 04:00:01 INFO - --DOMWINDOW == 34 (0x11e7ab800) [pid = 1722] [serial = 776] [outer = 0x0] [url = about:blank] 04:00:01 INFO - --DOMWINDOW == 33 (0x120e32800) [pid = 1722] [serial = 783] [outer = 0x0] [url = about:blank] 04:00:01 INFO - --DOMWINDOW == 32 (0x12623a400) [pid = 1722] [serial = 789] [outer = 0x0] [url = about:blank] 04:00:01 INFO - --DOMWINDOW == 31 (0x121312800) [pid = 1722] [serial = 780] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:01 INFO - --DOMWINDOW == 30 (0x11e714800) [pid = 1722] [serial = 763] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html] 04:00:01 INFO - MEMORY STAT | vsize 3457MB | residentFast 461MB | heapAllocated 122MB 04:00:01 INFO - 191 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_basic_net_logging.js | took 2569ms 04:00:01 INFO - ++DOCSHELL 0x1135b2800 == 11 [pid = 1722] [id = 342] 04:00:01 INFO - ++DOMWINDOW == 31 (0x113449000) [pid = 1722] [serial = 794] [outer = 0x0] 04:00:01 INFO - ++DOMWINDOW == 32 (0x113451000) [pid = 1722] [serial = 795] [outer = 0x113449000] 04:00:01 INFO - 192 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_block_mixedcontent_securityerrors.js 04:00:01 INFO - ++DOCSHELL 0x11efbe800 == 12 [pid = 1722] [id = 343] 04:00:01 INFO - ++DOMWINDOW == 33 (0x11ec90000) [pid = 1722] [serial = 796] [outer = 0x0] 04:00:01 INFO - ++DOMWINDOW == 34 (0x11ee18000) [pid = 1722] [serial = 797] [outer = 0x11ec90000] 04:00:02 INFO - ++DOMWINDOW == 35 (0x120259c00) [pid = 1722] [serial = 798] [outer = 0x11ec90000] 04:00:02 INFO - ++DOCSHELL 0x120ea5800 == 13 [pid = 1722] [id = 344] 04:00:02 INFO - ++DOMWINDOW == 36 (0x120e24000) [pid = 1722] [serial = 799] [outer = 0x0] 04:00:02 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805E0006: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 445 04:00:02 INFO - ++DOMWINDOW == 37 (0x120e31c00) [pid = 1722] [serial = 800] [outer = 0x120e24000] 04:00:02 INFO - ++DOCSHELL 0x11ec5d800 == 14 [pid = 1722] [id = 345] 04:00:02 INFO - ++DOMWINDOW == 38 (0x121115000) [pid = 1722] [serial = 801] [outer = 0x0] 04:00:02 INFO - ++DOMWINDOW == 39 (0x121117c00) [pid = 1722] [serial = 802] [outer = 0x121115000] 04:00:02 INFO - [1722] WARNING: Image width or height is non-positive: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6316 04:00:02 INFO - ++DOMWINDOW == 40 (0x121312c00) [pid = 1722] [serial = 803] [outer = 0x121115000] 04:00:02 INFO - ++DOCSHELL 0x125065800 == 15 [pid = 1722] [id = 346] 04:00:02 INFO - ++DOMWINDOW == 41 (0x1221bb400) [pid = 1722] [serial = 804] [outer = 0x0] 04:00:02 INFO - ++DOMWINDOW == 42 (0x12232ec00) [pid = 1722] [serial = 805] [outer = 0x1221bb400] 04:00:03 INFO - ++DOMWINDOW == 43 (0x126238800) [pid = 1722] [serial = 806] [outer = 0x11ec90000] 04:00:03 INFO - [1722] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsDocument.cpp, line 4754 04:00:03 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:00:03 INFO - ++DOCSHELL 0x113519000 == 16 [pid = 1722] [id = 347] 04:00:03 INFO - ++DOMWINDOW == 44 (0x126240c00) [pid = 1722] [serial = 807] [outer = 0x0] 04:00:03 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:00:03 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:00:03 INFO - ++DOMWINDOW == 45 (0x11e719000) [pid = 1722] [serial = 808] [outer = 0x126240c00] 04:00:03 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:00:03 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:00:03 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:00:03 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:00:03 INFO - ++DOMWINDOW == 46 (0x1240d8c00) [pid = 1722] [serial = 809] [outer = 0x126240c00] 04:00:03 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:00:04 INFO - --DOCSHELL 0x125065800 == 15 [pid = 1722] [id = 346] 04:00:04 INFO - --DOCSHELL 0x12570e000 == 14 [pid = 1722] [id = 339] 04:00:04 INFO - --DOCSHELL 0x112cb8800 == 13 [pid = 1722] [id = 338] 04:00:04 INFO - --DOMWINDOW == 45 (0x1203de800) [pid = 1722] [serial = 766] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:04 INFO - --DOMWINDOW == 44 (0x12211a800) [pid = 1722] [serial = 768] [outer = 0x0] [url = about:blank] 04:00:04 INFO - --DOMWINDOW == 43 (0x120d1a000) [pid = 1722] [serial = 779] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:04 INFO - --DOMWINDOW == 42 (0x121314c00) [pid = 1722] [serial = 781] [outer = 0x0] [url = about:blank] 04:00:04 INFO - --DOMWINDOW == 41 (0x12623c800) [pid = 1722] [serial = 770] [outer = 0x0] [url = about:blank] 04:00:04 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:00:04 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:00:04 INFO - --DOMWINDOW == 40 (0x120ffa800) [pid = 1722] [serial = 785] [outer = 0x0] [url = about:blank] 04:00:04 INFO - --DOMWINDOW == 39 (0x122ea0000) [pid = 1722] [serial = 787] [outer = 0x0] [url = about:blank] 04:00:04 INFO - --DOMWINDOW == 38 (0x11ee18000) [pid = 1722] [serial = 797] [outer = 0x0] [url = about:blank] 04:00:04 INFO - --DOMWINDOW == 37 (0x120e24000) [pid = 1722] [serial = 799] [outer = 0x0] [url = about:blank] 04:00:04 INFO - --DOMWINDOW == 36 (0x121117c00) [pid = 1722] [serial = 802] [outer = 0x0] [url = about:blank] 04:00:04 INFO - --DOMWINDOW == 35 (0x11e719000) [pid = 1722] [serial = 808] [outer = 0x0] [url = about:blank] 04:00:04 INFO - --DOMWINDOW == 34 (0x122ea1400) [pid = 1722] [serial = 788] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:04 INFO - --DOMWINDOW == 33 (0x122ea2400) [pid = 1722] [serial = 791] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:04 INFO - --DOMWINDOW == 32 (0x120e23800) [pid = 1722] [serial = 784] [outer = 0x0] [url = about:blank] 04:00:04 INFO - --DOMWINDOW == 31 (0x110d5a400) [pid = 1722] [serial = 786] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html?_date=1446551999220] 04:00:04 INFO - --DOMWINDOW == 30 (0x1300a6400) [pid = 1722] [serial = 793] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html?_date=1446551999220] 04:00:04 INFO - --DOMWINDOW == 29 (0x120259c00) [pid = 1722] [serial = 798] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 04:00:04 INFO - MEMORY STAT | vsize 3460MB | residentFast 463MB | heapAllocated 121MB 04:00:04 INFO - 193 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_block_mixedcontent_securityerrors.js | took 2986ms 04:00:04 INFO - ++DOCSHELL 0x112cd4800 == 14 [pid = 1722] [id = 348] 04:00:04 INFO - ++DOMWINDOW == 30 (0x113262800) [pid = 1722] [serial = 810] [outer = 0x0] 04:00:04 INFO - ++DOMWINDOW == 31 (0x113446800) [pid = 1722] [serial = 811] [outer = 0x113262800] 04:00:05 INFO - 194 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1006027_message_timestamps_incorrect.js 04:00:05 INFO - ++DOCSHELL 0x11518a800 == 15 [pid = 1722] [id = 349] 04:00:05 INFO - ++DOMWINDOW == 32 (0x11e78a000) [pid = 1722] [serial = 812] [outer = 0x0] 04:00:05 INFO - ++DOMWINDOW == 33 (0x11e7ab800) [pid = 1722] [serial = 813] [outer = 0x11e78a000] 04:00:05 INFO - ++DOCSHELL 0x112cc6800 == 16 [pid = 1722] [id = 350] 04:00:05 INFO - ++DOMWINDOW == 34 (0x11e7b0c00) [pid = 1722] [serial = 814] [outer = 0x0] 04:00:05 INFO - ++DOMWINDOW == 35 (0x11ef4a000) [pid = 1722] [serial = 815] [outer = 0x11e7b0c00] 04:00:05 INFO - ++DOMWINDOW == 36 (0x120e32800) [pid = 1722] [serial = 816] [outer = 0x11e7b0c00] 04:00:05 INFO - ++DOCSHELL 0x121845800 == 17 [pid = 1722] [id = 351] 04:00:05 INFO - ++DOMWINDOW == 37 (0x1214b1400) [pid = 1722] [serial = 817] [outer = 0x0] 04:00:05 INFO - ++DOMWINDOW == 38 (0x1214b7c00) [pid = 1722] [serial = 818] [outer = 0x1214b1400] 04:00:06 INFO - --DOCSHELL 0x120ea5800 == 16 [pid = 1722] [id = 344] 04:00:06 INFO - --DOCSHELL 0x113519000 == 15 [pid = 1722] [id = 347] 04:00:06 INFO - --DOCSHELL 0x11efbe800 == 14 [pid = 1722] [id = 343] 04:00:06 INFO - --DOCSHELL 0x11ec5d800 == 13 [pid = 1722] [id = 345] 04:00:06 INFO - --DOCSHELL 0x121845800 == 12 [pid = 1722] [id = 351] 04:00:06 INFO - --DOCSHELL 0x1135b2800 == 11 [pid = 1722] [id = 342] 04:00:06 INFO - --DOMWINDOW == 37 (0x1264a8400) [pid = 1722] [serial = 792] [outer = 0x0] [url = about:blank] 04:00:06 INFO - --DOMWINDOW == 36 (0x122ea7000) [pid = 1722] [serial = 790] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:06 INFO - --DOMWINDOW == 35 (0x120e31c00) [pid = 1722] [serial = 800] [outer = 0x0] [url = about:blank] 04:00:07 INFO - --DOMWINDOW == 34 (0x1240d8c00) [pid = 1722] [serial = 809] [outer = 0x0] [url = http://example.com/] 04:00:07 INFO - --DOMWINDOW == 33 (0x113451000) [pid = 1722] [serial = 795] [outer = 0x0] [url = about:blank] 04:00:07 INFO - --DOMWINDOW == 32 (0x11ef4a000) [pid = 1722] [serial = 815] [outer = 0x0] [url = about:blank] 04:00:07 INFO - --DOMWINDOW == 31 (0x121115000) [pid = 1722] [serial = 801] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:07 INFO - --DOMWINDOW == 30 (0x1221bb400) [pid = 1722] [serial = 804] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:07 INFO - --DOMWINDOW == 29 (0x126240c00) [pid = 1722] [serial = 807] [outer = 0x0] [url = http://example.com/] 04:00:07 INFO - --DOMWINDOW == 28 (0x11ec90000) [pid = 1722] [serial = 796] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 04:00:07 INFO - --DOMWINDOW == 27 (0x113449000) [pid = 1722] [serial = 794] [outer = 0x0] [url = about:blank] 04:00:07 INFO - --DOMWINDOW == 26 (0x126238800) [pid = 1722] [serial = 806] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 04:00:07 INFO - MEMORY STAT | vsize 3461MB | residentFast 465MB | heapAllocated 119MB 04:00:07 INFO - 195 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1006027_message_timestamps_incorrect.js | took 2180ms 04:00:07 INFO - ++DOCSHELL 0x112cca000 == 12 [pid = 1722] [id = 352] 04:00:07 INFO - ++DOMWINDOW == 27 (0x112f4a800) [pid = 1722] [serial = 819] [outer = 0x0] 04:00:07 INFO - ++DOMWINDOW == 28 (0x113444800) [pid = 1722] [serial = 820] [outer = 0x112f4a800] 04:00:07 INFO - 196 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1010953_cspro.js 04:00:07 INFO - ++DOCSHELL 0x114b7d800 == 13 [pid = 1722] [id = 353] 04:00:07 INFO - ++DOMWINDOW == 29 (0x11d465400) [pid = 1722] [serial = 821] [outer = 0x0] 04:00:07 INFO - ++DOMWINDOW == 30 (0x11e798400) [pid = 1722] [serial = 822] [outer = 0x11d465400] 04:00:07 INFO - ++DOCSHELL 0x11e82f000 == 14 [pid = 1722] [id = 354] 04:00:07 INFO - ++DOMWINDOW == 31 (0x11e7ad000) [pid = 1722] [serial = 823] [outer = 0x0] 04:00:07 INFO - ++DOMWINDOW == 32 (0x11f5cd000) [pid = 1722] [serial = 824] [outer = 0x11e7ad000] 04:00:07 INFO - ++DOMWINDOW == 33 (0x120fe6400) [pid = 1722] [serial = 825] [outer = 0x11e7ad000] 04:00:07 INFO - ++DOCSHELL 0x1223c6800 == 15 [pid = 1722] [id = 355] 04:00:07 INFO - ++DOMWINDOW == 34 (0x1214b5800) [pid = 1722] [serial = 826] [outer = 0x0] 04:00:07 INFO - ++DOMWINDOW == 35 (0x121806c00) [pid = 1722] [serial = 827] [outer = 0x1214b5800] 04:00:08 INFO - ++DOMWINDOW == 36 (0x1283f8400) [pid = 1722] [serial = 828] [outer = 0x11d465400] 04:00:08 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:00:09 INFO - console.log: 04:00:08.533 GET http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html [HTTP/1.1 200 OK 15ms] 04:00:09 INFO - 04:00:08.680 Content Security Policy: The page's settings blocked the loading of a resource at http://some.example.com/test.png ("img-src http://example.com").1 04:00:09 INFO - 04:00:08.681 GET http://some.example.com/test_bug_1010953_cspro.js [4ms] 04:00:09 INFO - 04:00:08.684 Content Security Policy: The page's settings observed the loading of a resource at http://some.example.com/test_bug_1010953_cspro.js ("script-src http://example.com"). A CSP report is being sent.1 04:00:09 INFO - 04:00:08.743 POST https://example.com/ignored/ [HTTP/1.1 200 Connected 203ms] 04:00:09 INFO - --DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 350] 04:00:09 INFO - --DOCSHELL 0x112cd4800 == 13 [pid = 1722] [id = 348] 04:00:09 INFO - --DOCSHELL 0x1223c6800 == 12 [pid = 1722] [id = 355] 04:00:09 INFO - --DOCSHELL 0x11518a800 == 11 [pid = 1722] [id = 349] 04:00:09 INFO - --DOMWINDOW == 35 (0x12232ec00) [pid = 1722] [serial = 805] [outer = 0x0] [url = about:blank] 04:00:09 INFO - --DOMWINDOW == 34 (0x121312c00) [pid = 1722] [serial = 803] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:09 INFO - --DOMWINDOW == 33 (0x11e7ab800) [pid = 1722] [serial = 813] [outer = 0x0] [url = about:blank] 04:00:09 INFO - --DOMWINDOW == 32 (0x113446800) [pid = 1722] [serial = 811] [outer = 0x0] [url = about:blank] 04:00:09 INFO - --DOMWINDOW == 31 (0x11f5cd000) [pid = 1722] [serial = 824] [outer = 0x0] [url = about:blank] 04:00:09 INFO - --DOMWINDOW == 30 (0x1214b1400) [pid = 1722] [serial = 817] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:09 INFO - --DOMWINDOW == 29 (0x11e7b0c00) [pid = 1722] [serial = 814] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:09 INFO - --DOMWINDOW == 28 (0x11e78a000) [pid = 1722] [serial = 812] [outer = 0x0] [url = data:text/html;charset=utf8,Test%20for%20Bug%201006027] 04:00:09 INFO - --DOMWINDOW == 27 (0x113262800) [pid = 1722] [serial = 810] [outer = 0x0] [url = about:blank] 04:00:10 INFO - MEMORY STAT | vsize 3462MB | residentFast 465MB | heapAllocated 120MB 04:00:10 INFO - 197 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1010953_cspro.js | took 2671ms 04:00:10 INFO - ++DOCSHELL 0x10036e800 == 12 [pid = 1722] [id = 356] 04:00:10 INFO - ++DOMWINDOW == 28 (0x113446c00) [pid = 1722] [serial = 829] [outer = 0x0] 04:00:10 INFO - ++DOMWINDOW == 29 (0x114b20000) [pid = 1722] [serial = 830] [outer = 0x113446c00] 04:00:10 INFO - 198 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1050691_click_function_to_source.js 04:00:10 INFO - ++DOCSHELL 0x11efcc800 == 13 [pid = 1722] [id = 357] 04:00:10 INFO - ++DOMWINDOW == 30 (0x11ebb9400) [pid = 1722] [serial = 831] [outer = 0x0] 04:00:10 INFO - ++DOMWINDOW == 31 (0x11ec99000) [pid = 1722] [serial = 832] [outer = 0x11ebb9400] 04:00:10 INFO - ++DOMWINDOW == 32 (0x1203e1800) [pid = 1722] [serial = 833] [outer = 0x11ebb9400] 04:00:10 INFO - ++DOCSHELL 0x113e4a800 == 14 [pid = 1722] [id = 358] 04:00:10 INFO - ++DOMWINDOW == 33 (0x120fe3400) [pid = 1722] [serial = 834] [outer = 0x0] 04:00:10 INFO - ++DOMWINDOW == 34 (0x120fe4400) [pid = 1722] [serial = 835] [outer = 0x120fe3400] 04:00:10 INFO - ++DOMWINDOW == 35 (0x121310400) [pid = 1722] [serial = 836] [outer = 0x120fe3400] 04:00:10 INFO - ++DOCSHELL 0x124f1a000 == 15 [pid = 1722] [id = 359] 04:00:10 INFO - ++DOMWINDOW == 36 (0x12232ec00) [pid = 1722] [serial = 837] [outer = 0x0] 04:00:10 INFO - ++DOMWINDOW == 37 (0x122e9ec00) [pid = 1722] [serial = 838] [outer = 0x12232ec00] 04:00:11 INFO - ++DOCSHELL 0x112b3f000 == 16 [pid = 1722] [id = 360] 04:00:11 INFO - ++DOMWINDOW == 38 (0x126236800) [pid = 1722] [serial = 839] [outer = 0x0] 04:00:11 INFO - ++DOMWINDOW == 39 (0x126237400) [pid = 1722] [serial = 840] [outer = 0x126236800] 04:00:11 INFO - console.warn: notDebuggee: cannot access the environment of this function. 04:00:11 INFO - ++DOCSHELL 0x1293db800 == 17 [pid = 1722] [id = 361] 04:00:11 INFO - ++DOMWINDOW == 40 (0x121310c00) [pid = 1722] [serial = 841] [outer = 0x0] 04:00:11 INFO - ++DOMWINDOW == 41 (0x12623a400) [pid = 1722] [serial = 842] [outer = 0x121310c00] 04:00:11 INFO - ++DOCSHELL 0x129664000 == 18 [pid = 1722] [id = 362] 04:00:11 INFO - ++DOMWINDOW == 42 (0x1283eb800) [pid = 1722] [serial = 843] [outer = 0x0] 04:00:11 INFO - ++DOMWINDOW == 43 (0x1283ee800) [pid = 1722] [serial = 844] [outer = 0x1283eb800] 04:00:13 INFO - --DOCSHELL 0x112cca000 == 17 [pid = 1722] [id = 352] 04:00:13 INFO - --DOCSHELL 0x114b7d800 == 16 [pid = 1722] [id = 353] 04:00:13 INFO - --DOCSHELL 0x11e82f000 == 15 [pid = 1722] [id = 354] 04:00:13 INFO - --DOCSHELL 0x124f1a000 == 14 [pid = 1722] [id = 359] 04:00:13 INFO - --DOCSHELL 0x112b3f000 == 13 [pid = 1722] [id = 360] 04:00:13 INFO - --DOCSHELL 0x1293db800 == 12 [pid = 1722] [id = 361] 04:00:13 INFO - --DOCSHELL 0x129664000 == 11 [pid = 1722] [id = 362] 04:00:13 INFO - --DOMWINDOW == 42 (0x1214b7c00) [pid = 1722] [serial = 818] [outer = 0x0] [url = about:blank] 04:00:13 INFO - --DOMWINDOW == 41 (0x120e32800) [pid = 1722] [serial = 816] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:13 INFO - --DOMWINDOW == 40 (0x11d465400) [pid = 1722] [serial = 821] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html] 04:00:13 INFO - --DOMWINDOW == 39 (0x112f4a800) [pid = 1722] [serial = 819] [outer = 0x0] [url = about:blank] 04:00:13 INFO - --DOMWINDOW == 38 (0x11ec99000) [pid = 1722] [serial = 832] [outer = 0x0] [url = about:blank] 04:00:13 INFO - --DOMWINDOW == 37 (0x11e798400) [pid = 1722] [serial = 822] [outer = 0x0] [url = about:blank] 04:00:13 INFO - --DOMWINDOW == 36 (0x113444800) [pid = 1722] [serial = 820] [outer = 0x0] [url = about:blank] 04:00:13 INFO - --DOMWINDOW == 35 (0x120fe4400) [pid = 1722] [serial = 835] [outer = 0x0] [url = about:blank] 04:00:13 INFO - --DOMWINDOW == 34 (0x1214b5800) [pid = 1722] [serial = 826] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:13 INFO - --DOMWINDOW == 33 (0x11e7ad000) [pid = 1722] [serial = 823] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:13 INFO - --DOMWINDOW == 32 (0x1283f8400) [pid = 1722] [serial = 828] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html] 04:00:13 INFO - MEMORY STAT | vsize 3464MB | residentFast 468MB | heapAllocated 123MB 04:00:13 INFO - 199 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1050691_click_function_to_source.js | took 3456ms 04:00:13 INFO - ++DOCSHELL 0x112cc8800 == 12 [pid = 1722] [id = 363] 04:00:13 INFO - ++DOMWINDOW == 33 (0x112f4f000) [pid = 1722] [serial = 845] [outer = 0x0] 04:00:13 INFO - ++DOMWINDOW == 34 (0x113446800) [pid = 1722] [serial = 846] [outer = 0x112f4f000] 04:00:13 INFO - 200 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_579412_input_focus.js 04:00:13 INFO - ++DOCSHELL 0x11e34d000 == 13 [pid = 1722] [id = 364] 04:00:13 INFO - ++DOMWINDOW == 35 (0x11d465400) [pid = 1722] [serial = 847] [outer = 0x0] 04:00:13 INFO - ++DOMWINDOW == 36 (0x11e7a8800) [pid = 1722] [serial = 848] [outer = 0x11d465400] 04:00:13 INFO - ++DOMWINDOW == 37 (0x122ea4c00) [pid = 1722] [serial = 849] [outer = 0x11d465400] 04:00:13 INFO - ++DOCSHELL 0x112cc0800 == 14 [pid = 1722] [id = 365] 04:00:13 INFO - ++DOMWINDOW == 38 (0x11ef14800) [pid = 1722] [serial = 850] [outer = 0x0] 04:00:13 INFO - ++DOMWINDOW == 39 (0x1203e6800) [pid = 1722] [serial = 851] [outer = 0x11ef14800] 04:00:14 INFO - ++DOMWINDOW == 40 (0x120e32400) [pid = 1722] [serial = 852] [outer = 0x11ef14800] 04:00:14 INFO - ++DOCSHELL 0x124f08800 == 15 [pid = 1722] [id = 366] 04:00:14 INFO - ++DOMWINDOW == 41 (0x12159f000) [pid = 1722] [serial = 853] [outer = 0x0] 04:00:14 INFO - ++DOMWINDOW == 42 (0x122124000) [pid = 1722] [serial = 854] [outer = 0x12159f000] 04:00:15 INFO - --DOCSHELL 0x11efcc800 == 14 [pid = 1722] [id = 357] 04:00:15 INFO - --DOCSHELL 0x113e4a800 == 13 [pid = 1722] [id = 358] 04:00:15 INFO - --DOCSHELL 0x124f08800 == 12 [pid = 1722] [id = 366] 04:00:15 INFO - --DOCSHELL 0x10036e800 == 11 [pid = 1722] [id = 356] 04:00:15 INFO - --DOMWINDOW == 41 (0x121806c00) [pid = 1722] [serial = 827] [outer = 0x0] [url = about:blank] 04:00:15 INFO - --DOMWINDOW == 40 (0x120fe6400) [pid = 1722] [serial = 825] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:15 INFO - --DOMWINDOW == 39 (0x1283eb800) [pid = 1722] [serial = 843] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:00:15 INFO - --DOMWINDOW == 38 (0x121310c00) [pid = 1722] [serial = 841] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 04:00:15 INFO - --DOMWINDOW == 37 (0x126236800) [pid = 1722] [serial = 839] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:00:15 INFO - --DOMWINDOW == 36 (0x11e7a8800) [pid = 1722] [serial = 848] [outer = 0x0] [url = about:blank] 04:00:15 INFO - --DOMWINDOW == 35 (0x114b20000) [pid = 1722] [serial = 830] [outer = 0x0] [url = about:blank] 04:00:15 INFO - --DOMWINDOW == 34 (0x1203e6800) [pid = 1722] [serial = 851] [outer = 0x0] [url = about:blank] 04:00:15 INFO - --DOMWINDOW == 33 (0x120fe3400) [pid = 1722] [serial = 834] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:15 INFO - --DOMWINDOW == 32 (0x12232ec00) [pid = 1722] [serial = 837] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:15 INFO - --DOMWINDOW == 31 (0x11ebb9400) [pid = 1722] [serial = 831] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_1050691_click_function_to_source.html] 04:00:15 INFO - --DOMWINDOW == 30 (0x113446c00) [pid = 1722] [serial = 829] [outer = 0x0] [url = about:blank] 04:00:15 INFO - --DOMWINDOW == 29 (0x1203e1800) [pid = 1722] [serial = 833] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_1050691_click_function_to_source.html] 04:00:15 INFO - MEMORY STAT | vsize 3462MB | residentFast 466MB | heapAllocated 122MB 04:00:15 INFO - 201 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_579412_input_focus.js | took 2264ms 04:00:15 INFO - ++DOCSHELL 0x112cc9000 == 12 [pid = 1722] [id = 367] 04:00:15 INFO - ++DOMWINDOW == 30 (0x112f4d400) [pid = 1722] [serial = 855] [outer = 0x0] 04:00:15 INFO - ++DOMWINDOW == 31 (0x113448800) [pid = 1722] [serial = 856] [outer = 0x112f4d400] 04:00:16 INFO - 202 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580001_closing_after_completion.js 04:00:16 INFO - ++DOCSHELL 0x11e80c800 == 13 [pid = 1722] [id = 368] 04:00:16 INFO - ++DOMWINDOW == 32 (0x11e78a800) [pid = 1722] [serial = 857] [outer = 0x0] 04:00:16 INFO - ++DOMWINDOW == 33 (0x11e7b1400) [pid = 1722] [serial = 858] [outer = 0x11e78a800] 04:00:16 INFO - ++DOMWINDOW == 34 (0x121828c00) [pid = 1722] [serial = 859] [outer = 0x11e78a800] 04:00:16 INFO - ++DOCSHELL 0x112e7a800 == 14 [pid = 1722] [id = 369] 04:00:16 INFO - ++DOMWINDOW == 35 (0x1203e6c00) [pid = 1722] [serial = 860] [outer = 0x0] 04:00:16 INFO - ++DOMWINDOW == 36 (0x120d16c00) [pid = 1722] [serial = 861] [outer = 0x1203e6c00] 04:00:16 INFO - ++DOMWINDOW == 37 (0x120fee400) [pid = 1722] [serial = 862] [outer = 0x1203e6c00] 04:00:16 INFO - ++DOCSHELL 0x124ac9000 == 15 [pid = 1722] [id = 370] 04:00:16 INFO - ++DOMWINDOW == 38 (0x1214b5400) [pid = 1722] [serial = 863] [outer = 0x0] 04:00:16 INFO - ++DOMWINDOW == 39 (0x121806c00) [pid = 1722] [serial = 864] [outer = 0x1214b5400] 04:00:18 INFO - --DOCSHELL 0x112cc8800 == 14 [pid = 1722] [id = 363] 04:00:18 INFO - --DOCSHELL 0x112cc0800 == 13 [pid = 1722] [id = 365] 04:00:18 INFO - --DOCSHELL 0x124ac9000 == 12 [pid = 1722] [id = 370] 04:00:18 INFO - --DOCSHELL 0x11e34d000 == 11 [pid = 1722] [id = 364] 04:00:18 INFO - --DOMWINDOW == 38 (0x126237400) [pid = 1722] [serial = 840] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:00:18 INFO - --DOMWINDOW == 37 (0x12623a400) [pid = 1722] [serial = 842] [outer = 0x0] [url = about:blank] 04:00:18 INFO - --DOMWINDOW == 36 (0x122e9ec00) [pid = 1722] [serial = 838] [outer = 0x0] [url = about:blank] 04:00:18 INFO - --DOMWINDOW == 35 (0x121310400) [pid = 1722] [serial = 836] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:18 INFO - --DOMWINDOW == 34 (0x1283ee800) [pid = 1722] [serial = 844] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:00:18 INFO - --DOMWINDOW == 33 (0x11e7b1400) [pid = 1722] [serial = 858] [outer = 0x0] [url = about:blank] 04:00:18 INFO - --DOMWINDOW == 32 (0x113446800) [pid = 1722] [serial = 846] [outer = 0x0] [url = about:blank] 04:00:18 INFO - --DOMWINDOW == 31 (0x120d16c00) [pid = 1722] [serial = 861] [outer = 0x0] [url = about:blank] 04:00:18 INFO - --DOMWINDOW == 30 (0x12159f000) [pid = 1722] [serial = 853] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:18 INFO - --DOMWINDOW == 29 (0x11ef14800) [pid = 1722] [serial = 850] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:18 INFO - --DOMWINDOW == 28 (0x11d465400) [pid = 1722] [serial = 847] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:18 INFO - --DOMWINDOW == 27 (0x112f4f000) [pid = 1722] [serial = 845] [outer = 0x0] [url = about:blank] 04:00:18 INFO - --DOMWINDOW == 26 (0x122ea4c00) [pid = 1722] [serial = 849] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:18 INFO - MEMORY STAT | vsize 3463MB | residentFast 466MB | heapAllocated 120MB 04:00:18 INFO - 203 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580001_closing_after_completion.js | took 2222ms 04:00:18 INFO - ++DOCSHELL 0x112cbc800 == 12 [pid = 1722] [id = 371] 04:00:18 INFO - ++DOMWINDOW == 27 (0x11315a800) [pid = 1722] [serial = 865] [outer = 0x0] 04:00:18 INFO - ++DOMWINDOW == 28 (0x113446800) [pid = 1722] [serial = 866] [outer = 0x11315a800] 04:00:18 INFO - 204 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580030_errors_after_page_reload.js 04:00:18 INFO - ++DOCSHELL 0x11ec43800 == 13 [pid = 1722] [id = 372] 04:00:18 INFO - ++DOMWINDOW == 29 (0x11e797800) [pid = 1722] [serial = 867] [outer = 0x0] 04:00:18 INFO - ++DOMWINDOW == 30 (0x11ebb6c00) [pid = 1722] [serial = 868] [outer = 0x11e797800] 04:00:18 INFO - ++DOMWINDOW == 31 (0x11f5cc800) [pid = 1722] [serial = 869] [outer = 0x11e797800] 04:00:18 INFO - ++DOCSHELL 0x11295a000 == 14 [pid = 1722] [id = 373] 04:00:18 INFO - ++DOMWINDOW == 32 (0x120d1e000) [pid = 1722] [serial = 870] [outer = 0x0] 04:00:18 INFO - ++DOMWINDOW == 33 (0x120e23400) [pid = 1722] [serial = 871] [outer = 0x120d1e000] 04:00:18 INFO - ++DOMWINDOW == 34 (0x120ffa400) [pid = 1722] [serial = 872] [outer = 0x120d1e000] 04:00:18 INFO - ++DOCSHELL 0x124f05000 == 15 [pid = 1722] [id = 374] 04:00:18 INFO - ++DOMWINDOW == 35 (0x122121400) [pid = 1722] [serial = 873] [outer = 0x0] 04:00:18 INFO - ++DOMWINDOW == 36 (0x1221bb400) [pid = 1722] [serial = 874] [outer = 0x122121400] 04:00:19 INFO - ++DOMWINDOW == 37 (0x12504e000) [pid = 1722] [serial = 875] [outer = 0x11e797800] 04:00:19 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:00:19 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-error.html, line 16: ReferenceError: fooBazBaz is not defined 04:00:20 INFO - --DOCSHELL 0x112e7a800 == 14 [pid = 1722] [id = 369] 04:00:20 INFO - --DOCSHELL 0x112cc9000 == 13 [pid = 1722] [id = 367] 04:00:20 INFO - --DOCSHELL 0x124f05000 == 12 [pid = 1722] [id = 374] 04:00:20 INFO - --DOCSHELL 0x11e80c800 == 11 [pid = 1722] [id = 368] 04:00:20 INFO - --DOMWINDOW == 36 (0x122124000) [pid = 1722] [serial = 854] [outer = 0x0] [url = about:blank] 04:00:20 INFO - --DOMWINDOW == 35 (0x120e32400) [pid = 1722] [serial = 852] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:20 INFO - --DOMWINDOW == 34 (0x11ebb6c00) [pid = 1722] [serial = 868] [outer = 0x0] [url = about:blank] 04:00:20 INFO - --DOMWINDOW == 33 (0x113448800) [pid = 1722] [serial = 856] [outer = 0x0] [url = about:blank] 04:00:20 INFO - --DOMWINDOW == 32 (0x120e23400) [pid = 1722] [serial = 871] [outer = 0x0] [url = about:blank] 04:00:20 INFO - --DOMWINDOW == 31 (0x1214b5400) [pid = 1722] [serial = 863] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:20 INFO - --DOMWINDOW == 30 (0x1203e6c00) [pid = 1722] [serial = 860] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:20 INFO - --DOMWINDOW == 29 (0x11e78a800) [pid = 1722] [serial = 857] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:20 INFO - --DOMWINDOW == 28 (0x112f4d400) [pid = 1722] [serial = 855] [outer = 0x0] [url = about:blank] 04:00:20 INFO - --DOMWINDOW == 27 (0x121828c00) [pid = 1722] [serial = 859] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:20 INFO - MEMORY STAT | vsize 3470MB | residentFast 466MB | heapAllocated 120MB 04:00:20 INFO - 205 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580030_errors_after_page_reload.js | took 2339ms 04:00:20 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 375] 04:00:20 INFO - ++DOMWINDOW == 28 (0x112f4f000) [pid = 1722] [serial = 876] [outer = 0x0] 04:00:20 INFO - ++DOMWINDOW == 29 (0x11344ec00) [pid = 1722] [serial = 877] [outer = 0x112f4f000] 04:00:20 INFO - 206 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580454_timestamp_l10n.js 04:00:20 INFO - ++DOCSHELL 0x11eb9d800 == 13 [pid = 1722] [id = 376] 04:00:20 INFO - ++DOMWINDOW == 30 (0x11e798c00) [pid = 1722] [serial = 878] [outer = 0x0] 04:00:20 INFO - ++DOMWINDOW == 31 (0x11ebbb800) [pid = 1722] [serial = 879] [outer = 0x11e798c00] 04:00:21 INFO - ++DOMWINDOW == 32 (0x1221b3400) [pid = 1722] [serial = 880] [outer = 0x11e798c00] 04:00:21 INFO - MEMORY STAT | vsize 3471MB | residentFast 466MB | heapAllocated 122MB 04:00:21 INFO - 207 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580454_timestamp_l10n.js | took 388ms 04:00:21 INFO - ++DOCSHELL 0x112cc9000 == 14 [pid = 1722] [id = 377] 04:00:21 INFO - ++DOMWINDOW == 33 (0x120e32000) [pid = 1722] [serial = 881] [outer = 0x0] 04:00:21 INFO - ++DOMWINDOW == 34 (0x120ff2800) [pid = 1722] [serial = 882] [outer = 0x120e32000] 04:00:21 INFO - 208 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_582201_duplicate_errors.js 04:00:21 INFO - ++DOCSHELL 0x124690800 == 15 [pid = 1722] [id = 378] 04:00:21 INFO - ++DOMWINDOW == 35 (0x121312c00) [pid = 1722] [serial = 883] [outer = 0x0] 04:00:21 INFO - ++DOMWINDOW == 36 (0x121317000) [pid = 1722] [serial = 884] [outer = 0x121312c00] 04:00:21 INFO - ++DOCSHELL 0x11eb95000 == 16 [pid = 1722] [id = 379] 04:00:21 INFO - ++DOMWINDOW == 37 (0x121319000) [pid = 1722] [serial = 885] [outer = 0x0] 04:00:21 INFO - ++DOMWINDOW == 38 (0x1214b5800) [pid = 1722] [serial = 886] [outer = 0x121319000] 04:00:21 INFO - ++DOMWINDOW == 39 (0x122e9e000) [pid = 1722] [serial = 887] [outer = 0x121319000] 04:00:21 INFO - ++DOCSHELL 0x112cbe800 == 17 [pid = 1722] [id = 380] 04:00:21 INFO - ++DOMWINDOW == 40 (0x122ea7400) [pid = 1722] [serial = 888] [outer = 0x0] 04:00:21 INFO - ++DOMWINDOW == 41 (0x1241db800) [pid = 1722] [serial = 889] [outer = 0x122ea7400] 04:00:22 INFO - ++DOMWINDOW == 42 (0x12c374400) [pid = 1722] [serial = 890] [outer = 0x121312c00] 04:00:22 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:00:22 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html, line 17: ReferenceError: fooDuplicateError1 is not defined 04:00:23 INFO - --DOCSHELL 0x112cbc800 == 16 [pid = 1722] [id = 371] 04:00:23 INFO - --DOCSHELL 0x11ec43800 == 15 [pid = 1722] [id = 372] 04:00:23 INFO - --DOCSHELL 0x11295a000 == 14 [pid = 1722] [id = 373] 04:00:23 INFO - --DOCSHELL 0x112cbe800 == 13 [pid = 1722] [id = 380] 04:00:23 INFO - --DOMWINDOW == 41 (0x120fee400) [pid = 1722] [serial = 862] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:23 INFO - --DOMWINDOW == 40 (0x121806c00) [pid = 1722] [serial = 864] [outer = 0x0] [url = about:blank] 04:00:23 INFO - --DOMWINDOW == 39 (0x11f5cc800) [pid = 1722] [serial = 869] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 04:00:23 INFO - --DOMWINDOW == 38 (0x113446800) [pid = 1722] [serial = 866] [outer = 0x0] [url = about:blank] 04:00:23 INFO - --DOMWINDOW == 37 (0x11344ec00) [pid = 1722] [serial = 877] [outer = 0x0] [url = about:blank] 04:00:23 INFO - --DOMWINDOW == 36 (0x11ebbb800) [pid = 1722] [serial = 879] [outer = 0x0] [url = about:blank] 04:00:23 INFO - --DOMWINDOW == 35 (0x1214b5800) [pid = 1722] [serial = 886] [outer = 0x0] [url = about:blank] 04:00:23 INFO - --DOMWINDOW == 34 (0x120d1e000) [pid = 1722] [serial = 870] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:23 INFO - --DOMWINDOW == 33 (0x122121400) [pid = 1722] [serial = 873] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:23 INFO - --DOMWINDOW == 32 (0x11315a800) [pid = 1722] [serial = 865] [outer = 0x0] [url = about:blank] 04:00:23 INFO - --DOMWINDOW == 31 (0x112f4f000) [pid = 1722] [serial = 876] [outer = 0x0] [url = about:blank] 04:00:23 INFO - --DOMWINDOW == 30 (0x11e798c00) [pid = 1722] [serial = 878] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:23 INFO - --DOMWINDOW == 29 (0x11e797800) [pid = 1722] [serial = 867] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 04:00:23 INFO - MEMORY STAT | vsize 3472MB | residentFast 468MB | heapAllocated 121MB 04:00:23 INFO - 209 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_582201_duplicate_errors.js | took 2461ms 04:00:23 INFO - ++DOCSHELL 0x112e90800 == 14 [pid = 1722] [id = 381] 04:00:23 INFO - ++DOMWINDOW == 30 (0x11e719000) [pid = 1722] [serial = 891] [outer = 0x0] 04:00:23 INFO - ++DOMWINDOW == 31 (0x11e7a6000) [pid = 1722] [serial = 892] [outer = 0x11e719000] 04:00:23 INFO - 210 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_583816_No_input_and_Tab_key_pressed.js 04:00:24 INFO - ++DOCSHELL 0x120e0f800 == 15 [pid = 1722] [id = 382] 04:00:24 INFO - ++DOMWINDOW == 32 (0x11ef14800) [pid = 1722] [serial = 893] [outer = 0x0] 04:00:24 INFO - ++DOMWINDOW == 33 (0x120263800) [pid = 1722] [serial = 894] [outer = 0x11ef14800] 04:00:24 INFO - ++DOMWINDOW == 34 (0x120e24c00) [pid = 1722] [serial = 895] [outer = 0x11ef14800] 04:00:24 INFO - ++DOCSHELL 0x112cbe800 == 16 [pid = 1722] [id = 383] 04:00:24 INFO - ++DOMWINDOW == 35 (0x120d16c00) [pid = 1722] [serial = 896] [outer = 0x0] 04:00:24 INFO - ++DOMWINDOW == 36 (0x12130cc00) [pid = 1722] [serial = 897] [outer = 0x120d16c00] 04:00:24 INFO - ++DOMWINDOW == 37 (0x121313800) [pid = 1722] [serial = 898] [outer = 0x120d16c00] 04:00:24 INFO - ++DOCSHELL 0x129377800 == 17 [pid = 1722] [id = 384] 04:00:24 INFO - ++DOMWINDOW == 38 (0x122ea8000) [pid = 1722] [serial = 899] [outer = 0x0] 04:00:24 INFO - ++DOMWINDOW == 39 (0x1241d3800) [pid = 1722] [serial = 900] [outer = 0x122ea8000] 04:00:25 INFO - --DOCSHELL 0x124690800 == 16 [pid = 1722] [id = 378] 04:00:25 INFO - --DOCSHELL 0x112cc4000 == 15 [pid = 1722] [id = 375] 04:00:25 INFO - --DOCSHELL 0x129377800 == 14 [pid = 1722] [id = 384] 04:00:25 INFO - --DOCSHELL 0x112cc9000 == 13 [pid = 1722] [id = 377] 04:00:25 INFO - --DOCSHELL 0x11eb9d800 == 12 [pid = 1722] [id = 376] 04:00:25 INFO - --DOCSHELL 0x11eb95000 == 11 [pid = 1722] [id = 379] 04:00:25 INFO - --DOMWINDOW == 38 (0x1221bb400) [pid = 1722] [serial = 874] [outer = 0x0] [url = about:blank] 04:00:25 INFO - --DOMWINDOW == 37 (0x120ffa400) [pid = 1722] [serial = 872] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:25 INFO - --DOMWINDOW == 36 (0x12504e000) [pid = 1722] [serial = 875] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 04:00:25 INFO - --DOMWINDOW == 35 (0x1221b3400) [pid = 1722] [serial = 880] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:26 INFO - --DOMWINDOW == 34 (0x120263800) [pid = 1722] [serial = 894] [outer = 0x0] [url = about:blank] 04:00:26 INFO - --DOMWINDOW == 33 (0x121317000) [pid = 1722] [serial = 884] [outer = 0x0] [url = about:blank] 04:00:26 INFO - --DOMWINDOW == 32 (0x120ff2800) [pid = 1722] [serial = 882] [outer = 0x0] [url = about:blank] 04:00:26 INFO - --DOMWINDOW == 31 (0x12130cc00) [pid = 1722] [serial = 897] [outer = 0x0] [url = about:blank] 04:00:26 INFO - --DOMWINDOW == 30 (0x121319000) [pid = 1722] [serial = 885] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:26 INFO - --DOMWINDOW == 29 (0x122ea7400) [pid = 1722] [serial = 888] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:26 INFO - --DOMWINDOW == 28 (0x121312c00) [pid = 1722] [serial = 883] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html] 04:00:26 INFO - --DOMWINDOW == 27 (0x120e32000) [pid = 1722] [serial = 881] [outer = 0x0] [url = about:blank] 04:00:26 INFO - --DOMWINDOW == 26 (0x12c374400) [pid = 1722] [serial = 890] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html] 04:00:26 INFO - MEMORY STAT | vsize 3470MB | residentFast 466MB | heapAllocated 121MB 04:00:26 INFO - 211 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_583816_No_input_and_Tab_key_pressed.js | took 2221ms 04:00:26 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 385] 04:00:26 INFO - ++DOMWINDOW == 27 (0x11315a800) [pid = 1722] [serial = 901] [outer = 0x0] 04:00:26 INFO - ++DOMWINDOW == 28 (0x113444c00) [pid = 1722] [serial = 902] [outer = 0x11315a800] 04:00:26 INFO - 212 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585237_line_limit.js 04:00:26 INFO - ++DOCSHELL 0x11e825800 == 13 [pid = 1722] [id = 386] 04:00:26 INFO - ++DOMWINDOW == 29 (0x115146400) [pid = 1722] [serial = 903] [outer = 0x0] 04:00:26 INFO - ++DOMWINDOW == 30 (0x11e7a9000) [pid = 1722] [serial = 904] [outer = 0x115146400] 04:00:26 INFO - ++DOCSHELL 0x11eec7000 == 14 [pid = 1722] [id = 387] 04:00:26 INFO - ++DOMWINDOW == 31 (0x11e7b0c00) [pid = 1722] [serial = 905] [outer = 0x0] 04:00:26 INFO - ++DOMWINDOW == 32 (0x11f5cd000) [pid = 1722] [serial = 906] [outer = 0x11e7b0c00] 04:00:26 INFO - ++DOMWINDOW == 33 (0x120fe4400) [pid = 1722] [serial = 907] [outer = 0x11e7b0c00] 04:00:26 INFO - ++DOCSHELL 0x124f8a800 == 15 [pid = 1722] [id = 388] 04:00:26 INFO - ++DOMWINDOW == 34 (0x12211a800) [pid = 1722] [serial = 908] [outer = 0x0] 04:00:26 INFO - ++DOMWINDOW == 35 (0x1221b3000) [pid = 1722] [serial = 909] [outer = 0x12211a800] 04:00:28 INFO - --DOCSHELL 0x112e90800 == 14 [pid = 1722] [id = 381] 04:00:28 INFO - --DOCSHELL 0x120e0f800 == 13 [pid = 1722] [id = 382] 04:00:28 INFO - --DOCSHELL 0x124f8a800 == 12 [pid = 1722] [id = 388] 04:00:28 INFO - --DOCSHELL 0x112cbe800 == 11 [pid = 1722] [id = 383] 04:00:28 INFO - --DOMWINDOW == 34 (0x1241db800) [pid = 1722] [serial = 889] [outer = 0x0] [url = about:blank] 04:00:28 INFO - --DOMWINDOW == 33 (0x122e9e000) [pid = 1722] [serial = 887] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:28 INFO - --DOMWINDOW == 32 (0x120e24c00) [pid = 1722] [serial = 895] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 04:00:28 INFO - --DOMWINDOW == 31 (0x11e7a6000) [pid = 1722] [serial = 892] [outer = 0x0] [url = about:blank] 04:00:28 INFO - --DOMWINDOW == 30 (0x11ef14800) [pid = 1722] [serial = 893] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 04:00:28 INFO - --DOMWINDOW == 29 (0x11e719000) [pid = 1722] [serial = 891] [outer = 0x0] [url = about:blank] 04:00:28 INFO - --DOMWINDOW == 28 (0x11f5cd000) [pid = 1722] [serial = 906] [outer = 0x0] [url = about:blank] 04:00:28 INFO - --DOMWINDOW == 27 (0x122ea8000) [pid = 1722] [serial = 899] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:28 INFO - --DOMWINDOW == 26 (0x120d16c00) [pid = 1722] [serial = 896] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:28 INFO - MEMORY STAT | vsize 3470MB | residentFast 466MB | heapAllocated 120MB 04:00:28 INFO - 213 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585237_line_limit.js | took 2521ms 04:00:28 INFO - ++DOCSHELL 0x112cbe000 == 12 [pid = 1722] [id = 389] 04:00:28 INFO - ++DOMWINDOW == 27 (0x11339b400) [pid = 1722] [serial = 910] [outer = 0x0] 04:00:28 INFO - ++DOMWINDOW == 28 (0x11344bc00) [pid = 1722] [serial = 911] [outer = 0x11339b400] 04:00:28 INFO - 214 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585956_console_trace.js 04:00:28 INFO - ++DOCSHELL 0x11e351800 == 13 [pid = 1722] [id = 390] 04:00:28 INFO - ++DOMWINDOW == 29 (0x11e798400) [pid = 1722] [serial = 912] [outer = 0x0] 04:00:29 INFO - ++DOMWINDOW == 30 (0x11ebba400) [pid = 1722] [serial = 913] [outer = 0x11e798400] 04:00:29 INFO - ++DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 391] 04:00:29 INFO - ++DOMWINDOW == 31 (0x11ebc0400) [pid = 1722] [serial = 914] [outer = 0x0] 04:00:29 INFO - ++DOMWINDOW == 32 (0x120d1b000) [pid = 1722] [serial = 915] [outer = 0x11ebc0400] 04:00:29 INFO - ++DOMWINDOW == 33 (0x120ff8c00) [pid = 1722] [serial = 916] [outer = 0x11ebc0400] 04:00:29 INFO - ++DOCSHELL 0x124f18800 == 15 [pid = 1722] [id = 392] 04:00:29 INFO - ++DOMWINDOW == 34 (0x121828c00) [pid = 1722] [serial = 917] [outer = 0x0] 04:00:29 INFO - ++DOMWINDOW == 35 (0x122124c00) [pid = 1722] [serial = 918] [outer = 0x121828c00] 04:00:30 INFO - ++DOMWINDOW == 36 (0x1296d4800) [pid = 1722] [serial = 919] [outer = 0x11e798400] 04:00:30 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:00:30 INFO - --DOCSHELL 0x11e825800 == 14 [pid = 1722] [id = 386] 04:00:30 INFO - --DOCSHELL 0x112cc4000 == 13 [pid = 1722] [id = 385] 04:00:30 INFO - --DOCSHELL 0x124f18800 == 12 [pid = 1722] [id = 392] 04:00:30 INFO - --DOCSHELL 0x11eec7000 == 11 [pid = 1722] [id = 387] 04:00:31 INFO - --DOMWINDOW == 35 (0x1241d3800) [pid = 1722] [serial = 900] [outer = 0x0] [url = about:blank] 04:00:31 INFO - --DOMWINDOW == 34 (0x121313800) [pid = 1722] [serial = 898] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:31 INFO - --DOMWINDOW == 33 (0x11e7a9000) [pid = 1722] [serial = 904] [outer = 0x0] [url = about:blank] 04:00:31 INFO - --DOMWINDOW == 32 (0x113444c00) [pid = 1722] [serial = 902] [outer = 0x0] [url = about:blank] 04:00:31 INFO - --DOMWINDOW == 31 (0x120d1b000) [pid = 1722] [serial = 915] [outer = 0x0] [url = about:blank] 04:00:31 INFO - --DOMWINDOW == 30 (0x11e7b0c00) [pid = 1722] [serial = 905] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:31 INFO - --DOMWINDOW == 29 (0x12211a800) [pid = 1722] [serial = 908] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:31 INFO - --DOMWINDOW == 28 (0x115146400) [pid = 1722] [serial = 903] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20bug%20585237] 04:00:31 INFO - --DOMWINDOW == 27 (0x11315a800) [pid = 1722] [serial = 901] [outer = 0x0] [url = about:blank] 04:00:31 INFO - MEMORY STAT | vsize 3470MB | residentFast 466MB | heapAllocated 121MB 04:00:31 INFO - 215 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585956_console_trace.js | took 2327ms 04:00:31 INFO - ++DOCSHELL 0x112cd2800 == 12 [pid = 1722] [id = 393] 04:00:31 INFO - ++DOMWINDOW == 28 (0x113d09400) [pid = 1722] [serial = 920] [outer = 0x0] 04:00:31 INFO - ++DOMWINDOW == 29 (0x115146000) [pid = 1722] [serial = 921] [outer = 0x113d09400] 04:00:31 INFO - 216 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_keys.js 04:00:31 INFO - ++DOCSHELL 0x120ea4800 == 13 [pid = 1722] [id = 394] 04:00:31 INFO - ++DOMWINDOW == 30 (0x11ee18000) [pid = 1722] [serial = 922] [outer = 0x0] 04:00:31 INFO - ++DOMWINDOW == 31 (0x11f5ccc00) [pid = 1722] [serial = 923] [outer = 0x11ee18000] 04:00:31 INFO - ++DOCSHELL 0x113e3c800 == 14 [pid = 1722] [id = 395] 04:00:31 INFO - ++DOMWINDOW == 32 (0x120265800) [pid = 1722] [serial = 924] [outer = 0x0] 04:00:31 INFO - ++DOMWINDOW == 33 (0x120e25000) [pid = 1722] [serial = 925] [outer = 0x120265800] 04:00:31 INFO - ++DOMWINDOW == 34 (0x121115000) [pid = 1722] [serial = 926] [outer = 0x120265800] 04:00:31 INFO - ++DOCSHELL 0x124f8a800 == 15 [pid = 1722] [id = 396] 04:00:31 INFO - ++DOMWINDOW == 35 (0x1221b7400) [pid = 1722] [serial = 927] [outer = 0x0] 04:00:31 INFO - ++DOMWINDOW == 36 (0x122336800) [pid = 1722] [serial = 928] [outer = 0x1221b7400] 04:00:34 INFO - --DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 391] 04:00:34 INFO - --DOCSHELL 0x124f8a800 == 13 [pid = 1722] [id = 396] 04:00:34 INFO - --DOCSHELL 0x112cbe000 == 12 [pid = 1722] [id = 389] 04:00:34 INFO - --DOCSHELL 0x11e351800 == 11 [pid = 1722] [id = 390] 04:00:34 INFO - --DOMWINDOW == 35 (0x120fe4400) [pid = 1722] [serial = 907] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:34 INFO - --DOMWINDOW == 34 (0x1221b3000) [pid = 1722] [serial = 909] [outer = 0x0] [url = about:blank] 04:00:34 INFO - --DOMWINDOW == 33 (0x120e25000) [pid = 1722] [serial = 925] [outer = 0x0] [url = about:blank] 04:00:34 INFO - --DOMWINDOW == 32 (0x11344bc00) [pid = 1722] [serial = 911] [outer = 0x0] [url = about:blank] 04:00:34 INFO - --DOMWINDOW == 31 (0x11ebba400) [pid = 1722] [serial = 913] [outer = 0x0] [url = about:blank] 04:00:34 INFO - --DOMWINDOW == 30 (0x121828c00) [pid = 1722] [serial = 917] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:34 INFO - --DOMWINDOW == 29 (0x11ebc0400) [pid = 1722] [serial = 914] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:34 INFO - --DOMWINDOW == 28 (0x11339b400) [pid = 1722] [serial = 910] [outer = 0x0] [url = about:blank] 04:00:34 INFO - --DOMWINDOW == 27 (0x11e798400) [pid = 1722] [serial = 912] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-585956-console-trace.html] 04:00:34 INFO - --DOMWINDOW == 26 (0x1296d4800) [pid = 1722] [serial = 919] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-585956-console-trace.html] 04:00:34 INFO - MEMORY STAT | vsize 3470MB | residentFast 466MB | heapAllocated 121MB 04:00:34 INFO - 217 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_keys.js | took 3195ms 04:00:34 INFO - ++DOCSHELL 0x112cc9000 == 12 [pid = 1722] [id = 397] 04:00:34 INFO - ++DOMWINDOW == 27 (0x112f45c00) [pid = 1722] [serial = 929] [outer = 0x0] 04:00:34 INFO - ++DOMWINDOW == 28 (0x11315a800) [pid = 1722] [serial = 930] [outer = 0x112f45c00] 04:00:34 INFO - 218 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_popup.js 04:00:34 INFO - ++DOCSHELL 0x11ee49800 == 13 [pid = 1722] [id = 398] 04:00:34 INFO - ++DOMWINDOW == 29 (0x11d465400) [pid = 1722] [serial = 931] [outer = 0x0] 04:00:34 INFO - ++DOMWINDOW == 30 (0x11e798400) [pid = 1722] [serial = 932] [outer = 0x11d465400] 04:00:34 INFO - ++DOCSHELL 0x112cba800 == 14 [pid = 1722] [id = 399] 04:00:34 INFO - ++DOMWINDOW == 31 (0x11e7b1000) [pid = 1722] [serial = 933] [outer = 0x0] 04:00:34 INFO - ++DOMWINDOW == 32 (0x1203e0800) [pid = 1722] [serial = 934] [outer = 0x11e7b1000] 04:00:35 INFO - ++DOMWINDOW == 33 (0x120ff3000) [pid = 1722] [serial = 935] [outer = 0x11e7b1000] 04:00:35 INFO - ++DOCSHELL 0x124f8a800 == 15 [pid = 1722] [id = 400] 04:00:35 INFO - ++DOMWINDOW == 34 (0x12211f800) [pid = 1722] [serial = 936] [outer = 0x0] 04:00:35 INFO - ++DOMWINDOW == 35 (0x1221bec00) [pid = 1722] [serial = 937] [outer = 0x12211f800] 04:00:36 INFO - --DOCSHELL 0x113e3c800 == 14 [pid = 1722] [id = 395] 04:00:36 INFO - --DOCSHELL 0x112cd2800 == 13 [pid = 1722] [id = 393] 04:00:36 INFO - --DOCSHELL 0x120ea4800 == 12 [pid = 1722] [id = 394] 04:00:36 INFO - --DOCSHELL 0x124f8a800 == 11 [pid = 1722] [id = 400] 04:00:36 INFO - --DOMWINDOW == 34 (0x122124c00) [pid = 1722] [serial = 918] [outer = 0x0] [url = about:blank] 04:00:36 INFO - --DOMWINDOW == 33 (0x120ff8c00) [pid = 1722] [serial = 916] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:36 INFO - --DOMWINDOW == 32 (0x1203e0800) [pid = 1722] [serial = 934] [outer = 0x0] [url = about:blank] 04:00:36 INFO - --DOMWINDOW == 31 (0x11f5ccc00) [pid = 1722] [serial = 923] [outer = 0x0] [url = about:blank] 04:00:36 INFO - --DOMWINDOW == 30 (0x115146000) [pid = 1722] [serial = 921] [outer = 0x0] [url = about:blank] 04:00:36 INFO - --DOMWINDOW == 29 (0x1221b7400) [pid = 1722] [serial = 927] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:36 INFO - --DOMWINDOW == 28 (0x120265800) [pid = 1722] [serial = 924] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:36 INFO - --DOMWINDOW == 27 (0x11ee18000) [pid = 1722] [serial = 922] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>bug%20585991%20-%20autocomplete%20popup%20keyboard%20usage%20test] 04:00:36 INFO - --DOMWINDOW == 26 (0x113d09400) [pid = 1722] [serial = 920] [outer = 0x0] [url = about:blank] 04:00:36 INFO - MEMORY STAT | vsize 3470MB | residentFast 466MB | heapAllocated 120MB 04:00:36 INFO - 219 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_popup.js | took 2161ms 04:00:36 INFO - ++DOCSHELL 0x112cc5800 == 12 [pid = 1722] [id = 401] 04:00:36 INFO - ++DOMWINDOW == 27 (0x112f4b000) [pid = 1722] [serial = 938] [outer = 0x0] 04:00:36 INFO - ++DOMWINDOW == 28 (0x11344ac00) [pid = 1722] [serial = 939] [outer = 0x112f4b000] 04:00:37 INFO - 220 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_586388_select_all.js 04:00:37 INFO - ++DOCSHELL 0x11eecb800 == 13 [pid = 1722] [id = 402] 04:00:37 INFO - ++DOMWINDOW == 29 (0x11e719400) [pid = 1722] [serial = 940] [outer = 0x0] 04:00:37 INFO - ++DOMWINDOW == 30 (0x11ebba400) [pid = 1722] [serial = 941] [outer = 0x11e719400] 04:00:37 INFO - ++DOMWINDOW == 31 (0x1202ecc00) [pid = 1722] [serial = 942] [outer = 0x11e719400] 04:00:37 INFO - ++DOCSHELL 0x112cb8800 == 14 [pid = 1722] [id = 403] 04:00:37 INFO - ++DOMWINDOW == 32 (0x120e26000) [pid = 1722] [serial = 943] [outer = 0x0] 04:00:37 INFO - ++DOMWINDOW == 33 (0x120e2d800) [pid = 1722] [serial = 944] [outer = 0x120e26000] 04:00:37 INFO - ++DOMWINDOW == 34 (0x121109800) [pid = 1722] [serial = 945] [outer = 0x120e26000] 04:00:37 INFO - ++DOCSHELL 0x12936b000 == 15 [pid = 1722] [id = 404] 04:00:37 INFO - ++DOMWINDOW == 35 (0x122ea8400) [pid = 1722] [serial = 946] [outer = 0x0] 04:00:37 INFO - ++DOMWINDOW == 36 (0x124390400) [pid = 1722] [serial = 947] [outer = 0x122ea8400] 04:00:39 INFO - --DOCSHELL 0x11ee49800 == 14 [pid = 1722] [id = 398] 04:00:39 INFO - --DOCSHELL 0x112cc9000 == 13 [pid = 1722] [id = 397] 04:00:39 INFO - --DOCSHELL 0x112cba800 == 12 [pid = 1722] [id = 399] 04:00:39 INFO - --DOCSHELL 0x12936b000 == 11 [pid = 1722] [id = 404] 04:00:39 INFO - --DOMWINDOW == 35 (0x122336800) [pid = 1722] [serial = 928] [outer = 0x0] [url = about:blank] 04:00:39 INFO - --DOMWINDOW == 34 (0x121115000) [pid = 1722] [serial = 926] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:39 INFO - --DOMWINDOW == 33 (0x11ebba400) [pid = 1722] [serial = 941] [outer = 0x0] [url = about:blank] 04:00:39 INFO - --DOMWINDOW == 32 (0x11e798400) [pid = 1722] [serial = 932] [outer = 0x0] [url = about:blank] 04:00:39 INFO - --DOMWINDOW == 31 (0x11315a800) [pid = 1722] [serial = 930] [outer = 0x0] [url = about:blank] 04:00:39 INFO - --DOMWINDOW == 30 (0x120e2d800) [pid = 1722] [serial = 944] [outer = 0x0] [url = about:blank] 04:00:39 INFO - --DOMWINDOW == 29 (0x12211f800) [pid = 1722] [serial = 936] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:39 INFO - --DOMWINDOW == 28 (0x11e7b1000) [pid = 1722] [serial = 933] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:39 INFO - --DOMWINDOW == 27 (0x11d465400) [pid = 1722] [serial = 931] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>bug%20585991%20-%20autocomplete%20popup%20test] 04:00:39 INFO - --DOMWINDOW == 26 (0x112f45c00) [pid = 1722] [serial = 929] [outer = 0x0] [url = about:blank] 04:00:39 INFO - MEMORY STAT | vsize 3470MB | residentFast 466MB | heapAllocated 122MB 04:00:39 INFO - 221 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_586388_select_all.js | took 2511ms 04:00:39 INFO - ++DOCSHELL 0x11efc2800 == 12 [pid = 1722] [id = 405] 04:00:39 INFO - ++DOMWINDOW == 27 (0x11ef54800) [pid = 1722] [serial = 948] [outer = 0x0] 04:00:39 INFO - ++DOMWINDOW == 28 (0x120265800) [pid = 1722] [serial = 949] [outer = 0x11ef54800] 04:00:39 INFO - 222 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_587617_output_copy.js 04:00:39 INFO - ++DOCSHELL 0x124aba800 == 13 [pid = 1722] [id = 406] 04:00:39 INFO - ++DOMWINDOW == 29 (0x11ebba400) [pid = 1722] [serial = 950] [outer = 0x0] 04:00:39 INFO - ++DOMWINDOW == 30 (0x120e31c00) [pid = 1722] [serial = 951] [outer = 0x11ebba400] 04:00:39 INFO - ++DOMWINDOW == 31 (0x124c35800) [pid = 1722] [serial = 952] [outer = 0x11ebba400] 04:00:39 INFO - ++DOCSHELL 0x112ccd000 == 14 [pid = 1722] [id = 407] 04:00:39 INFO - ++DOMWINDOW == 32 (0x1214adc00) [pid = 1722] [serial = 953] [outer = 0x0] 04:00:39 INFO - ++DOMWINDOW == 33 (0x1214af000) [pid = 1722] [serial = 954] [outer = 0x1214adc00] 04:00:40 INFO - ++DOMWINDOW == 34 (0x12211f800) [pid = 1722] [serial = 955] [outer = 0x1214adc00] 04:00:40 INFO - ++DOCSHELL 0x1293cd800 == 15 [pid = 1722] [id = 408] 04:00:40 INFO - ++DOMWINDOW == 35 (0x1247c3800) [pid = 1722] [serial = 956] [outer = 0x0] 04:00:40 INFO - ++DOMWINDOW == 36 (0x1247cb400) [pid = 1722] [serial = 957] [outer = 0x1247c3800] 04:00:41 INFO - --DOCSHELL 0x11eecb800 == 14 [pid = 1722] [id = 402] 04:00:41 INFO - --DOCSHELL 0x112cc5800 == 13 [pid = 1722] [id = 401] 04:00:41 INFO - --DOCSHELL 0x112cb8800 == 12 [pid = 1722] [id = 403] 04:00:41 INFO - --DOCSHELL 0x1293cd800 == 11 [pid = 1722] [id = 408] 04:00:41 INFO - --DOMWINDOW == 35 (0x1221bec00) [pid = 1722] [serial = 937] [outer = 0x0] [url = about:blank] 04:00:41 INFO - --DOMWINDOW == 34 (0x120ff3000) [pid = 1722] [serial = 935] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:41 INFO - --DOMWINDOW == 33 (0x120e31c00) [pid = 1722] [serial = 951] [outer = 0x0] [url = about:blank] 04:00:41 INFO - --DOMWINDOW == 32 (0x1202ecc00) [pid = 1722] [serial = 942] [outer = 0x0] [url = http://example.com/] 04:00:41 INFO - --DOMWINDOW == 31 (0x11344ac00) [pid = 1722] [serial = 939] [outer = 0x0] [url = about:blank] 04:00:41 INFO - --DOMWINDOW == 30 (0x1214af000) [pid = 1722] [serial = 954] [outer = 0x0] [url = about:blank] 04:00:41 INFO - --DOMWINDOW == 29 (0x122ea8400) [pid = 1722] [serial = 946] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:41 INFO - --DOMWINDOW == 28 (0x120e26000) [pid = 1722] [serial = 943] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:41 INFO - --DOMWINDOW == 27 (0x11e719400) [pid = 1722] [serial = 940] [outer = 0x0] [url = http://example.com/] 04:00:41 INFO - --DOMWINDOW == 26 (0x112f4b000) [pid = 1722] [serial = 938] [outer = 0x0] [url = about:blank] 04:00:41 INFO - MEMORY STAT | vsize 3470MB | residentFast 467MB | heapAllocated 121MB 04:00:41 INFO - 223 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_587617_output_copy.js | took 2236ms 04:00:41 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 409] 04:00:41 INFO - ++DOMWINDOW == 27 (0x113445000) [pid = 1722] [serial = 958] [outer = 0x0] 04:00:41 INFO - ++DOMWINDOW == 28 (0x114b63000) [pid = 1722] [serial = 959] [outer = 0x113445000] 04:00:42 INFO - 224 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588342_document_focus.js 04:00:42 INFO - ++DOCSHELL 0x11eeb3800 == 13 [pid = 1722] [id = 410] 04:00:42 INFO - ++DOMWINDOW == 29 (0x11ee55800) [pid = 1722] [serial = 960] [outer = 0x0] 04:00:42 INFO - ++DOMWINDOW == 30 (0x11f5ccc00) [pid = 1722] [serial = 961] [outer = 0x11ee55800] 04:00:42 INFO - ++DOCSHELL 0x112ccc800 == 14 [pid = 1722] [id = 411] 04:00:42 INFO - ++DOMWINDOW == 31 (0x1203df400) [pid = 1722] [serial = 962] [outer = 0x0] 04:00:42 INFO - ++DOMWINDOW == 32 (0x120e32000) [pid = 1722] [serial = 963] [outer = 0x1203df400] 04:00:42 INFO - ++DOMWINDOW == 33 (0x121317400) [pid = 1722] [serial = 964] [outer = 0x1203df400] 04:00:42 INFO - ++DOCSHELL 0x129375000 == 15 [pid = 1722] [id = 412] 04:00:42 INFO - ++DOMWINDOW == 34 (0x122ea7c00) [pid = 1722] [serial = 965] [outer = 0x0] 04:00:42 INFO - ++DOMWINDOW == 35 (0x1240dd400) [pid = 1722] [serial = 966] [outer = 0x122ea7c00] 04:00:43 INFO - --DOCSHELL 0x11efc2800 == 14 [pid = 1722] [id = 405] 04:00:43 INFO - --DOCSHELL 0x124aba800 == 13 [pid = 1722] [id = 406] 04:00:43 INFO - --DOCSHELL 0x112ccd000 == 12 [pid = 1722] [id = 407] 04:00:43 INFO - --DOCSHELL 0x129375000 == 11 [pid = 1722] [id = 412] 04:00:43 INFO - --DOMWINDOW == 34 (0x124390400) [pid = 1722] [serial = 947] [outer = 0x0] [url = about:blank] 04:00:43 INFO - --DOMWINDOW == 33 (0x121109800) [pid = 1722] [serial = 945] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:43 INFO - --DOMWINDOW == 32 (0x120e32000) [pid = 1722] [serial = 963] [outer = 0x0] [url = about:blank] 04:00:43 INFO - --DOMWINDOW == 31 (0x120265800) [pid = 1722] [serial = 949] [outer = 0x0] [url = about:blank] 04:00:43 INFO - --DOMWINDOW == 30 (0x1214adc00) [pid = 1722] [serial = 953] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:43 INFO - --DOMWINDOW == 29 (0x1247c3800) [pid = 1722] [serial = 956] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:43 INFO - --DOMWINDOW == 28 (0x11ebba400) [pid = 1722] [serial = 950] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:43 INFO - --DOMWINDOW == 27 (0x11ef54800) [pid = 1722] [serial = 948] [outer = 0x0] [url = about:blank] 04:00:43 INFO - --DOMWINDOW == 26 (0x124c35800) [pid = 1722] [serial = 952] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:44 INFO - MEMORY STAT | vsize 3469MB | residentFast 465MB | heapAllocated 120MB 04:00:44 INFO - 225 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588342_document_focus.js | took 2006ms 04:00:44 INFO - ++DOCSHELL 0x1128cb000 == 12 [pid = 1722] [id = 413] 04:00:44 INFO - ++DOMWINDOW == 27 (0x113447000) [pid = 1722] [serial = 967] [outer = 0x0] 04:00:44 INFO - ++DOMWINDOW == 28 (0x11344c800) [pid = 1722] [serial = 968] [outer = 0x113447000] 04:00:44 INFO - 226 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588730_text_node_insertion.js 04:00:44 INFO - ++DOCSHELL 0x11f647800 == 13 [pid = 1722] [id = 414] 04:00:44 INFO - ++DOMWINDOW == 29 (0x11ebb7800) [pid = 1722] [serial = 969] [outer = 0x0] 04:00:44 INFO - ++DOMWINDOW == 30 (0x11ec99000) [pid = 1722] [serial = 970] [outer = 0x11ebb7800] 04:00:44 INFO - ++DOMWINDOW == 31 (0x122124000) [pid = 1722] [serial = 971] [outer = 0x11ebb7800] 04:00:44 INFO - ++DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 415] 04:00:44 INFO - ++DOMWINDOW == 32 (0x120e30800) [pid = 1722] [serial = 972] [outer = 0x0] 04:00:44 INFO - ++DOMWINDOW == 33 (0x120ff2800) [pid = 1722] [serial = 973] [outer = 0x120e30800] 04:00:44 INFO - ++DOMWINDOW == 34 (0x121316c00) [pid = 1722] [serial = 974] [outer = 0x120e30800] 04:00:44 INFO - ++DOCSHELL 0x129381800 == 15 [pid = 1722] [id = 416] 04:00:44 INFO - ++DOMWINDOW == 35 (0x122ea7000) [pid = 1722] [serial = 975] [outer = 0x0] 04:00:44 INFO - ++DOMWINDOW == 36 (0x1240d8c00) [pid = 1722] [serial = 976] [outer = 0x122ea7000] 04:00:46 INFO - --DOCSHELL 0x11eeb3800 == 14 [pid = 1722] [id = 410] 04:00:46 INFO - --DOCSHELL 0x129381800 == 13 [pid = 1722] [id = 416] 04:00:46 INFO - --DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 409] 04:00:46 INFO - --DOCSHELL 0x112ccc800 == 11 [pid = 1722] [id = 411] 04:00:46 INFO - --DOMWINDOW == 35 (0x1247cb400) [pid = 1722] [serial = 957] [outer = 0x0] [url = about:blank] 04:00:46 INFO - --DOMWINDOW == 34 (0x12211f800) [pid = 1722] [serial = 955] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:46 INFO - --DOMWINDOW == 33 (0x11ec99000) [pid = 1722] [serial = 970] [outer = 0x0] [url = about:blank] 04:00:46 INFO - --DOMWINDOW == 32 (0x11f5ccc00) [pid = 1722] [serial = 961] [outer = 0x0] [url = about:blank] 04:00:46 INFO - --DOMWINDOW == 31 (0x114b63000) [pid = 1722] [serial = 959] [outer = 0x0] [url = about:blank] 04:00:46 INFO - --DOMWINDOW == 30 (0x120ff2800) [pid = 1722] [serial = 973] [outer = 0x0] [url = about:blank] 04:00:46 INFO - --DOMWINDOW == 29 (0x1203df400) [pid = 1722] [serial = 962] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:46 INFO - --DOMWINDOW == 28 (0x122ea7c00) [pid = 1722] [serial = 965] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:46 INFO - --DOMWINDOW == 27 (0x11ee55800) [pid = 1722] [serial = 960] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20588342] 04:00:46 INFO - --DOMWINDOW == 26 (0x113445000) [pid = 1722] [serial = 958] [outer = 0x0] [url = about:blank] 04:00:46 INFO - MEMORY STAT | vsize 3469MB | residentFast 465MB | heapAllocated 120MB 04:00:46 INFO - 227 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588730_text_node_insertion.js | took 2165ms 04:00:46 INFO - ++DOCSHELL 0x112cc9000 == 12 [pid = 1722] [id = 417] 04:00:46 INFO - ++DOMWINDOW == 27 (0x113445800) [pid = 1722] [serial = 977] [outer = 0x0] 04:00:46 INFO - ++DOMWINDOW == 28 (0x11344dc00) [pid = 1722] [serial = 978] [outer = 0x113445800] 04:00:46 INFO - 228 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588967_input_expansion.js 04:00:46 INFO - ++DOCSHELL 0x120ea4800 == 13 [pid = 1722] [id = 418] 04:00:46 INFO - ++DOMWINDOW == 29 (0x11ebbb800) [pid = 1722] [serial = 979] [outer = 0x0] 04:00:46 INFO - ++DOMWINDOW == 30 (0x11eef3c00) [pid = 1722] [serial = 980] [outer = 0x11ebbb800] 04:00:46 INFO - ++DOMWINDOW == 31 (0x1245bb800) [pid = 1722] [serial = 981] [outer = 0x11ebbb800] 04:00:46 INFO - ++DOCSHELL 0x112ccf000 == 14 [pid = 1722] [id = 419] 04:00:46 INFO - ++DOMWINDOW == 32 (0x120fee400) [pid = 1722] [serial = 982] [outer = 0x0] 04:00:46 INFO - ++DOMWINDOW == 33 (0x120ff3000) [pid = 1722] [serial = 983] [outer = 0x120fee400] 04:00:46 INFO - ++DOMWINDOW == 34 (0x121315c00) [pid = 1722] [serial = 984] [outer = 0x120fee400] 04:00:46 INFO - ++DOCSHELL 0x129381800 == 15 [pid = 1722] [id = 420] 04:00:46 INFO - ++DOMWINDOW == 35 (0x122ea7800) [pid = 1722] [serial = 985] [outer = 0x0] 04:00:46 INFO - ++DOMWINDOW == 36 (0x124341000) [pid = 1722] [serial = 986] [outer = 0x122ea7800] 04:00:48 INFO - --DOCSHELL 0x1128cb000 == 14 [pid = 1722] [id = 413] 04:00:48 INFO - --DOCSHELL 0x129381800 == 13 [pid = 1722] [id = 420] 04:00:48 INFO - --DOCSHELL 0x11f647800 == 12 [pid = 1722] [id = 414] 04:00:48 INFO - --DOCSHELL 0x112cc6800 == 11 [pid = 1722] [id = 415] 04:00:48 INFO - --DOMWINDOW == 35 (0x1240dd400) [pid = 1722] [serial = 966] [outer = 0x0] [url = about:blank] 04:00:48 INFO - --DOMWINDOW == 34 (0x121317400) [pid = 1722] [serial = 964] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:48 INFO - --DOMWINDOW == 33 (0x11eef3c00) [pid = 1722] [serial = 980] [outer = 0x0] [url = about:blank] 04:00:48 INFO - --DOMWINDOW == 32 (0x11344c800) [pid = 1722] [serial = 968] [outer = 0x0] [url = about:blank] 04:00:48 INFO - --DOMWINDOW == 31 (0x120ff3000) [pid = 1722] [serial = 983] [outer = 0x0] [url = about:blank] 04:00:48 INFO - --DOMWINDOW == 30 (0x120e30800) [pid = 1722] [serial = 972] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:48 INFO - --DOMWINDOW == 29 (0x122ea7000) [pid = 1722] [serial = 975] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:48 INFO - --DOMWINDOW == 28 (0x11ebb7800) [pid = 1722] [serial = 969] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:48 INFO - --DOMWINDOW == 27 (0x113447000) [pid = 1722] [serial = 967] [outer = 0x0] [url = about:blank] 04:00:48 INFO - --DOMWINDOW == 26 (0x122124000) [pid = 1722] [serial = 971] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:48 INFO - MEMORY STAT | vsize 3470MB | residentFast 466MB | heapAllocated 121MB 04:00:48 INFO - 229 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588967_input_expansion.js | took 2237ms 04:00:48 INFO - ++DOCSHELL 0x112cb7800 == 12 [pid = 1722] [id = 421] 04:00:48 INFO - ++DOMWINDOW == 27 (0x113447000) [pid = 1722] [serial = 987] [outer = 0x0] 04:00:48 INFO - ++DOMWINDOW == 28 (0x114b63000) [pid = 1722] [serial = 988] [outer = 0x113447000] 04:00:48 INFO - 230 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_589162_css_filter.js 04:00:48 INFO - ++DOCSHELL 0x122384000 == 13 [pid = 1722] [id = 422] 04:00:48 INFO - ++DOMWINDOW == 29 (0x11eefb000) [pid = 1722] [serial = 989] [outer = 0x0] 04:00:48 INFO - ++DOMWINDOW == 30 (0x1203df400) [pid = 1722] [serial = 990] [outer = 0x11eefb000] 04:00:48 INFO - ++DOCSHELL 0x112ccd000 == 14 [pid = 1722] [id = 423] 04:00:48 INFO - ++DOMWINDOW == 31 (0x1203e2400) [pid = 1722] [serial = 991] [outer = 0x0] 04:00:48 INFO - ++DOMWINDOW == 32 (0x120fe0400) [pid = 1722] [serial = 992] [outer = 0x1203e2400] 04:00:49 INFO - ++DOMWINDOW == 33 (0x112f41800) [pid = 1722] [serial = 993] [outer = 0x1203e2400] 04:00:49 INFO - ++DOCSHELL 0x129382800 == 15 [pid = 1722] [id = 424] 04:00:49 INFO - ++DOMWINDOW == 34 (0x1240d0000) [pid = 1722] [serial = 994] [outer = 0x0] 04:00:49 INFO - ++DOMWINDOW == 35 (0x124394400) [pid = 1722] [serial = 995] [outer = 0x1240d0000] 04:00:49 INFO - ++DOMWINDOW == 36 (0x126485400) [pid = 1722] [serial = 996] [outer = 0x11eefb000] 04:00:50 INFO - --DOCSHELL 0x120ea4800 == 14 [pid = 1722] [id = 418] 04:00:50 INFO - --DOCSHELL 0x112cc9000 == 13 [pid = 1722] [id = 417] 04:00:50 INFO - --DOCSHELL 0x129382800 == 12 [pid = 1722] [id = 424] 04:00:50 INFO - --DOCSHELL 0x112ccf000 == 11 [pid = 1722] [id = 419] 04:00:50 INFO - --DOMWINDOW == 35 (0x1240d8c00) [pid = 1722] [serial = 976] [outer = 0x0] [url = about:blank] 04:00:50 INFO - --DOMWINDOW == 34 (0x121316c00) [pid = 1722] [serial = 974] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:50 INFO - --DOMWINDOW == 33 (0x120fe0400) [pid = 1722] [serial = 992] [outer = 0x0] [url = about:blank] 04:00:50 INFO - --DOMWINDOW == 32 (0x11344dc00) [pid = 1722] [serial = 978] [outer = 0x0] [url = about:blank] 04:00:50 INFO - --DOMWINDOW == 31 (0x1203df400) [pid = 1722] [serial = 990] [outer = 0x0] [url = about:blank] 04:00:50 INFO - --DOMWINDOW == 30 (0x120fee400) [pid = 1722] [serial = 982] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:50 INFO - --DOMWINDOW == 29 (0x122ea7800) [pid = 1722] [serial = 985] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:50 INFO - --DOMWINDOW == 28 (0x11ebbb800) [pid = 1722] [serial = 979] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:50 INFO - --DOMWINDOW == 27 (0x113445800) [pid = 1722] [serial = 977] [outer = 0x0] [url = about:blank] 04:00:50 INFO - --DOMWINDOW == 26 (0x1245bb800) [pid = 1722] [serial = 981] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:50 INFO - MEMORY STAT | vsize 3469MB | residentFast 465MB | heapAllocated 121MB 04:00:50 INFO - 231 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_589162_css_filter.js | took 2164ms 04:00:50 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 425] 04:00:50 INFO - ++DOMWINDOW == 27 (0x11344a800) [pid = 1722] [serial = 997] [outer = 0x0] 04:00:50 INFO - ++DOMWINDOW == 28 (0x11e789400) [pid = 1722] [serial = 998] [outer = 0x11344a800] 04:00:51 INFO - 232 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_592442_closing_brackets.js 04:00:51 INFO - ++DOCSHELL 0x120e10800 == 13 [pid = 1722] [id = 426] 04:00:51 INFO - ++DOMWINDOW == 29 (0x11ef14800) [pid = 1722] [serial = 999] [outer = 0x0] 04:00:51 INFO - ++DOMWINDOW == 30 (0x1203df800) [pid = 1722] [serial = 1000] [outer = 0x11ef14800] 04:00:51 INFO - ++DOCSHELL 0x112cc2800 == 14 [pid = 1722] [id = 427] 04:00:51 INFO - ++DOMWINDOW == 31 (0x120d16400) [pid = 1722] [serial = 1001] [outer = 0x0] 04:00:51 INFO - ++DOMWINDOW == 32 (0x120fe6400) [pid = 1722] [serial = 1002] [outer = 0x120d16400] 04:00:51 INFO - ++DOMWINDOW == 33 (0x1214aac00) [pid = 1722] [serial = 1003] [outer = 0x120d16400] 04:00:51 INFO - ++DOCSHELL 0x129388800 == 15 [pid = 1722] [id = 428] 04:00:51 INFO - ++DOMWINDOW == 34 (0x1240da400) [pid = 1722] [serial = 1004] [outer = 0x0] 04:00:51 INFO - ++DOMWINDOW == 35 (0x124394800) [pid = 1722] [serial = 1005] [outer = 0x1240da400] 04:00:52 INFO - --DOCSHELL 0x122384000 == 14 [pid = 1722] [id = 422] 04:00:52 INFO - --DOCSHELL 0x112cb7800 == 13 [pid = 1722] [id = 421] 04:00:52 INFO - --DOCSHELL 0x129388800 == 12 [pid = 1722] [id = 428] 04:00:52 INFO - --DOCSHELL 0x112ccd000 == 11 [pid = 1722] [id = 423] 04:00:52 INFO - --DOMWINDOW == 34 (0x124341000) [pid = 1722] [serial = 986] [outer = 0x0] [url = about:blank] 04:00:52 INFO - --DOMWINDOW == 33 (0x121315c00) [pid = 1722] [serial = 984] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:52 INFO - --DOMWINDOW == 32 (0x126485400) [pid = 1722] [serial = 996] [outer = 0x0] [url = data:text/html;charset=utf-8,<div%20style='font-size:3em;foobarCssParser:baz'>test%20CSS%20parser%20filter</div>] 04:00:52 INFO - --DOMWINDOW == 31 (0x114b63000) [pid = 1722] [serial = 988] [outer = 0x0] [url = about:blank] 04:00:52 INFO - --DOMWINDOW == 30 (0x120fe6400) [pid = 1722] [serial = 1002] [outer = 0x0] [url = about:blank] 04:00:52 INFO - --DOMWINDOW == 29 (0x1203e2400) [pid = 1722] [serial = 991] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:52 INFO - --DOMWINDOW == 28 (0x1240d0000) [pid = 1722] [serial = 994] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:52 INFO - --DOMWINDOW == 27 (0x11eefb000) [pid = 1722] [serial = 989] [outer = 0x0] [url = data:text/html;charset=utf-8,<div%20style='font-size:3em;foobarCssParser:baz'>test%20CSS%20parser%20filter</div>] 04:00:52 INFO - --DOMWINDOW == 26 (0x113447000) [pid = 1722] [serial = 987] [outer = 0x0] [url = about:blank] 04:00:53 INFO - MEMORY STAT | vsize 3469MB | residentFast 465MB | heapAllocated 120MB 04:00:53 INFO - 233 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_592442_closing_brackets.js | took 2023ms 04:00:53 INFO - ++DOCSHELL 0x112cc8000 == 12 [pid = 1722] [id = 429] 04:00:53 INFO - ++DOMWINDOW == 27 (0x113445000) [pid = 1722] [serial = 1006] [outer = 0x0] 04:00:53 INFO - ++DOMWINDOW == 28 (0x11344d000) [pid = 1722] [serial = 1007] [outer = 0x113445000] 04:00:53 INFO - 234 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_593003_iframe_wrong_hud.js 04:00:53 INFO - ++DOCSHELL 0x120ead800 == 13 [pid = 1722] [id = 430] 04:00:53 INFO - ++DOMWINDOW == 29 (0x11ec99000) [pid = 1722] [serial = 1008] [outer = 0x0] 04:00:53 INFO - ++DOMWINDOW == 30 (0x11ef4a000) [pid = 1722] [serial = 1009] [outer = 0x11ec99000] 04:00:53 INFO - ++DOMWINDOW == 31 (0x120e26800) [pid = 1722] [serial = 1010] [outer = 0x11ec99000] 04:00:53 INFO - ++DOCSHELL 0x112bb2800 == 14 [pid = 1722] [id = 431] 04:00:53 INFO - ++DOMWINDOW == 32 (0x110d5b000) [pid = 1722] [serial = 1011] [outer = 0x0] 04:00:53 INFO - ++DOMWINDOW == 33 (0x12130e000) [pid = 1722] [serial = 1012] [outer = 0x110d5b000] 04:00:53 INFO - ++DOCSHELL 0x125712800 == 15 [pid = 1722] [id = 432] 04:00:53 INFO - ++DOMWINDOW == 34 (0x11288c800) [pid = 1722] [serial = 1013] [outer = 0x0] 04:00:53 INFO - ++DOMWINDOW == 35 (0x1214ab800) [pid = 1722] [serial = 1014] [outer = 0x11288c800] 04:00:53 INFO - ++DOMWINDOW == 36 (0x12152b400) [pid = 1722] [serial = 1015] [outer = 0x11288c800] 04:00:53 INFO - ++DOCSHELL 0x129659000 == 16 [pid = 1722] [id = 433] 04:00:53 INFO - ++DOMWINDOW == 37 (0x1245be400) [pid = 1722] [serial = 1016] [outer = 0x0] 04:00:53 INFO - ++DOMWINDOW == 38 (0x1247be000) [pid = 1722] [serial = 1017] [outer = 0x1245be400] 04:00:54 INFO - ++DOCSHELL 0x12c258800 == 17 [pid = 1722] [id = 434] 04:00:54 INFO - ++DOMWINDOW == 39 (0x112f40400) [pid = 1722] [serial = 1018] [outer = 0x0] 04:00:54 INFO - ++DOMWINDOW == 40 (0x1264b5800) [pid = 1722] [serial = 1019] [outer = 0x112f40400] 04:00:54 INFO - ++DOMWINDOW == 41 (0x128387400) [pid = 1722] [serial = 1020] [outer = 0x112f40400] 04:00:54 INFO - ++DOCSHELL 0x129673000 == 18 [pid = 1722] [id = 435] 04:00:54 INFO - ++DOMWINDOW == 42 (0x1264a8800) [pid = 1722] [serial = 1021] [outer = 0x0] 04:00:54 INFO - ++DOMWINDOW == 43 (0x1264abc00) [pid = 1722] [serial = 1022] [outer = 0x1264a8800] 04:00:54 INFO - ++DOMWINDOW == 44 (0x1273e1400) [pid = 1722] [serial = 1023] [outer = 0x1264a8800] 04:00:54 INFO - ++DOCSHELL 0x12f110800 == 19 [pid = 1722] [id = 436] 04:00:54 INFO - ++DOMWINDOW == 45 (0x126243800) [pid = 1722] [serial = 1024] [outer = 0x0] 04:00:54 INFO - ++DOMWINDOW == 46 (0x12837d800) [pid = 1722] [serial = 1025] [outer = 0x126243800] 04:00:55 INFO - ++DOMWINDOW == 47 (0x1283f9000) [pid = 1722] [serial = 1026] [outer = 0x11ec99000] 04:00:55 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:00:55 INFO - ++DOCSHELL 0x12c26d000 == 20 [pid = 1722] [id = 437] 04:00:55 INFO - ++DOMWINDOW == 48 (0x12c373400) [pid = 1722] [serial = 1027] [outer = 0x0] 04:00:55 INFO - ++DOMWINDOW == 49 (0x12c378400) [pid = 1722] [serial = 1028] [outer = 0x12c373400] 04:00:55 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:00:56 INFO - --DOCSHELL 0x120e10800 == 19 [pid = 1722] [id = 426] 04:00:56 INFO - --DOCSHELL 0x112cc2800 == 18 [pid = 1722] [id = 427] 04:00:56 INFO - --DOCSHELL 0x112cc4000 == 17 [pid = 1722] [id = 425] 04:00:56 INFO - --DOCSHELL 0x12f110800 == 16 [pid = 1722] [id = 436] 04:00:56 INFO - --DOMWINDOW == 48 (0x124394400) [pid = 1722] [serial = 995] [outer = 0x0] [url = about:blank] 04:00:56 INFO - --DOMWINDOW == 47 (0x112f41800) [pid = 1722] [serial = 993] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:56 INFO - --DOMWINDOW == 46 (0x120d16400) [pid = 1722] [serial = 1001] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:56 INFO - --DOMWINDOW == 45 (0x1240da400) [pid = 1722] [serial = 1004] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:56 INFO - --DOMWINDOW == 44 (0x11ef14800) [pid = 1722] [serial = 999] [outer = 0x0] [url = data:text/html;charset=utf-8,test%20for%20bug%20592442] 04:00:56 INFO - --DOMWINDOW == 43 (0x11344a800) [pid = 1722] [serial = 997] [outer = 0x0] [url = about:blank] 04:00:56 INFO - --DOMWINDOW == 42 (0x1264b5800) [pid = 1722] [serial = 1019] [outer = 0x0] [url = about:blank] 04:00:56 INFO - --DOMWINDOW == 41 (0x11ef4a000) [pid = 1722] [serial = 1009] [outer = 0x0] [url = about:blank] 04:00:56 INFO - --DOMWINDOW == 40 (0x1203df800) [pid = 1722] [serial = 1000] [outer = 0x0] [url = about:blank] 04:00:56 INFO - --DOMWINDOW == 39 (0x11e789400) [pid = 1722] [serial = 998] [outer = 0x0] [url = about:blank] 04:00:56 INFO - --DOMWINDOW == 38 (0x1264abc00) [pid = 1722] [serial = 1022] [outer = 0x0] [url = about:blank] 04:00:56 INFO - --DOMWINDOW == 37 (0x1214ab800) [pid = 1722] [serial = 1014] [outer = 0x0] [url = about:blank] 04:00:56 INFO - --DOMWINDOW == 36 (0x110d5b000) [pid = 1722] [serial = 1011] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html] 04:00:56 INFO - --DOCSHELL 0x129659000 == 15 [pid = 1722] [id = 433] 04:00:56 INFO - --DOMWINDOW == 35 (0x12130e000) [pid = 1722] [serial = 1012] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html] 04:00:56 INFO - --DOMWINDOW == 34 (0x120e26800) [pid = 1722] [serial = 1010] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html] 04:00:57 INFO - --DOCSHELL 0x112bb2800 == 14 [pid = 1722] [id = 431] 04:00:57 INFO - --DOCSHELL 0x125712800 == 13 [pid = 1722] [id = 432] 04:00:57 INFO - --DOCSHELL 0x129673000 == 12 [pid = 1722] [id = 435] 04:00:57 INFO - --DOCSHELL 0x12c258800 == 11 [pid = 1722] [id = 434] 04:00:57 INFO - --DOMWINDOW == 33 (0x1214aac00) [pid = 1722] [serial = 1003] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:57 INFO - --DOMWINDOW == 32 (0x124394800) [pid = 1722] [serial = 1005] [outer = 0x0] [url = about:blank] 04:00:57 INFO - --DOMWINDOW == 31 (0x112f40400) [pid = 1722] [serial = 1018] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:57 INFO - --DOMWINDOW == 30 (0x1264a8800) [pid = 1722] [serial = 1021] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:57 INFO - --DOMWINDOW == 29 (0x126243800) [pid = 1722] [serial = 1024] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:57 INFO - --DOCSHELL 0x12c26d000 == 10 [pid = 1722] [id = 437] 04:00:57 INFO - --DOMWINDOW == 28 (0x128387400) [pid = 1722] [serial = 1020] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:00:57 INFO - MEMORY STAT | vsize 3466MB | residentFast 463MB | heapAllocated 120MB 04:00:57 INFO - 235 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_593003_iframe_wrong_hud.js | took 4432ms 04:00:57 INFO - ++DOCSHELL 0x112cc8800 == 11 [pid = 1722] [id = 438] 04:00:57 INFO - ++DOMWINDOW == 29 (0x112f4ec00) [pid = 1722] [serial = 1029] [outer = 0x0] 04:00:57 INFO - ++DOMWINDOW == 30 (0x113447000) [pid = 1722] [serial = 1030] [outer = 0x112f4ec00] 04:00:57 INFO - 236 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_594497_history_arrow_keys.js 04:00:57 INFO - ++DOCSHELL 0x120dd6800 == 12 [pid = 1722] [id = 439] 04:00:57 INFO - ++DOMWINDOW == 31 (0x11ebb7c00) [pid = 1722] [serial = 1031] [outer = 0x0] 04:00:57 INFO - ++DOMWINDOW == 32 (0x11ee17000) [pid = 1722] [serial = 1032] [outer = 0x11ebb7c00] 04:00:57 INFO - ++DOCSHELL 0x120e0e800 == 13 [pid = 1722] [id = 440] 04:00:57 INFO - ++DOMWINDOW == 33 (0x11266e800) [pid = 1722] [serial = 1033] [outer = 0x0] 04:00:57 INFO - ++DOMWINDOW == 34 (0x120e23400) [pid = 1722] [serial = 1034] [outer = 0x11266e800] 04:00:58 INFO - ++DOMWINDOW == 35 (0x121115800) [pid = 1722] [serial = 1035] [outer = 0x11266e800] 04:00:58 INFO - ++DOCSHELL 0x129371800 == 14 [pid = 1722] [id = 441] 04:00:58 INFO - ++DOMWINDOW == 36 (0x121828800) [pid = 1722] [serial = 1036] [outer = 0x0] 04:00:58 INFO - ++DOMWINDOW == 37 (0x122121400) [pid = 1722] [serial = 1037] [outer = 0x121828800] 04:00:59 INFO - --DOCSHELL 0x120ead800 == 13 [pid = 1722] [id = 430] 04:00:59 INFO - --DOCSHELL 0x129371800 == 12 [pid = 1722] [id = 441] 04:00:59 INFO - --DOCSHELL 0x112cc8000 == 11 [pid = 1722] [id = 429] 04:00:59 INFO - --DOMWINDOW == 36 (0x12837d800) [pid = 1722] [serial = 1025] [outer = 0x0] [url = about:blank] 04:00:59 INFO - --DOMWINDOW == 35 (0x1273e1400) [pid = 1722] [serial = 1023] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:59 INFO - --DOMWINDOW == 34 (0x11344d000) [pid = 1722] [serial = 1007] [outer = 0x0] [url = about:blank] 04:00:59 INFO - --DOMWINDOW == 33 (0x120e23400) [pid = 1722] [serial = 1034] [outer = 0x0] [url = about:blank] 04:00:59 INFO - --DOMWINDOW == 32 (0x11288c800) [pid = 1722] [serial = 1013] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:00:59 INFO - --DOMWINDOW == 31 (0x1245be400) [pid = 1722] [serial = 1016] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:00:59 INFO - --DOMWINDOW == 30 (0x12c373400) [pid = 1722] [serial = 1027] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html] 04:00:59 INFO - --DOMWINDOW == 29 (0x11ec99000) [pid = 1722] [serial = 1008] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html] 04:00:59 INFO - --DOMWINDOW == 28 (0x113445000) [pid = 1722] [serial = 1006] [outer = 0x0] [url = about:blank] 04:00:59 INFO - --DOMWINDOW == 27 (0x12c378400) [pid = 1722] [serial = 1028] [outer = 0x0] [url = about:blank] 04:00:59 INFO - --DOMWINDOW == 26 (0x1283f9000) [pid = 1722] [serial = 1026] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html] 04:01:00 INFO - MEMORY STAT | vsize 3468MB | residentFast 464MB | heapAllocated 121MB 04:01:00 INFO - 237 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_594497_history_arrow_keys.js | took 2225ms 04:01:00 INFO - ++DOCSHELL 0x112cd4800 == 12 [pid = 1722] [id = 442] 04:01:00 INFO - ++DOMWINDOW == 27 (0x113443400) [pid = 1722] [serial = 1038] [outer = 0x0] 04:01:00 INFO - ++DOMWINDOW == 28 (0x11344ac00) [pid = 1722] [serial = 1039] [outer = 0x113443400] 04:01:00 INFO - 238 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595223_file_uri.js 04:01:00 INFO - ++DOCSHELL 0x124f0a000 == 13 [pid = 1722] [id = 443] 04:01:00 INFO - ++DOMWINDOW == 29 (0x11ebba400) [pid = 1722] [serial = 1040] [outer = 0x0] 04:01:00 INFO - ++DOMWINDOW == 30 (0x11f5cd000) [pid = 1722] [serial = 1041] [outer = 0x11ebba400] 04:01:00 INFO - ++DOCSHELL 0x112cce000 == 14 [pid = 1722] [id = 444] 04:01:00 INFO - ++DOMWINDOW == 31 (0x11318d800) [pid = 1722] [serial = 1042] [outer = 0x0] 04:01:00 INFO - ++DOMWINDOW == 32 (0x120ff2800) [pid = 1722] [serial = 1043] [outer = 0x11318d800] 04:01:00 INFO - ++DOMWINDOW == 33 (0x121316c00) [pid = 1722] [serial = 1044] [outer = 0x11318d800] 04:01:00 INFO - ++DOCSHELL 0x1293de000 == 15 [pid = 1722] [id = 445] 04:01:00 INFO - ++DOMWINDOW == 34 (0x122ea3000) [pid = 1722] [serial = 1045] [outer = 0x0] 04:01:00 INFO - ++DOMWINDOW == 35 (0x122ea5c00) [pid = 1722] [serial = 1046] [outer = 0x122ea3000] 04:01:01 INFO - ++DOMWINDOW == 36 (0x1283ed400) [pid = 1722] [serial = 1047] [outer = 0x11ebba400] 04:01:02 INFO - --DOCSHELL 0x112cc8800 == 14 [pid = 1722] [id = 438] 04:01:02 INFO - --DOCSHELL 0x120dd6800 == 13 [pid = 1722] [id = 439] 04:01:02 INFO - --DOCSHELL 0x120e0e800 == 12 [pid = 1722] [id = 440] 04:01:02 INFO - --DOCSHELL 0x1293de000 == 11 [pid = 1722] [id = 445] 04:01:02 INFO - --DOMWINDOW == 35 (0x1247be000) [pid = 1722] [serial = 1017] [outer = 0x0] [url = about:blank] 04:01:02 INFO - --DOMWINDOW == 34 (0x12152b400) [pid = 1722] [serial = 1015] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:02 INFO - --DOMWINDOW == 33 (0x11ee17000) [pid = 1722] [serial = 1032] [outer = 0x0] [url = about:blank] 04:01:02 INFO - --DOMWINDOW == 32 (0x113447000) [pid = 1722] [serial = 1030] [outer = 0x0] [url = about:blank] 04:01:02 INFO - --DOMWINDOW == 31 (0x120ff2800) [pid = 1722] [serial = 1043] [outer = 0x0] [url = about:blank] 04:01:02 INFO - --DOMWINDOW == 30 (0x121828800) [pid = 1722] [serial = 1036] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:02 INFO - --DOMWINDOW == 29 (0x11266e800) [pid = 1722] [serial = 1033] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:02 INFO - --DOMWINDOW == 28 (0x11ebb7c00) [pid = 1722] [serial = 1031] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20594497%20and%20bug%20619598] 04:01:02 INFO - --DOMWINDOW == 27 (0x112f4ec00) [pid = 1722] [serial = 1029] [outer = 0x0] [url = about:blank] 04:01:02 INFO - MEMORY STAT | vsize 3470MB | residentFast 467MB | heapAllocated 122MB 04:01:02 INFO - 239 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595223_file_uri.js | took 2352ms 04:01:02 INFO - ++DOCSHELL 0x112e7c000 == 12 [pid = 1722] [id = 446] 04:01:02 INFO - ++DOMWINDOW == 28 (0x11ebb7800) [pid = 1722] [serial = 1048] [outer = 0x0] 04:01:02 INFO - ++DOMWINDOW == 29 (0x11ee57c00) [pid = 1722] [serial = 1049] [outer = 0x11ebb7800] 04:01:02 INFO - 240 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595350_multiple_windows_and_tabs.js 04:01:02 INFO - ++DOCSHELL 0x124f1f000 == 13 [pid = 1722] [id = 447] 04:01:02 INFO - ++DOMWINDOW == 30 (0x120e24800) [pid = 1722] [serial = 1050] [outer = 0x0] 04:01:02 INFO - ++DOMWINDOW == 31 (0x120e31c00) [pid = 1722] [serial = 1051] [outer = 0x120e24800] 04:01:02 INFO - ++DOCSHELL 0x1252f1000 == 14 [pid = 1722] [id = 448] 04:01:02 INFO - ++DOMWINDOW == 32 (0x12110b400) [pid = 1722] [serial = 1052] [outer = 0x0] 04:01:02 INFO - ++DOMWINDOW == 33 (0x121161400) [pid = 1722] [serial = 1053] [outer = 0x12110b400] 04:01:02 INFO - ++DOCSHELL 0x129386000 == 15 [pid = 1722] [id = 449] 04:01:02 INFO - ++DOMWINDOW == 34 (0x121312800) [pid = 1722] [serial = 1054] [outer = 0x0] 04:01:02 INFO - ++DOMWINDOW == 35 (0x121315000) [pid = 1722] [serial = 1055] [outer = 0x121312800] 04:01:02 INFO - ++DOCSHELL 0x11ee2e800 == 16 [pid = 1722] [id = 450] 04:01:02 INFO - ++DOMWINDOW == 36 (0x122e9c000) [pid = 1722] [serial = 1056] [outer = 0x0] 04:01:02 INFO - ++DOCSHELL 0x129659800 == 17 [pid = 1722] [id = 451] 04:01:02 INFO - ++DOMWINDOW == 37 (0x122e9d800) [pid = 1722] [serial = 1057] [outer = 0x0] 04:01:02 INFO - ++DOMWINDOW == 38 (0x122e9f800) [pid = 1722] [serial = 1058] [outer = 0x122e9d800] 04:01:02 INFO - ++DOCSHELL 0x12c448800 == 18 [pid = 1722] [id = 452] 04:01:02 INFO - ++DOMWINDOW == 39 (0x122e9bc00) [pid = 1722] [serial = 1059] [outer = 0x0] 04:01:03 INFO - ++DOMWINDOW == 40 (0x126242c00) [pid = 1722] [serial = 1060] [outer = 0x122e9bc00] 04:01:03 INFO - ++DOMWINDOW == 41 (0x113444800) [pid = 1722] [serial = 1061] [outer = 0x122e9c000] 04:01:03 INFO - ++DOMWINDOW == 42 (0x113445800) [pid = 1722] [serial = 1062] [outer = 0x122e9d800] 04:01:03 INFO - ++DOMWINDOW == 43 (0x1264b7800) [pid = 1722] [serial = 1063] [outer = 0x122e9bc00] 04:01:03 INFO - ++DOCSHELL 0x12f124800 == 19 [pid = 1722] [id = 453] 04:01:03 INFO - ++DOMWINDOW == 44 (0x121805800) [pid = 1722] [serial = 1064] [outer = 0x0] 04:01:03 INFO - ++DOMWINDOW == 45 (0x1273e5800) [pid = 1722] [serial = 1065] [outer = 0x121805800] 04:01:03 INFO - ++DOCSHELL 0x1293d0000 == 20 [pid = 1722] [id = 454] 04:01:03 INFO - ++DOMWINDOW == 46 (0x121311000) [pid = 1722] [serial = 1066] [outer = 0x0] 04:01:03 INFO - ++DOMWINDOW == 47 (0x12837d000) [pid = 1722] [serial = 1067] [outer = 0x121311000] 04:01:03 INFO - ++DOCSHELL 0x112619800 == 21 [pid = 1722] [id = 455] 04:01:03 INFO - ++DOMWINDOW == 48 (0x12938f800) [pid = 1722] [serial = 1068] [outer = 0x0] 04:01:03 INFO - ++DOMWINDOW == 49 (0x129390000) [pid = 1722] [serial = 1069] [outer = 0x12938f800] 04:01:03 INFO - ++DOCSHELL 0x12fdd3000 == 22 [pid = 1722] [id = 456] 04:01:03 INFO - ++DOMWINDOW == 50 (0x121810c00) [pid = 1722] [serial = 1070] [outer = 0x0] 04:01:03 INFO - ++DOMWINDOW == 51 (0x121828800) [pid = 1722] [serial = 1071] [outer = 0x121810c00] 04:01:03 INFO - ++DOCSHELL 0x11ec5b800 == 23 [pid = 1722] [id = 457] 04:01:03 INFO - ++DOMWINDOW == 52 (0x1247cb400) [pid = 1722] [serial = 1072] [outer = 0x0] 04:01:03 INFO - ++DOMWINDOW == 53 (0x12c4e8400) [pid = 1722] [serial = 1073] [outer = 0x1247cb400] 04:01:04 INFO - ++DOCSHELL 0x13019e000 == 24 [pid = 1722] [id = 458] 04:01:04 INFO - ++DOMWINDOW == 54 (0x129396c00) [pid = 1722] [serial = 1074] [outer = 0x0] 04:01:04 INFO - ++DOMWINDOW == 55 (0x1296ccc00) [pid = 1722] [serial = 1075] [outer = 0x129396c00] 04:01:04 INFO - ++DOCSHELL 0x1293d6800 == 25 [pid = 1722] [id = 459] 04:01:04 INFO - ++DOMWINDOW == 56 (0x1245b9000) [pid = 1722] [serial = 1076] [outer = 0x0] 04:01:04 INFO - ++DOMWINDOW == 57 (0x12dd19000) [pid = 1722] [serial = 1077] [outer = 0x1245b9000] 04:01:04 INFO - ++DOMWINDOW == 58 (0x12f1b6400) [pid = 1722] [serial = 1078] [outer = 0x1245b9000] 04:01:04 INFO - ++DOMWINDOW == 59 (0x12f795400) [pid = 1722] [serial = 1079] [outer = 0x12938f800] 04:01:04 INFO - ++DOMWINDOW == 60 (0x12c3a5c00) [pid = 1722] [serial = 1080] [outer = 0x121810c00] 04:01:04 INFO - ++DOMWINDOW == 61 (0x110e32400) [pid = 1722] [serial = 1081] [outer = 0x1247cb400] 04:01:04 INFO - ++DOMWINDOW == 62 (0x130b71800) [pid = 1722] [serial = 1082] [outer = 0x129396c00] 04:01:04 INFO - ++DOCSHELL 0x137575800 == 26 [pid = 1722] [id = 460] 04:01:04 INFO - ++DOMWINDOW == 63 (0x130bc0000) [pid = 1722] [serial = 1083] [outer = 0x0] 04:01:04 INFO - ++DOMWINDOW == 64 (0x130bc2000) [pid = 1722] [serial = 1084] [outer = 0x130bc0000] 04:01:04 INFO - ++DOCSHELL 0x1301ae000 == 27 [pid = 1722] [id = 461] 04:01:04 INFO - ++DOMWINDOW == 65 (0x12826b800) [pid = 1722] [serial = 1085] [outer = 0x0] 04:01:04 INFO - ++DOMWINDOW == 66 (0x12826d800) [pid = 1722] [serial = 1086] [outer = 0x12826b800] 04:01:05 INFO - ++DOCSHELL 0x137567000 == 28 [pid = 1722] [id = 462] 04:01:05 INFO - ++DOMWINDOW == 67 (0x128273400) [pid = 1722] [serial = 1087] [outer = 0x0] 04:01:05 INFO - ++DOMWINDOW == 68 (0x128275c00) [pid = 1722] [serial = 1088] [outer = 0x128273400] 04:01:05 INFO - ++DOCSHELL 0x113454800 == 29 [pid = 1722] [id = 463] 04:01:05 INFO - ++DOMWINDOW == 69 (0x128278000) [pid = 1722] [serial = 1089] [outer = 0x0] 04:01:05 INFO - ++DOMWINDOW == 70 (0x128387800) [pid = 1722] [serial = 1090] [outer = 0x128278000] 04:01:08 INFO - MEMORY STAT | vsize 3502MB | residentFast 485MB | heapAllocated 147MB 04:01:08 INFO - 241 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595350_multiple_windows_and_tabs.js | took 5879ms 04:01:08 INFO - ++DOCSHELL 0x11346a800 == 30 [pid = 1722] [id = 464] 04:01:08 INFO - ++DOMWINDOW == 71 (0x1247c4800) [pid = 1722] [serial = 1091] [outer = 0x0] 04:01:08 INFO - ++DOMWINDOW == 72 (0x124c30000) [pid = 1722] [serial = 1092] [outer = 0x1247c4800] 04:01:08 INFO - 242 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595934_message_categories.js 04:01:08 INFO - ++DOCSHELL 0x1252f6800 == 31 [pid = 1722] [id = 465] 04:01:08 INFO - ++DOMWINDOW == 73 (0x128272400) [pid = 1722] [serial = 1093] [outer = 0x0] 04:01:08 INFO - ++DOMWINDOW == 74 (0x128384c00) [pid = 1722] [serial = 1094] [outer = 0x128272400] 04:01:08 INFO - ++DOCSHELL 0x12f23a800 == 32 [pid = 1722] [id = 466] 04:01:08 INFO - ++DOMWINDOW == 75 (0x128386000) [pid = 1722] [serial = 1095] [outer = 0x0] 04:01:08 INFO - ++DOMWINDOW == 76 (0x12838ac00) [pid = 1722] [serial = 1096] [outer = 0x128386000] 04:01:09 INFO - ++DOMWINDOW == 77 (0x12706d800) [pid = 1722] [serial = 1097] [outer = 0x128386000] 04:01:09 INFO - ++DOCSHELL 0x12fdd1800 == 33 [pid = 1722] [id = 467] 04:01:09 INFO - ++DOMWINDOW == 78 (0x12c21dc00) [pid = 1722] [serial = 1098] [outer = 0x0] 04:01:09 INFO - ++DOMWINDOW == 79 (0x12c21fc00) [pid = 1722] [serial = 1099] [outer = 0x12c21dc00] 04:01:10 INFO - ++DOMWINDOW == 80 (0x128304400) [pid = 1722] [serial = 1100] [outer = 0x128272400] 04:01:10 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:10 INFO - ++DOMWINDOW == 81 (0x13754fc00) [pid = 1722] [serial = 1101] [outer = 0x128272400] 04:01:10 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:10 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 04:01:11 INFO - ++DOMWINDOW == 82 (0x12e066c00) [pid = 1722] [serial = 1102] [outer = 0x128272400] 04:01:11 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:11 INFO - JavaScript error: resource://gre/modules/LoginManagerParent.jsm, line 185: TypeError: this._recipeManager is null 04:01:11 INFO - ++DOMWINDOW == 83 (0x12e062000) [pid = 1722] [serial = 1103] [outer = 0x128272400] 04:01:11 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:12 INFO - ++DOMWINDOW == 84 (0x12d407c00) [pid = 1722] [serial = 1104] [outer = 0x128272400] 04:01:12 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:12 INFO - ++DOMWINDOW == 85 (0x110d4d000) [pid = 1722] [serial = 1105] [outer = 0x128272400] 04:01:13 INFO - --DOCSHELL 0x112cce000 == 32 [pid = 1722] [id = 444] 04:01:13 INFO - --DOCSHELL 0x124f0a000 == 31 [pid = 1722] [id = 443] 04:01:13 INFO - --DOMWINDOW == 84 (0x122e9f800) [pid = 1722] [serial = 1058] [outer = 0x122e9d800] [url = about:blank] 04:01:13 INFO - ++DOMWINDOW == 85 (0x12623bc00) [pid = 1722] [serial = 1106] [outer = 0x128272400] 04:01:13 INFO - ++DOMWINDOW == 86 (0x128307800) [pid = 1722] [serial = 1107] [outer = 0x128272400] 04:01:13 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:13 INFO - ++DOMWINDOW == 87 (0x1283eb000) [pid = 1722] [serial = 1108] [outer = 0x128272400] 04:01:13 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:14 INFO - ++DOMWINDOW == 88 (0x1296cf000) [pid = 1722] [serial = 1109] [outer = 0x128272400] 04:01:14 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:14 INFO - ++DOMWINDOW == 89 (0x12e062800) [pid = 1722] [serial = 1110] [outer = 0x128272400] 04:01:14 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:14 INFO - ++DOMWINDOW == 90 (0x12f4d8400) [pid = 1722] [serial = 1111] [outer = 0x128272400] 04:01:14 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:15 INFO - --DOCSHELL 0x12fdd1800 == 30 [pid = 1722] [id = 467] 04:01:15 INFO - --DOCSHELL 0x112cd4800 == 29 [pid = 1722] [id = 442] 04:01:15 INFO - --DOCSHELL 0x112e7c000 == 28 [pid = 1722] [id = 446] 04:01:15 INFO - --DOCSHELL 0x124f1f000 == 27 [pid = 1722] [id = 447] 04:01:15 INFO - --DOCSHELL 0x1252f1000 == 26 [pid = 1722] [id = 448] 04:01:15 INFO - --DOCSHELL 0x112619800 == 25 [pid = 1722] [id = 455] 04:01:15 INFO - --DOCSHELL 0x1301ae000 == 24 [pid = 1722] [id = 461] 04:01:15 INFO - --DOCSHELL 0x137575800 == 23 [pid = 1722] [id = 460] 04:01:15 INFO - --DOCSHELL 0x12fdd3000 == 22 [pid = 1722] [id = 456] 04:01:15 INFO - --DOCSHELL 0x129386000 == 21 [pid = 1722] [id = 449] 04:01:15 INFO - --DOCSHELL 0x12c448800 == 20 [pid = 1722] [id = 452] 04:01:15 INFO - --DOCSHELL 0x113454800 == 19 [pid = 1722] [id = 463] 04:01:15 INFO - --DOCSHELL 0x1293d0000 == 18 [pid = 1722] [id = 454] 04:01:15 INFO - --DOCSHELL 0x11ee2e800 == 17 [pid = 1722] [id = 450] 04:01:15 INFO - --DOCSHELL 0x12f124800 == 16 [pid = 1722] [id = 453] 04:01:15 INFO - --DOCSHELL 0x137567000 == 15 [pid = 1722] [id = 462] 04:01:15 INFO - --DOCSHELL 0x129659800 == 14 [pid = 1722] [id = 451] 04:01:15 INFO - --DOCSHELL 0x11ec5b800 == 13 [pid = 1722] [id = 457] 04:01:15 INFO - --DOCSHELL 0x13019e000 == 12 [pid = 1722] [id = 458] 04:01:15 INFO - --DOCSHELL 0x1293d6800 == 11 [pid = 1722] [id = 459] 04:01:15 INFO - --DOMWINDOW == 89 (0x113444800) [pid = 1722] [serial = 1061] [outer = 0x122e9c000] [url = about:blank] 04:01:15 INFO - --DOMWINDOW == 88 (0x122121400) [pid = 1722] [serial = 1037] [outer = 0x0] [url = about:blank] 04:01:15 INFO - --DOMWINDOW == 87 (0x121115800) [pid = 1722] [serial = 1035] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:15 INFO - --DOMWINDOW == 86 (0x113445800) [pid = 1722] [serial = 1062] [outer = 0x122e9d800] [url = about:blank] 04:01:15 INFO - --DOMWINDOW == 85 (0x122e9c000) [pid = 1722] [serial = 1056] [outer = 0x0] [url = about:blank] 04:01:15 INFO - --DOMWINDOW == 84 (0x122e9d800) [pid = 1722] [serial = 1057] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 83 (0x12110b400) [pid = 1722] [serial = 1052] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 04:01:16 INFO - --DOMWINDOW == 82 (0x120e24800) [pid = 1722] [serial = 1050] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 04:01:16 INFO - --DOMWINDOW == 81 (0x11ebb7800) [pid = 1722] [serial = 1048] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 80 (0x1245b9000) [pid = 1722] [serial = 1076] [outer = 0x0] [url = about:newtab] 04:01:16 INFO - --DOMWINDOW == 79 (0x11ebba400) [pid = 1722] [serial = 1040] [outer = 0x0] [url = file:///builds/slave/test/build/tests/mochitest/browser/devtools/client/webconsole/test/test-network.html] 04:01:16 INFO - --DOMWINDOW == 78 (0x113443400) [pid = 1722] [serial = 1038] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 77 (0x121312800) [pid = 1722] [serial = 1054] [outer = 0x0] [url = chrome://browser/content/browser.xul] 04:01:16 INFO - --DOMWINDOW == 76 (0x121810c00) [pid = 1722] [serial = 1070] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:16 INFO - --DOMWINDOW == 75 (0x129396c00) [pid = 1722] [serial = 1074] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:16 INFO - --DOMWINDOW == 74 (0x1247cb400) [pid = 1722] [serial = 1072] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:16 INFO - --DOMWINDOW == 73 (0x11318d800) [pid = 1722] [serial = 1042] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:16 INFO - --DOMWINDOW == 72 (0x12938f800) [pid = 1722] [serial = 1068] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:16 INFO - --DOMWINDOW == 71 (0x122ea3000) [pid = 1722] [serial = 1045] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:16 INFO - --DOMWINDOW == 70 (0x121311000) [pid = 1722] [serial = 1066] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 04:01:16 INFO - --DOMWINDOW == 69 (0x121805800) [pid = 1722] [serial = 1064] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 04:01:16 INFO - --DOMWINDOW == 68 (0x122e9bc00) [pid = 1722] [serial = 1059] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 67 (0x12838ac00) [pid = 1722] [serial = 1096] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 66 (0x130bc0000) [pid = 1722] [serial = 1083] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:16 INFO - --DOMWINDOW == 65 (0x12826b800) [pid = 1722] [serial = 1085] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:16 INFO - --DOMWINDOW == 64 (0x128273400) [pid = 1722] [serial = 1087] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:16 INFO - --DOMWINDOW == 63 (0x128278000) [pid = 1722] [serial = 1089] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:16 INFO - --DOMWINDOW == 62 (0x121161400) [pid = 1722] [serial = 1053] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 61 (0x120e31c00) [pid = 1722] [serial = 1051] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 60 (0x11ee57c00) [pid = 1722] [serial = 1049] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 59 (0x126242c00) [pid = 1722] [serial = 1060] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 58 (0x12c4e8400) [pid = 1722] [serial = 1073] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 57 (0x1296ccc00) [pid = 1722] [serial = 1075] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 56 (0x129390000) [pid = 1722] [serial = 1069] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 55 (0x121828800) [pid = 1722] [serial = 1071] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 54 (0x12dd19000) [pid = 1722] [serial = 1077] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 53 (0x11f5cd000) [pid = 1722] [serial = 1041] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 52 (0x11344ac00) [pid = 1722] [serial = 1039] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 51 (0x12623bc00) [pid = 1722] [serial = 1106] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-svg.xhtml] 04:01:16 INFO - --DOMWINDOW == 50 (0x110d4d000) [pid = 1722] [serial = 1105] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-malformedxml.xhtml] 04:01:16 INFO - --DOMWINDOW == 49 (0x12e062000) [pid = 1722] [serial = 1103] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-html.html] 04:01:16 INFO - --DOMWINDOW == 48 (0x128384c00) [pid = 1722] [serial = 1094] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 47 (0x12837d000) [pid = 1722] [serial = 1067] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 46 (0x1273e5800) [pid = 1722] [serial = 1065] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 45 (0x1264b7800) [pid = 1722] [serial = 1063] [outer = 0x0] [url = about:blank] 04:01:16 INFO - --DOMWINDOW == 44 (0x128307800) [pid = 1722] [serial = 1107] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-css-parser.html] 04:01:16 INFO - --DOMWINDOW == 43 (0x1283ed400) [pid = 1722] [serial = 1047] [outer = 0x0] [url = file:///builds/slave/test/build/tests/mochitest/browser/devtools/client/webconsole/test/test-network.html] 04:01:16 INFO - --DOMWINDOW == 42 (0x12e066c00) [pid = 1722] [serial = 1102] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-html.html] 04:01:16 INFO - --DOMWINDOW == 41 (0x13754fc00) [pid = 1722] [serial = 1101] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-imagemap.html] 04:01:16 INFO - --DOMWINDOW == 40 (0x128304400) [pid = 1722] [serial = 1100] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-css-loader.html] 04:01:16 INFO - MEMORY STAT | vsize 3473MB | residentFast 474MB | heapAllocated 121MB 04:01:16 INFO - 243 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595934_message_categories.js | took 7842ms 04:01:16 INFO - ++DOCSHELL 0x112e93000 == 12 [pid = 1722] [id = 468] 04:01:16 INFO - ++DOMWINDOW == 41 (0x11344d400) [pid = 1722] [serial = 1112] [outer = 0x0] 04:01:16 INFO - ++DOMWINDOW == 42 (0x113451000) [pid = 1722] [serial = 1113] [outer = 0x11344d400] 04:01:16 INFO - 244 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597103_deactivateHUDForContext_unfocused_window.js 04:01:16 INFO - ++DOCSHELL 0x11345f800 == 13 [pid = 1722] [id = 469] 04:01:16 INFO - ++DOMWINDOW == 43 (0x11ebb6800) [pid = 1722] [serial = 1114] [outer = 0x0] 04:01:16 INFO - ++DOMWINDOW == 44 (0x11ebbf400) [pid = 1722] [serial = 1115] [outer = 0x11ebb6800] 04:01:16 INFO - ++DOMWINDOW == 45 (0x12152bc00) [pid = 1722] [serial = 1116] [outer = 0x11ebb6800] 04:01:16 INFO - ++DOCSHELL 0x11346b800 == 14 [pid = 1722] [id = 470] 04:01:16 INFO - ++DOMWINDOW == 46 (0x120263800) [pid = 1722] [serial = 1117] [outer = 0x0] 04:01:16 INFO - ++DOMWINDOW == 47 (0x1203eac00) [pid = 1722] [serial = 1118] [outer = 0x120263800] 04:01:16 INFO - ++DOCSHELL 0x1140bd800 == 15 [pid = 1722] [id = 471] 04:01:16 INFO - ++DOMWINDOW == 48 (0x120fe4400) [pid = 1722] [serial = 1119] [outer = 0x0] 04:01:16 INFO - ++DOCSHELL 0x1140c5800 == 16 [pid = 1722] [id = 472] 04:01:16 INFO - ++DOMWINDOW == 49 (0x120fee400) [pid = 1722] [serial = 1120] [outer = 0x0] 04:01:16 INFO - ++DOMWINDOW == 50 (0x120ff4400) [pid = 1722] [serial = 1121] [outer = 0x120fee400] 04:01:17 INFO - ++DOCSHELL 0x11eecd000 == 17 [pid = 1722] [id = 473] 04:01:17 INFO - ++DOMWINDOW == 51 (0x120fe3c00) [pid = 1722] [serial = 1122] [outer = 0x0] 04:01:17 INFO - ++DOMWINDOW == 52 (0x121811400) [pid = 1722] [serial = 1123] [outer = 0x120fe3c00] 04:01:17 INFO - ++DOMWINDOW == 53 (0x12232bc00) [pid = 1722] [serial = 1124] [outer = 0x120fe4400] 04:01:17 INFO - ++DOMWINDOW == 54 (0x12232ec00) [pid = 1722] [serial = 1125] [outer = 0x120fee400] 04:01:17 INFO - ++DOMWINDOW == 55 (0x122336800) [pid = 1722] [serial = 1126] [outer = 0x120fe3c00] 04:01:17 INFO - ++DOCSHELL 0x122187800 == 18 [pid = 1722] [id = 474] 04:01:17 INFO - ++DOMWINDOW == 56 (0x120ff8400) [pid = 1722] [serial = 1127] [outer = 0x0] 04:01:17 INFO - ++DOMWINDOW == 57 (0x1250b2400) [pid = 1722] [serial = 1128] [outer = 0x120ff8400] 04:01:17 INFO - ++DOMWINDOW == 58 (0x126240c00) [pid = 1722] [serial = 1129] [outer = 0x120ff8400] 04:01:17 INFO - ++DOCSHELL 0x124f08800 == 19 [pid = 1722] [id = 475] 04:01:17 INFO - ++DOMWINDOW == 59 (0x126402c00) [pid = 1722] [serial = 1130] [outer = 0x0] 04:01:17 INFO - ++DOMWINDOW == 60 (0x126485c00) [pid = 1722] [serial = 1131] [outer = 0x126402c00] 04:01:17 INFO - ++DOCSHELL 0x12570e000 == 20 [pid = 1722] [id = 476] 04:01:17 INFO - ++DOMWINDOW == 61 (0x1264ad400) [pid = 1722] [serial = 1132] [outer = 0x0] 04:01:17 INFO - ++DOMWINDOW == 62 (0x12706dc00) [pid = 1722] [serial = 1133] [outer = 0x1264ad400] 04:01:18 INFO - ++DOCSHELL 0x12820d000 == 21 [pid = 1722] [id = 477] 04:01:18 INFO - ++DOMWINDOW == 63 (0x12826e400) [pid = 1722] [serial = 1134] [outer = 0x0] 04:01:18 INFO - ++DOMWINDOW == 64 (0x128270800) [pid = 1722] [serial = 1135] [outer = 0x12826e400] 04:01:18 INFO - ++DOMWINDOW == 65 (0x128275800) [pid = 1722] [serial = 1136] [outer = 0x12826e400] 04:01:18 INFO - ++DOMWINDOW == 66 (0x128309c00) [pid = 1722] [serial = 1137] [outer = 0x126402c00] 04:01:18 INFO - ++DOMWINDOW == 67 (0x1283f2c00) [pid = 1722] [serial = 1138] [outer = 0x1264ad400] 04:01:18 INFO - ++DOCSHELL 0x129d3b000 == 22 [pid = 1722] [id = 478] 04:01:18 INFO - ++DOMWINDOW == 68 (0x1296d7c00) [pid = 1722] [serial = 1139] [outer = 0x0] 04:01:18 INFO - ++DOMWINDOW == 69 (0x1296da000) [pid = 1722] [serial = 1140] [outer = 0x1296d7c00] 04:01:18 INFO - ++DOCSHELL 0x12966d800 == 23 [pid = 1722] [id = 479] 04:01:18 INFO - ++DOMWINDOW == 70 (0x12837d000) [pid = 1722] [serial = 1141] [outer = 0x0] 04:01:18 INFO - ++DOMWINDOW == 71 (0x128381400) [pid = 1722] [serial = 1142] [outer = 0x12837d000] 04:01:18 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 04:01:21 INFO - --DOCSHELL 0x124f08800 == 22 [pid = 1722] [id = 475] 04:01:21 INFO - --DOCSHELL 0x129d3b000 == 21 [pid = 1722] [id = 478] 04:01:21 INFO - --DOCSHELL 0x12f23a800 == 20 [pid = 1722] [id = 466] 04:01:21 INFO - --DOCSHELL 0x1252f6800 == 19 [pid = 1722] [id = 465] 04:01:21 INFO - --DOCSHELL 0x11346a800 == 18 [pid = 1722] [id = 464] 04:01:21 INFO - --DOMWINDOW == 70 (0x121315000) [pid = 1722] [serial = 1055] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 69 (0x12f1b6400) [pid = 1722] [serial = 1078] [outer = 0x0] [url = about:newtab] 04:01:21 INFO - --DOMWINDOW == 68 (0x12826d800) [pid = 1722] [serial = 1086] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 67 (0x130bc2000) [pid = 1722] [serial = 1084] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 66 (0x12c3a5c00) [pid = 1722] [serial = 1080] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:21 INFO - --DOMWINDOW == 65 (0x12f795400) [pid = 1722] [serial = 1079] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:21 INFO - --DOMWINDOW == 64 (0x122ea5c00) [pid = 1722] [serial = 1046] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 63 (0x121316c00) [pid = 1722] [serial = 1044] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:21 INFO - --DOMWINDOW == 62 (0x128387800) [pid = 1722] [serial = 1090] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 61 (0x128275c00) [pid = 1722] [serial = 1088] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 60 (0x130b71800) [pid = 1722] [serial = 1082] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:21 INFO - --DOMWINDOW == 59 (0x110e32400) [pid = 1722] [serial = 1081] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:21 INFO - --DOMWINDOW == 58 (0x120ff4400) [pid = 1722] [serial = 1121] [outer = 0x120fee400] [url = about:blank] 04:01:21 INFO - --DOCSHELL 0x12966d800 == 17 [pid = 1722] [id = 479] 04:01:21 INFO - --DOMWINDOW == 57 (0x12c21dc00) [pid = 1722] [serial = 1098] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:21 INFO - --DOMWINDOW == 56 (0x128386000) [pid = 1722] [serial = 1095] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:21 INFO - --DOMWINDOW == 55 (0x1247c4800) [pid = 1722] [serial = 1091] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 54 (0x124c30000) [pid = 1722] [serial = 1092] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 53 (0x11ebbf400) [pid = 1722] [serial = 1115] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 52 (0x12706dc00) [pid = 1722] [serial = 1133] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 51 (0x121811400) [pid = 1722] [serial = 1123] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 50 (0x1250b2400) [pid = 1722] [serial = 1128] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 49 (0x128270800) [pid = 1722] [serial = 1135] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 48 (0x126485c00) [pid = 1722] [serial = 1131] [outer = 0x0] [url = about:blank] 04:01:21 INFO - --DOMWINDOW == 47 (0x128272400) [pid = 1722] [serial = 1093] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-image.html] 04:01:21 INFO - --DOMWINDOW == 46 (0x1283eb000) [pid = 1722] [serial = 1108] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-malformedxml-external.html] 04:01:21 INFO - --DOMWINDOW == 45 (0x1296cf000) [pid = 1722] [serial = 1109] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-empty-getelementbyid.html] 04:01:21 INFO - --DOMWINDOW == 44 (0x12e062800) [pid = 1722] [serial = 1110] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-canvas-css.html] 04:01:21 INFO - --DOMWINDOW == 43 (0x12f4d8400) [pid = 1722] [serial = 1111] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-image.html] 04:01:21 INFO - --DOMWINDOW == 42 (0x12d407c00) [pid = 1722] [serial = 1104] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-workers.html] 04:01:22 INFO - --DOCSHELL 0x12570e000 == 16 [pid = 1722] [id = 476] 04:01:22 INFO - --DOMWINDOW == 41 (0x12c21fc00) [pid = 1722] [serial = 1099] [outer = 0x0] [url = about:blank] 04:01:22 INFO - --DOMWINDOW == 40 (0x12706d800) [pid = 1722] [serial = 1097] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:22 INFO - --DOMWINDOW == 39 (0x126402c00) [pid = 1722] [serial = 1130] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:22 INFO - --DOMWINDOW == 38 (0x1296d7c00) [pid = 1722] [serial = 1139] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:22 INFO - MEMORY STAT | vsize 3496MB | residentFast 484MB | heapAllocated 123MB 04:01:22 INFO - 245 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597103_deactivateHUDForContext_unfocused_window.js | took 6197ms 04:01:22 INFO - ++DOCSHELL 0x112e21800 == 17 [pid = 1722] [id = 480] 04:01:22 INFO - ++DOMWINDOW == 39 (0x11318d800) [pid = 1722] [serial = 1143] [outer = 0x0] 04:01:22 INFO - ++DOMWINDOW == 40 (0x113444c00) [pid = 1722] [serial = 1144] [outer = 0x11318d800] 04:01:22 INFO - 246 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597136_external_script_errors.js 04:01:22 INFO - ++DOCSHELL 0x11345e800 == 18 [pid = 1722] [id = 481] 04:01:22 INFO - ++DOMWINDOW == 41 (0x11ebb6400) [pid = 1722] [serial = 1145] [outer = 0x0] 04:01:22 INFO - ++DOMWINDOW == 42 (0x11ebc0400) [pid = 1722] [serial = 1146] [outer = 0x11ebb6400] 04:01:23 INFO - ++DOMWINDOW == 43 (0x11f715400) [pid = 1722] [serial = 1147] [outer = 0x11ebb6400] 04:01:23 INFO - ++DOCSHELL 0x113469800 == 19 [pid = 1722] [id = 482] 04:01:23 INFO - ++DOMWINDOW == 44 (0x11ef54800) [pid = 1722] [serial = 1148] [outer = 0x0] 04:01:23 INFO - ++DOMWINDOW == 45 (0x120e23400) [pid = 1722] [serial = 1149] [outer = 0x11ef54800] 04:01:23 INFO - ++DOMWINDOW == 46 (0x120feec00) [pid = 1722] [serial = 1150] [outer = 0x11ef54800] 04:01:23 INFO - ++DOCSHELL 0x11ec5b800 == 20 [pid = 1722] [id = 483] 04:01:23 INFO - ++DOMWINDOW == 47 (0x1214b5800) [pid = 1722] [serial = 1151] [outer = 0x0] 04:01:23 INFO - ++DOMWINDOW == 48 (0x121828400) [pid = 1722] [serial = 1152] [outer = 0x1214b5800] 04:01:24 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.js, line 12: ReferenceError: bogus is not defined 04:01:24 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 04:01:25 INFO - --DOCSHELL 0x112e93000 == 19 [pid = 1722] [id = 468] 04:01:25 INFO - --DOCSHELL 0x113469800 == 18 [pid = 1722] [id = 482] 04:01:25 INFO - --DOCSHELL 0x11ec5b800 == 17 [pid = 1722] [id = 483] 04:01:25 INFO - --DOCSHELL 0x11345f800 == 16 [pid = 1722] [id = 469] 04:01:25 INFO - --DOCSHELL 0x11346b800 == 15 [pid = 1722] [id = 470] 04:01:25 INFO - --DOCSHELL 0x12820d000 == 14 [pid = 1722] [id = 477] 04:01:25 INFO - --DOCSHELL 0x1140c5800 == 13 [pid = 1722] [id = 472] 04:01:25 INFO - --DOCSHELL 0x11eecd000 == 12 [pid = 1722] [id = 473] 04:01:25 INFO - --DOCSHELL 0x1140bd800 == 11 [pid = 1722] [id = 471] 04:01:25 INFO - --DOCSHELL 0x122187800 == 10 [pid = 1722] [id = 474] 04:01:25 INFO - --DOMWINDOW == 47 (0x1296da000) [pid = 1722] [serial = 1140] [outer = 0x0] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 46 (0x128309c00) [pid = 1722] [serial = 1137] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:25 INFO - --DOMWINDOW == 45 (0x12232bc00) [pid = 1722] [serial = 1124] [outer = 0x120fe4400] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 44 (0x12232ec00) [pid = 1722] [serial = 1125] [outer = 0x120fee400] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 43 (0x120fe4400) [pid = 1722] [serial = 1119] [outer = 0x0] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 42 (0x120fee400) [pid = 1722] [serial = 1120] [outer = 0x0] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 41 (0x11344d400) [pid = 1722] [serial = 1112] [outer = 0x0] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 40 (0x12826e400) [pid = 1722] [serial = 1134] [outer = 0x0] [url = about:newtab] 04:01:25 INFO - --DOMWINDOW == 39 (0x1264ad400) [pid = 1722] [serial = 1132] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:25 INFO - --DOMWINDOW == 38 (0x12837d000) [pid = 1722] [serial = 1141] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:25 INFO - --DOMWINDOW == 37 (0x120263800) [pid = 1722] [serial = 1117] [outer = 0x0] [url = chrome://browser/content/browser.xul] 04:01:25 INFO - --DOMWINDOW == 36 (0x120ff8400) [pid = 1722] [serial = 1127] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:01:25 INFO - --DOMWINDOW == 35 (0x120fe3c00) [pid = 1722] [serial = 1122] [outer = 0x0] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 34 (0x11ebb6800) [pid = 1722] [serial = 1114] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:01:25 INFO - --DOMWINDOW == 33 (0x120e23400) [pid = 1722] [serial = 1149] [outer = 0x0] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 32 (0x11ebc0400) [pid = 1722] [serial = 1146] [outer = 0x0] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 31 (0x122336800) [pid = 1722] [serial = 1126] [outer = 0x0] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 30 (0x113451000) [pid = 1722] [serial = 1113] [outer = 0x0] [url = about:blank] 04:01:25 INFO - --DOMWINDOW == 29 (0x126240c00) [pid = 1722] [serial = 1129] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:01:25 INFO - --DOMWINDOW == 28 (0x12152bc00) [pid = 1722] [serial = 1116] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:01:25 INFO - MEMORY STAT | vsize 3469MB | residentFast 470MB | heapAllocated 114MB 04:01:25 INFO - 247 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597136_external_script_errors.js | took 2462ms 04:01:25 INFO - ++DOCSHELL 0x112cd1000 == 11 [pid = 1722] [id = 484] 04:01:25 INFO - ++DOMWINDOW == 29 (0x113165400) [pid = 1722] [serial = 1153] [outer = 0x0] 04:01:25 INFO - ++DOMWINDOW == 30 (0x113445000) [pid = 1722] [serial = 1154] [outer = 0x113165400] 04:01:25 INFO - 248 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597136_network_requests_from_chrome.js 04:01:25 INFO - MEMORY STAT | vsize 3469MB | residentFast 471MB | heapAllocated 115MB 04:01:25 INFO - 249 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597136_network_requests_from_chrome.js | took 146ms 04:01:25 INFO - ++DOCSHELL 0x11345f800 == 12 [pid = 1722] [id = 485] 04:01:25 INFO - ++DOMWINDOW == 31 (0x11e7b1400) [pid = 1722] [serial = 1155] [outer = 0x0] 04:01:25 INFO - ++DOMWINDOW == 32 (0x11ebc0400) [pid = 1722] [serial = 1156] [outer = 0x11e7b1400] 04:01:25 INFO - 250 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597460_filter_scroll.js 04:01:25 INFO - ++DOCSHELL 0x11284f000 == 13 [pid = 1722] [id = 486] 04:01:25 INFO - ++DOMWINDOW == 33 (0x1203dec00) [pid = 1722] [serial = 1157] [outer = 0x0] 04:01:25 INFO - ++DOMWINDOW == 34 (0x120d1a000) [pid = 1722] [serial = 1158] [outer = 0x1203dec00] 04:01:25 INFO - ++DOMWINDOW == 35 (0x120e2c000) [pid = 1722] [serial = 1159] [outer = 0x1203dec00] 04:01:26 INFO - ++DOCSHELL 0x112cca000 == 14 [pid = 1722] [id = 487] 04:01:26 INFO - ++DOMWINDOW == 36 (0x121115800) [pid = 1722] [serial = 1160] [outer = 0x0] 04:01:26 INFO - ++DOMWINDOW == 37 (0x12115b000) [pid = 1722] [serial = 1161] [outer = 0x121115800] 04:01:26 INFO - ++DOMWINDOW == 38 (0x121317800) [pid = 1722] [serial = 1162] [outer = 0x121115800] 04:01:26 INFO - ++DOCSHELL 0x1203d4000 == 15 [pid = 1722] [id = 488] 04:01:26 INFO - ++DOMWINDOW == 39 (0x122339000) [pid = 1722] [serial = 1163] [outer = 0x0] 04:01:26 INFO - ++DOMWINDOW == 40 (0x1225d6000) [pid = 1722] [serial = 1164] [outer = 0x122339000] 04:01:28 INFO - ++DOMWINDOW == 41 (0x12fcc9000) [pid = 1722] [serial = 1165] [outer = 0x1203dec00] 04:01:28 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:29 INFO - --DOCSHELL 0x11345e800 == 14 [pid = 1722] [id = 481] 04:01:29 INFO - --DOCSHELL 0x112e21800 == 13 [pid = 1722] [id = 480] 04:01:29 INFO - --DOCSHELL 0x1203d4000 == 12 [pid = 1722] [id = 488] 04:01:29 INFO - --DOMWINDOW == 40 (0x1203eac00) [pid = 1722] [serial = 1118] [outer = 0x0] [url = about:blank] 04:01:29 INFO - --DOMWINDOW == 39 (0x128275800) [pid = 1722] [serial = 1136] [outer = 0x0] [url = about:newtab] 04:01:29 INFO - --DOMWINDOW == 38 (0x128381400) [pid = 1722] [serial = 1142] [outer = 0x0] [url = about:blank] 04:01:29 INFO - --DOMWINDOW == 37 (0x1283f2c00) [pid = 1722] [serial = 1138] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:29 INFO - --DOMWINDOW == 36 (0x11318d800) [pid = 1722] [serial = 1143] [outer = 0x0] [url = about:blank] 04:01:29 INFO - --DOMWINDOW == 35 (0x113165400) [pid = 1722] [serial = 1153] [outer = 0x0] [url = about:blank] 04:01:29 INFO - --DOMWINDOW == 34 (0x11ebb6400) [pid = 1722] [serial = 1145] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.html] 04:01:29 INFO - --DOMWINDOW == 33 (0x11ef54800) [pid = 1722] [serial = 1148] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:29 INFO - --DOMWINDOW == 32 (0x1214b5800) [pid = 1722] [serial = 1151] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:29 INFO - --DOMWINDOW == 31 (0x12115b000) [pid = 1722] [serial = 1161] [outer = 0x0] [url = about:blank] 04:01:29 INFO - --DOMWINDOW == 30 (0x113444c00) [pid = 1722] [serial = 1144] [outer = 0x0] [url = about:blank] 04:01:29 INFO - --DOMWINDOW == 29 (0x113445000) [pid = 1722] [serial = 1154] [outer = 0x0] [url = about:blank] 04:01:29 INFO - --DOMWINDOW == 28 (0x120d1a000) [pid = 1722] [serial = 1158] [outer = 0x0] [url = about:blank] 04:01:29 INFO - MEMORY STAT | vsize 3475MB | residentFast 473MB | heapAllocated 118MB 04:01:29 INFO - 251 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597460_filter_scroll.js | took 4053ms 04:01:29 INFO - ++DOCSHELL 0x112ccc000 == 13 [pid = 1722] [id = 489] 04:01:29 INFO - ++DOMWINDOW == 29 (0x112f4ec00) [pid = 1722] [serial = 1166] [outer = 0x0] 04:01:29 INFO - ++DOMWINDOW == 30 (0x113195c00) [pid = 1722] [serial = 1167] [outer = 0x112f4ec00] 04:01:29 INFO - 252 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597756_reopen_closed_tab.js 04:01:29 INFO - ++DOCSHELL 0x113458800 == 14 [pid = 1722] [id = 490] 04:01:29 INFO - ++DOMWINDOW == 31 (0x11344e800) [pid = 1722] [serial = 1168] [outer = 0x0] 04:01:29 INFO - ++DOMWINDOW == 32 (0x114b57000) [pid = 1722] [serial = 1169] [outer = 0x11344e800] 04:01:30 INFO - ++DOMWINDOW == 33 (0x11ebb7c00) [pid = 1722] [serial = 1170] [outer = 0x11344e800] 04:01:30 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 04:01:30 INFO - ++DOCSHELL 0x112cba800 == 15 [pid = 1722] [id = 491] 04:01:30 INFO - ++DOMWINDOW == 34 (0x1203dd400) [pid = 1722] [serial = 1171] [outer = 0x0] 04:01:30 INFO - ++DOMWINDOW == 35 (0x1203e5000) [pid = 1722] [serial = 1172] [outer = 0x1203dd400] 04:01:30 INFO - ++DOMWINDOW == 36 (0x120e30800) [pid = 1722] [serial = 1173] [outer = 0x1203dd400] 04:01:30 INFO - ++DOCSHELL 0x11ee49800 == 16 [pid = 1722] [id = 492] 04:01:30 INFO - ++DOMWINDOW == 37 (0x1214afc00) [pid = 1722] [serial = 1174] [outer = 0x0] 04:01:30 INFO - ++DOMWINDOW == 38 (0x1214b5800) [pid = 1722] [serial = 1175] [outer = 0x1214afc00] 04:01:31 INFO - ++DOMWINDOW == 39 (0x12232a400) [pid = 1722] [serial = 1176] [outer = 0x11344e800] 04:01:31 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:31 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 04:01:32 INFO - --DOCSHELL 0x112cd1000 == 15 [pid = 1722] [id = 484] 04:01:32 INFO - --DOCSHELL 0x112cca000 == 14 [pid = 1722] [id = 487] 04:01:32 INFO - --DOCSHELL 0x11345f800 == 13 [pid = 1722] [id = 485] 04:01:32 INFO - --DOCSHELL 0x11284f000 == 12 [pid = 1722] [id = 486] 04:01:32 INFO - --DOCSHELL 0x11ee49800 == 11 [pid = 1722] [id = 492] 04:01:32 INFO - --DOMWINDOW == 38 (0x120feec00) [pid = 1722] [serial = 1150] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:32 INFO - --DOMWINDOW == 37 (0x121828400) [pid = 1722] [serial = 1152] [outer = 0x0] [url = about:blank] 04:01:32 INFO - --DOMWINDOW == 36 (0x11f715400) [pid = 1722] [serial = 1147] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.html] 04:01:32 INFO - ++DOCSHELL 0x11284f000 == 12 [pid = 1722] [id = 493] 04:01:32 INFO - ++DOMWINDOW == 37 (0x112c98000) [pid = 1722] [serial = 1177] [outer = 0x0] 04:01:32 INFO - ++DOMWINDOW == 38 (0x112f48800) [pid = 1722] [serial = 1178] [outer = 0x112c98000] 04:01:32 INFO - --DOMWINDOW == 37 (0x114b57000) [pid = 1722] [serial = 1169] [outer = 0x0] [url = about:blank] 04:01:32 INFO - --DOMWINDOW == 36 (0x11ebc0400) [pid = 1722] [serial = 1156] [outer = 0x0] [url = about:blank] 04:01:32 INFO - --DOMWINDOW == 35 (0x1203e5000) [pid = 1722] [serial = 1172] [outer = 0x0] [url = about:blank] 04:01:32 INFO - --DOMWINDOW == 34 (0x121115800) [pid = 1722] [serial = 1160] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:32 INFO - --DOMWINDOW == 33 (0x122339000) [pid = 1722] [serial = 1163] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:32 INFO - --DOMWINDOW == 32 (0x1203dec00) [pid = 1722] [serial = 1157] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 04:01:32 INFO - --DOMWINDOW == 31 (0x11e7b1400) [pid = 1722] [serial = 1155] [outer = 0x0] [url = about:blank] 04:01:32 INFO - --DOMWINDOW == 30 (0x120e2c000) [pid = 1722] [serial = 1159] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 04:01:32 INFO - --DOMWINDOW == 29 (0x12fcc9000) [pid = 1722] [serial = 1165] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 04:01:32 INFO - ++DOMWINDOW == 30 (0x1203e1000) [pid = 1722] [serial = 1179] [outer = 0x112c98000] 04:01:32 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 04:01:32 INFO - ++DOCSHELL 0x113457000 == 13 [pid = 1722] [id = 494] 04:01:32 INFO - ++DOMWINDOW == 31 (0x11e7ae800) [pid = 1722] [serial = 1180] [outer = 0x0] 04:01:32 INFO - ++DOMWINDOW == 32 (0x11ebb6c00) [pid = 1722] [serial = 1181] [outer = 0x11e7ae800] 04:01:32 INFO - ++DOMWINDOW == 33 (0x11f5cc000) [pid = 1722] [serial = 1182] [outer = 0x11e7ae800] 04:01:32 INFO - ++DOCSHELL 0x114b70000 == 14 [pid = 1722] [id = 495] 04:01:32 INFO - ++DOMWINDOW == 34 (0x121161400) [pid = 1722] [serial = 1183] [outer = 0x0] 04:01:32 INFO - ++DOMWINDOW == 35 (0x12130ec00) [pid = 1722] [serial = 1184] [outer = 0x121161400] 04:01:33 INFO - ++DOMWINDOW == 36 (0x12211a400) [pid = 1722] [serial = 1185] [outer = 0x112c98000] 04:01:33 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:33 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 04:01:34 INFO - --DOCSHELL 0x113458800 == 13 [pid = 1722] [id = 490] 04:01:34 INFO - --DOCSHELL 0x114b70000 == 12 [pid = 1722] [id = 495] 04:01:34 INFO - --DOCSHELL 0x112cba800 == 11 [pid = 1722] [id = 491] 04:01:34 INFO - --DOMWINDOW == 35 (0x121317800) [pid = 1722] [serial = 1162] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:34 INFO - --DOMWINDOW == 34 (0x1225d6000) [pid = 1722] [serial = 1164] [outer = 0x0] [url = about:blank] 04:01:34 INFO - --DOMWINDOW == 33 (0x11ebb7c00) [pid = 1722] [serial = 1170] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 04:01:34 INFO - --DOMWINDOW == 32 (0x112f48800) [pid = 1722] [serial = 1178] [outer = 0x0] [url = about:blank] 04:01:34 INFO - --DOMWINDOW == 31 (0x11ebb6c00) [pid = 1722] [serial = 1181] [outer = 0x0] [url = about:blank] 04:01:34 INFO - --DOMWINDOW == 30 (0x11344e800) [pid = 1722] [serial = 1168] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 04:01:34 INFO - --DOMWINDOW == 29 (0x12232a400) [pid = 1722] [serial = 1176] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 04:01:34 INFO - MEMORY STAT | vsize 3478MB | residentFast 475MB | heapAllocated 116MB 04:01:34 INFO - 253 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597756_reopen_closed_tab.js | took 4636ms 04:01:34 INFO - ++DOCSHELL 0x112cd6800 == 12 [pid = 1722] [id = 496] 04:01:34 INFO - ++DOMWINDOW == 30 (0x113444800) [pid = 1722] [serial = 1186] [outer = 0x0] 04:01:34 INFO - ++DOMWINDOW == 31 (0x11344d800) [pid = 1722] [serial = 1187] [outer = 0x113444800] 04:01:34 INFO - 254 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_599725_response_headers.js 04:01:34 INFO - ++DOCSHELL 0x113461800 == 13 [pid = 1722] [id = 497] 04:01:34 INFO - ++DOMWINDOW == 32 (0x11344c000) [pid = 1722] [serial = 1188] [outer = 0x0] 04:01:34 INFO - ++DOMWINDOW == 33 (0x11e7af000) [pid = 1722] [serial = 1189] [outer = 0x11344c000] 04:01:34 INFO - ++DOCSHELL 0x112cce800 == 14 [pid = 1722] [id = 498] 04:01:34 INFO - ++DOMWINDOW == 34 (0x11e7b1400) [pid = 1722] [serial = 1190] [outer = 0x0] 04:01:34 INFO - ++DOMWINDOW == 35 (0x11f110800) [pid = 1722] [serial = 1191] [outer = 0x11e7b1400] 04:01:35 INFO - ++DOMWINDOW == 36 (0x120e24400) [pid = 1722] [serial = 1192] [outer = 0x11e7b1400] 04:01:35 INFO - ++DOCSHELL 0x114b80800 == 15 [pid = 1722] [id = 499] 04:01:35 INFO - ++DOMWINDOW == 37 (0x1214ad800) [pid = 1722] [serial = 1193] [outer = 0x0] 04:01:35 INFO - ++DOMWINDOW == 38 (0x1214b4c00) [pid = 1722] [serial = 1194] [outer = 0x1214ad800] 04:01:35 INFO - ++DOMWINDOW == 39 (0x12830e000) [pid = 1722] [serial = 1195] [outer = 0x11344c000] 04:01:35 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:36 INFO - ++DOMWINDOW == 40 (0x12504cc00) [pid = 1722] [serial = 1196] [outer = 0x11344c000] 04:01:36 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:36 INFO - --DOCSHELL 0x112ccc000 == 14 [pid = 1722] [id = 489] 04:01:36 INFO - --DOCSHELL 0x11284f000 == 13 [pid = 1722] [id = 493] 04:01:36 INFO - --DOCSHELL 0x113457000 == 12 [pid = 1722] [id = 494] 04:01:36 INFO - --DOCSHELL 0x114b80800 == 11 [pid = 1722] [id = 499] 04:01:37 INFO - --DOMWINDOW == 39 (0x1203e1000) [pid = 1722] [serial = 1179] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 04:01:37 INFO - --DOMWINDOW == 38 (0x11f110800) [pid = 1722] [serial = 1191] [outer = 0x0] [url = about:blank] 04:01:37 INFO - --DOMWINDOW == 37 (0x113195c00) [pid = 1722] [serial = 1167] [outer = 0x0] [url = about:blank] 04:01:37 INFO - --DOMWINDOW == 36 (0x12830e000) [pid = 1722] [serial = 1195] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs] 04:01:37 INFO - --DOMWINDOW == 35 (0x1214afc00) [pid = 1722] [serial = 1174] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:37 INFO - --DOMWINDOW == 34 (0x1203dd400) [pid = 1722] [serial = 1171] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:37 INFO - --DOMWINDOW == 33 (0x11e7ae800) [pid = 1722] [serial = 1180] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:37 INFO - --DOMWINDOW == 32 (0x121161400) [pid = 1722] [serial = 1183] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:37 INFO - --DOMWINDOW == 31 (0x112f4ec00) [pid = 1722] [serial = 1166] [outer = 0x0] [url = about:blank] 04:01:37 INFO - --DOMWINDOW == 30 (0x112c98000) [pid = 1722] [serial = 1177] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 04:01:37 INFO - --DOMWINDOW == 29 (0x12211a400) [pid = 1722] [serial = 1185] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 04:01:37 INFO - MEMORY STAT | vsize 3478MB | residentFast 476MB | heapAllocated 117MB 04:01:37 INFO - 255 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_599725_response_headers.js | took 2585ms 04:01:37 INFO - ++DOCSHELL 0x112e98000 == 12 [pid = 1722] [id = 500] 04:01:37 INFO - ++DOMWINDOW == 30 (0x11344b800) [pid = 1722] [serial = 1197] [outer = 0x0] 04:01:37 INFO - ++DOMWINDOW == 31 (0x114dbec00) [pid = 1722] [serial = 1198] [outer = 0x11344b800] 04:01:37 INFO - 256 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_600183_charset.js 04:01:37 INFO - ++DOCSHELL 0x113518800 == 13 [pid = 1722] [id = 501] 04:01:37 INFO - ++DOMWINDOW == 32 (0x11ec90000) [pid = 1722] [serial = 1199] [outer = 0x0] 04:01:37 INFO - ++DOMWINDOW == 33 (0x11ef14800) [pid = 1722] [serial = 1200] [outer = 0x11ec90000] 04:01:37 INFO - ++DOCSHELL 0x113212000 == 14 [pid = 1722] [id = 502] 04:01:37 INFO - ++DOMWINDOW == 34 (0x11f111400) [pid = 1722] [serial = 1201] [outer = 0x0] 04:01:37 INFO - ++DOMWINDOW == 35 (0x1203e5000) [pid = 1722] [serial = 1202] [outer = 0x11f111400] 04:01:37 INFO - ++DOMWINDOW == 36 (0x120ff8c00) [pid = 1722] [serial = 1203] [outer = 0x11f111400] 04:01:37 INFO - ++DOCSHELL 0x11eec7800 == 15 [pid = 1722] [id = 503] 04:01:37 INFO - ++DOMWINDOW == 37 (0x121803c00) [pid = 1722] [serial = 1204] [outer = 0x0] 04:01:37 INFO - ++DOMWINDOW == 38 (0x121828c00) [pid = 1722] [serial = 1205] [outer = 0x121803c00] 04:01:38 INFO - ++DOMWINDOW == 39 (0x128381800) [pid = 1722] [serial = 1206] [outer = 0x11ec90000] 04:01:38 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:39 INFO - --DOCSHELL 0x113461800 == 14 [pid = 1722] [id = 497] 04:01:39 INFO - --DOCSHELL 0x112cd6800 == 13 [pid = 1722] [id = 496] 04:01:39 INFO - --DOCSHELL 0x11eec7800 == 12 [pid = 1722] [id = 503] 04:01:39 INFO - --DOCSHELL 0x112cce800 == 11 [pid = 1722] [id = 498] 04:01:39 INFO - --DOMWINDOW == 38 (0x1214b5800) [pid = 1722] [serial = 1175] [outer = 0x0] [url = about:blank] 04:01:39 INFO - --DOMWINDOW == 37 (0x120e30800) [pid = 1722] [serial = 1173] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:39 INFO - --DOMWINDOW == 36 (0x12130ec00) [pid = 1722] [serial = 1184] [outer = 0x0] [url = about:blank] 04:01:39 INFO - --DOMWINDOW == 35 (0x11f5cc000) [pid = 1722] [serial = 1182] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:39 INFO - --DOMWINDOW == 34 (0x12504cc00) [pid = 1722] [serial = 1196] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs] 04:01:39 INFO - --DOMWINDOW == 33 (0x11e7af000) [pid = 1722] [serial = 1189] [outer = 0x0] [url = about:blank] 04:01:39 INFO - --DOMWINDOW == 32 (0x11344d800) [pid = 1722] [serial = 1187] [outer = 0x0] [url = about:blank] 04:01:39 INFO - --DOMWINDOW == 31 (0x1203e5000) [pid = 1722] [serial = 1202] [outer = 0x0] [url = about:blank] 04:01:39 INFO - --DOMWINDOW == 30 (0x1214ad800) [pid = 1722] [serial = 1193] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:39 INFO - --DOMWINDOW == 29 (0x11e7b1400) [pid = 1722] [serial = 1190] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:39 INFO - --DOMWINDOW == 28 (0x11344c000) [pid = 1722] [serial = 1188] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs] 04:01:39 INFO - --DOMWINDOW == 27 (0x113444800) [pid = 1722] [serial = 1186] [outer = 0x0] [url = about:blank] 04:01:39 INFO - MEMORY STAT | vsize 3402MB | residentFast 478MB | heapAllocated 117MB 04:01:39 INFO - 257 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_600183_charset.js | took 2454ms 04:01:39 INFO - ++DOCSHELL 0x112cbd000 == 12 [pid = 1722] [id = 504] 04:01:39 INFO - ++DOMWINDOW == 28 (0x113449c00) [pid = 1722] [serial = 1207] [outer = 0x0] 04:01:39 INFO - ++DOMWINDOW == 29 (0x11344e400) [pid = 1722] [serial = 1208] [outer = 0x113449c00] 04:01:40 INFO - 258 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601177_log_levels.js 04:01:40 INFO - ++DOCSHELL 0x11346d800 == 13 [pid = 1722] [id = 505] 04:01:40 INFO - ++DOMWINDOW == 30 (0x112f4cc00) [pid = 1722] [serial = 1209] [outer = 0x0] 04:01:40 INFO - ++DOMWINDOW == 31 (0x11ebc0400) [pid = 1722] [serial = 1210] [outer = 0x112f4cc00] 04:01:40 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/tilt/tilt.js, line 263: ReferenceError: reference to undefined property this.visualizers[this.currentWindowId] 04:01:40 INFO - ++DOCSHELL 0x113319800 == 14 [pid = 1722] [id = 506] 04:01:40 INFO - ++DOMWINDOW == 32 (0x11ee51800) [pid = 1722] [serial = 1211] [outer = 0x0] 04:01:40 INFO - ++DOMWINDOW == 33 (0x120d21400) [pid = 1722] [serial = 1212] [outer = 0x11ee51800] 04:01:40 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js, line 949: ReferenceError: reference to undefined property aPacket.type 04:01:40 INFO - ++DOMWINDOW == 34 (0x120fe6400) [pid = 1722] [serial = 1213] [outer = 0x11ee51800] 04:01:40 INFO - ++DOCSHELL 0x11eeba000 == 15 [pid = 1722] [id = 507] 04:01:40 INFO - ++DOMWINDOW == 35 (0x1214b1400) [pid = 1722] [serial = 1214] [outer = 0x0] 04:01:40 INFO - ++DOMWINDOW == 36 (0x12152b400) [pid = 1722] [serial = 1215] [outer = 0x1214b1400] 04:01:40 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/gcli/source/lib/gcli/settings.js, line 185: ReferenceError: reference to undefined property prefSpec.ignoreTypeDifference 04:01:40 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/gcli/source/lib/gcli/commands/commands.js, line 293: ReferenceError: reference to undefined property this.paramSpec.manual 04:01:40 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/gcli/source/lib/gcli/system.js, line 366: ReferenceError: reference to undefined property command.front 04:01:40 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox.js, line 329: ReferenceError: reference to undefined property this._splitConsole 04:01:41 INFO - ++DOMWINDOW == 37 (0x12837dc00) [pid = 1722] [serial = 1216] [outer = 0x112f4cc00] 04:01:41 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:41 INFO - JavaScript strict warning: chrome://mochikit/content/tests/SimpleTest/TestRunner.js, line 237: ReferenceError: reference to undefined property message.level 04:01:41 INFO - JavaScript strict warning: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.js, line 6: ReferenceError: assignment to undeclared variable foobarBug601177strictError 04:01:41 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.js, line 8: TypeError: window.foobarBug601177exception is not a function 04:01:41 INFO - JavaScript strict warning: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html, line 8: ReferenceError: reference to undefined property window.undefinedPropertyBug601177 04:01:41 INFO - [1722] WARNING: RasterImage::Init failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/image/ImageFactory.cpp, line 109 04:01:42 INFO - --DOCSHELL 0x112e98000 == 14 [pid = 1722] [id = 500] 04:01:42 INFO - --DOCSHELL 0x11eeba000 == 13 [pid = 1722] [id = 507] 04:01:42 INFO - --DOCSHELL 0x113518800 == 12 [pid = 1722] [id = 501] 04:01:42 INFO - --DOCSHELL 0x113212000 == 11 [pid = 1722] [id = 502] 04:01:42 INFO - --DOMWINDOW == 36 (0x1214b4c00) [pid = 1722] [serial = 1194] [outer = 0x0] [url = about:blank] 04:01:42 INFO - --DOMWINDOW == 35 (0x120e24400) [pid = 1722] [serial = 1192] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:42 INFO - --DOMWINDOW == 34 (0x11ef14800) [pid = 1722] [serial = 1200] [outer = 0x0] [url = about:blank] 04:01:42 INFO - --DOMWINDOW == 33 (0x114dbec00) [pid = 1722] [serial = 1198] [outer = 0x0] [url = about:blank] 04:01:42 INFO - --DOMWINDOW == 32 (0x120d21400) [pid = 1722] [serial = 1212] [outer = 0x0] [url = about:blank] 04:01:42 INFO - --DOMWINDOW == 31 (0x121803c00) [pid = 1722] [serial = 1204] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:42 INFO - --DOMWINDOW == 30 (0x11f111400) [pid = 1722] [serial = 1201] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:42 INFO - --DOMWINDOW == 29 (0x11ec90000) [pid = 1722] [serial = 1199] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-600183-charset.html] 04:01:42 INFO - --DOMWINDOW == 28 (0x11344b800) [pid = 1722] [serial = 1197] [outer = 0x0] [url = about:blank] 04:01:42 INFO - --DOMWINDOW == 27 (0x128381800) [pid = 1722] [serial = 1206] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-600183-charset.html] 04:01:42 INFO - MEMORY STAT | vsize 3402MB | residentFast 478MB | heapAllocated 117MB 04:01:42 INFO - 259 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601177_log_levels.js | took 2552ms 04:01:42 INFO - ++DOCSHELL 0x112604000 == 12 [pid = 1722] [id = 508] 04:01:42 INFO - ++DOMWINDOW == 28 (0x113445800) [pid = 1722] [serial = 1217] [outer = 0x0] 04:01:42 INFO - ++DOMWINDOW == 29 (0x11344e800) [pid = 1722] [serial = 1218] [outer = 0x113445800] 04:01:42 INFO - 260 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601352_scroll.js 04:01:42 INFO - ++DOCSHELL 0x11346c000 == 13 [pid = 1722] [id = 509] 04:01:42 INFO - ++DOMWINDOW == 30 (0x11e798c00) [pid = 1722] [serial = 1219] [outer = 0x0] 04:01:42 INFO - ++DOMWINDOW == 31 (0x11ebb6c00) [pid = 1722] [serial = 1220] [outer = 0x11e798c00] 04:01:42 INFO - ++DOCSHELL 0x112cbc000 == 14 [pid = 1722] [id = 510] 04:01:42 INFO - ++DOMWINDOW == 32 (0x11ebba400) [pid = 1722] [serial = 1221] [outer = 0x0] 04:01:42 INFO - ++DOMWINDOW == 33 (0x1203dd400) [pid = 1722] [serial = 1222] [outer = 0x11ebba400] 04:01:43 INFO - ++DOMWINDOW == 34 (0x120fe3c00) [pid = 1722] [serial = 1223] [outer = 0x11ebba400] 04:01:43 INFO - ++DOCSHELL 0x11eeba000 == 15 [pid = 1722] [id = 511] 04:01:43 INFO - ++DOMWINDOW == 35 (0x1214b1000) [pid = 1722] [serial = 1224] [outer = 0x0] 04:01:43 INFO - ++DOMWINDOW == 36 (0x1214b7c00) [pid = 1722] [serial = 1225] [outer = 0x1214b1000] 04:01:44 INFO - console.debug: 04:01:44 INFO - rectNode 04:01:44 INFO - DOMRect 04:01:44 INFO - - prototype DOMRect 04:01:44 INFO - - height = 20 04:01:44 INFO - - width = 7433.33349609375 04:01:44 INFO - - x = 0 04:01:44 INFO - - y = 167 04:01:44 INFO - - prototype DOMRectReadOnly 04:01:44 INFO - - bottom = 187 04:01:44 INFO - - left = 0 04:01:44 INFO - - right = 7433.33349609375 04:01:44 INFO - - top = 167 04:01:44 INFO - - prototype Object 04:01:44 INFO - rectOutput 04:01:44 INFO - DOMRect 04:01:44 INFO - - prototype DOMRect 04:01:44 INFO - - height = 178 04:01:44 INFO - - width = 1200 04:01:44 INFO - - x = 0 04:01:44 INFO - - y = 24 04:01:44 INFO - - prototype DOMRectReadOnly 04:01:44 INFO - - bottom = 202 04:01:44 INFO - - left = 0 04:01:44 INFO - - right = 1200 04:01:44 INFO - - top = 24 04:01:44 INFO - - prototype Object 04:01:44 INFO - console.log: scrollNode scrollHeight 2060 scrollTop 1897 clientHeight 163 04:01:45 INFO - --DOCSHELL 0x112cbd000 == 14 [pid = 1722] [id = 504] 04:01:45 INFO - --DOCSHELL 0x11346d800 == 13 [pid = 1722] [id = 505] 04:01:45 INFO - --DOCSHELL 0x113319800 == 12 [pid = 1722] [id = 506] 04:01:45 INFO - --DOCSHELL 0x11eeba000 == 11 [pid = 1722] [id = 511] 04:01:45 INFO - --DOMWINDOW == 35 (0x120ff8c00) [pid = 1722] [serial = 1203] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:45 INFO - --DOMWINDOW == 34 (0x121828c00) [pid = 1722] [serial = 1205] [outer = 0x0] [url = about:blank] 04:01:45 INFO - --DOMWINDOW == 33 (0x11ee51800) [pid = 1722] [serial = 1211] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:45 INFO - --DOMWINDOW == 32 (0x113449c00) [pid = 1722] [serial = 1207] [outer = 0x0] [url = about:blank] 04:01:45 INFO - --DOMWINDOW == 31 (0x112f4cc00) [pid = 1722] [serial = 1209] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html] 04:01:45 INFO - --DOMWINDOW == 30 (0x1214b1400) [pid = 1722] [serial = 1214] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:45 INFO - --DOMWINDOW == 29 (0x11344e400) [pid = 1722] [serial = 1208] [outer = 0x0] [url = about:blank] 04:01:45 INFO - --DOMWINDOW == 28 (0x11ebc0400) [pid = 1722] [serial = 1210] [outer = 0x0] [url = about:blank] 04:01:45 INFO - --DOMWINDOW == 27 (0x1203dd400) [pid = 1722] [serial = 1222] [outer = 0x0] [url = about:blank] 04:01:45 INFO - --DOMWINDOW == 26 (0x12837dc00) [pid = 1722] [serial = 1216] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html] 04:01:45 INFO - MEMORY STAT | vsize 3402MB | residentFast 478MB | heapAllocated 117MB 04:01:45 INFO - 261 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601352_scroll.js | took 2858ms 04:01:45 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 512] 04:01:45 INFO - ++DOMWINDOW == 27 (0x112f4d400) [pid = 1722] [serial = 1226] [outer = 0x0] 04:01:45 INFO - ++DOMWINDOW == 28 (0x113262800) [pid = 1722] [serial = 1227] [outer = 0x112f4d400] 04:01:45 INFO - 262 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601667_filter_buttons.js 04:01:45 INFO - ++DOCSHELL 0x11345b800 == 13 [pid = 1722] [id = 513] 04:01:45 INFO - ++DOMWINDOW == 29 (0x113d0fc00) [pid = 1722] [serial = 1228] [outer = 0x0] 04:01:45 INFO - ++DOMWINDOW == 30 (0x114b2a400) [pid = 1722] [serial = 1229] [outer = 0x113d0fc00] 04:01:45 INFO - ++DOMWINDOW == 31 (0x11ebb6400) [pid = 1722] [serial = 1230] [outer = 0x113d0fc00] 04:01:46 INFO - ++DOCSHELL 0x112619800 == 14 [pid = 1722] [id = 514] 04:01:46 INFO - ++DOMWINDOW == 32 (0x12025ac00) [pid = 1722] [serial = 1231] [outer = 0x0] 04:01:46 INFO - ++DOMWINDOW == 33 (0x120265800) [pid = 1722] [serial = 1232] [outer = 0x12025ac00] 04:01:46 INFO - ++DOMWINDOW == 34 (0x120d24c00) [pid = 1722] [serial = 1233] [outer = 0x12025ac00] 04:01:46 INFO - ++DOCSHELL 0x11eeba000 == 15 [pid = 1722] [id = 515] 04:01:46 INFO - ++DOMWINDOW == 35 (0x1214aec00) [pid = 1722] [serial = 1234] [outer = 0x0] 04:01:46 INFO - ++DOMWINDOW == 36 (0x1214b2800) [pid = 1722] [serial = 1235] [outer = 0x1214aec00] 04:01:48 INFO - --DOCSHELL 0x112604000 == 14 [pid = 1722] [id = 508] 04:01:48 INFO - --DOCSHELL 0x11346c000 == 13 [pid = 1722] [id = 509] 04:01:48 INFO - --DOCSHELL 0x112cbc000 == 12 [pid = 1722] [id = 510] 04:01:48 INFO - --DOCSHELL 0x11eeba000 == 11 [pid = 1722] [id = 515] 04:01:48 INFO - --DOMWINDOW == 35 (0x12152b400) [pid = 1722] [serial = 1215] [outer = 0x0] [url = about:blank] 04:01:48 INFO - --DOMWINDOW == 34 (0x120fe6400) [pid = 1722] [serial = 1213] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:48 INFO - --DOMWINDOW == 33 (0x114b2a400) [pid = 1722] [serial = 1229] [outer = 0x0] [url = about:blank] 04:01:48 INFO - --DOMWINDOW == 32 (0x11ebb6c00) [pid = 1722] [serial = 1220] [outer = 0x0] [url = about:blank] 04:01:48 INFO - --DOMWINDOW == 31 (0x11344e800) [pid = 1722] [serial = 1218] [outer = 0x0] [url = about:blank] 04:01:48 INFO - --DOMWINDOW == 30 (0x120265800) [pid = 1722] [serial = 1232] [outer = 0x0] [url = about:blank] 04:01:48 INFO - --DOMWINDOW == 29 (0x11e798c00) [pid = 1722] [serial = 1219] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20601352] 04:01:48 INFO - --DOMWINDOW == 28 (0x113445800) [pid = 1722] [serial = 1217] [outer = 0x0] [url = about:blank] 04:01:48 INFO - MEMORY STAT | vsize 3401MB | residentFast 478MB | heapAllocated 117MB 04:01:48 INFO - 263 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601667_filter_buttons.js | took 2858ms 04:01:48 INFO - ++DOCSHELL 0x112ccf000 == 12 [pid = 1722] [id = 516] 04:01:48 INFO - ++DOMWINDOW == 29 (0x112f46c00) [pid = 1722] [serial = 1236] [outer = 0x0] 04:01:48 INFO - ++DOMWINDOW == 30 (0x113448000) [pid = 1722] [serial = 1237] [outer = 0x112f46c00] 04:01:48 INFO - 264 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_603750_websocket.js 04:01:48 INFO - ++DOCSHELL 0x11346b000 == 13 [pid = 1722] [id = 517] 04:01:48 INFO - ++DOMWINDOW == 31 (0x113450000) [pid = 1722] [serial = 1238] [outer = 0x0] 04:01:48 INFO - ++DOMWINDOW == 32 (0x114b2a400) [pid = 1722] [serial = 1239] [outer = 0x113450000] 04:01:48 INFO - ++DOCSHELL 0x112cce800 == 14 [pid = 1722] [id = 518] 04:01:48 INFO - ++DOMWINDOW == 33 (0x114dbc800) [pid = 1722] [serial = 1240] [outer = 0x0] 04:01:48 INFO - ++DOMWINDOW == 34 (0x11eefb000) [pid = 1722] [serial = 1241] [outer = 0x114dbc800] 04:01:48 INFO - ++DOMWINDOW == 35 (0x120d1a000) [pid = 1722] [serial = 1242] [outer = 0x114dbc800] 04:01:49 INFO - ++DOCSHELL 0x11ee49000 == 15 [pid = 1722] [id = 519] 04:01:49 INFO - ++DOMWINDOW == 36 (0x121314000) [pid = 1722] [serial = 1243] [outer = 0x0] 04:01:49 INFO - ++DOMWINDOW == 37 (0x121317800) [pid = 1722] [serial = 1244] [outer = 0x121314000] 04:01:49 INFO - ++DOMWINDOW == 38 (0x128310000) [pid = 1722] [serial = 1245] [outer = 0x113450000] 04:01:49 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:01:49 INFO - ++DOCSHELL 0x120e0f000 == 16 [pid = 1722] [id = 520] 04:01:49 INFO - ++DOMWINDOW == 39 (0x1214b2400) [pid = 1722] [serial = 1246] [outer = 0x0] 04:01:49 INFO - ++DOMWINDOW == 40 (0x1214b4c00) [pid = 1722] [serial = 1247] [outer = 0x1214b2400] 04:01:50 INFO - --DOCSHELL 0x11345b800 == 15 [pid = 1722] [id = 513] 04:01:50 INFO - --DOCSHELL 0x112cc4000 == 14 [pid = 1722] [id = 512] 04:01:50 INFO - --DOCSHELL 0x112619800 == 13 [pid = 1722] [id = 514] 04:01:50 INFO - --DOCSHELL 0x11ee49000 == 12 [pid = 1722] [id = 519] 04:01:51 INFO - --DOMWINDOW == 39 (0x11ebb6400) [pid = 1722] [serial = 1230] [outer = 0x0] [url = http://example.com/] 04:01:51 INFO - --DOMWINDOW == 38 (0x113262800) [pid = 1722] [serial = 1227] [outer = 0x0] [url = about:blank] 04:01:51 INFO - --DOMWINDOW == 37 (0x11eefb000) [pid = 1722] [serial = 1241] [outer = 0x0] [url = about:blank] 04:01:51 INFO - --DOMWINDOW == 36 (0x12025ac00) [pid = 1722] [serial = 1231] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:51 INFO - --DOMWINDOW == 35 (0x1214aec00) [pid = 1722] [serial = 1234] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:51 INFO - --DOMWINDOW == 34 (0x113d0fc00) [pid = 1722] [serial = 1228] [outer = 0x0] [url = http://example.com/] 04:01:51 INFO - --DOMWINDOW == 33 (0x112f4d400) [pid = 1722] [serial = 1226] [outer = 0x0] [url = about:blank] 04:01:51 INFO - MEMORY STAT | vsize 3400MB | residentFast 478MB | heapAllocated 117MB 04:01:51 INFO - 265 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_603750_websocket.js | took 2593ms 04:01:51 INFO - ++DOCSHELL 0x112604000 == 13 [pid = 1722] [id = 521] 04:01:51 INFO - ++DOMWINDOW == 34 (0x11344d800) [pid = 1722] [serial = 1248] [outer = 0x0] 04:01:51 INFO - ++DOMWINDOW == 35 (0x11e719000) [pid = 1722] [serial = 1249] [outer = 0x11344d800] 04:01:51 INFO - 266 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_611795.js 04:01:51 INFO - ++DOCSHELL 0x113e49800 == 14 [pid = 1722] [id = 522] 04:01:51 INFO - ++DOMWINDOW == 36 (0x11ebbb800) [pid = 1722] [serial = 1250] [outer = 0x0] 04:01:51 INFO - ++DOMWINDOW == 37 (0x11ee59c00) [pid = 1722] [serial = 1251] [outer = 0x11ebbb800] 04:01:51 INFO - ++DOCSHELL 0x112e7e800 == 15 [pid = 1722] [id = 523] 04:01:51 INFO - ++DOMWINDOW == 38 (0x11ef14800) [pid = 1722] [serial = 1252] [outer = 0x0] 04:01:51 INFO - ++DOMWINDOW == 39 (0x120d16400) [pid = 1722] [serial = 1253] [outer = 0x11ef14800] 04:01:51 INFO - ++DOMWINDOW == 40 (0x120fee000) [pid = 1722] [serial = 1254] [outer = 0x11ef14800] 04:01:51 INFO - ++DOCSHELL 0x11f64a000 == 16 [pid = 1722] [id = 524] 04:01:51 INFO - ++DOMWINDOW == 41 (0x12180ac00) [pid = 1722] [serial = 1255] [outer = 0x0] 04:01:51 INFO - ++DOMWINDOW == 42 (0x122120c00) [pid = 1722] [serial = 1256] [outer = 0x12180ac00] 04:01:52 INFO - ++DOMWINDOW == 43 (0x124c3bc00) [pid = 1722] [serial = 1257] [outer = 0x11ebbb800] 04:01:53 INFO - --DOCSHELL 0x120e0f000 == 15 [pid = 1722] [id = 520] 04:01:53 INFO - --DOCSHELL 0x112ccf000 == 14 [pid = 1722] [id = 516] 04:01:53 INFO - --DOCSHELL 0x112cce800 == 13 [pid = 1722] [id = 518] 04:01:53 INFO - --DOCSHELL 0x11f64a000 == 12 [pid = 1722] [id = 524] 04:01:53 INFO - --DOCSHELL 0x11346b000 == 11 [pid = 1722] [id = 517] 04:01:53 INFO - --DOMWINDOW == 42 (0x120d24c00) [pid = 1722] [serial = 1233] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:53 INFO - --DOMWINDOW == 41 (0x1214b2800) [pid = 1722] [serial = 1235] [outer = 0x0] [url = about:blank] 04:01:53 INFO - --DOMWINDOW == 40 (0x120d16400) [pid = 1722] [serial = 1253] [outer = 0x0] [url = about:blank] 04:01:53 INFO - --DOMWINDOW == 39 (0x113448000) [pid = 1722] [serial = 1237] [outer = 0x0] [url = about:blank] 04:01:53 INFO - --DOMWINDOW == 38 (0x114b2a400) [pid = 1722] [serial = 1239] [outer = 0x0] [url = about:blank] 04:01:53 INFO - --DOMWINDOW == 37 (0x1214b4c00) [pid = 1722] [serial = 1247] [outer = 0x0] [url = about:blank] 04:01:53 INFO - --DOMWINDOW == 36 (0x11ee59c00) [pid = 1722] [serial = 1251] [outer = 0x0] [url = about:blank] 04:01:53 INFO - --DOMWINDOW == 35 (0x114dbc800) [pid = 1722] [serial = 1240] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:53 INFO - --DOMWINDOW == 34 (0x121314000) [pid = 1722] [serial = 1243] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:53 INFO - --DOMWINDOW == 33 (0x112f46c00) [pid = 1722] [serial = 1236] [outer = 0x0] [url = about:blank] 04:01:53 INFO - --DOMWINDOW == 32 (0x113450000) [pid = 1722] [serial = 1238] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-603750-websocket.html] 04:01:53 INFO - --DOMWINDOW == 31 (0x1214b2400) [pid = 1722] [serial = 1246] [outer = 0x0] [url = data:text/html;charset=utf-8,hello%20world!] 04:01:53 INFO - --DOMWINDOW == 30 (0x128310000) [pid = 1722] [serial = 1245] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-603750-websocket.html] 04:01:53 INFO - MEMORY STAT | vsize 3400MB | residentFast 478MB | heapAllocated 117MB 04:01:53 INFO - 267 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_611795.js | took 2337ms 04:01:53 INFO - ++DOCSHELL 0x112cbe000 == 12 [pid = 1722] [id = 525] 04:01:53 INFO - ++DOMWINDOW == 31 (0x113262800) [pid = 1722] [serial = 1258] [outer = 0x0] 04:01:53 INFO - ++DOMWINDOW == 32 (0x113445800) [pid = 1722] [serial = 1259] [outer = 0x113262800] 04:01:53 INFO - 268 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613013_console_api_iframe.js 04:01:53 INFO - ++DOCSHELL 0x113466000 == 13 [pid = 1722] [id = 526] 04:01:53 INFO - ++DOMWINDOW == 33 (0x114dbb000) [pid = 1722] [serial = 1260] [outer = 0x0] 04:01:53 INFO - ++DOMWINDOW == 34 (0x11e719400) [pid = 1722] [serial = 1261] [outer = 0x114dbb000] 04:01:53 INFO - ++DOMWINDOW == 35 (0x11f5cc000) [pid = 1722] [serial = 1262] [outer = 0x114dbb000] 04:01:54 INFO - ++DOCSHELL 0x112e80000 == 14 [pid = 1722] [id = 527] 04:01:54 INFO - ++DOMWINDOW == 36 (0x11315bc00) [pid = 1722] [serial = 1263] [outer = 0x0] 04:01:54 INFO - ++DOMWINDOW == 37 (0x1203e5000) [pid = 1722] [serial = 1264] [outer = 0x11315bc00] 04:01:54 INFO - ++DOCSHELL 0x112e85000 == 15 [pid = 1722] [id = 528] 04:01:54 INFO - ++DOMWINDOW == 38 (0x120e2e800) [pid = 1722] [serial = 1265] [outer = 0x0] 04:01:54 INFO - ++DOMWINDOW == 39 (0x120e32000) [pid = 1722] [serial = 1266] [outer = 0x120e2e800] 04:01:54 INFO - ++DOMWINDOW == 40 (0x121108800) [pid = 1722] [serial = 1267] [outer = 0x120e2e800] 04:01:54 INFO - ++DOCSHELL 0x12017b000 == 16 [pid = 1722] [id = 529] 04:01:54 INFO - ++DOMWINDOW == 41 (0x121811400) [pid = 1722] [serial = 1268] [outer = 0x0] 04:01:54 INFO - ++DOMWINDOW == 42 (0x122121400) [pid = 1722] [serial = 1269] [outer = 0x121811400] 04:01:55 INFO - ++DOMWINDOW == 43 (0x121317400) [pid = 1722] [serial = 1270] [outer = 0x114dbb000] 04:01:55 INFO - ++DOCSHELL 0x11efd3000 == 17 [pid = 1722] [id = 530] 04:01:55 INFO - ++DOMWINDOW == 44 (0x1214b0400) [pid = 1722] [serial = 1271] [outer = 0x0] 04:01:55 INFO - [1722] WARNING: No inner window available!: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9246 04:01:55 INFO - --DOCSHELL 0x113e49800 == 16 [pid = 1722] [id = 522] 04:01:55 INFO - --DOCSHELL 0x112604000 == 15 [pid = 1722] [id = 521] 04:01:55 INFO - --DOCSHELL 0x12017b000 == 14 [pid = 1722] [id = 529] 04:01:55 INFO - --DOCSHELL 0x112e7e800 == 13 [pid = 1722] [id = 523] 04:01:55 INFO - --DOMWINDOW == 43 (0x121317800) [pid = 1722] [serial = 1244] [outer = 0x0] [url = about:blank] 04:01:55 INFO - --DOMWINDOW == 42 (0x120d1a000) [pid = 1722] [serial = 1242] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:55 INFO - ++DOMWINDOW == 43 (0x110d59000) [pid = 1722] [serial = 1272] [outer = 0x1214b0400] 04:01:56 INFO - --DOMWINDOW == 42 (0x11e719400) [pid = 1722] [serial = 1261] [outer = 0x0] [url = about:blank] 04:01:56 INFO - --DOMWINDOW == 41 (0x124c3bc00) [pid = 1722] [serial = 1257] [outer = 0x0] [url = data:text/html;charset=utf-8,<div%20style="-moz-opacity:0;">test%20repeated%20css%20warnings</div><p%20style="-moz-opacity:0">hi</p>] 04:01:56 INFO - --DOMWINDOW == 40 (0x11e719000) [pid = 1722] [serial = 1249] [outer = 0x0] [url = about:blank] 04:01:56 INFO - --DOMWINDOW == 39 (0x120e32000) [pid = 1722] [serial = 1266] [outer = 0x0] [url = about:blank] 04:01:56 INFO - --DOMWINDOW == 38 (0x11ef14800) [pid = 1722] [serial = 1252] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:56 INFO - --DOMWINDOW == 37 (0x12180ac00) [pid = 1722] [serial = 1255] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:56 INFO - --DOMWINDOW == 36 (0x11ebbb800) [pid = 1722] [serial = 1250] [outer = 0x0] [url = data:text/html;charset=utf-8,<div%20style="-moz-opacity:0;">test%20repeated%20css%20warnings</div><p%20style="-moz-opacity:0">hi</p>] 04:01:56 INFO - --DOMWINDOW == 35 (0x11344d800) [pid = 1722] [serial = 1248] [outer = 0x0] [url = about:blank] 04:01:56 INFO - MEMORY STAT | vsize 3399MB | residentFast 477MB | heapAllocated 117MB 04:01:56 INFO - 269 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613013_console_api_iframe.js | took 2321ms 04:01:56 INFO - ++DOCSHELL 0x112cd1000 == 14 [pid = 1722] [id = 531] 04:01:56 INFO - ++DOMWINDOW == 36 (0x113161400) [pid = 1722] [serial = 1273] [outer = 0x0] 04:01:56 INFO - ++DOMWINDOW == 37 (0x113447800) [pid = 1722] [serial = 1274] [outer = 0x113161400] 04:01:56 INFO - 270 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613280_jsterm_copy.js 04:01:56 INFO - ++DOCSHELL 0x113512800 == 15 [pid = 1722] [id = 532] 04:01:56 INFO - ++DOMWINDOW == 38 (0x113e11000) [pid = 1722] [serial = 1275] [outer = 0x0] 04:01:56 INFO - ++DOMWINDOW == 39 (0x114dbec00) [pid = 1722] [serial = 1276] [outer = 0x113e11000] 04:01:56 INFO - ++DOCSHELL 0x114b80800 == 16 [pid = 1722] [id = 533] 04:01:56 INFO - ++DOMWINDOW == 40 (0x112f44000) [pid = 1722] [serial = 1277] [outer = 0x0] 04:01:56 INFO - ++DOMWINDOW == 41 (0x11ef13000) [pid = 1722] [serial = 1278] [outer = 0x112f44000] 04:01:56 INFO - ++DOMWINDOW == 42 (0x120e23800) [pid = 1722] [serial = 1279] [outer = 0x112f44000] 04:01:56 INFO - ++DOCSHELL 0x120175000 == 17 [pid = 1722] [id = 534] 04:01:56 INFO - ++DOMWINDOW == 43 (0x1214aac00) [pid = 1722] [serial = 1280] [outer = 0x0] 04:01:56 INFO - ++DOMWINDOW == 44 (0x1214af800) [pid = 1722] [serial = 1281] [outer = 0x1214aac00] 04:01:58 INFO - --DOCSHELL 0x11efd3000 == 16 [pid = 1722] [id = 530] 04:01:58 INFO - --DOCSHELL 0x112e80000 == 15 [pid = 1722] [id = 527] 04:01:58 INFO - --DOCSHELL 0x112e85000 == 14 [pid = 1722] [id = 528] 04:01:58 INFO - --DOCSHELL 0x120175000 == 13 [pid = 1722] [id = 534] 04:01:58 INFO - --DOCSHELL 0x113466000 == 12 [pid = 1722] [id = 526] 04:01:58 INFO - --DOMWINDOW == 43 (0x122120c00) [pid = 1722] [serial = 1256] [outer = 0x0] [url = about:blank] 04:01:58 INFO - --DOMWINDOW == 42 (0x120fee000) [pid = 1722] [serial = 1254] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:58 INFO - --DOMWINDOW == 41 (0x1203e5000) [pid = 1722] [serial = 1264] [outer = 0x0] [url = data:text/html;charset=utf-8,little%20iframe] 04:01:58 INFO - --DOMWINDOW == 40 (0x110d59000) [pid = 1722] [serial = 1272] [outer = 0x0] [url = data:text/html;charset=utf-8,little%20iframe] 04:01:58 INFO - --DOMWINDOW == 39 (0x113445800) [pid = 1722] [serial = 1259] [outer = 0x0] [url = about:blank] 04:01:58 INFO - --DOMWINDOW == 38 (0x11ef13000) [pid = 1722] [serial = 1278] [outer = 0x0] [url = about:blank] 04:01:58 INFO - --DOMWINDOW == 37 (0x120e2e800) [pid = 1722] [serial = 1265] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:01:58 INFO - --DOMWINDOW == 36 (0x121811400) [pid = 1722] [serial = 1268] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:01:58 INFO - --DOMWINDOW == 35 (0x114dbb000) [pid = 1722] [serial = 1260] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html] 04:01:58 INFO - --DOMWINDOW == 34 (0x11315bc00) [pid = 1722] [serial = 1263] [outer = 0x0] [url = data:text/html;charset=utf-8,little%20iframe] 04:01:58 INFO - --DOMWINDOW == 33 (0x1214b0400) [pid = 1722] [serial = 1271] [outer = 0x0] [url = data:text/html;charset=utf-8,little%20iframe] 04:01:58 INFO - --DOMWINDOW == 32 (0x113262800) [pid = 1722] [serial = 1258] [outer = 0x0] [url = about:blank] 04:01:58 INFO - --DOMWINDOW == 31 (0x121317400) [pid = 1722] [serial = 1270] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html] 04:01:58 INFO - --DOMWINDOW == 30 (0x11f5cc000) [pid = 1722] [serial = 1262] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html] 04:01:58 INFO - MEMORY STAT | vsize 3398MB | residentFast 477MB | heapAllocated 116MB 04:01:58 INFO - 271 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613280_jsterm_copy.js | took 2077ms 04:01:58 INFO - ++DOCSHELL 0x112cc5800 == 13 [pid = 1722] [id = 535] 04:01:58 INFO - ++DOMWINDOW == 31 (0x112f4a800) [pid = 1722] [serial = 1282] [outer = 0x0] 04:01:58 INFO - ++DOMWINDOW == 32 (0x113262800) [pid = 1722] [serial = 1283] [outer = 0x112f4a800] 04:01:58 INFO - 272 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613642_maintain_scroll.js 04:01:58 INFO - ++DOCSHELL 0x11346f800 == 14 [pid = 1722] [id = 536] 04:01:58 INFO - ++DOMWINDOW == 33 (0x113e08400) [pid = 1722] [serial = 1284] [outer = 0x0] 04:01:58 INFO - ++DOMWINDOW == 34 (0x114dbc800) [pid = 1722] [serial = 1285] [outer = 0x113e08400] 04:01:58 INFO - ++DOCSHELL 0x112ccf800 == 15 [pid = 1722] [id = 537] 04:01:58 INFO - ++DOMWINDOW == 35 (0x11ee59c00) [pid = 1722] [serial = 1286] [outer = 0x0] 04:01:58 INFO - ++DOMWINDOW == 36 (0x11ef13000) [pid = 1722] [serial = 1287] [outer = 0x11ee59c00] 04:01:58 INFO - ++DOMWINDOW == 37 (0x120d21c00) [pid = 1722] [serial = 1288] [outer = 0x11ee59c00] 04:01:58 INFO - ++DOCSHELL 0x11efdb000 == 16 [pid = 1722] [id = 538] 04:01:58 INFO - ++DOMWINDOW == 38 (0x121317400) [pid = 1722] [serial = 1289] [outer = 0x0] 04:01:58 INFO - ++DOMWINDOW == 39 (0x1214a9000) [pid = 1722] [serial = 1290] [outer = 0x121317400] 04:02:01 INFO - --DOCSHELL 0x112cd1000 == 15 [pid = 1722] [id = 531] 04:02:01 INFO - --DOCSHELL 0x112cbe000 == 14 [pid = 1722] [id = 525] 04:02:01 INFO - --DOCSHELL 0x113512800 == 13 [pid = 1722] [id = 532] 04:02:01 INFO - --DOCSHELL 0x114b80800 == 12 [pid = 1722] [id = 533] 04:02:01 INFO - --DOCSHELL 0x11efdb000 == 11 [pid = 1722] [id = 538] 04:02:01 INFO - --DOMWINDOW == 38 (0x122121400) [pid = 1722] [serial = 1269] [outer = 0x0] [url = about:blank] 04:02:01 INFO - --DOMWINDOW == 37 (0x121108800) [pid = 1722] [serial = 1267] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:01 INFO - --DOMWINDOW == 36 (0x11ef13000) [pid = 1722] [serial = 1287] [outer = 0x0] [url = about:blank] 04:02:01 INFO - --DOMWINDOW == 35 (0x112f44000) [pid = 1722] [serial = 1277] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:01 INFO - --DOMWINDOW == 34 (0x1214aac00) [pid = 1722] [serial = 1280] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:01 INFO - --DOMWINDOW == 33 (0x113e11000) [pid = 1722] [serial = 1275] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613280] 04:02:01 INFO - --DOMWINDOW == 32 (0x113161400) [pid = 1722] [serial = 1273] [outer = 0x0] [url = about:blank] 04:02:01 INFO - --DOMWINDOW == 31 (0x114dbec00) [pid = 1722] [serial = 1276] [outer = 0x0] [url = about:blank] 04:02:01 INFO - --DOMWINDOW == 30 (0x113447800) [pid = 1722] [serial = 1274] [outer = 0x0] [url = about:blank] 04:02:01 INFO - MEMORY STAT | vsize 3402MB | residentFast 477MB | heapAllocated 121MB 04:02:01 INFO - 273 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613642_maintain_scroll.js | took 3345ms 04:02:01 INFO - ++DOCSHELL 0x112cc6800 == 12 [pid = 1722] [id = 539] 04:02:01 INFO - ++DOMWINDOW == 31 (0x1132e9400) [pid = 1722] [serial = 1291] [outer = 0x0] 04:02:01 INFO - ++DOMWINDOW == 32 (0x113447800) [pid = 1722] [serial = 1292] [outer = 0x1132e9400] 04:02:01 INFO - 274 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613642_prune_scroll.js 04:02:01 INFO - ++DOCSHELL 0x113511800 == 13 [pid = 1722] [id = 540] 04:02:01 INFO - ++DOMWINDOW == 33 (0x114b23800) [pid = 1722] [serial = 1293] [outer = 0x0] 04:02:01 INFO - ++DOMWINDOW == 34 (0x11d472400) [pid = 1722] [serial = 1294] [outer = 0x114b23800] 04:02:02 INFO - ++DOCSHELL 0x112cb7800 == 14 [pid = 1722] [id = 541] 04:02:02 INFO - ++DOMWINDOW == 35 (0x11e7a4800) [pid = 1722] [serial = 1295] [outer = 0x0] 04:02:02 INFO - ++DOMWINDOW == 36 (0x11f5ccc00) [pid = 1722] [serial = 1296] [outer = 0x11e7a4800] 04:02:02 INFO - ++DOMWINDOW == 37 (0x12025b800) [pid = 1722] [serial = 1297] [outer = 0x11e7a4800] 04:02:02 INFO - ++DOCSHELL 0x11f63a800 == 15 [pid = 1722] [id = 542] 04:02:02 INFO - ++DOMWINDOW == 38 (0x1214b1400) [pid = 1722] [serial = 1298] [outer = 0x0] 04:02:02 INFO - ++DOMWINDOW == 39 (0x1215dc400) [pid = 1722] [serial = 1299] [outer = 0x1214b1400] 04:02:04 INFO - --DOCSHELL 0x112cc5800 == 14 [pid = 1722] [id = 535] 04:02:04 INFO - --DOCSHELL 0x11346f800 == 13 [pid = 1722] [id = 536] 04:02:04 INFO - --DOCSHELL 0x11f63a800 == 12 [pid = 1722] [id = 542] 04:02:04 INFO - --DOCSHELL 0x112ccf800 == 11 [pid = 1722] [id = 537] 04:02:05 INFO - --DOMWINDOW == 38 (0x120e23800) [pid = 1722] [serial = 1279] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:05 INFO - --DOMWINDOW == 37 (0x1214af800) [pid = 1722] [serial = 1281] [outer = 0x0] [url = about:blank] 04:02:05 INFO - --DOMWINDOW == 36 (0x11f5ccc00) [pid = 1722] [serial = 1296] [outer = 0x0] [url = about:blank] 04:02:05 INFO - --DOMWINDOW == 35 (0x121317400) [pid = 1722] [serial = 1289] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:05 INFO - --DOMWINDOW == 34 (0x11ee59c00) [pid = 1722] [serial = 1286] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:05 INFO - --DOMWINDOW == 33 (0x113e08400) [pid = 1722] [serial = 1284] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613642:%20remember%20scroll%20location] 04:02:05 INFO - --DOMWINDOW == 32 (0x112f4a800) [pid = 1722] [serial = 1282] [outer = 0x0] [url = about:blank] 04:02:05 INFO - --DOMWINDOW == 31 (0x114dbc800) [pid = 1722] [serial = 1285] [outer = 0x0] [url = about:blank] 04:02:05 INFO - --DOMWINDOW == 30 (0x113262800) [pid = 1722] [serial = 1283] [outer = 0x0] [url = about:blank] 04:02:05 INFO - MEMORY STAT | vsize 3403MB | residentFast 478MB | heapAllocated 121MB 04:02:05 INFO - 275 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613642_prune_scroll.js | took 3364ms 04:02:05 INFO - ++DOCSHELL 0x1128cb000 == 12 [pid = 1722] [id = 543] 04:02:05 INFO - ++DOMWINDOW == 31 (0x113444400) [pid = 1722] [serial = 1300] [outer = 0x0] 04:02:05 INFO - ++DOMWINDOW == 32 (0x11344c400) [pid = 1722] [serial = 1301] [outer = 0x113444400] 04:02:05 INFO - 276 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_614793_jsterm_scroll.js 04:02:05 INFO - ++DOCSHELL 0x11351c800 == 13 [pid = 1722] [id = 544] 04:02:05 INFO - ++DOMWINDOW == 33 (0x114dbd800) [pid = 1722] [serial = 1302] [outer = 0x0] 04:02:05 INFO - ++DOMWINDOW == 34 (0x11e7ae800) [pid = 1722] [serial = 1303] [outer = 0x114dbd800] 04:02:05 INFO - ++DOCSHELL 0x112951000 == 14 [pid = 1722] [id = 545] 04:02:05 INFO - ++DOMWINDOW == 35 (0x11ebb6400) [pid = 1722] [serial = 1304] [outer = 0x0] 04:02:05 INFO - ++DOMWINDOW == 36 (0x11f719400) [pid = 1722] [serial = 1305] [outer = 0x11ebb6400] 04:02:05 INFO - ++DOMWINDOW == 37 (0x120e29c00) [pid = 1722] [serial = 1306] [outer = 0x11ebb6400] 04:02:05 INFO - ++DOCSHELL 0x11f63d000 == 15 [pid = 1722] [id = 546] 04:02:05 INFO - ++DOMWINDOW == 38 (0x1214aec00) [pid = 1722] [serial = 1307] [outer = 0x0] 04:02:05 INFO - ++DOMWINDOW == 39 (0x1214b2c00) [pid = 1722] [serial = 1308] [outer = 0x1214aec00] 04:02:08 INFO - --DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 539] 04:02:08 INFO - --DOCSHELL 0x113511800 == 13 [pid = 1722] [id = 540] 04:02:08 INFO - --DOCSHELL 0x112cb7800 == 12 [pid = 1722] [id = 541] 04:02:08 INFO - --DOCSHELL 0x11f63d000 == 11 [pid = 1722] [id = 546] 04:02:08 INFO - --DOMWINDOW == 38 (0x1214a9000) [pid = 1722] [serial = 1290] [outer = 0x0] [url = about:blank] 04:02:08 INFO - --DOMWINDOW == 37 (0x120d21c00) [pid = 1722] [serial = 1288] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:08 INFO - --DOMWINDOW == 36 (0x11f719400) [pid = 1722] [serial = 1305] [outer = 0x0] [url = about:blank] 04:02:08 INFO - --DOMWINDOW == 35 (0x11e7a4800) [pid = 1722] [serial = 1295] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:08 INFO - --DOMWINDOW == 34 (0x1214b1400) [pid = 1722] [serial = 1298] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:08 INFO - --DOMWINDOW == 33 (0x114b23800) [pid = 1722] [serial = 1293] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613642:%20maintain%20scroll%20with%20pruning%20of%20old%20messages] 04:02:08 INFO - --DOMWINDOW == 32 (0x1132e9400) [pid = 1722] [serial = 1291] [outer = 0x0] [url = about:blank] 04:02:08 INFO - --DOMWINDOW == 31 (0x11d472400) [pid = 1722] [serial = 1294] [outer = 0x0] [url = about:blank] 04:02:08 INFO - --DOMWINDOW == 30 (0x113447800) [pid = 1722] [serial = 1292] [outer = 0x0] [url = about:blank] 04:02:08 INFO - MEMORY STAT | vsize 3403MB | residentFast 478MB | heapAllocated 121MB 04:02:08 INFO - 277 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_614793_jsterm_scroll.js | took 3430ms 04:02:08 INFO - ++DOCSHELL 0x112cca000 == 12 [pid = 1722] [id = 547] 04:02:08 INFO - ++DOMWINDOW == 31 (0x113161800) [pid = 1722] [serial = 1309] [outer = 0x0] 04:02:08 INFO - ++DOMWINDOW == 32 (0x113445800) [pid = 1722] [serial = 1310] [outer = 0x113161800] 04:02:08 INFO - 278 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_618078_network_exceptions.js 04:02:09 INFO - ++DOCSHELL 0x113518800 == 13 [pid = 1722] [id = 548] 04:02:09 INFO - ++DOMWINDOW == 33 (0x114b2dc00) [pid = 1722] [serial = 1311] [outer = 0x0] 04:02:09 INFO - ++DOMWINDOW == 34 (0x11e719000) [pid = 1722] [serial = 1312] [outer = 0x114b2dc00] 04:02:09 INFO - ++DOCSHELL 0x112e7c000 == 14 [pid = 1722] [id = 549] 04:02:09 INFO - ++DOMWINDOW == 35 (0x11e7a4800) [pid = 1722] [serial = 1313] [outer = 0x0] 04:02:09 INFO - ++DOMWINDOW == 36 (0x11f719400) [pid = 1722] [serial = 1314] [outer = 0x11e7a4800] 04:02:09 INFO - ++DOMWINDOW == 37 (0x120e2e800) [pid = 1722] [serial = 1315] [outer = 0x11e7a4800] 04:02:09 INFO - ++DOCSHELL 0x12017b800 == 15 [pid = 1722] [id = 550] 04:02:09 INFO - ++DOMWINDOW == 38 (0x1214af800) [pid = 1722] [serial = 1316] [outer = 0x0] 04:02:09 INFO - ++DOMWINDOW == 39 (0x1214b5400) [pid = 1722] [serial = 1317] [outer = 0x1214af800] 04:02:10 INFO - ++DOMWINDOW == 40 (0x1283f4000) [pid = 1722] [serial = 1318] [outer = 0x114b2dc00] 04:02:10 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:02:10 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html, line 14: ReferenceError: bug618078exception is not defined 04:02:11 INFO - --DOCSHELL 0x1128cb000 == 14 [pid = 1722] [id = 543] 04:02:11 INFO - --DOCSHELL 0x11351c800 == 13 [pid = 1722] [id = 544] 04:02:11 INFO - --DOCSHELL 0x12017b800 == 12 [pid = 1722] [id = 550] 04:02:11 INFO - --DOCSHELL 0x112951000 == 11 [pid = 1722] [id = 545] 04:02:11 INFO - --DOMWINDOW == 39 (0x12025b800) [pid = 1722] [serial = 1297] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:11 INFO - --DOMWINDOW == 38 (0x1215dc400) [pid = 1722] [serial = 1299] [outer = 0x0] [url = about:blank] 04:02:11 INFO - --DOMWINDOW == 37 (0x11e7ae800) [pid = 1722] [serial = 1303] [outer = 0x0] [url = about:blank] 04:02:11 INFO - --DOMWINDOW == 36 (0x11344c400) [pid = 1722] [serial = 1301] [outer = 0x0] [url = about:blank] 04:02:11 INFO - --DOMWINDOW == 35 (0x11f719400) [pid = 1722] [serial = 1314] [outer = 0x0] [url = about:blank] 04:02:11 INFO - --DOMWINDOW == 34 (0x11ebb6400) [pid = 1722] [serial = 1304] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:11 INFO - --DOMWINDOW == 33 (0x1214aec00) [pid = 1722] [serial = 1307] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:11 INFO - --DOMWINDOW == 32 (0x114dbd800) [pid = 1722] [serial = 1302] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20614793:%20jsterm%20result%20scroll] 04:02:11 INFO - --DOMWINDOW == 31 (0x113444400) [pid = 1722] [serial = 1300] [outer = 0x0] [url = about:blank] 04:02:11 INFO - MEMORY STAT | vsize 3403MB | residentFast 477MB | heapAllocated 121MB 04:02:11 INFO - 279 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_618078_network_exceptions.js | took 2496ms 04:02:11 INFO - ++DOCSHELL 0x112ba9000 == 12 [pid = 1722] [id = 551] 04:02:11 INFO - ++DOMWINDOW == 32 (0x114dbc800) [pid = 1722] [serial = 1319] [outer = 0x0] 04:02:11 INFO - ++DOMWINDOW == 33 (0x11e78a800) [pid = 1722] [serial = 1320] [outer = 0x114dbc800] 04:02:11 INFO - 280 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_621644_jsterm_dollar.js 04:02:11 INFO - ++DOCSHELL 0x115180800 == 13 [pid = 1722] [id = 552] 04:02:11 INFO - ++DOMWINDOW == 34 (0x11344a800) [pid = 1722] [serial = 1321] [outer = 0x0] 04:02:11 INFO - ++DOMWINDOW == 35 (0x11f70e000) [pid = 1722] [serial = 1322] [outer = 0x11344a800] 04:02:11 INFO - ++DOMWINDOW == 36 (0x1203e6c00) [pid = 1722] [serial = 1323] [outer = 0x11344a800] 04:02:11 INFO - ++DOCSHELL 0x112e8b800 == 14 [pid = 1722] [id = 553] 04:02:11 INFO - ++DOMWINDOW == 37 (0x120e2b400) [pid = 1722] [serial = 1324] [outer = 0x0] 04:02:11 INFO - ++DOMWINDOW == 38 (0x120e2c800) [pid = 1722] [serial = 1325] [outer = 0x120e2b400] 04:02:12 INFO - ++DOMWINDOW == 39 (0x12110b400) [pid = 1722] [serial = 1326] [outer = 0x120e2b400] 04:02:12 INFO - ++DOCSHELL 0x121850800 == 15 [pid = 1722] [id = 554] 04:02:12 INFO - ++DOMWINDOW == 40 (0x122120400) [pid = 1722] [serial = 1327] [outer = 0x0] 04:02:12 INFO - ++DOMWINDOW == 41 (0x1221bdc00) [pid = 1722] [serial = 1328] [outer = 0x122120400] 04:02:13 INFO - --DOCSHELL 0x112cca000 == 14 [pid = 1722] [id = 547] 04:02:13 INFO - --DOCSHELL 0x113518800 == 13 [pid = 1722] [id = 548] 04:02:13 INFO - --DOCSHELL 0x112e7c000 == 12 [pid = 1722] [id = 549] 04:02:13 INFO - --DOCSHELL 0x121850800 == 11 [pid = 1722] [id = 554] 04:02:13 INFO - --DOMWINDOW == 40 (0x120e29c00) [pid = 1722] [serial = 1306] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:13 INFO - --DOMWINDOW == 39 (0x1214b2c00) [pid = 1722] [serial = 1308] [outer = 0x0] [url = about:blank] 04:02:13 INFO - --DOMWINDOW == 38 (0x11f70e000) [pid = 1722] [serial = 1322] [outer = 0x0] [url = about:blank] 04:02:13 INFO - --DOMWINDOW == 37 (0x11e719000) [pid = 1722] [serial = 1312] [outer = 0x0] [url = about:blank] 04:02:13 INFO - --DOMWINDOW == 36 (0x113445800) [pid = 1722] [serial = 1310] [outer = 0x0] [url = about:blank] 04:02:13 INFO - --DOMWINDOW == 35 (0x120e2c800) [pid = 1722] [serial = 1325] [outer = 0x0] [url = about:blank] 04:02:13 INFO - --DOMWINDOW == 34 (0x1214af800) [pid = 1722] [serial = 1316] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:13 INFO - --DOMWINDOW == 33 (0x11e7a4800) [pid = 1722] [serial = 1313] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:13 INFO - --DOMWINDOW == 32 (0x114b2dc00) [pid = 1722] [serial = 1311] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html] 04:02:13 INFO - --DOMWINDOW == 31 (0x113161800) [pid = 1722] [serial = 1309] [outer = 0x0] [url = about:blank] 04:02:13 INFO - --DOMWINDOW == 30 (0x1283f4000) [pid = 1722] [serial = 1318] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html] 04:02:13 INFO - MEMORY STAT | vsize 3403MB | residentFast 478MB | heapAllocated 120MB 04:02:13 INFO - 281 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_621644_jsterm_dollar.js | took 2261ms 04:02:13 INFO - ++DOCSHELL 0x112ccd000 == 12 [pid = 1722] [id = 555] 04:02:13 INFO - ++DOMWINDOW == 31 (0x113161800) [pid = 1722] [serial = 1329] [outer = 0x0] 04:02:13 INFO - ++DOMWINDOW == 32 (0x113444400) [pid = 1722] [serial = 1330] [outer = 0x113161800] 04:02:14 INFO - 282 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_622303_persistent_filters.js 04:02:14 INFO - ++DOCSHELL 0x113472800 == 13 [pid = 1722] [id = 556] 04:02:14 INFO - ++DOMWINDOW == 33 (0x114dbb000) [pid = 1722] [serial = 1331] [outer = 0x0] 04:02:14 INFO - ++DOMWINDOW == 34 (0x11e7ab800) [pid = 1722] [serial = 1332] [outer = 0x114dbb000] 04:02:14 INFO - ++DOMWINDOW == 35 (0x11f70f000) [pid = 1722] [serial = 1333] [outer = 0x114dbb000] 04:02:14 INFO - ++DOCSHELL 0x112cc0800 == 14 [pid = 1722] [id = 557] 04:02:14 INFO - ++DOMWINDOW == 36 (0x112f45400) [pid = 1722] [serial = 1334] [outer = 0x0] 04:02:14 INFO - ++DOMWINDOW == 37 (0x1202ee000) [pid = 1722] [serial = 1335] [outer = 0x112f45400] 04:02:14 INFO - ++DOMWINDOW == 38 (0x120e31c00) [pid = 1722] [serial = 1336] [outer = 0x112f45400] 04:02:14 INFO - ++DOCSHELL 0x120dcd000 == 15 [pid = 1722] [id = 558] 04:02:14 INFO - ++DOMWINDOW == 39 (0x12152bc00) [pid = 1722] [serial = 1337] [outer = 0x0] 04:02:14 INFO - ++DOMWINDOW == 40 (0x121811000) [pid = 1722] [serial = 1338] [outer = 0x12152bc00] 04:02:15 INFO - --DOCSHELL 0x115180800 == 14 [pid = 1722] [id = 552] 04:02:15 INFO - --DOCSHELL 0x112ba9000 == 13 [pid = 1722] [id = 551] 04:02:15 INFO - --DOCSHELL 0x120dcd000 == 12 [pid = 1722] [id = 558] 04:02:15 INFO - --DOCSHELL 0x112e8b800 == 11 [pid = 1722] [id = 553] 04:02:15 INFO - --DOMWINDOW == 39 (0x1214b5400) [pid = 1722] [serial = 1317] [outer = 0x0] [url = about:blank] 04:02:15 INFO - --DOMWINDOW == 38 (0x120e2e800) [pid = 1722] [serial = 1315] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:15 INFO - ++DOCSHELL 0x112b9d000 == 12 [pid = 1722] [id = 559] 04:02:15 INFO - ++DOMWINDOW == 39 (0x110d59800) [pid = 1722] [serial = 1339] [outer = 0x0] 04:02:15 INFO - ++DOMWINDOW == 40 (0x11265d800) [pid = 1722] [serial = 1340] [outer = 0x110d59800] 04:02:15 INFO - --DOMWINDOW == 39 (0x11e7ab800) [pid = 1722] [serial = 1332] [outer = 0x0] [url = about:blank] 04:02:15 INFO - --DOMWINDOW == 38 (0x11e78a800) [pid = 1722] [serial = 1320] [outer = 0x0] [url = about:blank] 04:02:15 INFO - --DOMWINDOW == 37 (0x1202ee000) [pid = 1722] [serial = 1335] [outer = 0x0] [url = about:blank] 04:02:15 INFO - --DOMWINDOW == 36 (0x122120400) [pid = 1722] [serial = 1327] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:15 INFO - --DOMWINDOW == 35 (0x120e2b400) [pid = 1722] [serial = 1324] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:15 INFO - --DOMWINDOW == 34 (0x11344a800) [pid = 1722] [serial = 1321] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-621644-jsterm-dollar.html] 04:02:15 INFO - --DOMWINDOW == 33 (0x114dbc800) [pid = 1722] [serial = 1319] [outer = 0x0] [url = about:blank] 04:02:15 INFO - --DOMWINDOW == 32 (0x1203e6c00) [pid = 1722] [serial = 1323] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-621644-jsterm-dollar.html] 04:02:15 INFO - ++DOMWINDOW == 33 (0x11344b800) [pid = 1722] [serial = 1341] [outer = 0x110d59800] 04:02:16 INFO - ++DOCSHELL 0x113e44000 == 13 [pid = 1722] [id = 560] 04:02:16 INFO - ++DOMWINDOW == 34 (0x120e29c00) [pid = 1722] [serial = 1342] [outer = 0x0] 04:02:16 INFO - ++DOMWINDOW == 35 (0x120e30800) [pid = 1722] [serial = 1343] [outer = 0x120e29c00] 04:02:17 INFO - --DOCSHELL 0x112cc0800 == 12 [pid = 1722] [id = 557] 04:02:17 INFO - --DOCSHELL 0x113e44000 == 11 [pid = 1722] [id = 560] 04:02:17 INFO - --DOMWINDOW == 34 (0x1221bdc00) [pid = 1722] [serial = 1328] [outer = 0x0] [url = about:blank] 04:02:17 INFO - --DOMWINDOW == 33 (0x12110b400) [pid = 1722] [serial = 1326] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:17 INFO - ++DOCSHELL 0x11284f800 == 12 [pid = 1722] [id = 561] 04:02:17 INFO - ++DOMWINDOW == 34 (0x110d57c00) [pid = 1722] [serial = 1344] [outer = 0x0] 04:02:17 INFO - ++DOMWINDOW == 35 (0x11280d800) [pid = 1722] [serial = 1345] [outer = 0x110d57c00] 04:02:17 INFO - --DOMWINDOW == 34 (0x11265d800) [pid = 1722] [serial = 1340] [outer = 0x0] [url = about:blank] 04:02:17 INFO - ++DOMWINDOW == 35 (0x11344e400) [pid = 1722] [serial = 1346] [outer = 0x110d57c00] 04:02:17 INFO - ++DOCSHELL 0x11346a000 == 13 [pid = 1722] [id = 562] 04:02:17 INFO - ++DOMWINDOW == 36 (0x120e25800) [pid = 1722] [serial = 1347] [outer = 0x0] 04:02:17 INFO - ++DOMWINDOW == 37 (0x120e2e800) [pid = 1722] [serial = 1348] [outer = 0x120e25800] 04:02:18 INFO - --DOCSHELL 0x112b9d000 == 12 [pid = 1722] [id = 559] 04:02:18 INFO - --DOCSHELL 0x11346a000 == 11 [pid = 1722] [id = 562] 04:02:18 INFO - --DOMWINDOW == 36 (0x11280d800) [pid = 1722] [serial = 1345] [outer = 0x0] [url = about:blank] 04:02:19 INFO - MEMORY STAT | vsize 3400MB | residentFast 475MB | heapAllocated 120MB 04:02:19 INFO - 283 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_622303_persistent_filters.js | took 5040ms 04:02:19 INFO - ++DOCSHELL 0x112cc6800 == 12 [pid = 1722] [id = 563] 04:02:19 INFO - ++DOMWINDOW == 37 (0x112f4c000) [pid = 1722] [serial = 1349] [outer = 0x0] 04:02:19 INFO - ++DOMWINDOW == 38 (0x113445800) [pid = 1722] [serial = 1350] [outer = 0x112f4c000] 04:02:19 INFO - 284 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_630733_response_redirect_headers.js 04:02:19 INFO - ++DOCSHELL 0x113473800 == 13 [pid = 1722] [id = 564] 04:02:19 INFO - ++DOMWINDOW == 39 (0x11d470800) [pid = 1722] [serial = 1351] [outer = 0x0] 04:02:19 INFO - ++DOMWINDOW == 40 (0x11ebb9400) [pid = 1722] [serial = 1352] [outer = 0x11d470800] 04:02:19 INFO - ++DOCSHELL 0x112cd4000 == 14 [pid = 1722] [id = 565] 04:02:19 INFO - ++DOMWINDOW == 41 (0x11ee17000) [pid = 1722] [serial = 1353] [outer = 0x0] 04:02:19 INFO - ++DOMWINDOW == 42 (0x1202e6000) [pid = 1722] [serial = 1354] [outer = 0x11ee17000] 04:02:19 INFO - ++DOMWINDOW == 43 (0x120fe6800) [pid = 1722] [serial = 1355] [outer = 0x11ee17000] 04:02:19 INFO - ++DOCSHELL 0x120d2d800 == 15 [pid = 1722] [id = 566] 04:02:19 INFO - ++DOMWINDOW == 44 (0x122124400) [pid = 1722] [serial = 1356] [outer = 0x0] 04:02:19 INFO - ++DOMWINDOW == 45 (0x1221bb000) [pid = 1722] [serial = 1357] [outer = 0x122124400] 04:02:20 INFO - ++DOMWINDOW == 46 (0x128380000) [pid = 1722] [serial = 1358] [outer = 0x11d470800] 04:02:20 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:02:21 INFO - --DOCSHELL 0x112ccd000 == 14 [pid = 1722] [id = 555] 04:02:21 INFO - --DOCSHELL 0x11284f800 == 13 [pid = 1722] [id = 561] 04:02:21 INFO - --DOCSHELL 0x113472800 == 12 [pid = 1722] [id = 556] 04:02:21 INFO - --DOCSHELL 0x120d2d800 == 11 [pid = 1722] [id = 566] 04:02:21 INFO - --DOMWINDOW == 45 (0x11f70f000) [pid = 1722] [serial = 1333] [outer = 0x0] [url = about:blank] 04:02:21 INFO - --DOMWINDOW == 44 (0x113444400) [pid = 1722] [serial = 1330] [outer = 0x0] [url = about:blank] 04:02:21 INFO - --DOMWINDOW == 43 (0x1202e6000) [pid = 1722] [serial = 1354] [outer = 0x0] [url = about:blank] 04:02:21 INFO - --DOMWINDOW == 42 (0x12152bc00) [pid = 1722] [serial = 1337] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:21 INFO - --DOMWINDOW == 41 (0x110d57c00) [pid = 1722] [serial = 1344] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:21 INFO - --DOMWINDOW == 40 (0x120e29c00) [pid = 1722] [serial = 1342] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:21 INFO - --DOMWINDOW == 39 (0x112f45400) [pid = 1722] [serial = 1334] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:21 INFO - --DOMWINDOW == 38 (0x120e25800) [pid = 1722] [serial = 1347] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:21 INFO - --DOMWINDOW == 37 (0x114dbb000) [pid = 1722] [serial = 1331] [outer = 0x0] [url = about:blank] 04:02:21 INFO - --DOMWINDOW == 36 (0x113161800) [pid = 1722] [serial = 1329] [outer = 0x0] [url = about:blank] 04:02:21 INFO - --DOMWINDOW == 35 (0x110d59800) [pid = 1722] [serial = 1339] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:21 INFO - MEMORY STAT | vsize 3401MB | residentFast 476MB | heapAllocated 121MB 04:02:21 INFO - 285 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_630733_response_redirect_headers.js | took 2451ms 04:02:21 INFO - ++DOCSHELL 0x11359a000 == 12 [pid = 1722] [id = 567] 04:02:21 INFO - ++DOMWINDOW == 36 (0x114dbc800) [pid = 1722] [serial = 1359] [outer = 0x0] 04:02:21 INFO - ++DOMWINDOW == 37 (0x11e7af000) [pid = 1722] [serial = 1360] [outer = 0x114dbc800] 04:02:21 INFO - 286 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632275_getters_document_width.js 04:02:21 INFO - ++DOCSHELL 0x11efd0800 == 13 [pid = 1722] [id = 568] 04:02:21 INFO - ++DOMWINDOW == 38 (0x12025b800) [pid = 1722] [serial = 1361] [outer = 0x0] 04:02:21 INFO - ++DOMWINDOW == 39 (0x1203df400) [pid = 1722] [serial = 1362] [outer = 0x12025b800] 04:02:21 INFO - ++DOMWINDOW == 40 (0x120e26000) [pid = 1722] [serial = 1363] [outer = 0x12025b800] 04:02:21 INFO - ++DOCSHELL 0x120d46800 == 14 [pid = 1722] [id = 569] 04:02:21 INFO - ++DOMWINDOW == 41 (0x120ffc000) [pid = 1722] [serial = 1364] [outer = 0x0] 04:02:21 INFO - ++DOMWINDOW == 42 (0x12110c800) [pid = 1722] [serial = 1365] [outer = 0x120ffc000] 04:02:22 INFO - ++DOMWINDOW == 43 (0x121317800) [pid = 1722] [serial = 1366] [outer = 0x120ffc000] 04:02:22 INFO - ++DOCSHELL 0x124aaf000 == 15 [pid = 1722] [id = 570] 04:02:22 INFO - ++DOMWINDOW == 44 (0x122e9e000) [pid = 1722] [serial = 1367] [outer = 0x0] 04:02:22 INFO - ++DOMWINDOW == 45 (0x122ea3c00) [pid = 1722] [serial = 1368] [outer = 0x122e9e000] 04:02:23 INFO - ++DOCSHELL 0x124f18800 == 16 [pid = 1722] [id = 571] 04:02:23 INFO - ++DOMWINDOW == 46 (0x121805800) [pid = 1722] [serial = 1369] [outer = 0x0] 04:02:23 INFO - ++DOMWINDOW == 47 (0x126241000) [pid = 1722] [serial = 1370] [outer = 0x121805800] 04:02:23 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 04:02:24 INFO - --DOCSHELL 0x124f18800 == 15 [pid = 1722] [id = 571] 04:02:24 INFO - --DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 563] 04:02:24 INFO - --DOCSHELL 0x113473800 == 13 [pid = 1722] [id = 564] 04:02:24 INFO - --DOCSHELL 0x112cd4000 == 12 [pid = 1722] [id = 565] 04:02:24 INFO - --DOCSHELL 0x124aaf000 == 11 [pid = 1722] [id = 570] 04:02:24 INFO - --DOMWINDOW == 46 (0x120e31c00) [pid = 1722] [serial = 1336] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:24 INFO - --DOMWINDOW == 45 (0x121811000) [pid = 1722] [serial = 1338] [outer = 0x0] [url = about:blank] 04:02:24 INFO - --DOMWINDOW == 44 (0x11344e400) [pid = 1722] [serial = 1346] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:24 INFO - --DOMWINDOW == 43 (0x120e2e800) [pid = 1722] [serial = 1348] [outer = 0x0] [url = about:blank] 04:02:24 INFO - --DOMWINDOW == 42 (0x11344b800) [pid = 1722] [serial = 1341] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:24 INFO - --DOMWINDOW == 41 (0x120e30800) [pid = 1722] [serial = 1343] [outer = 0x0] [url = about:blank] 04:02:25 INFO - --DOMWINDOW == 40 (0x12110c800) [pid = 1722] [serial = 1365] [outer = 0x0] [url = about:blank] 04:02:25 INFO - --DOMWINDOW == 39 (0x113445800) [pid = 1722] [serial = 1350] [outer = 0x0] [url = about:blank] 04:02:25 INFO - --DOMWINDOW == 38 (0x11ebb9400) [pid = 1722] [serial = 1352] [outer = 0x0] [url = about:blank] 04:02:25 INFO - --DOMWINDOW == 37 (0x128380000) [pid = 1722] [serial = 1358] [outer = 0x0] [url = http://example.com/redirect-from-bug-630733] 04:02:25 INFO - --DOMWINDOW == 36 (0x1203df400) [pid = 1722] [serial = 1362] [outer = 0x0] [url = about:blank] 04:02:25 INFO - --DOMWINDOW == 35 (0x11ee17000) [pid = 1722] [serial = 1353] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:25 INFO - --DOMWINDOW == 34 (0x122124400) [pid = 1722] [serial = 1356] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:25 INFO - --DOMWINDOW == 33 (0x112f4c000) [pid = 1722] [serial = 1349] [outer = 0x0] [url = about:blank] 04:02:25 INFO - --DOMWINDOW == 32 (0x11d470800) [pid = 1722] [serial = 1351] [outer = 0x0] [url = http://example.com/redirect-from-bug-630733] 04:02:25 INFO - MEMORY STAT | vsize 3403MB | residentFast 478MB | heapAllocated 123MB 04:02:25 INFO - 287 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632275_getters_document_width.js | took 3570ms 04:02:25 INFO - ++DOCSHELL 0x112ccf000 == 12 [pid = 1722] [id = 572] 04:02:25 INFO - ++DOMWINDOW == 33 (0x112f4c000) [pid = 1722] [serial = 1371] [outer = 0x0] 04:02:25 INFO - ++DOMWINDOW == 34 (0x113444400) [pid = 1722] [serial = 1372] [outer = 0x112f4c000] 04:02:25 INFO - 288 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632347_iterators_generators.js 04:02:25 INFO - ++DOCSHELL 0x11351f000 == 13 [pid = 1722] [id = 573] 04:02:25 INFO - ++DOMWINDOW == 35 (0x11d466000) [pid = 1722] [serial = 1373] [outer = 0x0] 04:02:25 INFO - ++DOMWINDOW == 36 (0x11e7ab800) [pid = 1722] [serial = 1374] [outer = 0x11d466000] 04:02:25 INFO - ++DOMWINDOW == 37 (0x12025b000) [pid = 1722] [serial = 1375] [outer = 0x11d466000] 04:02:25 INFO - ++DOCSHELL 0x1140d2000 == 14 [pid = 1722] [id = 574] 04:02:25 INFO - ++DOMWINDOW == 38 (0x120e24c00) [pid = 1722] [serial = 1376] [outer = 0x0] 04:02:25 INFO - ++DOMWINDOW == 39 (0x120e26400) [pid = 1722] [serial = 1377] [outer = 0x120e24c00] 04:02:25 INFO - ++DOMWINDOW == 40 (0x120ff8400) [pid = 1722] [serial = 1378] [outer = 0x120e24c00] 04:02:25 INFO - ++DOCSHELL 0x121854000 == 15 [pid = 1722] [id = 575] 04:02:25 INFO - ++DOMWINDOW == 41 (0x12211f800) [pid = 1722] [serial = 1379] [outer = 0x0] 04:02:25 INFO - ++DOMWINDOW == 42 (0x122124c00) [pid = 1722] [serial = 1380] [outer = 0x12211f800] 04:02:27 INFO - ++DOCSHELL 0x11346a000 == 16 [pid = 1722] [id = 576] 04:02:27 INFO - ++DOMWINDOW == 43 (0x120e29c00) [pid = 1722] [serial = 1381] [outer = 0x0] 04:02:27 INFO - ++DOMWINDOW == 44 (0x121316800) [pid = 1722] [serial = 1382] [outer = 0x120e29c00] 04:02:27 INFO - --DOCSHELL 0x1140d2000 == 15 [pid = 1722] [id = 574] 04:02:27 INFO - --DOCSHELL 0x121854000 == 14 [pid = 1722] [id = 575] 04:02:27 INFO - --DOCSHELL 0x11359a000 == 13 [pid = 1722] [id = 567] 04:02:27 INFO - --DOCSHELL 0x11346a000 == 12 [pid = 1722] [id = 576] 04:02:27 INFO - --DOCSHELL 0x120d46800 == 11 [pid = 1722] [id = 569] 04:02:27 INFO - --DOCSHELL 0x11efd0800 == 10 [pid = 1722] [id = 568] 04:02:27 INFO - --DOMWINDOW == 43 (0x1221bb000) [pid = 1722] [serial = 1357] [outer = 0x0] [url = about:blank] 04:02:27 INFO - --DOMWINDOW == 42 (0x120fe6800) [pid = 1722] [serial = 1355] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:28 INFO - --DOMWINDOW == 41 (0x121805800) [pid = 1722] [serial = 1369] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:02:28 INFO - --DOMWINDOW == 40 (0x114dbc800) [pid = 1722] [serial = 1359] [outer = 0x0] [url = about:blank] 04:02:28 INFO - --DOMWINDOW == 39 (0x12025b800) [pid = 1722] [serial = 1361] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632275-getters.html] 04:02:28 INFO - --DOMWINDOW == 38 (0x11e7ab800) [pid = 1722] [serial = 1374] [outer = 0x0] [url = about:blank] 04:02:28 INFO - --DOMWINDOW == 37 (0x11e7af000) [pid = 1722] [serial = 1360] [outer = 0x0] [url = about:blank] 04:02:28 INFO - --DOMWINDOW == 36 (0x120e26400) [pid = 1722] [serial = 1377] [outer = 0x0] [url = about:blank] 04:02:28 INFO - --DOMWINDOW == 35 (0x122e9e000) [pid = 1722] [serial = 1367] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:28 INFO - --DOMWINDOW == 34 (0x120ffc000) [pid = 1722] [serial = 1364] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:28 INFO - MEMORY STAT | vsize 3402MB | residentFast 477MB | heapAllocated 122MB 04:02:28 INFO - 289 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632347_iterators_generators.js | took 2826ms 04:02:28 INFO - ++DOCSHELL 0x112cc6800 == 11 [pid = 1722] [id = 577] 04:02:28 INFO - ++DOMWINDOW == 35 (0x112f4b400) [pid = 1722] [serial = 1383] [outer = 0x0] 04:02:28 INFO - ++DOMWINDOW == 36 (0x113444800) [pid = 1722] [serial = 1384] [outer = 0x112f4b400] 04:02:28 INFO - 290 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632817.js 04:02:28 INFO - ++DOCSHELL 0x11321f800 == 12 [pid = 1722] [id = 578] 04:02:28 INFO - ++DOMWINDOW == 37 (0x11f5cc800) [pid = 1722] [serial = 1385] [outer = 0x0] 04:02:28 INFO - ++DOMWINDOW == 38 (0x120262800) [pid = 1722] [serial = 1386] [outer = 0x11f5cc800] 04:02:28 INFO - ++DOCSHELL 0x11eecb800 == 13 [pid = 1722] [id = 579] 04:02:28 INFO - ++DOMWINDOW == 39 (0x120258c00) [pid = 1722] [serial = 1387] [outer = 0x0] 04:02:28 INFO - ++DOMWINDOW == 40 (0x120ff4800) [pid = 1722] [serial = 1388] [outer = 0x120258c00] 04:02:28 INFO - ++DOMWINDOW == 41 (0x121316400) [pid = 1722] [serial = 1389] [outer = 0x120258c00] 04:02:28 INFO - ++DOCSHELL 0x12188b000 == 14 [pid = 1722] [id = 580] 04:02:28 INFO - ++DOMWINDOW == 42 (0x1225d9800) [pid = 1722] [serial = 1390] [outer = 0x0] 04:02:28 INFO - ++DOMWINDOW == 43 (0x122d4b000) [pid = 1722] [serial = 1391] [outer = 0x1225d9800] 04:02:29 INFO - ++DOMWINDOW == 44 (0x1283eb000) [pid = 1722] [serial = 1392] [outer = 0x11f5cc800] 04:02:29 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:02:30 INFO - ++DOMWINDOW == 45 (0x126408400) [pid = 1722] [serial = 1393] [outer = 0x11f5cc800] 04:02:30 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:02:30 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:02:30 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:02:30 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:02:30 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:02:30 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:02:30 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:02:30 INFO - JavaScript error: resource://gre/modules/LoginManagerParent.jsm, line 185: TypeError: this._recipeManager is null 04:02:30 INFO - ++DOMWINDOW == 46 (0x1276ad800) [pid = 1722] [serial = 1394] [outer = 0x11f5cc800] 04:02:30 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:02:31 INFO - --DOCSHELL 0x11351f000 == 13 [pid = 1722] [id = 573] 04:02:31 INFO - --DOCSHELL 0x112ccf000 == 12 [pid = 1722] [id = 572] 04:02:31 INFO - --DOCSHELL 0x12188b000 == 11 [pid = 1722] [id = 580] 04:02:31 INFO - --DOMWINDOW == 45 (0x121317800) [pid = 1722] [serial = 1366] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:31 INFO - --DOMWINDOW == 44 (0x122ea3c00) [pid = 1722] [serial = 1368] [outer = 0x0] [url = about:blank] 04:02:31 INFO - --DOMWINDOW == 43 (0x126241000) [pid = 1722] [serial = 1370] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:02:31 INFO - --DOMWINDOW == 42 (0x120e26000) [pid = 1722] [serial = 1363] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632275-getters.html] 04:02:31 INFO - --DOMWINDOW == 41 (0x113444400) [pid = 1722] [serial = 1372] [outer = 0x0] [url = about:blank] 04:02:31 INFO - --DOMWINDOW == 40 (0x120ff4800) [pid = 1722] [serial = 1388] [outer = 0x0] [url = about:blank] 04:02:31 INFO - --DOMWINDOW == 39 (0x120e24c00) [pid = 1722] [serial = 1376] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:31 INFO - --DOMWINDOW == 38 (0x12211f800) [pid = 1722] [serial = 1379] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:31 INFO - --DOMWINDOW == 37 (0x112f4c000) [pid = 1722] [serial = 1371] [outer = 0x0] [url = about:blank] 04:02:31 INFO - --DOMWINDOW == 36 (0x11d466000) [pid = 1722] [serial = 1373] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632347-iterators-generators.html] 04:02:31 INFO - --DOMWINDOW == 35 (0x120e29c00) [pid = 1722] [serial = 1381] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:02:31 INFO - --DOMWINDOW == 34 (0x12025b000) [pid = 1722] [serial = 1375] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632347-iterators-generators.html] 04:02:31 INFO - --DOMWINDOW == 33 (0x1283eb000) [pid = 1722] [serial = 1392] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:02:32 INFO - MEMORY STAT | vsize 3403MB | residentFast 478MB | heapAllocated 122MB 04:02:32 INFO - 291 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632817.js | took 3715ms 04:02:32 INFO - ++DOCSHELL 0x113468800 == 12 [pid = 1722] [id = 581] 04:02:32 INFO - ++DOMWINDOW == 34 (0x11344f800) [pid = 1722] [serial = 1395] [outer = 0x0] 04:02:32 INFO - ++DOMWINDOW == 35 (0x114b20000) [pid = 1722] [serial = 1396] [outer = 0x11344f800] 04:02:32 INFO - 292 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_642108_pruneTest.js 04:02:32 INFO - ++DOCSHELL 0x11ee49800 == 13 [pid = 1722] [id = 582] 04:02:32 INFO - ++DOMWINDOW == 36 (0x11ebb7c00) [pid = 1722] [serial = 1397] [outer = 0x0] 04:02:32 INFO - ++DOMWINDOW == 37 (0x11f110800) [pid = 1722] [serial = 1398] [outer = 0x11ebb7c00] 04:02:32 INFO - ++DOCSHELL 0x113467800 == 14 [pid = 1722] [id = 583] 04:02:32 INFO - ++DOMWINDOW == 38 (0x11f5cd000) [pid = 1722] [serial = 1399] [outer = 0x0] 04:02:32 INFO - ++DOMWINDOW == 39 (0x120d1e000) [pid = 1722] [serial = 1400] [outer = 0x11f5cd000] 04:02:32 INFO - ++DOMWINDOW == 40 (0x120ffd800) [pid = 1722] [serial = 1401] [outer = 0x11f5cd000] 04:02:32 INFO - ++DOCSHELL 0x12218b000 == 15 [pid = 1722] [id = 584] 04:02:32 INFO - ++DOMWINDOW == 41 (0x12211d800) [pid = 1722] [serial = 1402] [outer = 0x0] 04:02:32 INFO - ++DOMWINDOW == 42 (0x1221b0800) [pid = 1722] [serial = 1403] [outer = 0x12211d800] 04:02:34 INFO - --DOCSHELL 0x12218b000 == 14 [pid = 1722] [id = 584] 04:02:34 INFO - --DOCSHELL 0x11321f800 == 13 [pid = 1722] [id = 578] 04:02:34 INFO - --DOCSHELL 0x112cc6800 == 12 [pid = 1722] [id = 577] 04:02:34 INFO - --DOCSHELL 0x11eecb800 == 11 [pid = 1722] [id = 579] 04:02:34 INFO - --DOMWINDOW == 41 (0x122124c00) [pid = 1722] [serial = 1380] [outer = 0x0] [url = about:blank] 04:02:34 INFO - --DOMWINDOW == 40 (0x120ff8400) [pid = 1722] [serial = 1378] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:34 INFO - --DOMWINDOW == 39 (0x121316800) [pid = 1722] [serial = 1382] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:02:34 INFO - --DOMWINDOW == 38 (0x120262800) [pid = 1722] [serial = 1386] [outer = 0x0] [url = about:blank] 04:02:34 INFO - --DOMWINDOW == 37 (0x113444800) [pid = 1722] [serial = 1384] [outer = 0x0] [url = about:blank] 04:02:34 INFO - --DOMWINDOW == 36 (0x120d1e000) [pid = 1722] [serial = 1400] [outer = 0x0] [url = about:blank] 04:02:34 INFO - --DOMWINDOW == 35 (0x120258c00) [pid = 1722] [serial = 1387] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:34 INFO - --DOMWINDOW == 34 (0x1225d9800) [pid = 1722] [serial = 1390] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:34 INFO - --DOMWINDOW == 33 (0x11f5cc800) [pid = 1722] [serial = 1385] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:02:34 INFO - --DOMWINDOW == 32 (0x112f4b400) [pid = 1722] [serial = 1383] [outer = 0x0] [url = about:blank] 04:02:34 INFO - MEMORY STAT | vsize 3404MB | residentFast 479MB | heapAllocated 121MB 04:02:34 INFO - 293 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_642108_pruneTest.js | took 2227ms 04:02:34 INFO - ++DOCSHELL 0x112cd2800 == 12 [pid = 1722] [id = 585] 04:02:34 INFO - ++DOMWINDOW == 33 (0x113195c00) [pid = 1722] [serial = 1404] [outer = 0x0] 04:02:34 INFO - ++DOMWINDOW == 34 (0x11344e400) [pid = 1722] [serial = 1405] [outer = 0x113195c00] 04:02:34 INFO - 294 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_644419_log_limits.js 04:02:34 INFO - ++DOCSHELL 0x113e34800 == 13 [pid = 1722] [id = 586] 04:02:34 INFO - ++DOMWINDOW == 35 (0x11ebb5400) [pid = 1722] [serial = 1406] [outer = 0x0] 04:02:34 INFO - ++DOMWINDOW == 36 (0x11f111400) [pid = 1722] [serial = 1407] [outer = 0x11ebb5400] 04:02:34 INFO - ++DOCSHELL 0x112ccf800 == 14 [pid = 1722] [id = 587] 04:02:34 INFO - ++DOMWINDOW == 37 (0x11f70f000) [pid = 1722] [serial = 1408] [outer = 0x0] 04:02:34 INFO - ++DOMWINDOW == 38 (0x120e24c00) [pid = 1722] [serial = 1409] [outer = 0x11f70f000] 04:02:34 INFO - ++DOMWINDOW == 39 (0x121108800) [pid = 1722] [serial = 1410] [outer = 0x11f70f000] 04:02:35 INFO - ++DOCSHELL 0x120eb8800 == 15 [pid = 1722] [id = 588] 04:02:35 INFO - ++DOMWINDOW == 40 (0x12211c000) [pid = 1722] [serial = 1411] [outer = 0x0] 04:02:35 INFO - ++DOMWINDOW == 41 (0x122124800) [pid = 1722] [serial = 1412] [outer = 0x12211c000] 04:02:35 INFO - ++DOMWINDOW == 42 (0x1283eec00) [pid = 1722] [serial = 1413] [outer = 0x11ebb5400] 04:02:35 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:02:35 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 15: ReferenceError: bar is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar0 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar1 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar2 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar3 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar4 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar5 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar6 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar7 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar8 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar9 is not defined 04:02:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar10 is not defined 04:02:37 INFO - --DOCSHELL 0x113468800 == 14 [pid = 1722] [id = 581] 04:02:37 INFO - --DOCSHELL 0x120eb8800 == 13 [pid = 1722] [id = 588] 04:02:37 INFO - --DOCSHELL 0x11ee49800 == 12 [pid = 1722] [id = 582] 04:02:37 INFO - --DOCSHELL 0x113467800 == 11 [pid = 1722] [id = 583] 04:02:37 INFO - --DOMWINDOW == 41 (0x121316400) [pid = 1722] [serial = 1389] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:37 INFO - --DOMWINDOW == 40 (0x122d4b000) [pid = 1722] [serial = 1391] [outer = 0x0] [url = about:blank] 04:02:37 INFO - --DOMWINDOW == 39 (0x1276ad800) [pid = 1722] [serial = 1394] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:02:37 INFO - --DOMWINDOW == 38 (0x126408400) [pid = 1722] [serial = 1393] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:02:37 INFO - --DOMWINDOW == 37 (0x120e24c00) [pid = 1722] [serial = 1409] [outer = 0x0] [url = about:blank] 04:02:37 INFO - --DOMWINDOW == 36 (0x114b20000) [pid = 1722] [serial = 1396] [outer = 0x0] [url = about:blank] 04:02:37 INFO - --DOMWINDOW == 35 (0x11f110800) [pid = 1722] [serial = 1398] [outer = 0x0] [url = about:blank] 04:02:37 INFO - --DOMWINDOW == 34 (0x12211d800) [pid = 1722] [serial = 1402] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:37 INFO - --DOMWINDOW == 33 (0x11f5cd000) [pid = 1722] [serial = 1399] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:37 INFO - --DOMWINDOW == 32 (0x11344f800) [pid = 1722] [serial = 1395] [outer = 0x0] [url = about:blank] 04:02:37 INFO - --DOMWINDOW == 31 (0x11ebb7c00) [pid = 1722] [serial = 1397] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>test%20for%20bug%20642108.] 04:02:37 INFO - MEMORY STAT | vsize 3405MB | residentFast 480MB | heapAllocated 122MB 04:02:37 INFO - 295 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_644419_log_limits.js | took 3126ms 04:02:37 INFO - ++DOCSHELL 0x11346c000 == 12 [pid = 1722] [id = 589] 04:02:37 INFO - ++DOMWINDOW == 32 (0x114b20000) [pid = 1722] [serial = 1414] [outer = 0x0] 04:02:37 INFO - ++DOMWINDOW == 33 (0x11e7a4800) [pid = 1722] [serial = 1415] [outer = 0x114b20000] 04:02:37 INFO - 296 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_646025_console_file_location.js 04:02:37 INFO - ++DOCSHELL 0x11eec5000 == 13 [pid = 1722] [id = 590] 04:02:37 INFO - ++DOMWINDOW == 34 (0x1203dec00) [pid = 1722] [serial = 1416] [outer = 0x0] 04:02:37 INFO - ++DOMWINDOW == 35 (0x1203eac00) [pid = 1722] [serial = 1417] [outer = 0x1203dec00] 04:02:37 INFO - ++DOCSHELL 0x11346b000 == 14 [pid = 1722] [id = 591] 04:02:37 INFO - ++DOMWINDOW == 36 (0x110d59000) [pid = 1722] [serial = 1418] [outer = 0x0] 04:02:37 INFO - ++DOMWINDOW == 37 (0x120e32000) [pid = 1722] [serial = 1419] [outer = 0x110d59000] 04:02:38 INFO - ++DOMWINDOW == 38 (0x12130d800) [pid = 1722] [serial = 1420] [outer = 0x110d59000] 04:02:38 INFO - ++DOCSHELL 0x122379800 == 15 [pid = 1722] [id = 592] 04:02:38 INFO - ++DOMWINDOW == 39 (0x12232a400) [pid = 1722] [serial = 1421] [outer = 0x0] 04:02:38 INFO - ++DOMWINDOW == 40 (0x122334000) [pid = 1722] [serial = 1422] [outer = 0x12232a400] 04:02:39 INFO - ++DOMWINDOW == 41 (0x12938a000) [pid = 1722] [serial = 1423] [outer = 0x1203dec00] 04:02:39 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:02:39 INFO - --DOCSHELL 0x113e34800 == 14 [pid = 1722] [id = 586] 04:02:39 INFO - --DOCSHELL 0x112ccf800 == 13 [pid = 1722] [id = 587] 04:02:39 INFO - --DOCSHELL 0x122379800 == 12 [pid = 1722] [id = 592] 04:02:40 INFO - --DOMWINDOW == 40 (0x1221b0800) [pid = 1722] [serial = 1403] [outer = 0x0] [url = about:blank] 04:02:40 INFO - --DOMWINDOW == 39 (0x120ffd800) [pid = 1722] [serial = 1401] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:40 INFO - --DOMWINDOW == 38 (0x11ebb5400) [pid = 1722] [serial = 1406] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html] 04:02:40 INFO - --DOMWINDOW == 37 (0x113195c00) [pid = 1722] [serial = 1404] [outer = 0x0] [url = about:blank] 04:02:40 INFO - --DOMWINDOW == 36 (0x11f111400) [pid = 1722] [serial = 1407] [outer = 0x0] [url = about:blank] 04:02:40 INFO - --DOMWINDOW == 35 (0x11344e400) [pid = 1722] [serial = 1405] [outer = 0x0] [url = about:blank] 04:02:40 INFO - --DOMWINDOW == 34 (0x120e32000) [pid = 1722] [serial = 1419] [outer = 0x0] [url = about:blank] 04:02:40 INFO - --DOMWINDOW == 33 (0x12211c000) [pid = 1722] [serial = 1411] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:40 INFO - --DOMWINDOW == 32 (0x11f70f000) [pid = 1722] [serial = 1408] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:40 INFO - MEMORY STAT | vsize 3405MB | residentFast 480MB | heapAllocated 122MB 04:02:40 INFO - 297 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_646025_console_file_location.js | took 2481ms 04:02:40 INFO - ++DOCSHELL 0x112cb9000 == 13 [pid = 1722] [id = 593] 04:02:40 INFO - ++DOMWINDOW == 33 (0x113e08400) [pid = 1722] [serial = 1424] [outer = 0x0] 04:02:40 INFO - ++DOMWINDOW == 34 (0x115146400) [pid = 1722] [serial = 1425] [outer = 0x113e08400] 04:02:40 INFO - 298 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_651501_document_body_autocomplete.js 04:02:40 INFO - ++DOCSHELL 0x11ee49800 == 14 [pid = 1722] [id = 594] 04:02:40 INFO - ++DOMWINDOW == 35 (0x120258c00) [pid = 1722] [serial = 1426] [outer = 0x0] 04:02:40 INFO - ++DOMWINDOW == 36 (0x1203e5000) [pid = 1722] [serial = 1427] [outer = 0x120258c00] 04:02:40 INFO - ++DOCSHELL 0x113465000 == 15 [pid = 1722] [id = 595] 04:02:40 INFO - ++DOMWINDOW == 37 (0x120d1dc00) [pid = 1722] [serial = 1428] [outer = 0x0] 04:02:40 INFO - ++DOMWINDOW == 38 (0x120ffe400) [pid = 1722] [serial = 1429] [outer = 0x120d1dc00] 04:02:40 INFO - ++DOMWINDOW == 39 (0x121313c00) [pid = 1722] [serial = 1430] [outer = 0x120d1dc00] 04:02:40 INFO - ++DOCSHELL 0x1228bc800 == 16 [pid = 1722] [id = 596] 04:02:40 INFO - ++DOMWINDOW == 40 (0x122333400) [pid = 1722] [serial = 1431] [outer = 0x0] 04:02:40 INFO - ++DOMWINDOW == 41 (0x1223e7000) [pid = 1722] [serial = 1432] [outer = 0x122333400] 04:02:42 INFO - ++DOCSHELL 0x11350f800 == 17 [pid = 1722] [id = 597] 04:02:42 INFO - ++DOMWINDOW == 42 (0x1264b0400) [pid = 1722] [serial = 1433] [outer = 0x0] 04:02:42 INFO - ++DOMWINDOW == 43 (0x1264b1400) [pid = 1722] [serial = 1434] [outer = 0x1264b0400] 04:02:42 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 04:02:43 INFO - --DOCSHELL 0x112cd2800 == 16 [pid = 1722] [id = 585] 04:02:43 INFO - --DOCSHELL 0x11346c000 == 15 [pid = 1722] [id = 589] 04:02:43 INFO - --DOCSHELL 0x11eec5000 == 14 [pid = 1722] [id = 590] 04:02:43 INFO - --DOCSHELL 0x1228bc800 == 13 [pid = 1722] [id = 596] 04:02:43 INFO - --DOCSHELL 0x11346b000 == 12 [pid = 1722] [id = 591] 04:02:43 INFO - --DOCSHELL 0x11350f800 == 11 [pid = 1722] [id = 597] 04:02:43 INFO - --DOMWINDOW == 42 (0x122124800) [pid = 1722] [serial = 1412] [outer = 0x0] [url = about:blank] 04:02:43 INFO - --DOMWINDOW == 41 (0x121108800) [pid = 1722] [serial = 1410] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:43 INFO - --DOMWINDOW == 40 (0x1283eec00) [pid = 1722] [serial = 1413] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html] 04:02:44 INFO - --DOMWINDOW == 39 (0x120ffe400) [pid = 1722] [serial = 1429] [outer = 0x0] [url = about:blank] 04:02:44 INFO - --DOMWINDOW == 38 (0x110d59000) [pid = 1722] [serial = 1418] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:44 INFO - --DOMWINDOW == 37 (0x12232a400) [pid = 1722] [serial = 1421] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:44 INFO - --DOMWINDOW == 36 (0x1203dec00) [pid = 1722] [serial = 1416] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-646025-console-file-location.html] 04:02:44 INFO - --DOMWINDOW == 35 (0x114b20000) [pid = 1722] [serial = 1414] [outer = 0x0] [url = about:blank] 04:02:44 INFO - --DOMWINDOW == 34 (0x1203eac00) [pid = 1722] [serial = 1417] [outer = 0x0] [url = about:blank] 04:02:44 INFO - --DOMWINDOW == 33 (0x11e7a4800) [pid = 1722] [serial = 1415] [outer = 0x0] [url = about:blank] 04:02:44 INFO - --DOMWINDOW == 32 (0x12938a000) [pid = 1722] [serial = 1423] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-646025-console-file-location.html] 04:02:44 INFO - MEMORY STAT | vsize 3405MB | residentFast 480MB | heapAllocated 124MB 04:02:44 INFO - 299 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_651501_document_body_autocomplete.js | took 3738ms 04:02:44 INFO - ++DOCSHELL 0x112cc8000 == 12 [pid = 1722] [id = 598] 04:02:44 INFO - ++DOMWINDOW == 33 (0x112f4c400) [pid = 1722] [serial = 1435] [outer = 0x0] 04:02:44 INFO - ++DOMWINDOW == 34 (0x11339b400) [pid = 1722] [serial = 1436] [outer = 0x112f4c400] 04:02:44 INFO - 300 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_653531_highlighter_console_helper.js 04:02:44 INFO - ++DOCSHELL 0x113473800 == 13 [pid = 1722] [id = 599] 04:02:44 INFO - ++DOMWINDOW == 35 (0x11d465400) [pid = 1722] [serial = 1437] [outer = 0x0] 04:02:44 INFO - ++DOMWINDOW == 36 (0x11ebb6c00) [pid = 1722] [serial = 1438] [outer = 0x11d465400] 04:02:44 INFO - ++DOCSHELL 0x11ee49000 == 14 [pid = 1722] [id = 600] 04:02:44 INFO - ++DOMWINDOW == 37 (0x1203dd400) [pid = 1722] [serial = 1439] [outer = 0x0] 04:02:44 INFO - ++DOMWINDOW == 38 (0x120e25400) [pid = 1722] [serial = 1440] [outer = 0x1203dd400] 04:02:44 INFO - ++DOMWINDOW == 39 (0x121115400) [pid = 1722] [serial = 1441] [outer = 0x1203dd400] 04:02:45 INFO - ++DOCSHELL 0x114b6e000 == 15 [pid = 1722] [id = 601] 04:02:45 INFO - ++DOMWINDOW == 40 (0x126403c00) [pid = 1722] [serial = 1442] [outer = 0x0] 04:02:45 INFO - ++DOMWINDOW == 41 (0x126485c00) [pid = 1722] [serial = 1443] [outer = 0x126403c00] 04:02:45 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:02:45 INFO - ++DOCSHELL 0x128229000 == 16 [pid = 1722] [id = 602] 04:02:45 INFO - ++DOMWINDOW == 42 (0x12830e800) [pid = 1722] [serial = 1444] [outer = 0x0] 04:02:45 INFO - ++DOMWINDOW == 43 (0x12830f000) [pid = 1722] [serial = 1445] [outer = 0x12830e800] 04:02:45 INFO - ++DOCSHELL 0x129373800 == 17 [pid = 1722] [id = 603] 04:02:45 INFO - ++DOMWINDOW == 44 (0x128310800) [pid = 1722] [serial = 1446] [outer = 0x0] 04:02:45 INFO - ++DOCSHELL 0x129375000 == 18 [pid = 1722] [id = 604] 04:02:45 INFO - ++DOMWINDOW == 45 (0x128311400) [pid = 1722] [serial = 1447] [outer = 0x0] 04:02:45 INFO - ++DOCSHELL 0x129375800 == 19 [pid = 1722] [id = 605] 04:02:45 INFO - ++DOMWINDOW == 46 (0x128311c00) [pid = 1722] [serial = 1448] [outer = 0x0] 04:02:45 INFO - ++DOCSHELL 0x129376000 == 20 [pid = 1722] [id = 606] 04:02:45 INFO - ++DOMWINDOW == 47 (0x12837c800) [pid = 1722] [serial = 1449] [outer = 0x0] 04:02:45 INFO - ++DOCSHELL 0x129376800 == 21 [pid = 1722] [id = 607] 04:02:45 INFO - ++DOMWINDOW == 48 (0x12837dc00) [pid = 1722] [serial = 1450] [outer = 0x0] 04:02:45 INFO - ++DOMWINDOW == 49 (0x128380c00) [pid = 1722] [serial = 1451] [outer = 0x128310800] 04:02:45 INFO - ++DOMWINDOW == 50 (0x128382800) [pid = 1722] [serial = 1452] [outer = 0x128311400] 04:02:45 INFO - ++DOMWINDOW == 51 (0x128384000) [pid = 1722] [serial = 1453] [outer = 0x128311c00] 04:02:45 INFO - ++DOMWINDOW == 52 (0x128385800) [pid = 1722] [serial = 1454] [outer = 0x12837c800] 04:02:45 INFO - ++DOMWINDOW == 53 (0x128387400) [pid = 1722] [serial = 1455] [outer = 0x12837dc00] 04:02:45 INFO - ++DOCSHELL 0x124aca800 == 22 [pid = 1722] [id = 608] 04:02:45 INFO - ++DOMWINDOW == 54 (0x121314c00) [pid = 1722] [serial = 1456] [outer = 0x0] 04:02:45 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:02:45 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:02:45 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:02:45 INFO - ++DOCSHELL 0x122384000 == 23 [pid = 1722] [id = 609] 04:02:45 INFO - ++DOMWINDOW == 55 (0x114dbec00) [pid = 1722] [serial = 1457] [outer = 0x0] 04:02:45 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:02:45 INFO - ++DOMWINDOW == 56 (0x122ea3c00) [pid = 1722] [serial = 1458] [outer = 0x121314c00] 04:02:45 INFO - ++DOMWINDOW == 57 (0x128270800) [pid = 1722] [serial = 1459] [outer = 0x114dbec00] 04:02:45 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:02:45 INFO - ++DOCSHELL 0x1293d4000 == 24 [pid = 1722] [id = 610] 04:02:45 INFO - ++DOMWINDOW == 58 (0x1264ad000) [pid = 1722] [serial = 1460] [outer = 0x0] 04:02:45 INFO - ++DOCSHELL 0x1293d6800 == 25 [pid = 1722] [id = 611] 04:02:45 INFO - ++DOMWINDOW == 59 (0x1283f8400) [pid = 1722] [serial = 1461] [outer = 0x0] 04:02:45 INFO - ++DOCSHELL 0x1293d9000 == 26 [pid = 1722] [id = 612] 04:02:45 INFO - ++DOMWINDOW == 60 (0x12938d000) [pid = 1722] [serial = 1462] [outer = 0x0] 04:02:45 INFO - ++DOCSHELL 0x1293dd000 == 27 [pid = 1722] [id = 613] 04:02:45 INFO - ++DOMWINDOW == 61 (0x12938d800) [pid = 1722] [serial = 1463] [outer = 0x0] 04:02:45 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:02:45 INFO - ++DOCSHELL 0x1293dd800 == 28 [pid = 1722] [id = 614] 04:02:45 INFO - ++DOMWINDOW == 62 (0x12938e400) [pid = 1722] [serial = 1464] [outer = 0x0] 04:02:45 INFO - ++DOMWINDOW == 63 (0x12938ec00) [pid = 1722] [serial = 1465] [outer = 0x12938e400] 04:02:46 INFO - ++DOMWINDOW == 64 (0x12826f000) [pid = 1722] [serial = 1466] [outer = 0x1264ad000] 04:02:46 INFO - ++DOMWINDOW == 65 (0x1296d0000) [pid = 1722] [serial = 1467] [outer = 0x1283f8400] 04:02:46 INFO - ++DOMWINDOW == 66 (0x1296d1c00) [pid = 1722] [serial = 1468] [outer = 0x12938d000] 04:02:46 INFO - ++DOMWINDOW == 67 (0x1296d2c00) [pid = 1722] [serial = 1469] [outer = 0x12938d800] 04:02:46 INFO - ++DOMWINDOW == 68 (0x1296d3c00) [pid = 1722] [serial = 1470] [outer = 0x12938e400] 04:02:47 INFO - ++DOCSHELL 0x124f17800 == 29 [pid = 1722] [id = 615] 04:02:47 INFO - ++DOMWINDOW == 69 (0x1296d3000) [pid = 1722] [serial = 1471] [outer = 0x0] 04:02:47 INFO - ++DOMWINDOW == 70 (0x12f159000) [pid = 1722] [serial = 1472] [outer = 0x1296d3000] 04:02:47 INFO - --DOCSHELL 0x1293d6800 == 28 [pid = 1722] [id = 611] 04:02:47 INFO - --DOCSHELL 0x1293d9000 == 27 [pid = 1722] [id = 612] 04:02:47 INFO - --DOCSHELL 0x1293d4000 == 26 [pid = 1722] [id = 610] 04:02:47 INFO - --DOCSHELL 0x1293dd000 == 25 [pid = 1722] [id = 613] 04:02:47 INFO - --DOCSHELL 0x122384000 == 24 [pid = 1722] [id = 609] 04:02:47 INFO - --DOCSHELL 0x124aca800 == 23 [pid = 1722] [id = 608] 04:02:48 INFO - console.error: 04:02:48 INFO - Protocol error (noSuchActor): No such actor for ID: server1.conn136.animationsActor23 04:02:48 INFO - MEMORY STAT | vsize 3409MB | residentFast 484MB | heapAllocated 135MB 04:02:48 INFO - 301 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_653531_highlighter_console_helper.js | took 3866ms 04:02:48 INFO - ++DOCSHELL 0x112ccf800 == 24 [pid = 1722] [id = 616] 04:02:48 INFO - ++DOMWINDOW == 71 (0x11318d800) [pid = 1722] [serial = 1473] [outer = 0x0] 04:02:48 INFO - ++DOMWINDOW == 72 (0x113e04000) [pid = 1722] [serial = 1474] [outer = 0x11318d800] 04:02:48 INFO - 302 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_658368_time_methods.js 04:02:48 INFO - ++DOCSHELL 0x113e4b000 == 25 [pid = 1722] [id = 617] 04:02:48 INFO - ++DOMWINDOW == 73 (0x120e2b400) [pid = 1722] [serial = 1475] [outer = 0x0] 04:02:48 INFO - ++DOMWINDOW == 74 (0x120fe6400) [pid = 1722] [serial = 1476] [outer = 0x120e2b400] 04:02:48 INFO - ++DOMWINDOW == 75 (0x121319000) [pid = 1722] [serial = 1477] [outer = 0x120e2b400] 04:02:48 INFO - ++DOCSHELL 0x128216800 == 26 [pid = 1722] [id = 618] 04:02:48 INFO - ++DOMWINDOW == 76 (0x1221b0800) [pid = 1722] [serial = 1478] [outer = 0x0] 04:02:48 INFO - ++DOMWINDOW == 77 (0x12232b800) [pid = 1722] [serial = 1479] [outer = 0x1221b0800] 04:02:48 INFO - ++DOMWINDOW == 78 (0x1245b9000) [pid = 1722] [serial = 1480] [outer = 0x1221b0800] 04:02:48 INFO - ++DOCSHELL 0x129668000 == 27 [pid = 1722] [id = 619] 04:02:48 INFO - ++DOMWINDOW == 79 (0x128275000) [pid = 1722] [serial = 1481] [outer = 0x0] 04:02:48 INFO - ++DOMWINDOW == 80 (0x128277800) [pid = 1722] [serial = 1482] [outer = 0x128275000] 04:02:49 INFO - ++DOCSHELL 0x12fabb000 == 28 [pid = 1722] [id = 620] 04:02:49 INFO - ++DOMWINDOW == 81 (0x12938ac00) [pid = 1722] [serial = 1483] [outer = 0x0] 04:02:49 INFO - ++DOMWINDOW == 82 (0x1296d0c00) [pid = 1722] [serial = 1484] [outer = 0x12938ac00] 04:02:50 INFO - ++DOCSHELL 0x13059b800 == 29 [pid = 1722] [id = 621] 04:02:50 INFO - ++DOMWINDOW == 83 (0x120ff3000) [pid = 1722] [serial = 1485] [outer = 0x0] 04:02:50 INFO - ++DOMWINDOW == 84 (0x1283ea800) [pid = 1722] [serial = 1486] [outer = 0x120ff3000] 04:02:50 INFO - ++DOMWINDOW == 85 (0x1283f0000) [pid = 1722] [serial = 1487] [outer = 0x120ff3000] 04:02:50 INFO - ++DOCSHELL 0x130f39000 == 30 [pid = 1722] [id = 622] 04:02:50 INFO - ++DOMWINDOW == 86 (0x12fcc5c00) [pid = 1722] [serial = 1488] [outer = 0x0] 04:02:50 INFO - ++DOMWINDOW == 87 (0x12fcc9000) [pid = 1722] [serial = 1489] [outer = 0x12fcc5c00] 04:02:51 INFO - ++DOMWINDOW == 88 (0x12ff49800) [pid = 1722] [serial = 1490] [outer = 0x12938ac00] 04:02:51 INFO - ++DOMWINDOW == 89 (0x1300a6000) [pid = 1722] [serial = 1491] [outer = 0x12938ac00] 04:02:52 INFO - --DOCSHELL 0x1293dd800 == 29 [pid = 1722] [id = 614] 04:02:52 INFO - --DOCSHELL 0x112cc8000 == 28 [pid = 1722] [id = 598] 04:02:52 INFO - --DOCSHELL 0x113473800 == 27 [pid = 1722] [id = 599] 04:02:52 INFO - --DOCSHELL 0x11ee49000 == 26 [pid = 1722] [id = 600] 04:02:52 INFO - --DOCSHELL 0x112cb9000 == 25 [pid = 1722] [id = 593] 04:02:52 INFO - --DOCSHELL 0x114b6e000 == 24 [pid = 1722] [id = 601] 04:02:52 INFO - --DOCSHELL 0x11ee49800 == 23 [pid = 1722] [id = 594] 04:02:52 INFO - --DOCSHELL 0x128229000 == 22 [pid = 1722] [id = 602] 04:02:52 INFO - --DOCSHELL 0x113465000 == 21 [pid = 1722] [id = 595] 04:02:52 INFO - --DOCSHELL 0x124f17800 == 20 [pid = 1722] [id = 615] 04:02:52 INFO - --DOCSHELL 0x129373800 == 19 [pid = 1722] [id = 603] 04:02:52 INFO - --DOCSHELL 0x129375000 == 18 [pid = 1722] [id = 604] 04:02:52 INFO - --DOCSHELL 0x129375800 == 17 [pid = 1722] [id = 605] 04:02:52 INFO - --DOCSHELL 0x129376000 == 16 [pid = 1722] [id = 606] 04:02:52 INFO - --DOCSHELL 0x129376800 == 15 [pid = 1722] [id = 607] 04:02:52 INFO - --DOCSHELL 0x130f39000 == 14 [pid = 1722] [id = 622] 04:02:52 INFO - --DOMWINDOW == 88 (0x12130d800) [pid = 1722] [serial = 1420] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:52 INFO - --DOMWINDOW == 87 (0x122334000) [pid = 1722] [serial = 1422] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 86 (0x1264b0400) [pid = 1722] [serial = 1433] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:02:52 INFO - --DOMWINDOW == 85 (0x120258c00) [pid = 1722] [serial = 1426] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20autocompletion%20bug%20in%20document.body] 04:02:52 INFO - --DOMWINDOW == 84 (0x113e08400) [pid = 1722] [serial = 1424] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 83 (0x12938e400) [pid = 1722] [serial = 1464] [outer = 0x0] [url = data:text/html,<html></html>] 04:02:52 INFO - --DOMWINDOW == 82 (0x12232b800) [pid = 1722] [serial = 1479] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 81 (0x120e25400) [pid = 1722] [serial = 1440] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 80 (0x11d465400) [pid = 1722] [serial = 1437] [outer = 0x0] [url = data:text/html;charset=utf-8,test%20for%20highlighter%20helper%20in%20web%20console] 04:02:52 INFO - --DOMWINDOW == 79 (0x121314c00) [pid = 1722] [serial = 1456] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:02:52 INFO - --DOMWINDOW == 78 (0x1203dd400) [pid = 1722] [serial = 1439] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:52 INFO - --DOMWINDOW == 77 (0x114dbec00) [pid = 1722] [serial = 1457] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:02:52 INFO - --DOMWINDOW == 76 (0x1264ad000) [pid = 1722] [serial = 1460] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:02:52 INFO - --DOMWINDOW == 75 (0x1283f8400) [pid = 1722] [serial = 1461] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:02:52 INFO - --DOMWINDOW == 74 (0x12938d000) [pid = 1722] [serial = 1462] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:02:52 INFO - --DOMWINDOW == 73 (0x12938d800) [pid = 1722] [serial = 1463] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:02:52 INFO - --DOMWINDOW == 72 (0x12830e800) [pid = 1722] [serial = 1444] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:02:52 INFO - --DOMWINDOW == 71 (0x126403c00) [pid = 1722] [serial = 1442] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:02:52 INFO - --DOMWINDOW == 70 (0x1296d3000) [pid = 1722] [serial = 1471] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:52 INFO - --DOMWINDOW == 69 (0x112f4c400) [pid = 1722] [serial = 1435] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 68 (0x11ebb6c00) [pid = 1722] [serial = 1438] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 67 (0x12837dc00) [pid = 1722] [serial = 1450] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:02:52 INFO - --DOMWINDOW == 66 (0x12837c800) [pid = 1722] [serial = 1449] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:02:52 INFO - --DOMWINDOW == 65 (0x128311c00) [pid = 1722] [serial = 1448] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:02:52 INFO - --DOMWINDOW == 64 (0x128311400) [pid = 1722] [serial = 1447] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:02:52 INFO - --DOMWINDOW == 63 (0x128310800) [pid = 1722] [serial = 1446] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:02:52 INFO - --DOMWINDOW == 62 (0x11339b400) [pid = 1722] [serial = 1436] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 61 (0x120d1dc00) [pid = 1722] [serial = 1428] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:52 INFO - --DOMWINDOW == 60 (0x122333400) [pid = 1722] [serial = 1431] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:52 INFO - --DOMWINDOW == 59 (0x1283ea800) [pid = 1722] [serial = 1486] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 58 (0x120fe6400) [pid = 1722] [serial = 1476] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 57 (0x115146400) [pid = 1722] [serial = 1425] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 56 (0x12938ec00) [pid = 1722] [serial = 1465] [outer = 0x0] [url = about:blank] 04:02:52 INFO - --DOMWINDOW == 55 (0x1296d3c00) [pid = 1722] [serial = 1470] [outer = 0x0] [url = data:text/html,<html></html>] 04:02:53 INFO - --DOCSHELL 0x129668000 == 13 [pid = 1722] [id = 619] 04:02:53 INFO - --DOMWINDOW == 54 (0x128384000) [pid = 1722] [serial = 1453] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:02:53 INFO - MEMORY STAT | vsize 3395MB | residentFast 481MB | heapAllocated 119MB 04:02:53 INFO - 303 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_658368_time_methods.js | took 4892ms 04:02:53 INFO - ++DOCSHELL 0x112cba800 == 14 [pid = 1722] [id = 623] 04:02:53 INFO - ++DOMWINDOW == 55 (0x11ebbd400) [pid = 1722] [serial = 1492] [outer = 0x0] 04:02:53 INFO - ++DOMWINDOW == 56 (0x11f111400) [pid = 1722] [serial = 1493] [outer = 0x11ebbd400] 04:02:53 INFO - 304 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_659907_console_dir.js 04:02:53 INFO - ++DOCSHELL 0x120e0d800 == 15 [pid = 1722] [id = 624] 04:02:53 INFO - ++DOMWINDOW == 57 (0x120e2d800) [pid = 1722] [serial = 1494] [outer = 0x0] 04:02:53 INFO - ++DOMWINDOW == 58 (0x120fee400) [pid = 1722] [serial = 1495] [outer = 0x120e2d800] 04:02:53 INFO - ++DOCSHELL 0x11e346000 == 16 [pid = 1722] [id = 625] 04:02:53 INFO - ++DOMWINDOW == 59 (0x121312800) [pid = 1722] [serial = 1496] [outer = 0x0] 04:02:53 INFO - ++DOMWINDOW == 60 (0x121315000) [pid = 1722] [serial = 1497] [outer = 0x121312800] 04:02:53 INFO - ++DOMWINDOW == 61 (0x12159a400) [pid = 1722] [serial = 1498] [outer = 0x121312800] 04:02:53 INFO - ++DOCSHELL 0x1252f6800 == 17 [pid = 1722] [id = 626] 04:02:53 INFO - ++DOMWINDOW == 62 (0x1245be400) [pid = 1722] [serial = 1499] [outer = 0x0] 04:02:53 INFO - ++DOMWINDOW == 63 (0x12477d400) [pid = 1722] [serial = 1500] [outer = 0x1245be400] 04:02:54 INFO - ++DOCSHELL 0x129667800 == 18 [pid = 1722] [id = 627] 04:02:54 INFO - ++DOMWINDOW == 64 (0x1283ea400) [pid = 1722] [serial = 1501] [outer = 0x0] 04:02:54 INFO - ++DOMWINDOW == 65 (0x1283eb000) [pid = 1722] [serial = 1502] [outer = 0x1283ea400] 04:02:54 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 04:02:57 INFO - --DOCSHELL 0x129667800 == 17 [pid = 1722] [id = 627] 04:02:59 INFO - --DOCSHELL 0x11e346000 == 16 [pid = 1722] [id = 625] 04:02:59 INFO - --DOCSHELL 0x1252f6800 == 15 [pid = 1722] [id = 626] 04:02:59 INFO - --DOCSHELL 0x128216800 == 14 [pid = 1722] [id = 618] 04:02:59 INFO - --DOCSHELL 0x112ccf800 == 13 [pid = 1722] [id = 616] 04:02:59 INFO - --DOCSHELL 0x113e4b000 == 12 [pid = 1722] [id = 617] 04:02:59 INFO - --DOCSHELL 0x12fabb000 == 11 [pid = 1722] [id = 620] 04:02:59 INFO - --DOCSHELL 0x13059b800 == 10 [pid = 1722] [id = 621] 04:02:59 INFO - --DOMWINDOW == 64 (0x12f159000) [pid = 1722] [serial = 1472] [outer = 0x0] [url = about:blank] 04:02:59 INFO - --DOMWINDOW == 63 (0x1296d2c00) [pid = 1722] [serial = 1469] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:02:59 INFO - --DOMWINDOW == 62 (0x1296d1c00) [pid = 1722] [serial = 1468] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:02:59 INFO - --DOMWINDOW == 61 (0x1296d0000) [pid = 1722] [serial = 1467] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:02:59 INFO - --DOMWINDOW == 60 (0x12826f000) [pid = 1722] [serial = 1466] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:02:59 INFO - --DOMWINDOW == 59 (0x128270800) [pid = 1722] [serial = 1459] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:02:59 INFO - --DOMWINDOW == 58 (0x128387400) [pid = 1722] [serial = 1455] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:02:59 INFO - --DOMWINDOW == 57 (0x128385800) [pid = 1722] [serial = 1454] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:02:59 INFO - --DOMWINDOW == 56 (0x1264b1400) [pid = 1722] [serial = 1434] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:02:59 INFO - --DOMWINDOW == 55 (0x1223e7000) [pid = 1722] [serial = 1432] [outer = 0x0] [url = about:blank] 04:02:59 INFO - --DOMWINDOW == 54 (0x121313c00) [pid = 1722] [serial = 1430] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:59 INFO - --DOMWINDOW == 53 (0x121115400) [pid = 1722] [serial = 1441] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:59 INFO - --DOMWINDOW == 52 (0x128380c00) [pid = 1722] [serial = 1451] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:02:59 INFO - --DOMWINDOW == 51 (0x128382800) [pid = 1722] [serial = 1452] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:02:59 INFO - --DOMWINDOW == 50 (0x126485c00) [pid = 1722] [serial = 1443] [outer = 0x0] [url = about:blank] 04:02:59 INFO - --DOMWINDOW == 49 (0x1203e5000) [pid = 1722] [serial = 1427] [outer = 0x0] [url = about:blank] 04:02:59 INFO - --DOMWINDOW == 48 (0x122ea3c00) [pid = 1722] [serial = 1458] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:02:59 INFO - --DOMWINDOW == 47 (0x12830f000) [pid = 1722] [serial = 1445] [outer = 0x0] [url = about:blank] 04:02:59 INFO - --DOMWINDOW == 46 (0x1300a6000) [pid = 1722] [serial = 1491] [outer = 0x0] [url = data:text/html;charset=utf-8,<script>console.timeEnd('bTimer');</script>] 04:02:59 INFO - --DOMWINDOW == 45 (0x12ff49800) [pid = 1722] [serial = 1490] [outer = 0x0] [url = data:text/html;charset=utf-8,<script>console.time('bTimer');</script>] 04:02:59 INFO - --DOMWINDOW == 44 (0x1296d0c00) [pid = 1722] [serial = 1484] [outer = 0x0] [url = about:blank] 04:02:59 INFO - --DOMWINDOW == 43 (0x113e04000) [pid = 1722] [serial = 1474] [outer = 0x0] [url = about:blank] 04:02:59 INFO - --DOMWINDOW == 42 (0x12fcc5c00) [pid = 1722] [serial = 1488] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:59 INFO - --DOMWINDOW == 41 (0x1221b0800) [pid = 1722] [serial = 1478] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:59 INFO - --DOMWINDOW == 40 (0x128275000) [pid = 1722] [serial = 1481] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:02:59 INFO - --DOMWINDOW == 39 (0x120ff3000) [pid = 1722] [serial = 1485] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:02:59 INFO - --DOMWINDOW == 38 (0x12938ac00) [pid = 1722] [serial = 1483] [outer = 0x0] [url = data:text/html;charset=utf-8,<script>console.timeEnd('bTimer');</script>] 04:02:59 INFO - --DOMWINDOW == 37 (0x120e2b400) [pid = 1722] [serial = 1475] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-658368-time-methods.html] 04:02:59 INFO - --DOMWINDOW == 36 (0x11318d800) [pid = 1722] [serial = 1473] [outer = 0x0] [url = about:blank] 04:02:59 INFO - --DOMWINDOW == 35 (0x121315000) [pid = 1722] [serial = 1497] [outer = 0x0] [url = about:blank] 04:02:59 INFO - --DOMWINDOW == 34 (0x121319000) [pid = 1722] [serial = 1477] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-658368-time-methods.html] 04:02:59 INFO - MEMORY STAT | vsize 3396MB | residentFast 473MB | heapAllocated 128MB 04:02:59 INFO - 305 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_659907_console_dir.js | took 6535ms 04:02:59 INFO - ++DOCSHELL 0x112cc8000 == 11 [pid = 1722] [id = 628] 04:02:59 INFO - ++DOMWINDOW == 35 (0x11315bc00) [pid = 1722] [serial = 1503] [outer = 0x0] 04:02:59 INFO - ++DOMWINDOW == 36 (0x113443c00) [pid = 1722] [serial = 1504] [outer = 0x11315bc00] 04:03:00 INFO - 306 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_660806_history_nav.js 04:03:00 INFO - ++DOCSHELL 0x11350f800 == 12 [pid = 1722] [id = 629] 04:03:00 INFO - ++DOMWINDOW == 37 (0x11d472400) [pid = 1722] [serial = 1505] [outer = 0x0] 04:03:00 INFO - ++DOMWINDOW == 38 (0x11e7ad000) [pid = 1722] [serial = 1506] [outer = 0x11d472400] 04:03:00 INFO - ++DOCSHELL 0x112ccc000 == 13 [pid = 1722] [id = 630] 04:03:00 INFO - ++DOMWINDOW == 39 (0x11ebb7800) [pid = 1722] [serial = 1507] [outer = 0x0] 04:03:00 INFO - ++DOMWINDOW == 40 (0x120e23800) [pid = 1722] [serial = 1508] [outer = 0x11ebb7800] 04:03:00 INFO - ++DOMWINDOW == 41 (0x121108c00) [pid = 1722] [serial = 1509] [outer = 0x11ebb7800] 04:03:00 INFO - ++DOCSHELL 0x120eb0800 == 14 [pid = 1722] [id = 631] 04:03:00 INFO - ++DOMWINDOW == 42 (0x12211d800) [pid = 1722] [serial = 1510] [outer = 0x0] 04:03:00 INFO - ++DOMWINDOW == 43 (0x122124800) [pid = 1722] [serial = 1511] [outer = 0x12211d800] 04:03:01 INFO - --DOCSHELL 0x120e0d800 == 13 [pid = 1722] [id = 624] 04:03:01 INFO - --DOCSHELL 0x112cba800 == 12 [pid = 1722] [id = 623] 04:03:01 INFO - --DOMWINDOW == 42 (0x12fcc9000) [pid = 1722] [serial = 1489] [outer = 0x0] [url = about:blank] 04:03:01 INFO - --DOMWINDOW == 41 (0x1245b9000) [pid = 1722] [serial = 1480] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:01 INFO - --DOMWINDOW == 40 (0x128277800) [pid = 1722] [serial = 1482] [outer = 0x0] [url = about:blank] 04:03:01 INFO - --DOMWINDOW == 39 (0x1283f0000) [pid = 1722] [serial = 1487] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:02 INFO - --DOMWINDOW == 38 (0x1283ea400) [pid = 1722] [serial = 1501] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:03:02 INFO - --DOMWINDOW == 37 (0x121312800) [pid = 1722] [serial = 1496] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:02 INFO - --DOMWINDOW == 36 (0x120e23800) [pid = 1722] [serial = 1508] [outer = 0x0] [url = about:blank] 04:03:02 INFO - --DOMWINDOW == 35 (0x11ebbd400) [pid = 1722] [serial = 1492] [outer = 0x0] [url = about:blank] 04:03:02 INFO - --DOMWINDOW == 34 (0x120e2d800) [pid = 1722] [serial = 1494] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20659907:%20Expand%20console%20object%20with%20a%20dir%20method] 04:03:02 INFO - --DOMWINDOW == 33 (0x1245be400) [pid = 1722] [serial = 1499] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:02 INFO - MEMORY STAT | vsize 3397MB | residentFast 474MB | heapAllocated 124MB 04:03:02 INFO - 307 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_660806_history_nav.js | took 2342ms 04:03:02 INFO - ++DOCSHELL 0x112cd7000 == 13 [pid = 1722] [id = 632] 04:03:02 INFO - ++DOMWINDOW == 34 (0x113444400) [pid = 1722] [serial = 1512] [outer = 0x0] 04:03:02 INFO - ++DOMWINDOW == 35 (0x11344c800) [pid = 1722] [serial = 1513] [outer = 0x113444400] 04:03:02 INFO - 308 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_664131_console_group.js 04:03:02 INFO - ++DOCSHELL 0x11e350800 == 14 [pid = 1722] [id = 633] 04:03:02 INFO - ++DOMWINDOW == 36 (0x11e7afc00) [pid = 1722] [serial = 1514] [outer = 0x0] 04:03:02 INFO - ++DOMWINDOW == 37 (0x11ef16000) [pid = 1722] [serial = 1515] [outer = 0x11e7afc00] 04:03:02 INFO - ++DOCSHELL 0x11269a000 == 15 [pid = 1722] [id = 634] 04:03:02 INFO - ++DOMWINDOW == 38 (0x11f70f000) [pid = 1722] [serial = 1516] [outer = 0x0] 04:03:02 INFO - ++DOMWINDOW == 39 (0x120d25400) [pid = 1722] [serial = 1517] [outer = 0x11f70f000] 04:03:02 INFO - ++DOMWINDOW == 40 (0x121117c00) [pid = 1722] [serial = 1518] [outer = 0x11f70f000] 04:03:02 INFO - ++DOCSHELL 0x1228db000 == 16 [pid = 1722] [id = 635] 04:03:02 INFO - ++DOMWINDOW == 41 (0x122124000) [pid = 1722] [serial = 1519] [outer = 0x0] 04:03:02 INFO - ++DOMWINDOW == 42 (0x12232bc00) [pid = 1722] [serial = 1520] [outer = 0x122124000] 04:03:04 INFO - --DOCSHELL 0x120eb0800 == 15 [pid = 1722] [id = 631] 04:03:04 INFO - --DOCSHELL 0x1228db000 == 14 [pid = 1722] [id = 635] 04:03:04 INFO - --DOCSHELL 0x112ccc000 == 13 [pid = 1722] [id = 630] 04:03:04 INFO - --DOCSHELL 0x112cc8000 == 12 [pid = 1722] [id = 628] 04:03:04 INFO - --DOCSHELL 0x11350f800 == 11 [pid = 1722] [id = 629] 04:03:04 INFO - --DOMWINDOW == 41 (0x12477d400) [pid = 1722] [serial = 1500] [outer = 0x0] [url = about:blank] 04:03:04 INFO - --DOMWINDOW == 40 (0x12159a400) [pid = 1722] [serial = 1498] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:04 INFO - --DOMWINDOW == 39 (0x1283eb000) [pid = 1722] [serial = 1502] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:03:04 INFO - --DOMWINDOW == 38 (0x120fee400) [pid = 1722] [serial = 1495] [outer = 0x0] [url = about:blank] 04:03:04 INFO - --DOMWINDOW == 37 (0x11f111400) [pid = 1722] [serial = 1493] [outer = 0x0] [url = about:blank] 04:03:04 INFO - --DOMWINDOW == 36 (0x11e7ad000) [pid = 1722] [serial = 1506] [outer = 0x0] [url = about:blank] 04:03:04 INFO - --DOMWINDOW == 35 (0x113443c00) [pid = 1722] [serial = 1504] [outer = 0x0] [url = about:blank] 04:03:04 INFO - --DOMWINDOW == 34 (0x120d25400) [pid = 1722] [serial = 1517] [outer = 0x0] [url = about:blank] 04:03:04 INFO - --DOMWINDOW == 33 (0x12211d800) [pid = 1722] [serial = 1510] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:04 INFO - --DOMWINDOW == 32 (0x11ebb7800) [pid = 1722] [serial = 1507] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:04 INFO - --DOMWINDOW == 31 (0x11d472400) [pid = 1722] [serial = 1505] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>bug%20660806%20-%20history%20navigation%20must%20not%20show%20the%20autocomplete%20popup] 04:03:04 INFO - --DOMWINDOW == 30 (0x11315bc00) [pid = 1722] [serial = 1503] [outer = 0x0] [url = about:blank] 04:03:04 INFO - MEMORY STAT | vsize 3399MB | residentFast 476MB | heapAllocated 119MB 04:03:04 INFO - 309 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_664131_console_group.js | took 2490ms 04:03:04 INFO - ++DOCSHELL 0x112cc6800 == 12 [pid = 1722] [id = 636] 04:03:04 INFO - ++DOMWINDOW == 31 (0x113443c00) [pid = 1722] [serial = 1521] [outer = 0x0] 04:03:04 INFO - ++DOMWINDOW == 32 (0x113d05400) [pid = 1722] [serial = 1522] [outer = 0x113443c00] 04:03:05 INFO - 310 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_686937_autocomplete_JSTerm_helpers.js 04:03:05 INFO - ++DOCSHELL 0x11ee34800 == 13 [pid = 1722] [id = 637] 04:03:05 INFO - ++DOMWINDOW == 33 (0x11ec90000) [pid = 1722] [serial = 1523] [outer = 0x0] 04:03:05 INFO - ++DOMWINDOW == 34 (0x11f715400) [pid = 1722] [serial = 1524] [outer = 0x11ec90000] 04:03:05 INFO - ++DOCSHELL 0x112e96800 == 14 [pid = 1722] [id = 638] 04:03:05 INFO - ++DOMWINDOW == 35 (0x120263800) [pid = 1722] [serial = 1525] [outer = 0x0] 04:03:05 INFO - ++DOMWINDOW == 36 (0x120e25800) [pid = 1722] [serial = 1526] [outer = 0x120263800] 04:03:05 INFO - ++DOMWINDOW == 37 (0x12115cc00) [pid = 1722] [serial = 1527] [outer = 0x120263800] 04:03:05 INFO - ++DOCSHELL 0x122384000 == 15 [pid = 1722] [id = 639] 04:03:05 INFO - ++DOMWINDOW == 38 (0x122e9e400) [pid = 1722] [serial = 1528] [outer = 0x0] 04:03:05 INFO - ++DOMWINDOW == 39 (0x122ea2400) [pid = 1722] [serial = 1529] [outer = 0x122e9e400] 04:03:08 INFO - --DOCSHELL 0x122384000 == 14 [pid = 1722] [id = 639] 04:03:08 INFO - --DOCSHELL 0x11e350800 == 13 [pid = 1722] [id = 633] 04:03:08 INFO - --DOCSHELL 0x112cd7000 == 12 [pid = 1722] [id = 632] 04:03:08 INFO - --DOCSHELL 0x11269a000 == 11 [pid = 1722] [id = 634] 04:03:08 INFO - --DOMWINDOW == 38 (0x122124800) [pid = 1722] [serial = 1511] [outer = 0x0] [url = about:blank] 04:03:08 INFO - --DOMWINDOW == 37 (0x121108c00) [pid = 1722] [serial = 1509] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:08 INFO - --DOMWINDOW == 36 (0x11e7afc00) [pid = 1722] [serial = 1514] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20664131:%20Expand%20console%20object%20with%20group%20methods] 04:03:08 INFO - --DOMWINDOW == 35 (0x113444400) [pid = 1722] [serial = 1512] [outer = 0x0] [url = about:blank] 04:03:08 INFO - --DOMWINDOW == 34 (0x11ef16000) [pid = 1722] [serial = 1515] [outer = 0x0] [url = about:blank] 04:03:08 INFO - --DOMWINDOW == 33 (0x11344c800) [pid = 1722] [serial = 1513] [outer = 0x0] [url = about:blank] 04:03:08 INFO - --DOMWINDOW == 32 (0x122124000) [pid = 1722] [serial = 1519] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:08 INFO - --DOMWINDOW == 31 (0x11f70f000) [pid = 1722] [serial = 1516] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:08 INFO - --DOMWINDOW == 30 (0x120e25800) [pid = 1722] [serial = 1526] [outer = 0x0] [url = about:blank] 04:03:08 INFO - MEMORY STAT | vsize 3398MB | residentFast 477MB | heapAllocated 121MB 04:03:08 INFO - 311 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_686937_autocomplete_JSTerm_helpers.js | took 3824ms 04:03:08 INFO - ++DOCSHELL 0x112cc2800 == 12 [pid = 1722] [id = 640] 04:03:08 INFO - ++DOMWINDOW == 31 (0x113262800) [pid = 1722] [serial = 1530] [outer = 0x0] 04:03:08 INFO - ++DOMWINDOW == 32 (0x113450000) [pid = 1722] [serial = 1531] [outer = 0x113262800] 04:03:09 INFO - 312 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_704295.js 04:03:09 INFO - ++DOCSHELL 0x11e346000 == 13 [pid = 1722] [id = 641] 04:03:09 INFO - ++DOMWINDOW == 33 (0x11e7ad000) [pid = 1722] [serial = 1532] [outer = 0x0] 04:03:09 INFO - ++DOMWINDOW == 34 (0x11ef16000) [pid = 1722] [serial = 1533] [outer = 0x11e7ad000] 04:03:09 INFO - ++DOMWINDOW == 35 (0x12152bc00) [pid = 1722] [serial = 1534] [outer = 0x11e7ad000] 04:03:09 INFO - ++DOCSHELL 0x112cc0800 == 14 [pid = 1722] [id = 642] 04:03:09 INFO - ++DOMWINDOW == 36 (0x120fe3400) [pid = 1722] [serial = 1535] [outer = 0x0] 04:03:09 INFO - ++DOMWINDOW == 37 (0x120feec00) [pid = 1722] [serial = 1536] [outer = 0x120fe3400] 04:03:09 INFO - ++DOMWINDOW == 38 (0x121160800) [pid = 1722] [serial = 1537] [outer = 0x120fe3400] 04:03:09 INFO - ++DOCSHELL 0x124abe000 == 15 [pid = 1722] [id = 643] 04:03:09 INFO - ++DOMWINDOW == 39 (0x122e9f000) [pid = 1722] [serial = 1538] [outer = 0x0] 04:03:09 INFO - ++DOMWINDOW == 40 (0x122ea3400) [pid = 1722] [serial = 1539] [outer = 0x122e9f000] 04:03:11 INFO - --DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 636] 04:03:11 INFO - --DOCSHELL 0x11ee34800 == 13 [pid = 1722] [id = 637] 04:03:11 INFO - --DOCSHELL 0x112e96800 == 12 [pid = 1722] [id = 638] 04:03:11 INFO - --DOCSHELL 0x124abe000 == 11 [pid = 1722] [id = 643] 04:03:11 INFO - --DOMWINDOW == 39 (0x12232bc00) [pid = 1722] [serial = 1520] [outer = 0x0] [url = about:blank] 04:03:11 INFO - --DOMWINDOW == 38 (0x121117c00) [pid = 1722] [serial = 1518] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:11 INFO - --DOMWINDOW == 37 (0x11ef16000) [pid = 1722] [serial = 1533] [outer = 0x0] [url = about:blank] 04:03:11 INFO - --DOMWINDOW == 36 (0x11f715400) [pid = 1722] [serial = 1524] [outer = 0x0] [url = about:blank] 04:03:11 INFO - --DOMWINDOW == 35 (0x113d05400) [pid = 1722] [serial = 1522] [outer = 0x0] [url = about:blank] 04:03:11 INFO - --DOMWINDOW == 34 (0x120feec00) [pid = 1722] [serial = 1536] [outer = 0x0] [url = about:blank] 04:03:11 INFO - --DOMWINDOW == 33 (0x122e9e400) [pid = 1722] [serial = 1528] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:11 INFO - --DOMWINDOW == 32 (0x120263800) [pid = 1722] [serial = 1525] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:11 INFO - --DOMWINDOW == 31 (0x11ec90000) [pid = 1722] [serial = 1523] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20JSTerm%20Helpers%20autocomplete] 04:03:11 INFO - --DOMWINDOW == 30 (0x113443c00) [pid = 1722] [serial = 1521] [outer = 0x0] [url = about:blank] 04:03:11 INFO - MEMORY STAT | vsize 3399MB | residentFast 477MB | heapAllocated 120MB 04:03:11 INFO - 313 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_704295.js | took 2367ms 04:03:11 INFO - ++DOCSHELL 0x112ccd000 == 12 [pid = 1722] [id = 644] 04:03:11 INFO - ++DOMWINDOW == 31 (0x113d0ac00) [pid = 1722] [serial = 1540] [outer = 0x0] 04:03:11 INFO - ++DOMWINDOW == 32 (0x11d465400) [pid = 1722] [serial = 1541] [outer = 0x113d0ac00] 04:03:11 INFO - 314 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_734061_No_input_change_and_Tab_key_pressed.js 04:03:11 INFO - ++DOCSHELL 0x11ee49800 == 13 [pid = 1722] [id = 645] 04:03:11 INFO - ++DOMWINDOW == 33 (0x11f719400) [pid = 1722] [serial = 1542] [outer = 0x0] 04:03:11 INFO - ++DOMWINDOW == 34 (0x1203e5000) [pid = 1722] [serial = 1543] [outer = 0x11f719400] 04:03:11 INFO - ++DOMWINDOW == 35 (0x1214b0400) [pid = 1722] [serial = 1544] [outer = 0x11f719400] 04:03:11 INFO - ++DOCSHELL 0x113e4a000 == 14 [pid = 1722] [id = 646] 04:03:11 INFO - ++DOMWINDOW == 36 (0x120e24800) [pid = 1722] [serial = 1545] [outer = 0x0] 04:03:11 INFO - ++DOMWINDOW == 37 (0x120fe4400) [pid = 1722] [serial = 1546] [outer = 0x120e24800] 04:03:11 INFO - ++DOMWINDOW == 38 (0x1214ab400) [pid = 1722] [serial = 1547] [outer = 0x120e24800] 04:03:11 INFO - ++DOCSHELL 0x124ac5000 == 15 [pid = 1722] [id = 647] 04:03:11 INFO - ++DOMWINDOW == 39 (0x122ea7800) [pid = 1722] [serial = 1548] [outer = 0x0] 04:03:11 INFO - ++DOMWINDOW == 40 (0x124394400) [pid = 1722] [serial = 1549] [outer = 0x122ea7800] 04:03:13 INFO - --DOCSHELL 0x112cc0800 == 14 [pid = 1722] [id = 642] 04:03:13 INFO - --DOCSHELL 0x11e346000 == 13 [pid = 1722] [id = 641] 04:03:13 INFO - --DOCSHELL 0x124ac5000 == 12 [pid = 1722] [id = 647] 04:03:13 INFO - --DOCSHELL 0x112cc2800 == 11 [pid = 1722] [id = 640] 04:03:13 INFO - --DOMWINDOW == 39 (0x122ea2400) [pid = 1722] [serial = 1529] [outer = 0x0] [url = about:blank] 04:03:13 INFO - --DOMWINDOW == 38 (0x12115cc00) [pid = 1722] [serial = 1527] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:13 INFO - --DOMWINDOW == 37 (0x1203e5000) [pid = 1722] [serial = 1543] [outer = 0x0] [url = about:blank] 04:03:13 INFO - --DOMWINDOW == 36 (0x113450000) [pid = 1722] [serial = 1531] [outer = 0x0] [url = about:blank] 04:03:13 INFO - --DOMWINDOW == 35 (0x120fe4400) [pid = 1722] [serial = 1546] [outer = 0x0] [url = about:blank] 04:03:13 INFO - --DOMWINDOW == 34 (0x122e9f000) [pid = 1722] [serial = 1538] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:13 INFO - --DOMWINDOW == 33 (0x120fe3400) [pid = 1722] [serial = 1535] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:13 INFO - --DOMWINDOW == 32 (0x11e7ad000) [pid = 1722] [serial = 1532] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:03:13 INFO - --DOMWINDOW == 31 (0x113262800) [pid = 1722] [serial = 1530] [outer = 0x0] [url = about:blank] 04:03:13 INFO - --DOMWINDOW == 30 (0x12152bc00) [pid = 1722] [serial = 1534] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:03:13 INFO - MEMORY STAT | vsize 3399MB | residentFast 477MB | heapAllocated 119MB 04:03:13 INFO - 315 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_734061_No_input_change_and_Tab_key_pressed.js | took 2274ms 04:03:13 INFO - ++DOCSHELL 0x112cc6800 == 12 [pid = 1722] [id = 648] 04:03:13 INFO - ++DOMWINDOW == 31 (0x11318d800) [pid = 1722] [serial = 1550] [outer = 0x0] 04:03:13 INFO - ++DOMWINDOW == 32 (0x113444c00) [pid = 1722] [serial = 1551] [outer = 0x11318d800] 04:03:13 INFO - 316 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_737873_mixedcontent.js 04:03:13 INFO - ++DOCSHELL 0x11eecb800 == 13 [pid = 1722] [id = 649] 04:03:13 INFO - ++DOMWINDOW == 33 (0x11ef16000) [pid = 1722] [serial = 1552] [outer = 0x0] 04:03:13 INFO - ++DOMWINDOW == 34 (0x1202e4400) [pid = 1722] [serial = 1553] [outer = 0x11ef16000] 04:03:14 INFO - ++DOCSHELL 0x113459800 == 14 [pid = 1722] [id = 650] 04:03:14 INFO - ++DOMWINDOW == 35 (0x1203dec00) [pid = 1722] [serial = 1554] [outer = 0x0] 04:03:14 INFO - ++DOMWINDOW == 36 (0x120fee400) [pid = 1722] [serial = 1555] [outer = 0x1203dec00] 04:03:14 INFO - ++DOMWINDOW == 37 (0x12110b400) [pid = 1722] [serial = 1556] [outer = 0x1203dec00] 04:03:14 INFO - ++DOCSHELL 0x124f19000 == 15 [pid = 1722] [id = 651] 04:03:14 INFO - ++DOMWINDOW == 38 (0x122ea2c00) [pid = 1722] [serial = 1557] [outer = 0x0] 04:03:14 INFO - ++DOMWINDOW == 39 (0x122ea6400) [pid = 1722] [serial = 1558] [outer = 0x122ea2c00] 04:03:15 INFO - ++DOMWINDOW == 40 (0x1283f6800) [pid = 1722] [serial = 1559] [outer = 0x11ef16000] 04:03:15 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:03:15 INFO - ++DOCSHELL 0x12936b000 == 16 [pid = 1722] [id = 652] 04:03:15 INFO - ++DOMWINDOW == 41 (0x1264afc00) [pid = 1722] [serial = 1560] [outer = 0x0] 04:03:15 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:03:15 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:03:15 INFO - ++DOMWINDOW == 42 (0x1264b6c00) [pid = 1722] [serial = 1561] [outer = 0x1264afc00] 04:03:15 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:03:15 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:03:15 INFO - ++DOMWINDOW == 43 (0x1273dfc00) [pid = 1722] [serial = 1562] [outer = 0x1264afc00] 04:03:15 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:03:15 INFO - [1722] WARNING: Requested underline style is not valid: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 04:03:15 INFO - [1722] WARNING: non-IME selection type: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 04:03:16 INFO - --DOCSHELL 0x112ccd000 == 15 [pid = 1722] [id = 644] 04:03:16 INFO - --DOCSHELL 0x113e4a000 == 14 [pid = 1722] [id = 646] 04:03:16 INFO - --DOCSHELL 0x124f19000 == 13 [pid = 1722] [id = 651] 04:03:16 INFO - --DOCSHELL 0x11ee49800 == 12 [pid = 1722] [id = 645] 04:03:16 INFO - --DOMWINDOW == 42 (0x122ea3400) [pid = 1722] [serial = 1539] [outer = 0x0] [url = about:blank] 04:03:16 INFO - --DOMWINDOW == 41 (0x121160800) [pid = 1722] [serial = 1537] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:16 INFO - --DOMWINDOW == 40 (0x1214b0400) [pid = 1722] [serial = 1544] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 04:03:16 INFO - --DOMWINDOW == 39 (0x11d465400) [pid = 1722] [serial = 1541] [outer = 0x0] [url = about:blank] 04:03:16 INFO - --DOMWINDOW == 38 (0x120fee400) [pid = 1722] [serial = 1555] [outer = 0x0] [url = about:blank] 04:03:16 INFO - --DOMWINDOW == 37 (0x1264b6c00) [pid = 1722] [serial = 1561] [outer = 0x0] [url = about:blank] 04:03:16 INFO - --DOMWINDOW == 36 (0x120e24800) [pid = 1722] [serial = 1545] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:16 INFO - --DOMWINDOW == 35 (0x122ea7800) [pid = 1722] [serial = 1548] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:16 INFO - --DOMWINDOW == 34 (0x11f719400) [pid = 1722] [serial = 1542] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 04:03:16 INFO - --DOMWINDOW == 33 (0x113d0ac00) [pid = 1722] [serial = 1540] [outer = 0x0] [url = about:blank] 04:03:16 INFO - MEMORY STAT | vsize 3402MB | residentFast 477MB | heapAllocated 123MB 04:03:16 INFO - 317 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_737873_mixedcontent.js | took 2823ms 04:03:16 INFO - ++DOCSHELL 0x112853800 == 13 [pid = 1722] [id = 653] 04:03:16 INFO - ++DOMWINDOW == 34 (0x115144800) [pid = 1722] [serial = 1563] [outer = 0x0] 04:03:16 INFO - ++DOMWINDOW == 35 (0x11ebb5400) [pid = 1722] [serial = 1564] [outer = 0x115144800] 04:03:16 INFO - 318 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_752559_ineffective_iframe_sandbox_warning.js 04:03:16 INFO - ++DOCSHELL 0x120eb8800 == 14 [pid = 1722] [id = 654] 04:03:16 INFO - ++DOMWINDOW == 36 (0x120d25000) [pid = 1722] [serial = 1565] [outer = 0x0] 04:03:16 INFO - ++DOMWINDOW == 37 (0x120e26000) [pid = 1722] [serial = 1566] [outer = 0x120d25000] 04:03:16 INFO - ++DOMWINDOW == 38 (0x120ff4800) [pid = 1722] [serial = 1567] [outer = 0x120d25000] 04:03:17 INFO - ++DOCSHELL 0x1228d1000 == 15 [pid = 1722] [id = 655] 04:03:17 INFO - ++DOMWINDOW == 39 (0x110d5b400) [pid = 1722] [serial = 1568] [outer = 0x0] 04:03:17 INFO - ++DOMWINDOW == 40 (0x121312000) [pid = 1722] [serial = 1569] [outer = 0x110d5b400] 04:03:17 INFO - ++DOCSHELL 0x112cb8000 == 16 [pid = 1722] [id = 656] 04:03:17 INFO - ++DOMWINDOW == 41 (0x1214adc00) [pid = 1722] [serial = 1570] [outer = 0x0] 04:03:17 INFO - ++DOMWINDOW == 42 (0x1214af800) [pid = 1722] [serial = 1571] [outer = 0x1214adc00] 04:03:17 INFO - ++DOMWINDOW == 43 (0x12211a400) [pid = 1722] [serial = 1572] [outer = 0x1214adc00] 04:03:17 INFO - ++DOCSHELL 0x128214000 == 17 [pid = 1722] [id = 657] 04:03:17 INFO - ++DOMWINDOW == 44 (0x1247be800) [pid = 1722] [serial = 1573] [outer = 0x0] 04:03:17 INFO - ++DOMWINDOW == 45 (0x124884800) [pid = 1722] [serial = 1574] [outer = 0x1247be800] 04:03:18 INFO - ++DOCSHELL 0x128214800 == 18 [pid = 1722] [id = 658] 04:03:18 INFO - ++DOMWINDOW == 46 (0x1273e0400) [pid = 1722] [serial = 1575] [outer = 0x0] 04:03:18 INFO - ++DOMWINDOW == 47 (0x1273eac00) [pid = 1722] [serial = 1576] [outer = 0x1273e0400] 04:03:18 INFO - ++DOMWINDOW == 48 (0x121805800) [pid = 1722] [serial = 1577] [outer = 0x1273e0400] 04:03:18 INFO - ++DOCSHELL 0x12966a800 == 19 [pid = 1722] [id = 659] 04:03:18 INFO - ++DOMWINDOW == 49 (0x112f42400) [pid = 1722] [serial = 1578] [outer = 0x0] 04:03:18 INFO - ++DOMWINDOW == 50 (0x1129be800) [pid = 1722] [serial = 1579] [outer = 0x112f42400] 04:03:18 INFO - ++DOMWINDOW == 51 (0x1264af000) [pid = 1722] [serial = 1580] [outer = 0x112f42400] 04:03:18 INFO - ++DOCSHELL 0x129666800 == 20 [pid = 1722] [id = 660] 04:03:18 INFO - ++DOMWINDOW == 52 (0x1203ea000) [pid = 1722] [serial = 1581] [outer = 0x0] 04:03:18 INFO - ++DOMWINDOW == 53 (0x128303800) [pid = 1722] [serial = 1582] [outer = 0x1203ea000] 04:03:18 INFO - ++DOMWINDOW == 54 (0x128305800) [pid = 1722] [serial = 1583] [outer = 0x1203ea000] 04:03:18 INFO - ++DOCSHELL 0x12c3bd000 == 21 [pid = 1722] [id = 661] 04:03:18 INFO - ++DOMWINDOW == 55 (0x1247c3400) [pid = 1722] [serial = 1584] [outer = 0x0] 04:03:18 INFO - ++DOMWINDOW == 56 (0x128308c00) [pid = 1722] [serial = 1585] [outer = 0x1247c3400] 04:03:19 INFO - ++DOCSHELL 0x12d98e800 == 22 [pid = 1722] [id = 662] 04:03:19 INFO - ++DOMWINDOW == 57 (0x1283ee000) [pid = 1722] [serial = 1586] [outer = 0x0] 04:03:19 INFO - ++DOMWINDOW == 58 (0x12938e400) [pid = 1722] [serial = 1587] [outer = 0x1283ee000] 04:03:19 INFO - ++DOMWINDOW == 59 (0x129394c00) [pid = 1722] [serial = 1588] [outer = 0x1283ee000] 04:03:19 INFO - ++DOCSHELL 0x128223000 == 23 [pid = 1722] [id = 663] 04:03:19 INFO - ++DOMWINDOW == 60 (0x1247c9400) [pid = 1722] [serial = 1589] [outer = 0x0] 04:03:19 INFO - ++DOMWINDOW == 61 (0x1296d4800) [pid = 1722] [serial = 1590] [outer = 0x1247c9400] 04:03:19 INFO - ++DOCSHELL 0x12e083000 == 24 [pid = 1722] [id = 664] 04:03:19 INFO - ++DOMWINDOW == 62 (0x12d407c00) [pid = 1722] [serial = 1591] [outer = 0x0] 04:03:19 INFO - ++DOMWINDOW == 63 (0x12d408c00) [pid = 1722] [serial = 1592] [outer = 0x12d407c00] 04:03:19 INFO - ++DOMWINDOW == 64 (0x12a06f400) [pid = 1722] [serial = 1593] [outer = 0x12d407c00] 04:03:20 INFO - ++DOCSHELL 0x12f917800 == 25 [pid = 1722] [id = 665] 04:03:20 INFO - ++DOMWINDOW == 65 (0x12e06b400) [pid = 1722] [serial = 1594] [outer = 0x0] 04:03:20 INFO - ++DOMWINDOW == 66 (0x12ee0d000) [pid = 1722] [serial = 1595] [outer = 0x12e06b400] 04:03:20 INFO - ++DOCSHELL 0x124867000 == 26 [pid = 1722] [id = 666] 04:03:20 INFO - ++DOMWINDOW == 67 (0x1214ac400) [pid = 1722] [serial = 1596] [outer = 0x0] 04:03:20 INFO - ++DOMWINDOW == 68 (0x1214b0000) [pid = 1722] [serial = 1597] [outer = 0x1214ac400] 04:03:21 INFO - ++DOMWINDOW == 69 (0x124778c00) [pid = 1722] [serial = 1598] [outer = 0x1214ac400] 04:03:21 INFO - ++DOCSHELL 0x11295a000 == 27 [pid = 1722] [id = 667] 04:03:21 INFO - ++DOMWINDOW == 70 (0x126240000) [pid = 1722] [serial = 1599] [outer = 0x0] 04:03:21 INFO - ++DOMWINDOW == 71 (0x126485c00) [pid = 1722] [serial = 1600] [outer = 0x126240000] 04:03:21 INFO - ++DOMWINDOW == 72 (0x1264b1c00) [pid = 1722] [serial = 1601] [outer = 0x126240000] 04:03:21 INFO - ++DOCSHELL 0x124f1c000 == 28 [pid = 1722] [id = 668] 04:03:21 INFO - ++DOMWINDOW == 73 (0x1245bb800) [pid = 1722] [serial = 1602] [outer = 0x0] 04:03:21 INFO - ++DOMWINDOW == 74 (0x12830c000) [pid = 1722] [serial = 1603] [outer = 0x1245bb800] 04:03:21 INFO - ++DOMWINDOW == 75 (0x128387c00) [pid = 1722] [serial = 1604] [outer = 0x1245bb800] 04:03:21 INFO - ++DOCSHELL 0x12fabb800 == 29 [pid = 1722] [id = 669] 04:03:21 INFO - ++DOMWINDOW == 76 (0x1283ed400) [pid = 1722] [serial = 1605] [outer = 0x0] 04:03:21 INFO - ++DOMWINDOW == 77 (0x12f4e1400) [pid = 1722] [serial = 1606] [outer = 0x1283ed400] 04:03:22 INFO - ++DOCSHELL 0x12ff6f800 == 30 [pid = 1722] [id = 670] 04:03:22 INFO - ++DOMWINDOW == 78 (0x12ff24000) [pid = 1722] [serial = 1607] [outer = 0x0] 04:03:22 INFO - ++DOMWINDOW == 79 (0x12ffcb400) [pid = 1722] [serial = 1608] [outer = 0x12ff24000] 04:03:22 INFO - ++DOMWINDOW == 80 (0x12938a000) [pid = 1722] [serial = 1609] [outer = 0x12ff24000] 04:03:22 INFO - ++DOCSHELL 0x12fdcb800 == 31 [pid = 1722] [id = 671] 04:03:22 INFO - ++DOMWINDOW == 81 (0x1276c2800) [pid = 1722] [serial = 1610] [outer = 0x0] 04:03:23 INFO - ++DOMWINDOW == 82 (0x1276c5800) [pid = 1722] [serial = 1611] [outer = 0x1276c2800] 04:03:23 INFO - ++DOMWINDOW == 83 (0x1276c3800) [pid = 1722] [serial = 1612] [outer = 0x1276c2800] 04:03:23 INFO - ++DOCSHELL 0x1326e3800 == 32 [pid = 1722] [id = 672] 04:03:23 INFO - ++DOMWINDOW == 84 (0x124c3d800) [pid = 1722] [serial = 1613] [outer = 0x0] 04:03:23 INFO - ++DOMWINDOW == 85 (0x1276ca400) [pid = 1722] [serial = 1614] [outer = 0x124c3d800] 04:03:23 INFO - ++DOCSHELL 0x112968800 == 33 [pid = 1722] [id = 673] 04:03:23 INFO - ++DOMWINDOW == 86 (0x12826f000) [pid = 1722] [serial = 1615] [outer = 0x0] 04:03:23 INFO - ++DOMWINDOW == 87 (0x12938c800) [pid = 1722] [serial = 1616] [outer = 0x12826f000] 04:03:23 INFO - ++DOMWINDOW == 88 (0x1276ccc00) [pid = 1722] [serial = 1617] [outer = 0x12826f000] 04:03:23 INFO - ++DOCSHELL 0x1326fe800 == 34 [pid = 1722] [id = 674] 04:03:23 INFO - ++DOMWINDOW == 89 (0x130b6d800) [pid = 1722] [serial = 1618] [outer = 0x0] 04:03:23 INFO - ++DOMWINDOW == 90 (0x130b6f800) [pid = 1722] [serial = 1619] [outer = 0x130b6d800] 04:03:24 INFO - ++DOCSHELL 0x13756d000 == 35 [pid = 1722] [id = 675] 04:03:24 INFO - ++DOMWINDOW == 91 (0x130bc7c00) [pid = 1722] [serial = 1620] [outer = 0x0] 04:03:24 INFO - ++DOMWINDOW == 92 (0x13bc85000) [pid = 1722] [serial = 1621] [outer = 0x130bc7c00] 04:03:24 INFO - ++DOMWINDOW == 93 (0x12fcd0400) [pid = 1722] [serial = 1622] [outer = 0x130bc7c00] 04:03:24 INFO - ++DOCSHELL 0x129755000 == 36 [pid = 1722] [id = 676] 04:03:24 INFO - ++DOMWINDOW == 94 (0x12ff4e800) [pid = 1722] [serial = 1623] [outer = 0x0] 04:03:24 INFO - [1722] WARNING: No inner window available!: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9246 04:03:25 INFO - ++DOMWINDOW == 95 (0x13bb50800) [pid = 1722] [serial = 1624] [outer = 0x12ff4e800] 04:03:25 INFO - ++DOMWINDOW == 96 (0x120d20c00) [pid = 1722] [serial = 1625] [outer = 0x12ff4e800] 04:03:25 INFO - ++DOCSHELL 0x11268b800 == 37 [pid = 1722] [id = 677] 04:03:25 INFO - ++DOMWINDOW == 97 (0x112673400) [pid = 1722] [serial = 1626] [outer = 0x0] 04:03:25 INFO - ++DOMWINDOW == 98 (0x11280f800) [pid = 1722] [serial = 1627] [outer = 0x112673400] 04:03:25 INFO - ++DOCSHELL 0x11320e000 == 38 [pid = 1722] [id = 678] 04:03:25 INFO - ++DOMWINDOW == 99 (0x1129b6c00) [pid = 1722] [serial = 1628] [outer = 0x0] 04:03:25 INFO - ++DOMWINDOW == 100 (0x1129bfc00) [pid = 1722] [serial = 1629] [outer = 0x1129b6c00] 04:03:25 INFO - ++DOMWINDOW == 101 (0x11315a400) [pid = 1722] [serial = 1630] [outer = 0x1129b6c00] 04:03:26 INFO - ++DOCSHELL 0x11efca800 == 39 [pid = 1722] [id = 679] 04:03:26 INFO - ++DOMWINDOW == 102 (0x11ebb8800) [pid = 1722] [serial = 1631] [outer = 0x0] 04:03:26 INFO - ++DOMWINDOW == 103 (0x11ee5c400) [pid = 1722] [serial = 1632] [outer = 0x11ebb8800] 04:03:26 INFO - --DOCSHELL 0x113459800 == 38 [pid = 1722] [id = 650] 04:03:26 INFO - --DOCSHELL 0x12936b000 == 37 [pid = 1722] [id = 652] 04:03:27 INFO - --DOCSHELL 0x112cc6800 == 36 [pid = 1722] [id = 648] 04:03:27 INFO - --DOCSHELL 0x11eecb800 == 35 [pid = 1722] [id = 649] 04:03:27 INFO - --DOCSHELL 0x11efca800 == 34 [pid = 1722] [id = 679] 04:03:27 INFO - --DOMWINDOW == 102 (0x124394400) [pid = 1722] [serial = 1549] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 101 (0x1214ab400) [pid = 1722] [serial = 1547] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:27 INFO - --DOMWINDOW == 100 (0x122ea2c00) [pid = 1722] [serial = 1557] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:27 INFO - --DOMWINDOW == 99 (0x1203dec00) [pid = 1722] [serial = 1554] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:27 INFO - --DOMWINDOW == 98 (0x1129bfc00) [pid = 1722] [serial = 1629] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 97 (0x11ef16000) [pid = 1722] [serial = 1552] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-737873-mixedcontent.html] 04:03:27 INFO - --DOMWINDOW == 96 (0x1264afc00) [pid = 1722] [serial = 1560] [outer = 0x0] [url = http://example.com/] 04:03:27 INFO - --DOMWINDOW == 95 (0x13bb50800) [pid = 1722] [serial = 1624] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 94 (0x13bc85000) [pid = 1722] [serial = 1621] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 93 (0x1276c5800) [pid = 1722] [serial = 1611] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 92 (0x12ffcb400) [pid = 1722] [serial = 1608] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 91 (0x126485c00) [pid = 1722] [serial = 1600] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 90 (0x1214b0000) [pid = 1722] [serial = 1597] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 89 (0x12938e400) [pid = 1722] [serial = 1587] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 88 (0x1129be800) [pid = 1722] [serial = 1579] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 87 (0x1273eac00) [pid = 1722] [serial = 1576] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 86 (0x12938c800) [pid = 1722] [serial = 1616] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 85 (0x12830c000) [pid = 1722] [serial = 1603] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 84 (0x12d408c00) [pid = 1722] [serial = 1592] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 83 (0x128303800) [pid = 1722] [serial = 1582] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 82 (0x113444c00) [pid = 1722] [serial = 1551] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 81 (0x1273dfc00) [pid = 1722] [serial = 1562] [outer = 0x0] [url = http://example.com/] 04:03:27 INFO - --DOMWINDOW == 80 (0x1202e4400) [pid = 1722] [serial = 1553] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 79 (0x1214af800) [pid = 1722] [serial = 1571] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 78 (0x120e26000) [pid = 1722] [serial = 1566] [outer = 0x0] [url = about:blank] 04:03:27 INFO - --DOMWINDOW == 77 (0x11318d800) [pid = 1722] [serial = 1550] [outer = 0x0] [url = about:blank] 04:03:28 INFO - --DOCSHELL 0x1326fe800 == 33 [pid = 1722] [id = 674] 04:03:28 INFO - --DOCSHELL 0x12fabb800 == 32 [pid = 1722] [id = 669] 04:03:28 INFO - --DOCSHELL 0x12f917800 == 31 [pid = 1722] [id = 665] 04:03:28 INFO - --DOCSHELL 0x12c3bd000 == 30 [pid = 1722] [id = 661] 04:03:28 INFO - --DOCSHELL 0x128214000 == 29 [pid = 1722] [id = 657] 04:03:28 INFO - --DOMWINDOW == 76 (0x1283f6800) [pid = 1722] [serial = 1559] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-737873-mixedcontent.html] 04:03:28 INFO - MEMORY STAT | vsize 3407MB | residentFast 482MB | heapAllocated 131MB 04:03:28 INFO - 319 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_752559_ineffective_iframe_sandbox_warning.js | took 11935ms 04:03:28 INFO - ++DOCSHELL 0x113461000 == 30 [pid = 1722] [id = 680] 04:03:28 INFO - ++DOMWINDOW == 77 (0x11f5ccc00) [pid = 1722] [serial = 1633] [outer = 0x0] 04:03:28 INFO - ++DOMWINDOW == 78 (0x12025a000) [pid = 1722] [serial = 1634] [outer = 0x11f5ccc00] 04:03:28 INFO - 320 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_about_blank_web_console_warning.js 04:03:28 INFO - ++DOCSHELL 0x11351f000 == 31 [pid = 1722] [id = 681] 04:03:28 INFO - ++DOMWINDOW == 79 (0x120fec800) [pid = 1722] [serial = 1635] [outer = 0x0] 04:03:28 INFO - ++DOMWINDOW == 80 (0x120ff1000) [pid = 1722] [serial = 1636] [outer = 0x120fec800] 04:03:29 INFO - ++DOMWINDOW == 81 (0x121115c00) [pid = 1722] [serial = 1637] [outer = 0x120fec800] 04:03:29 INFO - ++DOCSHELL 0x114b80800 == 32 [pid = 1722] [id = 682] 04:03:29 INFO - ++DOMWINDOW == 82 (0x121319400) [pid = 1722] [serial = 1638] [outer = 0x0] 04:03:29 INFO - ++DOMWINDOW == 83 (0x1214aac00) [pid = 1722] [serial = 1639] [outer = 0x121319400] 04:03:29 INFO - ++DOCSHELL 0x11269a000 == 33 [pid = 1722] [id = 683] 04:03:29 INFO - ++DOMWINDOW == 84 (0x121809c00) [pid = 1722] [serial = 1640] [outer = 0x0] 04:03:29 INFO - ++DOMWINDOW == 85 (0x121810800) [pid = 1722] [serial = 1641] [outer = 0x121809c00] 04:03:29 INFO - ++DOMWINDOW == 86 (0x1221bbc00) [pid = 1722] [serial = 1642] [outer = 0x121809c00] 04:03:29 INFO - ++DOCSHELL 0x11f63d000 == 34 [pid = 1722] [id = 684] 04:03:29 INFO - ++DOMWINDOW == 87 (0x121811000) [pid = 1722] [serial = 1643] [outer = 0x0] 04:03:29 INFO - ++DOMWINDOW == 88 (0x1245bd000) [pid = 1722] [serial = 1644] [outer = 0x121811000] 04:03:31 INFO - --DOCSHELL 0x129755000 == 33 [pid = 1722] [id = 676] 04:03:31 INFO - --DOCSHELL 0x12e083000 == 32 [pid = 1722] [id = 664] 04:03:31 INFO - --DOCSHELL 0x112cb8000 == 31 [pid = 1722] [id = 656] 04:03:31 INFO - --DOCSHELL 0x11f63d000 == 30 [pid = 1722] [id = 684] 04:03:31 INFO - --DOCSHELL 0x13756d000 == 29 [pid = 1722] [id = 675] 04:03:31 INFO - --DOCSHELL 0x11320e000 == 28 [pid = 1722] [id = 678] 04:03:31 INFO - --DOCSHELL 0x112968800 == 27 [pid = 1722] [id = 673] 04:03:31 INFO - --DOCSHELL 0x129666800 == 26 [pid = 1722] [id = 660] 04:03:31 INFO - --DOCSHELL 0x124f1c000 == 25 [pid = 1722] [id = 668] 04:03:31 INFO - --DOMWINDOW == 87 (0x122ea6400) [pid = 1722] [serial = 1558] [outer = 0x0] [url = about:blank] 04:03:31 INFO - --DOMWINDOW == 86 (0x12110b400) [pid = 1722] [serial = 1556] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:31 INFO - --DOMWINDOW == 85 (0x126240000) [pid = 1722] [serial = 1599] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 04:03:31 INFO - --DOMWINDOW == 84 (0x1214ac400) [pid = 1722] [serial = 1596] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning3.html] 04:03:31 INFO - --DOMWINDOW == 83 (0x1247c9400) [pid = 1722] [serial = 1589] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 04:03:31 INFO - --DOMWINDOW == 82 (0x1283ee000) [pid = 1722] [serial = 1586] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning2.html] 04:03:31 INFO - --DOMWINDOW == 81 (0x112f42400) [pid = 1722] [serial = 1578] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 04:03:31 INFO - --DOMWINDOW == 80 (0x1273e0400) [pid = 1722] [serial = 1575] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning1.html] 04:03:31 INFO - --DOMWINDOW == 79 (0x110d5b400) [pid = 1722] [serial = 1568] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 04:03:31 INFO - --DOMWINDOW == 78 (0x120d25000) [pid = 1722] [serial = 1565] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning0.html] 04:03:31 INFO - --DOMWINDOW == 77 (0x115144800) [pid = 1722] [serial = 1563] [outer = 0x0] [url = about:blank] 04:03:31 INFO - --DOMWINDOW == 76 (0x112673400) [pid = 1722] [serial = 1626] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 04:03:31 INFO - --DOMWINDOW == 75 (0x12ff4e800) [pid = 1722] [serial = 1623] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested2.html] 04:03:31 INFO - --DOMWINDOW == 74 (0x130bc7c00) [pid = 1722] [serial = 1620] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning5.html] 04:03:31 INFO - --DOMWINDOW == 73 (0x124c3d800) [pid = 1722] [serial = 1613] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 04:03:31 INFO - --DOMWINDOW == 72 (0x1276c2800) [pid = 1722] [serial = 1610] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested1.html] 04:03:31 INFO - --DOMWINDOW == 71 (0x12ff24000) [pid = 1722] [serial = 1607] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning4.html] 04:03:31 INFO - --DOMWINDOW == 70 (0x1129b6c00) [pid = 1722] [serial = 1628] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:31 INFO - --DOMWINDOW == 69 (0x11ebb8800) [pid = 1722] [serial = 1631] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:31 INFO - --DOMWINDOW == 68 (0x120ff1000) [pid = 1722] [serial = 1636] [outer = 0x0] [url = about:blank] 04:03:31 INFO - --DOMWINDOW == 67 (0x11ebb5400) [pid = 1722] [serial = 1564] [outer = 0x0] [url = about:blank] 04:03:31 INFO - --DOMWINDOW == 66 (0x121810800) [pid = 1722] [serial = 1641] [outer = 0x0] [url = about:blank] 04:03:31 INFO - --DOMWINDOW == 65 (0x11280f800) [pid = 1722] [serial = 1627] [outer = 0x0] [url = about:blank] 04:03:31 INFO - --DOMWINDOW == 64 (0x120d20c00) [pid = 1722] [serial = 1625] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested2.html] 04:03:31 INFO - --DOMWINDOW == 63 (0x12fcd0400) [pid = 1722] [serial = 1622] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning5.html] 04:03:31 INFO - --DOMWINDOW == 62 (0x1276ca400) [pid = 1722] [serial = 1614] [outer = 0x0] [url = about:blank] 04:03:31 INFO - --DOMWINDOW == 61 (0x1276c3800) [pid = 1722] [serial = 1612] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested1.html] 04:03:31 INFO - --DOMWINDOW == 60 (0x12938a000) [pid = 1722] [serial = 1609] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning4.html] 04:03:31 INFO - --DOMWINDOW == 59 (0x1264b1c00) [pid = 1722] [serial = 1601] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 04:03:31 INFO - --DOMWINDOW == 58 (0x124778c00) [pid = 1722] [serial = 1598] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning3.html] 04:03:31 INFO - --DOMWINDOW == 57 (0x1296d4800) [pid = 1722] [serial = 1590] [outer = 0x0] [url = about:blank] 04:03:31 INFO - --DOMWINDOW == 56 (0x129394c00) [pid = 1722] [serial = 1588] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning2.html] 04:03:31 INFO - --DOMWINDOW == 55 (0x1264af000) [pid = 1722] [serial = 1580] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 04:03:31 INFO - --DOMWINDOW == 54 (0x121805800) [pid = 1722] [serial = 1577] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning1.html] 04:03:31 INFO - --DOMWINDOW == 53 (0x121312000) [pid = 1722] [serial = 1569] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 04:03:31 INFO - --DOMWINDOW == 52 (0x120ff4800) [pid = 1722] [serial = 1567] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning0.html] 04:03:31 INFO - MEMORY STAT | vsize 3404MB | residentFast 480MB | heapAllocated 125MB 04:03:31 INFO - 321 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_about_blank_web_console_warning.js | took 2470ms 04:03:31 INFO - ++DOCSHELL 0x112cc6800 == 26 [pid = 1722] [id = 685] 04:03:31 INFO - ++DOMWINDOW == 53 (0x112c98400) [pid = 1722] [serial = 1645] [outer = 0x0] 04:03:31 INFO - ++DOMWINDOW == 54 (0x112f41000) [pid = 1722] [serial = 1646] [outer = 0x112c98400] 04:03:31 INFO - 322 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_764572_output_open_url.js 04:03:31 INFO - ++DOCSHELL 0x113208800 == 27 [pid = 1722] [id = 686] 04:03:31 INFO - ++DOMWINDOW == 55 (0x11318ac00) [pid = 1722] [serial = 1647] [outer = 0x0] 04:03:31 INFO - ++DOMWINDOW == 56 (0x113399400) [pid = 1722] [serial = 1648] [outer = 0x11318ac00] 04:03:31 INFO - ++DOMWINDOW == 57 (0x120ffe400) [pid = 1722] [serial = 1649] [outer = 0x11318ac00] 04:03:31 INFO - ++DOCSHELL 0x113314800 == 28 [pid = 1722] [id = 687] 04:03:31 INFO - ++DOMWINDOW == 58 (0x113d0b800) [pid = 1722] [serial = 1650] [outer = 0x0] 04:03:31 INFO - ++DOMWINDOW == 59 (0x113e10800) [pid = 1722] [serial = 1651] [outer = 0x113d0b800] 04:03:31 INFO - ++DOMWINDOW == 60 (0x11ebb5400) [pid = 1722] [serial = 1652] [outer = 0x113d0b800] 04:03:31 INFO - ++DOCSHELL 0x11e350800 == 29 [pid = 1722] [id = 688] 04:03:31 INFO - ++DOMWINDOW == 61 (0x120ff8400) [pid = 1722] [serial = 1653] [outer = 0x0] 04:03:31 INFO - ++DOMWINDOW == 62 (0x121112800) [pid = 1722] [serial = 1654] [outer = 0x120ff8400] 04:03:32 INFO - ++DOMWINDOW == 63 (0x126143800) [pid = 1722] [serial = 1655] [outer = 0x11318ac00] 04:03:32 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:03:32 INFO - ++DOCSHELL 0x121888800 == 30 [pid = 1722] [id = 689] 04:03:32 INFO - ++DOMWINDOW == 64 (0x126244c00) [pid = 1722] [serial = 1656] [outer = 0x0] 04:03:33 INFO - ++DOMWINDOW == 65 (0x126483400) [pid = 1722] [serial = 1657] [outer = 0x126244c00] 04:03:33 INFO - ++DOMWINDOW == 66 (0x126241400) [pid = 1722] [serial = 1658] [outer = 0x126244c00] 04:03:34 INFO - --DOCSHELL 0x12fdcb800 == 29 [pid = 1722] [id = 671] 04:03:34 INFO - --DOCSHELL 0x1326e3800 == 28 [pid = 1722] [id = 672] 04:03:34 INFO - --DOCSHELL 0x128223000 == 27 [pid = 1722] [id = 663] 04:03:34 INFO - --DOCSHELL 0x12966a800 == 26 [pid = 1722] [id = 659] 04:03:34 INFO - --DOCSHELL 0x1228d1000 == 25 [pid = 1722] [id = 655] 04:03:34 INFO - --DOCSHELL 0x11295a000 == 24 [pid = 1722] [id = 667] 04:03:34 INFO - --DOCSHELL 0x114b80800 == 23 [pid = 1722] [id = 682] 04:03:34 INFO - --DOCSHELL 0x12ff6f800 == 22 [pid = 1722] [id = 670] 04:03:34 INFO - --DOCSHELL 0x11268b800 == 21 [pid = 1722] [id = 677] 04:03:34 INFO - --DOCSHELL 0x120eb8800 == 20 [pid = 1722] [id = 654] 04:03:34 INFO - --DOCSHELL 0x112853800 == 19 [pid = 1722] [id = 653] 04:03:34 INFO - --DOCSHELL 0x11269a000 == 18 [pid = 1722] [id = 683] 04:03:34 INFO - --DOCSHELL 0x11e350800 == 17 [pid = 1722] [id = 688] 04:03:34 INFO - --DOCSHELL 0x11351f000 == 16 [pid = 1722] [id = 681] 04:03:34 INFO - --DOCSHELL 0x12d98e800 == 15 [pid = 1722] [id = 662] 04:03:34 INFO - --DOCSHELL 0x128214800 == 14 [pid = 1722] [id = 658] 04:03:34 INFO - --DOCSHELL 0x124867000 == 13 [pid = 1722] [id = 666] 04:03:34 INFO - --DOMWINDOW == 65 (0x11ee5c400) [pid = 1722] [serial = 1632] [outer = 0x0] [url = about:blank] 04:03:34 INFO - --DOMWINDOW == 64 (0x11315a400) [pid = 1722] [serial = 1630] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:34 INFO - --DOMWINDOW == 63 (0x121319400) [pid = 1722] [serial = 1638] [outer = 0x0] [url = about:blank] 04:03:34 INFO - --DOMWINDOW == 62 (0x120fec800) [pid = 1722] [serial = 1635] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-762593-insecure-passwords-about-blank-web-console-warning.html] 04:03:34 INFO - --DOMWINDOW == 61 (0x11f5ccc00) [pid = 1722] [serial = 1633] [outer = 0x0] [url = about:blank] 04:03:34 INFO - --DOMWINDOW == 60 (0x113399400) [pid = 1722] [serial = 1648] [outer = 0x0] [url = about:blank] 04:03:34 INFO - --DOMWINDOW == 59 (0x1214aac00) [pid = 1722] [serial = 1639] [outer = 0x0] [url = about:blank] 04:03:34 INFO - --DOMWINDOW == 58 (0x12025a000) [pid = 1722] [serial = 1634] [outer = 0x0] [url = about:blank] 04:03:34 INFO - --DOMWINDOW == 57 (0x113e10800) [pid = 1722] [serial = 1651] [outer = 0x0] [url = about:blank] 04:03:34 INFO - --DOMWINDOW == 56 (0x126483400) [pid = 1722] [serial = 1657] [outer = 0x0] [url = about:blank] 04:03:34 INFO - --DOMWINDOW == 55 (0x126244c00) [pid = 1722] [serial = 1656] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:03:34 INFO - --DOMWINDOW == 54 (0x121809c00) [pid = 1722] [serial = 1640] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:34 INFO - --DOMWINDOW == 53 (0x1283ed400) [pid = 1722] [serial = 1605] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:34 INFO - --DOMWINDOW == 52 (0x1245bb800) [pid = 1722] [serial = 1602] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:34 INFO - --DOMWINDOW == 51 (0x1214adc00) [pid = 1722] [serial = 1570] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:34 INFO - --DOMWINDOW == 50 (0x1203ea000) [pid = 1722] [serial = 1581] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:34 INFO - --DOMWINDOW == 49 (0x130b6d800) [pid = 1722] [serial = 1618] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:34 INFO - --DOMWINDOW == 48 (0x1247be800) [pid = 1722] [serial = 1573] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:34 INFO - --DOMWINDOW == 47 (0x1247c3400) [pid = 1722] [serial = 1584] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:34 INFO - --DOMWINDOW == 46 (0x12d407c00) [pid = 1722] [serial = 1591] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:34 INFO - --DOMWINDOW == 45 (0x12826f000) [pid = 1722] [serial = 1615] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:34 INFO - --DOMWINDOW == 44 (0x12e06b400) [pid = 1722] [serial = 1594] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:34 INFO - --DOMWINDOW == 43 (0x121811000) [pid = 1722] [serial = 1643] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:34 INFO - --DOMWINDOW == 42 (0x121115c00) [pid = 1722] [serial = 1637] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-762593-insecure-passwords-about-blank-web-console-warning.html] 04:03:34 INFO - MEMORY STAT | vsize 3405MB | residentFast 481MB | heapAllocated 124MB 04:03:34 INFO - 323 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_764572_output_open_url.js | took 3257ms 04:03:34 INFO - ++DOCSHELL 0x112e95800 == 14 [pid = 1722] [id = 690] 04:03:34 INFO - ++DOMWINDOW == 43 (0x1132e8c00) [pid = 1722] [serial = 1659] [outer = 0x0] 04:03:34 INFO - ++DOMWINDOW == 44 (0x11344c800) [pid = 1722] [serial = 1660] [outer = 0x1132e8c00] 04:03:34 INFO - 324 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_766001_JS_Console_in_Debugger.js 04:03:34 INFO - ++DOCSHELL 0x113511800 == 15 [pid = 1722] [id = 691] 04:03:34 INFO - ++DOMWINDOW == 45 (0x113e0f800) [pid = 1722] [serial = 1661] [outer = 0x0] 04:03:34 INFO - ++DOMWINDOW == 46 (0x114b5a800) [pid = 1722] [serial = 1662] [outer = 0x113e0f800] 04:03:35 INFO - ++DOMWINDOW == 47 (0x11e7ad000) [pid = 1722] [serial = 1663] [outer = 0x113e0f800] 04:03:35 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-errors.js, line 6: TypeError: document.bar is not a function 04:03:35 INFO - ++DOCSHELL 0x112cbc000 == 16 [pid = 1722] [id = 692] 04:03:35 INFO - ++DOMWINDOW == 48 (0x114bfb400) [pid = 1722] [serial = 1664] [outer = 0x0] 04:03:35 INFO - ++DOMWINDOW == 49 (0x11f5c0c00) [pid = 1722] [serial = 1665] [outer = 0x114bfb400] 04:03:35 INFO - ++DOMWINDOW == 50 (0x1203e7000) [pid = 1722] [serial = 1666] [outer = 0x114bfb400] 04:03:35 INFO - ++DOCSHELL 0x120175000 == 17 [pid = 1722] [id = 693] 04:03:35 INFO - ++DOMWINDOW == 51 (0x1214ad800) [pid = 1722] [serial = 1667] [outer = 0x0] 04:03:35 INFO - ++DOMWINDOW == 52 (0x1215a0800) [pid = 1722] [serial = 1668] [outer = 0x1214ad800] 04:03:36 INFO - ++DOCSHELL 0x11518f800 == 18 [pid = 1722] [id = 694] 04:03:36 INFO - ++DOMWINDOW == 53 (0x1214b5800) [pid = 1722] [serial = 1669] [outer = 0x0] 04:03:36 INFO - ++DOMWINDOW == 54 (0x1247be800) [pid = 1722] [serial = 1670] [outer = 0x1214b5800] 04:03:36 INFO - ++DOCSHELL 0x12218b000 == 19 [pid = 1722] [id = 695] 04:03:36 INFO - ++DOMWINDOW == 55 (0x1266f5400) [pid = 1722] [serial = 1671] [outer = 0x0] 04:03:36 INFO - ++DOMWINDOW == 56 (0x12706fc00) [pid = 1722] [serial = 1672] [outer = 0x1266f5400] 04:03:38 INFO - --DOCSHELL 0x120175000 == 18 [pid = 1722] [id = 693] 04:03:38 INFO - --DOCSHELL 0x11518f800 == 17 [pid = 1722] [id = 694] 04:03:38 INFO - --DOCSHELL 0x12218b000 == 16 [pid = 1722] [id = 695] 04:03:38 INFO - --DOMWINDOW == 55 (0x12211a400) [pid = 1722] [serial = 1572] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:38 INFO - --DOMWINDOW == 54 (0x124884800) [pid = 1722] [serial = 1574] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 53 (0x128305800) [pid = 1722] [serial = 1583] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:38 INFO - --DOMWINDOW == 52 (0x128308c00) [pid = 1722] [serial = 1585] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 51 (0x12a06f400) [pid = 1722] [serial = 1593] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:38 INFO - --DOMWINDOW == 50 (0x12ee0d000) [pid = 1722] [serial = 1595] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 49 (0x128387c00) [pid = 1722] [serial = 1604] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:38 INFO - --DOMWINDOW == 48 (0x12f4e1400) [pid = 1722] [serial = 1606] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 47 (0x1276ccc00) [pid = 1722] [serial = 1617] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:38 INFO - --DOMWINDOW == 46 (0x130b6f800) [pid = 1722] [serial = 1619] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 45 (0x1221bbc00) [pid = 1722] [serial = 1642] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:38 INFO - --DOMWINDOW == 44 (0x1245bd000) [pid = 1722] [serial = 1644] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 43 (0x120ffe400) [pid = 1722] [serial = 1649] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:03:38 INFO - --DOMWINDOW == 42 (0x126241400) [pid = 1722] [serial = 1658] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:03:38 INFO - --DOMWINDOW == 41 (0x112c98400) [pid = 1722] [serial = 1645] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 40 (0x11318ac00) [pid = 1722] [serial = 1647] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:03:38 INFO - --DOMWINDOW == 39 (0x112f41000) [pid = 1722] [serial = 1646] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 38 (0x114b5a800) [pid = 1722] [serial = 1662] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 37 (0x11f5c0c00) [pid = 1722] [serial = 1665] [outer = 0x0] [url = about:blank] 04:03:38 INFO - --DOMWINDOW == 36 (0x126143800) [pid = 1722] [serial = 1655] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:03:38 INFO - MEMORY STAT | vsize 3409MB | residentFast 484MB | heapAllocated 124MB 04:03:38 INFO - 325 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_766001_JS_Console_in_Debugger.js | took 3760ms 04:03:38 INFO - ++DOCSHELL 0x112cb7800 == 17 [pid = 1722] [id = 696] 04:03:38 INFO - ++DOMWINDOW == 37 (0x1129be400) [pid = 1722] [serial = 1673] [outer = 0x0] 04:03:38 INFO - ++DOMWINDOW == 38 (0x112c9e800) [pid = 1722] [serial = 1674] [outer = 0x1129be400] 04:03:38 INFO - 326 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_770099_violation.js 04:03:38 INFO - ++DOCSHELL 0x112e93800 == 18 [pid = 1722] [id = 697] 04:03:38 INFO - ++DOMWINDOW == 39 (0x112f4f800) [pid = 1722] [serial = 1675] [outer = 0x0] 04:03:38 INFO - ++DOMWINDOW == 40 (0x11318cc00) [pid = 1722] [serial = 1676] [outer = 0x112f4f800] 04:03:38 INFO - ++DOCSHELL 0x112e22800 == 19 [pid = 1722] [id = 698] 04:03:38 INFO - ++DOMWINDOW == 41 (0x11326ac00) [pid = 1722] [serial = 1677] [outer = 0x0] 04:03:38 INFO - ++DOMWINDOW == 42 (0x113d0ac00) [pid = 1722] [serial = 1678] [outer = 0x11326ac00] 04:03:39 INFO - ++DOMWINDOW == 43 (0x11e78a000) [pid = 1722] [serial = 1679] [outer = 0x11326ac00] 04:03:39 INFO - ++DOCSHELL 0x114d95800 == 20 [pid = 1722] [id = 699] 04:03:39 INFO - ++DOMWINDOW == 44 (0x120e2b400) [pid = 1722] [serial = 1680] [outer = 0x0] 04:03:39 INFO - ++DOMWINDOW == 45 (0x120e32800) [pid = 1722] [serial = 1681] [outer = 0x120e2b400] 04:03:40 INFO - ++DOMWINDOW == 46 (0x128274000) [pid = 1722] [serial = 1682] [outer = 0x112f4f800] 04:03:40 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:03:41 INFO - --DOCSHELL 0x112cc6800 == 19 [pid = 1722] [id = 685] 04:03:41 INFO - --DOCSHELL 0x113208800 == 18 [pid = 1722] [id = 686] 04:03:41 INFO - --DOCSHELL 0x112e95800 == 17 [pid = 1722] [id = 690] 04:03:41 INFO - --DOCSHELL 0x113461000 == 16 [pid = 1722] [id = 680] 04:03:41 INFO - --DOCSHELL 0x112cbc000 == 15 [pid = 1722] [id = 692] 04:03:41 INFO - --DOCSHELL 0x114d95800 == 14 [pid = 1722] [id = 699] 04:03:41 INFO - --DOCSHELL 0x121888800 == 13 [pid = 1722] [id = 689] 04:03:41 INFO - --DOCSHELL 0x113314800 == 12 [pid = 1722] [id = 687] 04:03:41 INFO - --DOCSHELL 0x113511800 == 11 [pid = 1722] [id = 691] 04:03:41 INFO - --DOMWINDOW == 45 (0x11344c800) [pid = 1722] [serial = 1660] [outer = 0x0] [url = about:blank] 04:03:41 INFO - --DOMWINDOW == 44 (0x113d0ac00) [pid = 1722] [serial = 1678] [outer = 0x0] [url = about:blank] 04:03:41 INFO - --DOMWINDOW == 43 (0x120ff8400) [pid = 1722] [serial = 1653] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:41 INFO - --DOMWINDOW == 42 (0x113d0b800) [pid = 1722] [serial = 1650] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:41 INFO - --DOMWINDOW == 41 (0x1214ad800) [pid = 1722] [serial = 1667] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:41 INFO - --DOMWINDOW == 40 (0x114bfb400) [pid = 1722] [serial = 1664] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:41 INFO - --DOMWINDOW == 39 (0x113e0f800) [pid = 1722] [serial = 1661] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-console-links.html] 04:03:41 INFO - --DOMWINDOW == 38 (0x1132e8c00) [pid = 1722] [serial = 1659] [outer = 0x0] [url = about:blank] 04:03:41 INFO - --DOMWINDOW == 37 (0x1214b5800) [pid = 1722] [serial = 1669] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 04:03:41 INFO - --DOMWINDOW == 36 (0x1266f5400) [pid = 1722] [serial = 1671] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:03:41 INFO - --DOMWINDOW == 35 (0x11e7ad000) [pid = 1722] [serial = 1663] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-console-links.html] 04:03:41 INFO - MEMORY STAT | vsize 3404MB | residentFast 480MB | heapAllocated 124MB 04:03:41 INFO - 327 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_770099_violation.js | took 2672ms 04:03:41 INFO - ++DOCSHELL 0x113306800 == 12 [pid = 1722] [id = 700] 04:03:41 INFO - ++DOMWINDOW == 36 (0x113446400) [pid = 1722] [serial = 1683] [outer = 0x0] 04:03:41 INFO - ++DOMWINDOW == 37 (0x11344e400) [pid = 1722] [serial = 1684] [outer = 0x113446400] 04:03:41 INFO - 328 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_782653_CSS_links_in_Style_Editor.js 04:03:41 INFO - ++DOCSHELL 0x1135af000 == 13 [pid = 1722] [id = 701] 04:03:41 INFO - ++DOMWINDOW == 38 (0x113e0f800) [pid = 1722] [serial = 1685] [outer = 0x0] 04:03:41 INFO - ++DOMWINDOW == 39 (0x114bf1800) [pid = 1722] [serial = 1686] [outer = 0x113e0f800] 04:03:41 INFO - ++DOMWINDOW == 40 (0x11e7a9000) [pid = 1722] [serial = 1687] [outer = 0x113e0f800] 04:03:41 INFO - ++DOCSHELL 0x112ba4000 == 14 [pid = 1722] [id = 702] 04:03:41 INFO - ++DOMWINDOW == 41 (0x11ef16000) [pid = 1722] [serial = 1688] [outer = 0x0] 04:03:41 INFO - ++DOMWINDOW == 42 (0x120258c00) [pid = 1722] [serial = 1689] [outer = 0x11ef16000] 04:03:42 INFO - ++DOMWINDOW == 43 (0x1203e6c00) [pid = 1722] [serial = 1690] [outer = 0x11ef16000] 04:03:42 INFO - ++DOCSHELL 0x120d2e800 == 15 [pid = 1722] [id = 703] 04:03:42 INFO - ++DOMWINDOW == 44 (0x12152bc00) [pid = 1722] [serial = 1691] [outer = 0x0] 04:03:42 INFO - ++DOMWINDOW == 45 (0x121809800) [pid = 1722] [serial = 1692] [outer = 0x12152bc00] 04:03:42 INFO - ++DOCSHELL 0x120eb8800 == 16 [pid = 1722] [id = 704] 04:03:42 INFO - ++DOMWINDOW == 46 (0x124492000) [pid = 1722] [serial = 1693] [outer = 0x0] 04:03:42 INFO - ++DOMWINDOW == 47 (0x1245b4400) [pid = 1722] [serial = 1694] [outer = 0x124492000] 04:03:43 INFO - ++DOCSHELL 0x121860800 == 17 [pid = 1722] [id = 705] 04:03:43 INFO - ++DOMWINDOW == 48 (0x1247c4800) [pid = 1722] [serial = 1695] [outer = 0x0] 04:03:43 INFO - ++DOMWINDOW == 49 (0x1247c8400) [pid = 1722] [serial = 1696] [outer = 0x1247c4800] 04:03:43 INFO - ++DOCSHELL 0x129381800 == 18 [pid = 1722] [id = 706] 04:03:43 INFO - ++DOMWINDOW == 50 (0x12c36bc00) [pid = 1722] [serial = 1697] [outer = 0x0] 04:03:43 INFO - ++DOMWINDOW == 51 (0x1247c8800) [pid = 1722] [serial = 1698] [outer = 0x12c36bc00] 04:03:45 INFO - --DOCSHELL 0x112e93800 == 17 [pid = 1722] [id = 697] 04:03:45 INFO - --DOCSHELL 0x112cb7800 == 16 [pid = 1722] [id = 696] 04:03:45 INFO - --DOCSHELL 0x112e22800 == 15 [pid = 1722] [id = 698] 04:03:45 INFO - --DOCSHELL 0x120d2e800 == 14 [pid = 1722] [id = 703] 04:03:45 INFO - --DOCSHELL 0x120eb8800 == 13 [pid = 1722] [id = 704] 04:03:45 INFO - --DOCSHELL 0x121860800 == 12 [pid = 1722] [id = 705] 04:03:45 INFO - --DOMWINDOW == 50 (0x121112800) [pid = 1722] [serial = 1654] [outer = 0x0] [url = about:blank] 04:03:45 INFO - --DOMWINDOW == 49 (0x11ebb5400) [pid = 1722] [serial = 1652] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:45 INFO - --DOMWINDOW == 48 (0x1215a0800) [pid = 1722] [serial = 1668] [outer = 0x0] [url = about:blank] 04:03:45 INFO - --DOMWINDOW == 47 (0x1203e7000) [pid = 1722] [serial = 1666] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:45 INFO - --DOMWINDOW == 46 (0x1247be800) [pid = 1722] [serial = 1670] [outer = 0x0] [url = about:blank] 04:03:45 INFO - --DOMWINDOW == 45 (0x12706fc00) [pid = 1722] [serial = 1672] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:03:45 INFO - --DOCSHELL 0x129381800 == 11 [pid = 1722] [id = 706] 04:03:45 INFO - --DOMWINDOW == 44 (0x120258c00) [pid = 1722] [serial = 1689] [outer = 0x0] [url = about:blank] 04:03:45 INFO - --DOMWINDOW == 43 (0x120e2b400) [pid = 1722] [serial = 1680] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:45 INFO - --DOMWINDOW == 42 (0x11326ac00) [pid = 1722] [serial = 1677] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:45 INFO - --DOMWINDOW == 41 (0x1129be400) [pid = 1722] [serial = 1673] [outer = 0x0] [url = about:blank] 04:03:45 INFO - --DOMWINDOW == 40 (0x112f4f800) [pid = 1722] [serial = 1675] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug_770099_violation.html] 04:03:45 INFO - --DOMWINDOW == 39 (0x112c9e800) [pid = 1722] [serial = 1674] [outer = 0x0] [url = about:blank] 04:03:45 INFO - --DOMWINDOW == 38 (0x11318cc00) [pid = 1722] [serial = 1676] [outer = 0x0] [url = about:blank] 04:03:45 INFO - --DOMWINDOW == 37 (0x114bf1800) [pid = 1722] [serial = 1686] [outer = 0x0] [url = about:blank] 04:03:45 INFO - --DOMWINDOW == 36 (0x128274000) [pid = 1722] [serial = 1682] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug_770099_violation.html] 04:03:45 INFO - MEMORY STAT | vsize 3493MB | residentFast 530MB | heapAllocated 163MB 04:03:45 INFO - 329 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_782653_CSS_links_in_Style_Editor.js | took 3848ms 04:03:45 INFO - ++DOCSHELL 0x112cc5800 == 12 [pid = 1722] [id = 707] 04:03:45 INFO - ++DOMWINDOW == 37 (0x112bc1000) [pid = 1722] [serial = 1699] [outer = 0x0] 04:03:45 INFO - ++DOMWINDOW == 38 (0x112f42800) [pid = 1722] [serial = 1700] [outer = 0x112bc1000] 04:03:45 INFO - 330 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_804845_ctrl_key_nav.js 04:03:45 INFO - ++DOCSHELL 0x11328c800 == 13 [pid = 1722] [id = 708] 04:03:45 INFO - ++DOMWINDOW == 39 (0x113266000) [pid = 1722] [serial = 1701] [outer = 0x0] 04:03:45 INFO - ++DOMWINDOW == 40 (0x1133a3c00) [pid = 1722] [serial = 1702] [outer = 0x113266000] 04:03:45 INFO - ++DOCSHELL 0x112cc0800 == 14 [pid = 1722] [id = 709] 04:03:45 INFO - ++DOMWINDOW == 41 (0x113445c00) [pid = 1722] [serial = 1703] [outer = 0x0] 04:03:45 INFO - ++DOMWINDOW == 42 (0x113e08c00) [pid = 1722] [serial = 1704] [outer = 0x113445c00] 04:03:45 INFO - ++DOMWINDOW == 43 (0x11ebb6c00) [pid = 1722] [serial = 1705] [outer = 0x113445c00] 04:03:45 INFO - ++DOCSHELL 0x11e35b000 == 15 [pid = 1722] [id = 710] 04:03:45 INFO - ++DOMWINDOW == 44 (0x120fe4400) [pid = 1722] [serial = 1706] [outer = 0x0] 04:03:45 INFO - ++DOMWINDOW == 45 (0x120ff0000) [pid = 1722] [serial = 1707] [outer = 0x120fe4400] 04:03:47 INFO - --DOCSHELL 0x1135af000 == 14 [pid = 1722] [id = 701] 04:03:47 INFO - --DOCSHELL 0x112ba4000 == 13 [pid = 1722] [id = 702] 04:03:47 INFO - --DOCSHELL 0x113306800 == 12 [pid = 1722] [id = 700] 04:03:47 INFO - --DOCSHELL 0x11e35b000 == 11 [pid = 1722] [id = 710] 04:03:47 INFO - --DOMWINDOW == 44 (0x120e32800) [pid = 1722] [serial = 1681] [outer = 0x0] [url = about:blank] 04:03:47 INFO - --DOMWINDOW == 43 (0x11e78a000) [pid = 1722] [serial = 1679] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:47 INFO - --DOMWINDOW == 42 (0x113446400) [pid = 1722] [serial = 1683] [outer = 0x0] [url = about:blank] 04:03:47 INFO - --DOMWINDOW == 41 (0x11344e400) [pid = 1722] [serial = 1684] [outer = 0x0] [url = about:blank] 04:03:47 INFO - --DOMWINDOW == 40 (0x113e08c00) [pid = 1722] [serial = 1704] [outer = 0x0] [url = about:blank] 04:03:47 INFO - --DOMWINDOW == 39 (0x124492000) [pid = 1722] [serial = 1693] [outer = 0x0] [url = chrome://devtools/content/styleeditor/styleeditor.xul] 04:03:47 INFO - --DOMWINDOW == 38 (0x11ef16000) [pid = 1722] [serial = 1688] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:47 INFO - --DOMWINDOW == 37 (0x12152bc00) [pid = 1722] [serial = 1691] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:47 INFO - --DOMWINDOW == 36 (0x113e0f800) [pid = 1722] [serial = 1685] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-782653-css-errors.html] 04:03:47 INFO - --DOMWINDOW == 35 (0x12c36bc00) [pid = 1722] [serial = 1697] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:03:47 INFO - --DOMWINDOW == 34 (0x1247c4800) [pid = 1722] [serial = 1695] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:03:47 INFO - --DOMWINDOW == 33 (0x11e7a9000) [pid = 1722] [serial = 1687] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-782653-css-errors.html] 04:03:48 INFO - MEMORY STAT | vsize 3449MB | residentFast 530MB | heapAllocated 118MB 04:03:48 INFO - 331 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_804845_ctrl_key_nav.js | took 2526ms 04:03:48 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 711] 04:03:48 INFO - ++DOMWINDOW == 34 (0x1129b9800) [pid = 1722] [serial = 1708] [outer = 0x0] 04:03:48 INFO - ++DOMWINDOW == 35 (0x112c98400) [pid = 1722] [serial = 1709] [outer = 0x1129b9800] 04:03:48 INFO - 332 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_817834_add_edited_input_to_history.js 04:03:48 INFO - ++DOCSHELL 0x11345b800 == 13 [pid = 1722] [id = 712] 04:03:48 INFO - ++DOMWINDOW == 36 (0x11318cc00) [pid = 1722] [serial = 1710] [outer = 0x0] 04:03:48 INFO - ++DOMWINDOW == 37 (0x113399400) [pid = 1722] [serial = 1711] [outer = 0x11318cc00] 04:03:48 INFO - ++DOCSHELL 0x112ba5000 == 14 [pid = 1722] [id = 713] 04:03:48 INFO - ++DOMWINDOW == 38 (0x113e11c00) [pid = 1722] [serial = 1712] [outer = 0x0] 04:03:48 INFO - ++DOMWINDOW == 39 (0x114b23800) [pid = 1722] [serial = 1713] [outer = 0x113e11c00] 04:03:48 INFO - ++DOMWINDOW == 40 (0x11ee55800) [pid = 1722] [serial = 1714] [outer = 0x113e11c00] 04:03:48 INFO - ++DOCSHELL 0x11eb94800 == 15 [pid = 1722] [id = 714] 04:03:48 INFO - ++DOMWINDOW == 41 (0x120fee800) [pid = 1722] [serial = 1715] [outer = 0x0] 04:03:48 INFO - ++DOMWINDOW == 42 (0x120ffb400) [pid = 1722] [serial = 1716] [outer = 0x120fee800] 04:03:50 INFO - --DOCSHELL 0x112cc5800 == 14 [pid = 1722] [id = 707] 04:03:50 INFO - --DOCSHELL 0x112cc0800 == 13 [pid = 1722] [id = 709] 04:03:50 INFO - --DOCSHELL 0x11328c800 == 12 [pid = 1722] [id = 708] 04:03:50 INFO - --DOCSHELL 0x11eb94800 == 11 [pid = 1722] [id = 714] 04:03:50 INFO - --DOMWINDOW == 41 (0x1245b4400) [pid = 1722] [serial = 1694] [outer = 0x0] [url = about:blank] 04:03:50 INFO - --DOMWINDOW == 40 (0x1203e6c00) [pid = 1722] [serial = 1690] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:50 INFO - --DOMWINDOW == 39 (0x121809800) [pid = 1722] [serial = 1692] [outer = 0x0] [url = about:blank] 04:03:50 INFO - --DOMWINDOW == 38 (0x1247c8800) [pid = 1722] [serial = 1698] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:03:50 INFO - --DOMWINDOW == 37 (0x1247c8400) [pid = 1722] [serial = 1696] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:03:50 INFO - --DOMWINDOW == 36 (0x1133a3c00) [pid = 1722] [serial = 1702] [outer = 0x0] [url = about:blank] 04:03:50 INFO - --DOMWINDOW == 35 (0x112f42800) [pid = 1722] [serial = 1700] [outer = 0x0] [url = about:blank] 04:03:50 INFO - --DOMWINDOW == 34 (0x114b23800) [pid = 1722] [serial = 1713] [outer = 0x0] [url = about:blank] 04:03:50 INFO - --DOMWINDOW == 33 (0x120fe4400) [pid = 1722] [serial = 1706] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:50 INFO - --DOMWINDOW == 32 (0x113266000) [pid = 1722] [serial = 1701] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20804845%20and%20bug%20619598] 04:03:50 INFO - --DOMWINDOW == 31 (0x112bc1000) [pid = 1722] [serial = 1699] [outer = 0x0] [url = about:blank] 04:03:50 INFO - --DOMWINDOW == 30 (0x113445c00) [pid = 1722] [serial = 1703] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:50 INFO - MEMORY STAT | vsize 3449MB | residentFast 530MB | heapAllocated 116MB 04:03:50 INFO - 333 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_817834_add_edited_input_to_history.js | took 2127ms 04:03:50 INFO - ++DOCSHELL 0x112cc1000 == 12 [pid = 1722] [id = 715] 04:03:50 INFO - ++DOMWINDOW == 31 (0x112bbb400) [pid = 1722] [serial = 1717] [outer = 0x0] 04:03:50 INFO - ++DOMWINDOW == 32 (0x112f41000) [pid = 1722] [serial = 1718] [outer = 0x112bbb400] 04:03:50 INFO - 334 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_837351_securityerrors.js 04:03:50 INFO - ++DOCSHELL 0x113465000 == 13 [pid = 1722] [id = 716] 04:03:50 INFO - ++DOMWINDOW == 33 (0x1132db000) [pid = 1722] [serial = 1719] [outer = 0x0] 04:03:50 INFO - ++DOMWINDOW == 34 (0x113447800) [pid = 1722] [serial = 1720] [outer = 0x1132db000] 04:03:50 INFO - ++DOMWINDOW == 35 (0x113e0c000) [pid = 1722] [serial = 1721] [outer = 0x1132db000] 04:03:50 INFO - ++DOCSHELL 0x113e47000 == 14 [pid = 1722] [id = 717] 04:03:50 INFO - ++DOMWINDOW == 36 (0x11e714000) [pid = 1722] [serial = 1722] [outer = 0x0] 04:03:50 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805E0006: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 445 04:03:50 INFO - ++DOMWINDOW == 37 (0x11e7a4800) [pid = 1722] [serial = 1723] [outer = 0x11e714000] 04:03:50 INFO - ++DOCSHELL 0x112cca800 == 15 [pid = 1722] [id = 718] 04:03:50 INFO - ++DOMWINDOW == 38 (0x11344e400) [pid = 1722] [serial = 1724] [outer = 0x0] 04:03:50 INFO - ++DOMWINDOW == 39 (0x11ec99000) [pid = 1722] [serial = 1725] [outer = 0x11344e400] 04:03:50 INFO - ++DOMWINDOW == 40 (0x11f715c00) [pid = 1722] [serial = 1726] [outer = 0x11344e400] 04:03:51 INFO - ++DOCSHELL 0x11efd5000 == 16 [pid = 1722] [id = 719] 04:03:51 INFO - ++DOMWINDOW == 41 (0x121115800) [pid = 1722] [serial = 1727] [outer = 0x0] 04:03:51 INFO - ++DOMWINDOW == 42 (0x121161400) [pid = 1722] [serial = 1728] [outer = 0x121115800] 04:03:52 INFO - --DOCSHELL 0x11345b800 == 15 [pid = 1722] [id = 712] 04:03:52 INFO - --DOCSHELL 0x112cc4000 == 14 [pid = 1722] [id = 711] 04:03:52 INFO - --DOCSHELL 0x11efd5000 == 13 [pid = 1722] [id = 719] 04:03:52 INFO - --DOCSHELL 0x112ba5000 == 12 [pid = 1722] [id = 713] 04:03:52 INFO - --DOMWINDOW == 41 (0x120ff0000) [pid = 1722] [serial = 1707] [outer = 0x0] [url = about:blank] 04:03:52 INFO - --DOMWINDOW == 40 (0x11ebb6c00) [pid = 1722] [serial = 1705] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:52 INFO - --DOMWINDOW == 39 (0x113447800) [pid = 1722] [serial = 1720] [outer = 0x0] [url = about:blank] 04:03:52 INFO - --DOMWINDOW == 38 (0x113399400) [pid = 1722] [serial = 1711] [outer = 0x0] [url = about:blank] 04:03:52 INFO - --DOMWINDOW == 37 (0x112c98400) [pid = 1722] [serial = 1709] [outer = 0x0] [url = about:blank] 04:03:52 INFO - --DOMWINDOW == 36 (0x11ec99000) [pid = 1722] [serial = 1725] [outer = 0x0] [url = about:blank] 04:03:52 INFO - --DOMWINDOW == 35 (0x120fee800) [pid = 1722] [serial = 1715] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:52 INFO - --DOMWINDOW == 34 (0x113e11c00) [pid = 1722] [serial = 1712] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:52 INFO - --DOMWINDOW == 33 (0x11318cc00) [pid = 1722] [serial = 1710] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20817834] 04:03:52 INFO - --DOMWINDOW == 32 (0x1129b9800) [pid = 1722] [serial = 1708] [outer = 0x0] [url = about:blank] 04:03:52 INFO - MEMORY STAT | vsize 3448MB | residentFast 530MB | heapAllocated 116MB 04:03:52 INFO - 335 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_837351_securityerrors.js | took 2294ms 04:03:52 INFO - ++DOCSHELL 0x112cc6000 == 13 [pid = 1722] [id = 720] 04:03:52 INFO - ++DOMWINDOW == 33 (0x112bc1800) [pid = 1722] [serial = 1729] [outer = 0x0] 04:03:52 INFO - ++DOMWINDOW == 34 (0x112f4ac00) [pid = 1722] [serial = 1730] [outer = 0x112bc1800] 04:03:52 INFO - 336 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_915141_toggle_response_logging_with_keyboard.js 04:03:52 INFO - ++DOCSHELL 0x11345b000 == 14 [pid = 1722] [id = 721] 04:03:52 INFO - ++DOMWINDOW == 35 (0x113444c00) [pid = 1722] [serial = 1731] [outer = 0x0] 04:03:52 INFO - ++DOMWINDOW == 36 (0x11344ec00) [pid = 1722] [serial = 1732] [outer = 0x113444c00] 04:03:53 INFO - ++DOCSHELL 0x11346d800 == 15 [pid = 1722] [id = 722] 04:03:53 INFO - ++DOMWINDOW == 37 (0x112916400) [pid = 1722] [serial = 1733] [outer = 0x0] 04:03:53 INFO - ++DOMWINDOW == 38 (0x114bfe000) [pid = 1722] [serial = 1734] [outer = 0x112916400] 04:03:53 INFO - ++DOMWINDOW == 39 (0x11ee5c400) [pid = 1722] [serial = 1735] [outer = 0x112916400] 04:03:53 INFO - ++DOCSHELL 0x11ee49000 == 16 [pid = 1722] [id = 723] 04:03:53 INFO - ++DOMWINDOW == 40 (0x12110c800) [pid = 1722] [serial = 1736] [outer = 0x0] 04:03:53 INFO - ++DOMWINDOW == 41 (0x12115b000) [pid = 1722] [serial = 1737] [outer = 0x12110c800] 04:03:55 INFO - --DOCSHELL 0x113e47000 == 15 [pid = 1722] [id = 717] 04:03:55 INFO - --DOCSHELL 0x112cc1000 == 14 [pid = 1722] [id = 715] 04:03:55 INFO - --DOCSHELL 0x113465000 == 13 [pid = 1722] [id = 716] 04:03:55 INFO - --DOCSHELL 0x11ee49000 == 12 [pid = 1722] [id = 723] 04:03:55 INFO - --DOCSHELL 0x112cca800 == 11 [pid = 1722] [id = 718] 04:03:55 INFO - --DOMWINDOW == 40 (0x120ffb400) [pid = 1722] [serial = 1716] [outer = 0x0] [url = about:blank] 04:03:55 INFO - --DOMWINDOW == 39 (0x11ee55800) [pid = 1722] [serial = 1714] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:55 INFO - --DOMWINDOW == 38 (0x114bfe000) [pid = 1722] [serial = 1734] [outer = 0x0] [url = about:blank] 04:03:55 INFO - --DOMWINDOW == 37 (0x11e7a4800) [pid = 1722] [serial = 1723] [outer = 0x0] [url = about:blank] 04:03:55 INFO - --DOMWINDOW == 36 (0x112f41000) [pid = 1722] [serial = 1718] [outer = 0x0] [url = about:blank] 04:03:55 INFO - --DOMWINDOW == 35 (0x121115800) [pid = 1722] [serial = 1727] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:55 INFO - --DOMWINDOW == 34 (0x11344e400) [pid = 1722] [serial = 1724] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:55 INFO - --DOMWINDOW == 33 (0x11e714000) [pid = 1722] [serial = 1722] [outer = 0x0] [url = about:blank] 04:03:55 INFO - --DOMWINDOW == 32 (0x1132db000) [pid = 1722] [serial = 1719] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-837351-security-errors.html] 04:03:55 INFO - --DOMWINDOW == 31 (0x112bbb400) [pid = 1722] [serial = 1717] [outer = 0x0] [url = about:blank] 04:03:55 INFO - --DOMWINDOW == 30 (0x113e0c000) [pid = 1722] [serial = 1721] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-837351-security-errors.html] 04:03:55 INFO - MEMORY STAT | vsize 3451MB | residentFast 530MB | heapAllocated 115MB 04:03:55 INFO - 337 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_915141_toggle_response_logging_with_keyboard.js | took 2507ms 04:03:55 INFO - ++DOCSHELL 0x112cc2000 == 12 [pid = 1722] [id = 724] 04:03:55 INFO - ++DOMWINDOW == 31 (0x1129c0c00) [pid = 1722] [serial = 1738] [outer = 0x0] 04:03:55 INFO - ++DOMWINDOW == 32 (0x112f46000) [pid = 1722] [serial = 1739] [outer = 0x1129c0c00] 04:03:55 INFO - 338 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_922212_console_dirxml.js 04:03:55 INFO - ++DOCSHELL 0x113458000 == 13 [pid = 1722] [id = 725] 04:03:55 INFO - ++DOMWINDOW == 33 (0x113445c00) [pid = 1722] [serial = 1740] [outer = 0x0] 04:03:55 INFO - ++DOMWINDOW == 34 (0x11344e400) [pid = 1722] [serial = 1741] [outer = 0x113445c00] 04:03:55 INFO - ++DOCSHELL 0x1128d3800 == 14 [pid = 1722] [id = 726] 04:03:55 INFO - ++DOMWINDOW == 35 (0x113d09000) [pid = 1722] [serial = 1742] [outer = 0x0] 04:03:55 INFO - ++DOMWINDOW == 36 (0x114b5e800) [pid = 1722] [serial = 1743] [outer = 0x113d09000] 04:03:55 INFO - ++DOMWINDOW == 37 (0x11ebbf400) [pid = 1722] [serial = 1744] [outer = 0x113d09000] 04:03:55 INFO - ++DOCSHELL 0x11eeae800 == 15 [pid = 1722] [id = 727] 04:03:55 INFO - ++DOMWINDOW == 38 (0x120fe6800) [pid = 1722] [serial = 1745] [outer = 0x0] 04:03:55 INFO - ++DOMWINDOW == 39 (0x120ff1000) [pid = 1722] [serial = 1746] [outer = 0x120fe6800] 04:03:57 INFO - --DOCSHELL 0x11345b000 == 14 [pid = 1722] [id = 721] 04:03:57 INFO - --DOCSHELL 0x112cc6000 == 13 [pid = 1722] [id = 720] 04:03:57 INFO - --DOCSHELL 0x11eeae800 == 12 [pid = 1722] [id = 727] 04:03:57 INFO - --DOCSHELL 0x11346d800 == 11 [pid = 1722] [id = 722] 04:03:57 INFO - --DOMWINDOW == 38 (0x121161400) [pid = 1722] [serial = 1728] [outer = 0x0] [url = about:blank] 04:03:57 INFO - --DOMWINDOW == 37 (0x11f715c00) [pid = 1722] [serial = 1726] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:57 INFO - --DOMWINDOW == 36 (0x112f4ac00) [pid = 1722] [serial = 1730] [outer = 0x0] [url = about:blank] 04:03:57 INFO - --DOMWINDOW == 35 (0x114b5e800) [pid = 1722] [serial = 1743] [outer = 0x0] [url = about:blank] 04:03:57 INFO - --DOMWINDOW == 34 (0x11344ec00) [pid = 1722] [serial = 1732] [outer = 0x0] [url = about:blank] 04:03:57 INFO - --DOMWINDOW == 33 (0x112916400) [pid = 1722] [serial = 1733] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:03:57 INFO - --DOMWINDOW == 32 (0x12110c800) [pid = 1722] [serial = 1736] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:03:57 INFO - --DOMWINDOW == 31 (0x112bc1800) [pid = 1722] [serial = 1729] [outer = 0x0] [url = about:blank] 04:03:57 INFO - --DOMWINDOW == 30 (0x113444c00) [pid = 1722] [serial = 1731] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20915141:%20Toggle%20log%20response%20bodies%20with%20keyboard] 04:03:57 INFO - MEMORY STAT | vsize 3451MB | residentFast 530MB | heapAllocated 116MB 04:03:57 INFO - 339 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_922212_console_dirxml.js | took 2397ms 04:03:57 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 728] 04:03:57 INFO - ++DOMWINDOW == 31 (0x112c9e800) [pid = 1722] [serial = 1747] [outer = 0x0] 04:03:57 INFO - ++DOMWINDOW == 32 (0x112f4b000) [pid = 1722] [serial = 1748] [outer = 0x112c9e800] 04:03:58 INFO - 340 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_cached_autocomplete.js 04:03:58 INFO - ++DOCSHELL 0x11346d800 == 13 [pid = 1722] [id = 729] 04:03:58 INFO - ++DOMWINDOW == 33 (0x113446400) [pid = 1722] [serial = 1749] [outer = 0x0] 04:03:58 INFO - ++DOMWINDOW == 34 (0x113450000) [pid = 1722] [serial = 1750] [outer = 0x113446400] 04:03:58 INFO - ++DOCSHELL 0x112cca800 == 14 [pid = 1722] [id = 730] 04:03:58 INFO - ++DOMWINDOW == 35 (0x113d0b800) [pid = 1722] [serial = 1751] [outer = 0x0] 04:03:58 INFO - ++DOMWINDOW == 36 (0x114dbcc00) [pid = 1722] [serial = 1752] [outer = 0x113d0b800] 04:03:58 INFO - ++DOMWINDOW == 37 (0x11f5cc800) [pid = 1722] [serial = 1753] [outer = 0x113d0b800] 04:03:58 INFO - ++DOCSHELL 0x11efc1000 == 15 [pid = 1722] [id = 731] 04:03:58 INFO - ++DOMWINDOW == 38 (0x120ffc000) [pid = 1722] [serial = 1754] [outer = 0x0] 04:03:58 INFO - ++DOMWINDOW == 39 (0x121109400) [pid = 1722] [serial = 1755] [outer = 0x120ffc000] 04:04:04 INFO - --DOCSHELL 0x113458000 == 14 [pid = 1722] [id = 725] 04:04:04 INFO - --DOCSHELL 0x112cc2000 == 13 [pid = 1722] [id = 724] 04:04:04 INFO - --DOCSHELL 0x112cca800 == 12 [pid = 1722] [id = 730] 04:04:04 INFO - --DOCSHELL 0x1128d3800 == 11 [pid = 1722] [id = 726] 04:04:04 INFO - --DOCSHELL 0x11efc1000 == 10 [pid = 1722] [id = 731] 04:04:04 INFO - --DOMWINDOW == 38 (0x11ee5c400) [pid = 1722] [serial = 1735] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:04 INFO - --DOMWINDOW == 37 (0x12115b000) [pid = 1722] [serial = 1737] [outer = 0x0] [url = about:blank] 04:04:04 INFO - --DOMWINDOW == 36 (0x11344e400) [pid = 1722] [serial = 1741] [outer = 0x0] [url = about:blank] 04:04:04 INFO - --DOMWINDOW == 35 (0x112f46000) [pid = 1722] [serial = 1739] [outer = 0x0] [url = about:blank] 04:04:04 INFO - --DOMWINDOW == 34 (0x120fe6800) [pid = 1722] [serial = 1745] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:04 INFO - --DOMWINDOW == 33 (0x113d09000) [pid = 1722] [serial = 1742] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:04 INFO - --DOMWINDOW == 32 (0x113445c00) [pid = 1722] [serial = 1740] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20922212:%20%20Add%20console.dirxml] 04:04:04 INFO - --DOMWINDOW == 31 (0x1129c0c00) [pid = 1722] [serial = 1738] [outer = 0x0] [url = about:blank] 04:04:04 INFO - --DOMWINDOW == 30 (0x114dbcc00) [pid = 1722] [serial = 1752] [outer = 0x0] [url = about:blank] 04:04:04 INFO - MEMORY STAT | vsize 3445MB | residentFast 526MB | heapAllocated 119MB 04:04:04 INFO - 341 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_cached_autocomplete.js | took 6584ms 04:04:04 INFO - ++DOCSHELL 0x112cc5000 == 11 [pid = 1722] [id = 732] 04:04:04 INFO - ++DOMWINDOW == 31 (0x112bc1c00) [pid = 1722] [serial = 1756] [outer = 0x0] 04:04:04 INFO - ++DOMWINDOW == 32 (0x11315e800) [pid = 1722] [serial = 1757] [outer = 0x112bc1c00] 04:04:04 INFO - 342 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_cd_iframe.js 04:04:04 INFO - ++DOCSHELL 0x11345c800 == 12 [pid = 1722] [id = 733] 04:04:04 INFO - ++DOMWINDOW == 33 (0x11344e800) [pid = 1722] [serial = 1758] [outer = 0x0] 04:04:04 INFO - ++DOMWINDOW == 34 (0x113d1d000) [pid = 1722] [serial = 1759] [outer = 0x11344e800] 04:04:04 INFO - ++DOMWINDOW == 35 (0x11513f800) [pid = 1722] [serial = 1760] [outer = 0x11344e800] 04:04:04 INFO - ++DOCSHELL 0x113454800 == 13 [pid = 1722] [id = 734] 04:04:04 INFO - ++DOMWINDOW == 36 (0x112bb5000) [pid = 1722] [serial = 1761] [outer = 0x0] 04:04:04 INFO - ++DOMWINDOW == 37 (0x11ec99000) [pid = 1722] [serial = 1762] [outer = 0x112bb5000] 04:04:05 INFO - ++DOCSHELL 0x112cc6800 == 14 [pid = 1722] [id = 735] 04:04:05 INFO - ++DOMWINDOW == 38 (0x120159800) [pid = 1722] [serial = 1763] [outer = 0x0] 04:04:05 INFO - ++DOMWINDOW == 39 (0x120264c00) [pid = 1722] [serial = 1764] [outer = 0x120159800] 04:04:05 INFO - ++DOMWINDOW == 40 (0x120d25000) [pid = 1722] [serial = 1765] [outer = 0x120159800] 04:04:05 INFO - ++DOCSHELL 0x120175800 == 15 [pid = 1722] [id = 736] 04:04:05 INFO - ++DOMWINDOW == 41 (0x121314000) [pid = 1722] [serial = 1766] [outer = 0x0] 04:04:05 INFO - ++DOMWINDOW == 42 (0x1214a9000) [pid = 1722] [serial = 1767] [outer = 0x121314000] 04:04:07 INFO - --DOCSHELL 0x112cc4000 == 14 [pid = 1722] [id = 728] 04:04:07 INFO - --DOCSHELL 0x11346d800 == 13 [pid = 1722] [id = 729] 04:04:07 INFO - --DOCSHELL 0x120175800 == 12 [pid = 1722] [id = 736] 04:04:07 INFO - --DOMWINDOW == 41 (0x120ff1000) [pid = 1722] [serial = 1746] [outer = 0x0] [url = about:blank] 04:04:07 INFO - --DOMWINDOW == 40 (0x11ebbf400) [pid = 1722] [serial = 1744] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:07 INFO - --DOMWINDOW == 39 (0x112f4b000) [pid = 1722] [serial = 1748] [outer = 0x0] [url = about:blank] 04:04:07 INFO - --DOMWINDOW == 38 (0x113450000) [pid = 1722] [serial = 1750] [outer = 0x0] [url = about:blank] 04:04:07 INFO - --DOMWINDOW == 37 (0x113d1d000) [pid = 1722] [serial = 1759] [outer = 0x0] [url = about:blank] 04:04:07 INFO - --DOMWINDOW == 36 (0x120264c00) [pid = 1722] [serial = 1764] [outer = 0x0] [url = about:blank] 04:04:07 INFO - --DOMWINDOW == 35 (0x120ffc000) [pid = 1722] [serial = 1754] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:07 INFO - --DOMWINDOW == 34 (0x113d0b800) [pid = 1722] [serial = 1751] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:07 INFO - --DOMWINDOW == 33 (0x112c9e800) [pid = 1722] [serial = 1747] [outer = 0x0] [url = about:blank] 04:04:07 INFO - --DOMWINDOW == 32 (0x113446400) [pid = 1722] [serial = 1749] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20cached%20autocompletion%20results] 04:04:08 INFO - MEMORY STAT | vsize 3446MB | residentFast 528MB | heapAllocated 116MB 04:04:08 INFO - 343 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_cd_iframe.js | took 3366ms 04:04:08 INFO - ++DOCSHELL 0x112967800 == 13 [pid = 1722] [id = 737] 04:04:08 INFO - ++DOMWINDOW == 33 (0x112c9cc00) [pid = 1722] [serial = 1768] [outer = 0x0] 04:04:08 INFO - ++DOMWINDOW == 34 (0x112f49c00) [pid = 1722] [serial = 1769] [outer = 0x112c9cc00] 04:04:08 INFO - 344 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_certificate_messages.js 04:04:08 INFO - ++DOCSHELL 0x11346d800 == 14 [pid = 1722] [id = 738] 04:04:08 INFO - ++DOMWINDOW == 35 (0x113446c00) [pid = 1722] [serial = 1770] [outer = 0x0] 04:04:08 INFO - ++DOMWINDOW == 36 (0x113d0b800) [pid = 1722] [serial = 1771] [outer = 0x113446c00] 04:04:08 INFO - ++DOCSHELL 0x112cd3800 == 15 [pid = 1722] [id = 739] 04:04:08 INFO - ++DOMWINDOW == 37 (0x112bc1800) [pid = 1722] [serial = 1772] [outer = 0x0] 04:04:08 INFO - ++DOMWINDOW == 38 (0x115144800) [pid = 1722] [serial = 1773] [outer = 0x112bc1800] 04:04:08 INFO - ++DOMWINDOW == 39 (0x11ef14800) [pid = 1722] [serial = 1774] [outer = 0x112bc1800] 04:04:08 INFO - ++DOCSHELL 0x11f63d000 == 16 [pid = 1722] [id = 740] 04:04:08 INFO - ++DOMWINDOW == 40 (0x120ff5800) [pid = 1722] [serial = 1775] [outer = 0x0] 04:04:08 INFO - ++DOMWINDOW == 41 (0x120ffe000) [pid = 1722] [serial = 1776] [outer = 0x120ff5800] 04:04:09 INFO - ++DOMWINDOW == 42 (0x128277000) [pid = 1722] [serial = 1777] [outer = 0x113446c00] 04:04:09 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:04:10 INFO - ++DOMWINDOW == 43 (0x12830f400) [pid = 1722] [serial = 1778] [outer = 0x113446c00] 04:04:10 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:04:10 INFO - ++DOMWINDOW == 44 (0x1132db800) [pid = 1722] [serial = 1779] [outer = 0x113446c00] 04:04:10 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:04:10 INFO - ++DOMWINDOW == 45 (0x1283f5400) [pid = 1722] [serial = 1780] [outer = 0x113446c00] 04:04:10 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:04:11 INFO - --DOCSHELL 0x113454800 == 15 [pid = 1722] [id = 734] 04:04:11 INFO - --DOCSHELL 0x112cc5000 == 14 [pid = 1722] [id = 732] 04:04:11 INFO - --DOCSHELL 0x112cc6800 == 13 [pid = 1722] [id = 735] 04:04:11 INFO - --DOCSHELL 0x112cd3800 == 12 [pid = 1722] [id = 739] 04:04:11 INFO - --DOCSHELL 0x11f63d000 == 11 [pid = 1722] [id = 740] 04:04:11 INFO - --DOCSHELL 0x11345c800 == 10 [pid = 1722] [id = 733] 04:04:11 INFO - --DOMWINDOW == 44 (0x121109400) [pid = 1722] [serial = 1755] [outer = 0x0] [url = about:blank] 04:04:11 INFO - --DOMWINDOW == 43 (0x11f5cc800) [pid = 1722] [serial = 1753] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:12 INFO - --DOMWINDOW == 42 (0x11315e800) [pid = 1722] [serial = 1757] [outer = 0x0] [url = about:blank] 04:04:12 INFO - --DOMWINDOW == 41 (0x115144800) [pid = 1722] [serial = 1773] [outer = 0x0] [url = about:blank] 04:04:12 INFO - --DOMWINDOW == 40 (0x120159800) [pid = 1722] [serial = 1763] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:12 INFO - --DOMWINDOW == 39 (0x113d0b800) [pid = 1722] [serial = 1771] [outer = 0x0] [url = about:blank] 04:04:12 INFO - --DOMWINDOW == 38 (0x112bb5000) [pid = 1722] [serial = 1761] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 04:04:12 INFO - --DOMWINDOW == 37 (0x112bc1c00) [pid = 1722] [serial = 1756] [outer = 0x0] [url = about:blank] 04:04:12 INFO - --DOMWINDOW == 36 (0x121314000) [pid = 1722] [serial = 1766] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:12 INFO - --DOMWINDOW == 35 (0x11344e800) [pid = 1722] [serial = 1758] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-parent.html] 04:04:12 INFO - --DOMWINDOW == 34 (0x11513f800) [pid = 1722] [serial = 1760] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-parent.html] 04:04:12 INFO - --DOMWINDOW == 33 (0x11ec99000) [pid = 1722] [serial = 1762] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 04:04:12 INFO - MEMORY STAT | vsize 3445MB | residentFast 526MB | heapAllocated 117MB 04:04:12 INFO - 345 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_certificate_messages.js | took 4047ms 04:04:12 INFO - ++DOCSHELL 0x113457800 == 11 [pid = 1722] [id = 741] 04:04:12 INFO - ++DOMWINDOW == 34 (0x113399400) [pid = 1722] [serial = 1781] [outer = 0x0] 04:04:12 INFO - ++DOMWINDOW == 35 (0x11344e400) [pid = 1722] [serial = 1782] [outer = 0x113399400] 04:04:12 INFO - 346 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_change_font_size.js 04:04:12 INFO - ++DOCSHELL 0x113e47800 == 12 [pid = 1722] [id = 742] 04:04:12 INFO - ++DOMWINDOW == 36 (0x11513f800) [pid = 1722] [serial = 1783] [outer = 0x0] 04:04:12 INFO - ++DOMWINDOW == 37 (0x11d46f800) [pid = 1722] [serial = 1784] [outer = 0x11513f800] 04:04:12 INFO - ++DOMWINDOW == 38 (0x11ee19800) [pid = 1722] [serial = 1785] [outer = 0x11513f800] 04:04:12 INFO - ++DOCSHELL 0x11f639000 == 13 [pid = 1722] [id = 743] 04:04:12 INFO - ++DOMWINDOW == 39 (0x1203eac00) [pid = 1722] [serial = 1786] [outer = 0x0] 04:04:12 INFO - ++DOMWINDOW == 40 (0x120d18800) [pid = 1722] [serial = 1787] [outer = 0x1203eac00] 04:04:13 INFO - MEMORY STAT | vsize 3455MB | residentFast 529MB | heapAllocated 122MB 04:04:13 INFO - 347 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_change_font_size.js | took 1089ms 04:04:13 INFO - ++DOCSHELL 0x120dcb800 == 14 [pid = 1722] [id = 744] 04:04:13 INFO - ++DOMWINDOW == 41 (0x113266000) [pid = 1722] [serial = 1788] [outer = 0x0] 04:04:13 INFO - ++DOMWINDOW == 42 (0x121115800) [pid = 1722] [serial = 1789] [outer = 0x113266000] 04:04:13 INFO - 348 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_chrome.js 04:04:13 INFO - ++DOCSHELL 0x120ea9000 == 15 [pid = 1722] [id = 745] 04:04:13 INFO - ++DOMWINDOW == 43 (0x12232b800) [pid = 1722] [serial = 1790] [outer = 0x0] 04:04:13 INFO - ++DOMWINDOW == 44 (0x1223e6c00) [pid = 1722] [serial = 1791] [outer = 0x12232b800] 04:04:13 INFO - ++DOMWINDOW == 45 (0x113446400) [pid = 1722] [serial = 1792] [outer = 0x12232b800] 04:04:14 INFO - ++DOCSHELL 0x12821f800 == 16 [pid = 1722] [id = 746] 04:04:14 INFO - ++DOMWINDOW == 46 (0x125740c00) [pid = 1722] [serial = 1793] [outer = 0x0] 04:04:14 INFO - ++DOMWINDOW == 47 (0x125741c00) [pid = 1722] [serial = 1794] [outer = 0x125740c00] 04:04:14 INFO - ++DOMWINDOW == 48 (0x126143800) [pid = 1722] [serial = 1795] [outer = 0x125740c00] 04:04:14 INFO - ++DOCSHELL 0x12936e800 == 17 [pid = 1722] [id = 747] 04:04:14 INFO - ++DOMWINDOW == 49 (0x1276ae800) [pid = 1722] [serial = 1796] [outer = 0x0] 04:04:14 INFO - ++DOMWINDOW == 50 (0x1276c0800) [pid = 1722] [serial = 1797] [outer = 0x1276ae800] 04:04:15 INFO - --DOCSHELL 0x112967800 == 16 [pid = 1722] [id = 737] 04:04:15 INFO - --DOCSHELL 0x11346d800 == 15 [pid = 1722] [id = 738] 04:04:15 INFO - --DOCSHELL 0x12936e800 == 14 [pid = 1722] [id = 747] 04:04:16 INFO - --DOMWINDOW == 49 (0x1214a9000) [pid = 1722] [serial = 1767] [outer = 0x0] [url = about:blank] 04:04:16 INFO - --DOMWINDOW == 48 (0x120d25000) [pid = 1722] [serial = 1765] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:16 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 04:04:16 INFO - --DOMWINDOW == 47 (0x112f49c00) [pid = 1722] [serial = 1769] [outer = 0x0] [url = about:blank] 04:04:16 INFO - --DOMWINDOW == 46 (0x11344e400) [pid = 1722] [serial = 1782] [outer = 0x0] [url = about:blank] 04:04:16 INFO - --DOMWINDOW == 45 (0x11d46f800) [pid = 1722] [serial = 1784] [outer = 0x0] [url = about:blank] 04:04:16 INFO - --DOMWINDOW == 44 (0x11ee19800) [pid = 1722] [serial = 1785] [outer = 0x0] [url = http://example.com/] 04:04:16 INFO - --DOMWINDOW == 43 (0x1223e6c00) [pid = 1722] [serial = 1791] [outer = 0x0] [url = about:blank] 04:04:16 INFO - --DOMWINDOW == 42 (0x125741c00) [pid = 1722] [serial = 1794] [outer = 0x0] [url = about:blank] 04:04:16 INFO - --DOMWINDOW == 41 (0x1214b1000) [pid = 1722] [serial = 1224] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:16 INFO - --DOMWINDOW == 40 (0x112bc1800) [pid = 1722] [serial = 1772] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:16 INFO - --DOMWINDOW == 39 (0x120ff5800) [pid = 1722] [serial = 1775] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:16 INFO - --DOMWINDOW == 38 (0x11ebba400) [pid = 1722] [serial = 1221] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:16 INFO - --DOMWINDOW == 37 (0x112c9cc00) [pid = 1722] [serial = 1768] [outer = 0x0] [url = about:blank] 04:04:16 INFO - --DOMWINDOW == 36 (0x113446c00) [pid = 1722] [serial = 1770] [outer = 0x0] [url = https://sha256ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 04:04:16 INFO - --DOMWINDOW == 35 (0x113399400) [pid = 1722] [serial = 1781] [outer = 0x0] [url = about:blank] 04:04:16 INFO - --DOMWINDOW == 34 (0x11513f800) [pid = 1722] [serial = 1783] [outer = 0x0] [url = http://example.com/] 04:04:16 INFO - --DOMWINDOW == 33 (0x128277000) [pid = 1722] [serial = 1777] [outer = 0x0] [url = https://sha1ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 04:04:16 INFO - --DOMWINDOW == 32 (0x12830f400) [pid = 1722] [serial = 1778] [outer = 0x0] [url = https://rc4.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 04:04:16 INFO - --DOMWINDOW == 31 (0x1132db800) [pid = 1722] [serial = 1779] [outer = 0x0] [url = https://rc4.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html?] 04:04:16 INFO - --DOMWINDOW == 30 (0x1283f5400) [pid = 1722] [serial = 1780] [outer = 0x0] [url = https://sha256ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 04:04:16 INFO - MEMORY STAT | vsize 3454MB | residentFast 530MB | heapAllocated 119MB 04:04:16 INFO - 349 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_chrome.js | took 2673ms 04:04:16 INFO - ++DOCSHELL 0x112cd0000 == 15 [pid = 1722] [id = 748] 04:04:16 INFO - ++DOMWINDOW == 31 (0x112c95400) [pid = 1722] [serial = 1798] [outer = 0x0] 04:04:16 INFO - ++DOMWINDOW == 32 (0x112f42800) [pid = 1722] [serial = 1799] [outer = 0x112c95400] 04:04:16 INFO - 350 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_clickable_urls.js 04:04:16 INFO - ++DOCSHELL 0x113465000 == 16 [pid = 1722] [id = 749] 04:04:16 INFO - ++DOMWINDOW == 33 (0x113399400) [pid = 1722] [serial = 1800] [outer = 0x0] 04:04:16 INFO - ++DOMWINDOW == 34 (0x113447000) [pid = 1722] [serial = 1801] [outer = 0x113399400] 04:04:16 INFO - ++DOCSHELL 0x11345b800 == 17 [pid = 1722] [id = 750] 04:04:16 INFO - ++DOMWINDOW == 35 (0x113448c00) [pid = 1722] [serial = 1802] [outer = 0x0] 04:04:16 INFO - ++DOMWINDOW == 36 (0x113e11c00) [pid = 1722] [serial = 1803] [outer = 0x113448c00] 04:04:16 INFO - ++DOMWINDOW == 37 (0x11ee51800) [pid = 1722] [serial = 1804] [outer = 0x113448c00] 04:04:16 INFO - ++DOCSHELL 0x1203c2800 == 18 [pid = 1722] [id = 751] 04:04:16 INFO - ++DOMWINDOW == 38 (0x120ffdc00) [pid = 1722] [serial = 1805] [outer = 0x0] 04:04:16 INFO - ++DOMWINDOW == 39 (0x121112c00) [pid = 1722] [serial = 1806] [outer = 0x120ffdc00] 04:04:17 INFO - ++DOCSHELL 0x124ac8800 == 19 [pid = 1722] [id = 752] 04:04:17 INFO - ++DOMWINDOW == 40 (0x126242000) [pid = 1722] [serial = 1807] [outer = 0x0] 04:04:17 INFO - ++DOMWINDOW == 41 (0x126403c00) [pid = 1722] [serial = 1808] [outer = 0x126242000] 04:04:17 INFO - ++DOMWINDOW == 42 (0x11e7ad000) [pid = 1722] [serial = 1809] [outer = 0x126242000] 04:04:18 INFO - ++DOCSHELL 0x129377000 == 20 [pid = 1722] [id = 753] 04:04:18 INFO - ++DOMWINDOW == 43 (0x1221b4000) [pid = 1722] [serial = 1810] [outer = 0x0] 04:04:18 INFO - ++DOMWINDOW == 44 (0x1276c1400) [pid = 1722] [serial = 1811] [outer = 0x1221b4000] 04:04:18 INFO - ++DOMWINDOW == 45 (0x127078800) [pid = 1722] [serial = 1812] [outer = 0x1221b4000] 04:04:19 INFO - ++DOCSHELL 0x12965d000 == 21 [pid = 1722] [id = 754] 04:04:19 INFO - ++DOMWINDOW == 46 (0x128308c00) [pid = 1722] [serial = 1813] [outer = 0x0] 04:04:19 INFO - ++DOMWINDOW == 47 (0x12830b400) [pid = 1722] [serial = 1814] [outer = 0x128308c00] 04:04:19 INFO - ++DOMWINDOW == 48 (0x12838a800) [pid = 1722] [serial = 1815] [outer = 0x128308c00] 04:04:19 INFO - ++DOCSHELL 0x129d32000 == 22 [pid = 1722] [id = 755] 04:04:19 INFO - ++DOMWINDOW == 49 (0x128380400) [pid = 1722] [serial = 1816] [outer = 0x0] 04:04:19 INFO - ++DOMWINDOW == 50 (0x1283ec800) [pid = 1722] [serial = 1817] [outer = 0x128380400] 04:04:20 INFO - ++DOMWINDOW == 51 (0x1129b9800) [pid = 1722] [serial = 1818] [outer = 0x128380400] 04:04:20 INFO - ++DOCSHELL 0x12187d800 == 23 [pid = 1722] [id = 756] 04:04:20 INFO - ++DOMWINDOW == 52 (0x125741800) [pid = 1722] [serial = 1819] [outer = 0x0] 04:04:20 INFO - ++DOMWINDOW == 53 (0x126241400) [pid = 1722] [serial = 1820] [outer = 0x125741800] 04:04:21 INFO - ++DOMWINDOW == 54 (0x121317000) [pid = 1722] [serial = 1821] [outer = 0x125741800] 04:04:21 INFO - ++DOCSHELL 0x12a149000 == 24 [pid = 1722] [id = 757] 04:04:21 INFO - ++DOMWINDOW == 55 (0x12837f000) [pid = 1722] [serial = 1822] [outer = 0x0] 04:04:21 INFO - ++DOMWINDOW == 56 (0x128383800) [pid = 1722] [serial = 1823] [outer = 0x12837f000] 04:04:21 INFO - ++DOMWINDOW == 57 (0x128273c00) [pid = 1722] [serial = 1824] [outer = 0x12837f000] 04:04:22 INFO - ++DOCSHELL 0x12d992800 == 25 [pid = 1722] [id = 758] 04:04:22 INFO - ++DOMWINDOW == 58 (0x128380000) [pid = 1722] [serial = 1825] [outer = 0x0] 04:04:22 INFO - ++DOMWINDOW == 59 (0x1283f5000) [pid = 1722] [serial = 1826] [outer = 0x128380000] 04:04:22 INFO - ++DOMWINDOW == 60 (0x1283f8000) [pid = 1722] [serial = 1827] [outer = 0x128380000] 04:04:24 INFO - --DOCSHELL 0x11f639000 == 24 [pid = 1722] [id = 743] 04:04:24 INFO - --DOCSHELL 0x113e47800 == 23 [pid = 1722] [id = 742] 04:04:24 INFO - --DOCSHELL 0x113457800 == 22 [pid = 1722] [id = 741] 04:04:24 INFO - --DOCSHELL 0x1203c2800 == 21 [pid = 1722] [id = 751] 04:04:24 INFO - --DOCSHELL 0x12821f800 == 20 [pid = 1722] [id = 746] 04:04:24 INFO - --DOCSHELL 0x120ea9000 == 19 [pid = 1722] [id = 745] 04:04:24 INFO - --DOCSHELL 0x120dcb800 == 18 [pid = 1722] [id = 744] 04:04:24 INFO - --DOMWINDOW == 59 (0x1214b7c00) [pid = 1722] [serial = 1225] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 58 (0x11ef14800) [pid = 1722] [serial = 1774] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:24 INFO - --DOMWINDOW == 57 (0x120ffe000) [pid = 1722] [serial = 1776] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 56 (0x120fe3c00) [pid = 1722] [serial = 1223] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:24 INFO - --DOMWINDOW == 55 (0x125740c00) [pid = 1722] [serial = 1793] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:24 INFO - --DOMWINDOW == 54 (0x1276ae800) [pid = 1722] [serial = 1796] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:24 INFO - --DOMWINDOW == 53 (0x1203eac00) [pid = 1722] [serial = 1786] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:24 INFO - --DOMWINDOW == 52 (0x113266000) [pid = 1722] [serial = 1788] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 51 (0x126242000) [pid = 1722] [serial = 1807] [outer = 0x0] [url = http://example.com/] 04:04:24 INFO - --DOMWINDOW == 50 (0x1221b4000) [pid = 1722] [serial = 1810] [outer = 0x0] [url = https://example.com/] 04:04:24 INFO - --DOMWINDOW == 49 (0x128308c00) [pid = 1722] [serial = 1813] [outer = 0x0] [url = https://example.com/] 04:04:24 INFO - --DOMWINDOW == 48 (0x12232b800) [pid = 1722] [serial = 1790] [outer = 0x0] [url = about:config] 04:04:24 INFO - --DOMWINDOW == 47 (0x128380400) [pid = 1722] [serial = 1816] [outer = 0x0] [url = http://example.com/foo] 04:04:24 INFO - --DOMWINDOW == 46 (0x1283ec800) [pid = 1722] [serial = 1817] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 45 (0x121317000) [pid = 1722] [serial = 1821] [outer = 0x0] [url = http://example.com/] 04:04:24 INFO - --DOMWINDOW == 44 (0x1129b9800) [pid = 1722] [serial = 1818] [outer = 0x0] [url = http://example.com/foo] 04:04:24 INFO - --DOMWINDOW == 43 (0x12837f000) [pid = 1722] [serial = 1822] [outer = 0x0] [url = http://example.com/] 04:04:24 INFO - --DOMWINDOW == 42 (0x128383800) [pid = 1722] [serial = 1823] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 41 (0x128273c00) [pid = 1722] [serial = 1824] [outer = 0x0] [url = http://example.com/] 04:04:24 INFO - --DOMWINDOW == 40 (0x128380000) [pid = 1722] [serial = 1825] [outer = 0x0] [url = http://example.com/] 04:04:24 INFO - --DOMWINDOW == 39 (0x1283f5000) [pid = 1722] [serial = 1826] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 38 (0x1283f8000) [pid = 1722] [serial = 1827] [outer = 0x0] [url = http://example.com/] 04:04:24 INFO - --DOMWINDOW == 37 (0x126241400) [pid = 1722] [serial = 1820] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 36 (0x125741800) [pid = 1722] [serial = 1819] [outer = 0x0] [url = http://example.com/] 04:04:24 INFO - --DOMWINDOW == 35 (0x113e11c00) [pid = 1722] [serial = 1803] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 34 (0x121115800) [pid = 1722] [serial = 1789] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 33 (0x126403c00) [pid = 1722] [serial = 1808] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 32 (0x11e7ad000) [pid = 1722] [serial = 1809] [outer = 0x0] [url = http://example.com/] 04:04:24 INFO - --DOMWINDOW == 31 (0x1276c1400) [pid = 1722] [serial = 1811] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 30 (0x127078800) [pid = 1722] [serial = 1812] [outer = 0x0] [url = https://example.com/] 04:04:24 INFO - --DOMWINDOW == 29 (0x12830b400) [pid = 1722] [serial = 1814] [outer = 0x0] [url = about:blank] 04:04:24 INFO - --DOMWINDOW == 28 (0x12838a800) [pid = 1722] [serial = 1815] [outer = 0x0] [url = https://example.com/] 04:04:25 INFO - MEMORY STAT | vsize 3452MB | residentFast 534MB | heapAllocated 121MB 04:04:25 INFO - 351 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_clickable_urls.js | took 8641ms 04:04:25 INFO - ++DOCSHELL 0x112ccf000 == 19 [pid = 1722] [id = 759] 04:04:25 INFO - ++DOMWINDOW == 29 (0x1132e8c00) [pid = 1722] [serial = 1828] [outer = 0x0] 04:04:25 INFO - ++DOMWINDOW == 30 (0x113445c00) [pid = 1722] [serial = 1829] [outer = 0x1132e8c00] 04:04:25 INFO - 352 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_closure_inspection.js 04:04:25 INFO - ++DOCSHELL 0x113e4e800 == 20 [pid = 1722] [id = 760] 04:04:25 INFO - ++DOMWINDOW == 31 (0x113e04000) [pid = 1722] [serial = 1830] [outer = 0x0] 04:04:25 INFO - ++DOMWINDOW == 32 (0x113e11c00) [pid = 1722] [serial = 1831] [outer = 0x113e04000] 04:04:25 INFO - ++DOMWINDOW == 33 (0x11ebb8400) [pid = 1722] [serial = 1832] [outer = 0x113e04000] 04:04:25 INFO - ++DOCSHELL 0x11e819000 == 21 [pid = 1722] [id = 761] 04:04:25 INFO - ++DOMWINDOW == 34 (0x120264c00) [pid = 1722] [serial = 1833] [outer = 0x0] 04:04:25 INFO - ++DOMWINDOW == 35 (0x1202e8400) [pid = 1722] [serial = 1834] [outer = 0x120264c00] 04:04:25 INFO - ++DOMWINDOW == 36 (0x120d25400) [pid = 1722] [serial = 1835] [outer = 0x120264c00] 04:04:25 INFO - ++DOCSHELL 0x12469f000 == 22 [pid = 1722] [id = 762] 04:04:25 INFO - ++DOMWINDOW == 37 (0x1214b4c00) [pid = 1722] [serial = 1836] [outer = 0x0] 04:04:25 INFO - ++DOMWINDOW == 38 (0x12211d800) [pid = 1722] [serial = 1837] [outer = 0x1214b4c00] 04:04:26 INFO - ++DOCSHELL 0x129657800 == 23 [pid = 1722] [id = 763] 04:04:26 INFO - ++DOMWINDOW == 39 (0x120e23400) [pid = 1722] [serial = 1838] [outer = 0x0] 04:04:26 INFO - ++DOMWINDOW == 40 (0x1276c9400) [pid = 1722] [serial = 1839] [outer = 0x120e23400] 04:04:26 INFO - ++DOCSHELL 0x129677000 == 24 [pid = 1722] [id = 764] 04:04:26 INFO - ++DOMWINDOW == 41 (0x128388c00) [pid = 1722] [serial = 1840] [outer = 0x0] 04:04:26 INFO - ++DOMWINDOW == 42 (0x12838b400) [pid = 1722] [serial = 1841] [outer = 0x128388c00] 04:04:27 INFO - ++DOCSHELL 0x11e35b000 == 25 [pid = 1722] [id = 765] 04:04:27 INFO - ++DOMWINDOW == 43 (0x12dd80c00) [pid = 1722] [serial = 1842] [outer = 0x0] 04:04:27 INFO - ++DOMWINDOW == 44 (0x12e05d400) [pid = 1722] [serial = 1843] [outer = 0x12dd80c00] 04:04:28 INFO - [1722] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 173 04:04:28 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 274 04:04:28 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js, line 3548: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create 04:04:33 INFO - --DOCSHELL 0x112cd0000 == 24 [pid = 1722] [id = 748] 04:04:33 INFO - --DOCSHELL 0x113465000 == 23 [pid = 1722] [id = 749] 04:04:33 INFO - --DOCSHELL 0x11e819000 == 22 [pid = 1722] [id = 761] 04:04:33 INFO - --DOCSHELL 0x12469f000 == 21 [pid = 1722] [id = 762] 04:04:33 INFO - --DOCSHELL 0x124ac8800 == 20 [pid = 1722] [id = 752] 04:04:33 INFO - --DOCSHELL 0x129377000 == 19 [pid = 1722] [id = 753] 04:04:33 INFO - --DOCSHELL 0x12965d000 == 18 [pid = 1722] [id = 754] 04:04:33 INFO - --DOCSHELL 0x129d32000 == 17 [pid = 1722] [id = 755] 04:04:33 INFO - --DOCSHELL 0x129657800 == 16 [pid = 1722] [id = 763] 04:04:33 INFO - --DOCSHELL 0x11345b800 == 15 [pid = 1722] [id = 750] 04:04:33 INFO - --DOCSHELL 0x12187d800 == 14 [pid = 1722] [id = 756] 04:04:33 INFO - --DOCSHELL 0x12a149000 == 13 [pid = 1722] [id = 757] 04:04:33 INFO - --DOCSHELL 0x12d992800 == 12 [pid = 1722] [id = 758] 04:04:33 INFO - --DOCSHELL 0x129677000 == 11 [pid = 1722] [id = 764] 04:04:33 INFO - --DOCSHELL 0x11e35b000 == 10 [pid = 1722] [id = 765] 04:04:33 INFO - --DOMWINDOW == 43 (0x113446400) [pid = 1722] [serial = 1792] [outer = 0x0] [url = about:config] 04:04:33 INFO - --DOMWINDOW == 42 (0x1276c0800) [pid = 1722] [serial = 1797] [outer = 0x0] [url = about:blank] 04:04:33 INFO - --DOMWINDOW == 41 (0x126143800) [pid = 1722] [serial = 1795] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:33 INFO - --DOMWINDOW == 40 (0x120d18800) [pid = 1722] [serial = 1787] [outer = 0x0] [url = about:blank] 04:04:33 INFO - --DOMWINDOW == 39 (0x120ffdc00) [pid = 1722] [serial = 1805] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:33 INFO - --DOMWINDOW == 38 (0x113448c00) [pid = 1722] [serial = 1802] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:33 INFO - --DOMWINDOW == 37 (0x112c95400) [pid = 1722] [serial = 1798] [outer = 0x0] [url = about:blank] 04:04:33 INFO - --DOMWINDOW == 36 (0x113399400) [pid = 1722] [serial = 1800] [outer = 0x0] [url = data:text/html;charset=utf8,Bug%201005909%20-%20Clickable%20URLS] 04:04:33 INFO - --DOMWINDOW == 35 (0x128388c00) [pid = 1722] [serial = 1840] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:04:33 INFO - --DOMWINDOW == 34 (0x112f42800) [pid = 1722] [serial = 1799] [outer = 0x0] [url = about:blank] 04:04:33 INFO - --DOMWINDOW == 33 (0x113447000) [pid = 1722] [serial = 1801] [outer = 0x0] [url = about:blank] 04:04:33 INFO - --DOMWINDOW == 32 (0x113e11c00) [pid = 1722] [serial = 1831] [outer = 0x0] [url = about:blank] 04:04:33 INFO - --DOMWINDOW == 31 (0x1202e8400) [pid = 1722] [serial = 1834] [outer = 0x0] [url = about:blank] 04:04:33 INFO - MEMORY STAT | vsize 3448MB | residentFast 529MB | heapAllocated 129MB 04:04:33 INFO - 353 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_closure_inspection.js | took 8566ms 04:04:33 INFO - ++DOCSHELL 0x112cc4000 == 11 [pid = 1722] [id = 766] 04:04:33 INFO - ++DOMWINDOW == 32 (0x112f45400) [pid = 1722] [serial = 1844] [outer = 0x0] 04:04:33 INFO - ++DOMWINDOW == 33 (0x113165400) [pid = 1722] [serial = 1845] [outer = 0x112f45400] 04:04:33 INFO - 354 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_column_numbers.js 04:04:33 INFO - ++DOCSHELL 0x113463000 == 12 [pid = 1722] [id = 767] 04:04:33 INFO - ++DOMWINDOW == 34 (0x113d0b800) [pid = 1722] [serial = 1846] [outer = 0x0] 04:04:33 INFO - ++DOMWINDOW == 35 (0x113e05800) [pid = 1722] [serial = 1847] [outer = 0x113d0b800] 04:04:33 INFO - ++DOMWINDOW == 36 (0x11d46f800) [pid = 1722] [serial = 1848] [outer = 0x113d0b800] 04:04:34 INFO - ++DOCSHELL 0x11e350800 == 13 [pid = 1722] [id = 768] 04:04:34 INFO - ++DOMWINDOW == 37 (0x1202e4000) [pid = 1722] [serial = 1849] [outer = 0x0] 04:04:34 INFO - ++DOMWINDOW == 38 (0x1202e8400) [pid = 1722] [serial = 1850] [outer = 0x1202e4000] 04:04:34 INFO - ++DOMWINDOW == 39 (0x1203eac00) [pid = 1722] [serial = 1851] [outer = 0x1202e4000] 04:04:34 INFO - ++DOCSHELL 0x120e05800 == 14 [pid = 1722] [id = 769] 04:04:34 INFO - ++DOMWINDOW == 40 (0x121317c00) [pid = 1722] [serial = 1852] [outer = 0x0] 04:04:34 INFO - ++DOMWINDOW == 41 (0x1214ab000) [pid = 1722] [serial = 1853] [outer = 0x121317c00] 04:04:35 INFO - --DOCSHELL 0x113e4e800 == 13 [pid = 1722] [id = 760] 04:04:35 INFO - --DOCSHELL 0x112ccf000 == 12 [pid = 1722] [id = 759] 04:04:35 INFO - --DOMWINDOW == 40 (0x121112c00) [pid = 1722] [serial = 1806] [outer = 0x0] [url = about:blank] 04:04:35 INFO - --DOMWINDOW == 39 (0x11ee51800) [pid = 1722] [serial = 1804] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:36 INFO - --DOMWINDOW == 38 (0x12838b400) [pid = 1722] [serial = 1841] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:04:36 INFO - --DOMWINDOW == 37 (0x12dd80c00) [pid = 1722] [serial = 1842] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:04:36 INFO - --DOMWINDOW == 36 (0x1202e8400) [pid = 1722] [serial = 1850] [outer = 0x0] [url = about:blank] 04:04:36 INFO - --DOMWINDOW == 35 (0x113e04000) [pid = 1722] [serial = 1830] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-closures.html] 04:04:36 INFO - --DOMWINDOW == 34 (0x120264c00) [pid = 1722] [serial = 1833] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:36 INFO - --DOMWINDOW == 33 (0x113e05800) [pid = 1722] [serial = 1847] [outer = 0x0] [url = about:blank] 04:04:36 INFO - --DOMWINDOW == 32 (0x1132e8c00) [pid = 1722] [serial = 1828] [outer = 0x0] [url = about:blank] 04:04:36 INFO - --DOMWINDOW == 31 (0x1214b4c00) [pid = 1722] [serial = 1836] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:36 INFO - --DOMWINDOW == 30 (0x120e23400) [pid = 1722] [serial = 1838] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 04:04:36 INFO - MEMORY STAT | vsize 3441MB | residentFast 528MB | heapAllocated 118MB 04:04:36 INFO - 355 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_column_numbers.js | took 2598ms 04:04:36 INFO - ++DOCSHELL 0x112bb2800 == 13 [pid = 1722] [id = 770] 04:04:36 INFO - ++DOMWINDOW == 31 (0x112c9cc00) [pid = 1722] [serial = 1854] [outer = 0x0] 04:04:36 INFO - ++DOMWINDOW == 32 (0x112f48400) [pid = 1722] [serial = 1855] [outer = 0x112c9cc00] 04:04:36 INFO - 356 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_completion.js 04:04:36 INFO - ++DOCSHELL 0x11346e800 == 14 [pid = 1722] [id = 771] 04:04:36 INFO - ++DOMWINDOW == 33 (0x11344c000) [pid = 1722] [serial = 1856] [outer = 0x0] 04:04:36 INFO - ++DOMWINDOW == 34 (0x113d0c800) [pid = 1722] [serial = 1857] [outer = 0x11344c000] 04:04:36 INFO - ++DOCSHELL 0x11345b800 == 15 [pid = 1722] [id = 772] 04:04:36 INFO - ++DOMWINDOW == 35 (0x113d1d000) [pid = 1722] [serial = 1858] [outer = 0x0] 04:04:36 INFO - ++DOMWINDOW == 36 (0x11e789400) [pid = 1722] [serial = 1859] [outer = 0x113d1d000] 04:04:36 INFO - ++DOMWINDOW == 37 (0x120258c00) [pid = 1722] [serial = 1860] [outer = 0x113d1d000] 04:04:37 INFO - ++DOCSHELL 0x1203d6000 == 16 [pid = 1722] [id = 773] 04:04:37 INFO - ++DOMWINDOW == 38 (0x120ffe000) [pid = 1722] [serial = 1861] [outer = 0x0] 04:04:37 INFO - ++DOMWINDOW == 39 (0x12110d800) [pid = 1722] [serial = 1862] [outer = 0x120ffe000] 04:04:38 INFO - --DOCSHELL 0x120e05800 == 15 [pid = 1722] [id = 769] 04:04:38 INFO - --DOCSHELL 0x113463000 == 14 [pid = 1722] [id = 767] 04:04:38 INFO - --DOCSHELL 0x112cc4000 == 13 [pid = 1722] [id = 766] 04:04:38 INFO - --DOCSHELL 0x1203d6000 == 12 [pid = 1722] [id = 773] 04:04:38 INFO - --DOCSHELL 0x11e350800 == 11 [pid = 1722] [id = 768] 04:04:38 INFO - --DOMWINDOW == 38 (0x12211d800) [pid = 1722] [serial = 1837] [outer = 0x0] [url = about:blank] 04:04:38 INFO - --DOMWINDOW == 37 (0x12e05d400) [pid = 1722] [serial = 1843] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:04:38 INFO - --DOMWINDOW == 36 (0x113445c00) [pid = 1722] [serial = 1829] [outer = 0x0] [url = about:blank] 04:04:38 INFO - --DOMWINDOW == 35 (0x11ebb8400) [pid = 1722] [serial = 1832] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-closures.html] 04:04:38 INFO - --DOMWINDOW == 34 (0x1276c9400) [pid = 1722] [serial = 1839] [outer = 0x0] [url = about:blank] 04:04:38 INFO - --DOMWINDOW == 33 (0x120d25400) [pid = 1722] [serial = 1835] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:38 INFO - --DOMWINDOW == 32 (0x113165400) [pid = 1722] [serial = 1845] [outer = 0x0] [url = about:blank] 04:04:38 INFO - --DOMWINDOW == 31 (0x11e789400) [pid = 1722] [serial = 1859] [outer = 0x0] [url = about:blank] 04:04:38 INFO - --DOMWINDOW == 30 (0x113d0b800) [pid = 1722] [serial = 1846] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-column.html] 04:04:38 INFO - --DOMWINDOW == 29 (0x112f45400) [pid = 1722] [serial = 1844] [outer = 0x0] [url = about:blank] 04:04:39 INFO - --DOMWINDOW == 28 (0x11d46f800) [pid = 1722] [serial = 1848] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-column.html] 04:04:39 INFO - MEMORY STAT | vsize 3449MB | residentFast 530MB | heapAllocated 117MB 04:04:39 INFO - 357 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_completion.js | took 2560ms 04:04:39 INFO - ++DOCSHELL 0x112cb7800 == 12 [pid = 1722] [id = 774] 04:04:39 INFO - ++DOMWINDOW == 29 (0x112f41400) [pid = 1722] [serial = 1863] [outer = 0x0] 04:04:39 INFO - ++DOMWINDOW == 30 (0x113163c00) [pid = 1722] [serial = 1864] [outer = 0x112f41400] 04:04:39 INFO - 358 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_api_stackframe.js 04:04:39 INFO - ++DOCSHELL 0x113467800 == 13 [pid = 1722] [id = 775] 04:04:39 INFO - ++DOMWINDOW == 31 (0x11344ec00) [pid = 1722] [serial = 1865] [outer = 0x0] 04:04:39 INFO - ++DOMWINDOW == 32 (0x113e02800) [pid = 1722] [serial = 1866] [outer = 0x11344ec00] 04:04:39 INFO - ++DOMWINDOW == 33 (0x11d46f800) [pid = 1722] [serial = 1867] [outer = 0x11344ec00] 04:04:39 INFO - ++DOCSHELL 0x112ccf000 == 14 [pid = 1722] [id = 776] 04:04:39 INFO - ++DOMWINDOW == 34 (0x1202e8400) [pid = 1722] [serial = 1868] [outer = 0x0] 04:04:39 INFO - ++DOMWINDOW == 35 (0x1203dd800) [pid = 1722] [serial = 1869] [outer = 0x1202e8400] 04:04:39 INFO - ++DOMWINDOW == 36 (0x120d25400) [pid = 1722] [serial = 1870] [outer = 0x1202e8400] 04:04:39 INFO - ++DOCSHELL 0x120e19000 == 15 [pid = 1722] [id = 777] 04:04:39 INFO - ++DOMWINDOW == 37 (0x1214aa400) [pid = 1722] [serial = 1871] [outer = 0x0] 04:04:39 INFO - ++DOMWINDOW == 38 (0x122122000) [pid = 1722] [serial = 1872] [outer = 0x1214aa400] 04:04:41 INFO - --DOCSHELL 0x11346e800 == 14 [pid = 1722] [id = 771] 04:04:41 INFO - --DOCSHELL 0x112bb2800 == 13 [pid = 1722] [id = 770] 04:04:41 INFO - --DOCSHELL 0x11345b800 == 12 [pid = 1722] [id = 772] 04:04:41 INFO - --DOMWINDOW == 37 (0x1203dd800) [pid = 1722] [serial = 1869] [outer = 0x0] [url = about:blank] 04:04:41 INFO - --DOMWINDOW == 36 (0x112c9cc00) [pid = 1722] [serial = 1854] [outer = 0x0] [url = about:blank] 04:04:41 INFO - --DOMWINDOW == 35 (0x11344c000) [pid = 1722] [serial = 1856] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20code%20completion] 04:04:41 INFO - --DOMWINDOW == 34 (0x113d1d000) [pid = 1722] [serial = 1858] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:41 INFO - --DOMWINDOW == 33 (0x113d0c800) [pid = 1722] [serial = 1857] [outer = 0x0] [url = about:blank] 04:04:41 INFO - --DOMWINDOW == 32 (0x113e02800) [pid = 1722] [serial = 1866] [outer = 0x0] [url = about:blank] 04:04:41 INFO - --DOMWINDOW == 31 (0x121317c00) [pid = 1722] [serial = 1852] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:41 INFO - --DOMWINDOW == 30 (0x1202e4000) [pid = 1722] [serial = 1849] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:41 INFO - --DOMWINDOW == 29 (0x120ffe000) [pid = 1722] [serial = 1861] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:41 INFO - MEMORY STAT | vsize 3449MB | residentFast 530MB | heapAllocated 117MB 04:04:41 INFO - 359 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_api_stackframe.js | took 2283ms 04:04:41 INFO - ++DOCSHELL 0x112604000 == 13 [pid = 1722] [id = 778] 04:04:41 INFO - ++DOMWINDOW == 30 (0x112c9fc00) [pid = 1722] [serial = 1873] [outer = 0x0] 04:04:41 INFO - ++DOMWINDOW == 31 (0x113164c00) [pid = 1722] [serial = 1874] [outer = 0x112c9fc00] 04:04:41 INFO - 360 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_custom_styles.js 04:04:41 INFO - ++DOCSHELL 0x1135a7800 == 14 [pid = 1722] [id = 779] 04:04:41 INFO - ++DOMWINDOW == 32 (0x113450000) [pid = 1722] [serial = 1875] [outer = 0x0] 04:04:41 INFO - ++DOMWINDOW == 33 (0x113e03c00) [pid = 1722] [serial = 1876] [outer = 0x113450000] 04:04:41 INFO - ++DOCSHELL 0x11346d800 == 15 [pid = 1722] [id = 780] 04:04:41 INFO - ++DOMWINDOW == 34 (0x113e0f800) [pid = 1722] [serial = 1877] [outer = 0x0] 04:04:41 INFO - ++DOMWINDOW == 35 (0x11e7aa000) [pid = 1722] [serial = 1878] [outer = 0x113e0f800] 04:04:41 INFO - ++DOMWINDOW == 36 (0x1202e4000) [pid = 1722] [serial = 1879] [outer = 0x113e0f800] 04:04:42 INFO - ++DOCSHELL 0x120e05800 == 16 [pid = 1722] [id = 781] 04:04:42 INFO - ++DOMWINDOW == 37 (0x12115b800) [pid = 1722] [serial = 1880] [outer = 0x0] 04:04:42 INFO - ++DOMWINDOW == 38 (0x12130d400) [pid = 1722] [serial = 1881] [outer = 0x12115b800] 04:04:43 INFO - --DOCSHELL 0x120e19000 == 15 [pid = 1722] [id = 777] 04:04:43 INFO - --DOCSHELL 0x112cb7800 == 14 [pid = 1722] [id = 774] 04:04:43 INFO - --DOCSHELL 0x113467800 == 13 [pid = 1722] [id = 775] 04:04:43 INFO - --DOCSHELL 0x120e05800 == 12 [pid = 1722] [id = 781] 04:04:43 INFO - --DOCSHELL 0x112ccf000 == 11 [pid = 1722] [id = 776] 04:04:43 INFO - --DOMWINDOW == 37 (0x1214ab000) [pid = 1722] [serial = 1853] [outer = 0x0] [url = about:blank] 04:04:43 INFO - --DOMWINDOW == 36 (0x120258c00) [pid = 1722] [serial = 1860] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:43 INFO - --DOMWINDOW == 35 (0x1203eac00) [pid = 1722] [serial = 1851] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:43 INFO - --DOMWINDOW == 34 (0x12110d800) [pid = 1722] [serial = 1862] [outer = 0x0] [url = about:blank] 04:04:43 INFO - --DOMWINDOW == 33 (0x112f48400) [pid = 1722] [serial = 1855] [outer = 0x0] [url = about:blank] 04:04:43 INFO - --DOMWINDOW == 32 (0x112f41400) [pid = 1722] [serial = 1863] [outer = 0x0] [url = about:blank] 04:04:43 INFO - --DOMWINDOW == 31 (0x113163c00) [pid = 1722] [serial = 1864] [outer = 0x0] [url = about:blank] 04:04:43 INFO - --DOMWINDOW == 30 (0x11e7aa000) [pid = 1722] [serial = 1878] [outer = 0x0] [url = about:blank] 04:04:43 INFO - --DOMWINDOW == 29 (0x1214aa400) [pid = 1722] [serial = 1871] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:43 INFO - --DOMWINDOW == 28 (0x1202e8400) [pid = 1722] [serial = 1868] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:43 INFO - --DOMWINDOW == 27 (0x11344ec00) [pid = 1722] [serial = 1865] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-api-stackframe.html] 04:04:43 INFO - --DOMWINDOW == 26 (0x11d46f800) [pid = 1722] [serial = 1867] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-api-stackframe.html] 04:04:43 INFO - MEMORY STAT | vsize 3449MB | residentFast 531MB | heapAllocated 116MB 04:04:43 INFO - 361 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_custom_styles.js | took 2285ms 04:04:43 INFO - ++DOCSHELL 0x11284f000 == 12 [pid = 1722] [id = 782] 04:04:43 INFO - ++DOMWINDOW == 27 (0x112f41800) [pid = 1722] [serial = 1882] [outer = 0x0] 04:04:43 INFO - ++DOMWINDOW == 28 (0x11315a400) [pid = 1722] [serial = 1883] [outer = 0x112f41800] 04:04:44 INFO - 362 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_extras.js 04:04:44 INFO - ++DOCSHELL 0x114b6e000 == 13 [pid = 1722] [id = 783] 04:04:44 INFO - ++DOMWINDOW == 29 (0x11344f000) [pid = 1722] [serial = 1884] [outer = 0x0] 04:04:44 INFO - ++DOMWINDOW == 30 (0x113e05800) [pid = 1722] [serial = 1885] [outer = 0x11344f000] 04:04:44 INFO - ++DOMWINDOW == 31 (0x11e798400) [pid = 1722] [serial = 1886] [outer = 0x11344f000] 04:04:44 INFO - ++DOCSHELL 0x11eb9a800 == 14 [pid = 1722] [id = 784] 04:04:44 INFO - ++DOMWINDOW == 32 (0x1203dec00) [pid = 1722] [serial = 1887] [outer = 0x0] 04:04:44 INFO - ++DOMWINDOW == 33 (0x1203e1000) [pid = 1722] [serial = 1888] [outer = 0x1203dec00] 04:04:44 INFO - ++DOMWINDOW == 34 (0x120e2b000) [pid = 1722] [serial = 1889] [outer = 0x1203dec00] 04:04:44 INFO - ++DOCSHELL 0x121882800 == 15 [pid = 1722] [id = 785] 04:04:44 INFO - ++DOMWINDOW == 35 (0x1214a9000) [pid = 1722] [serial = 1890] [outer = 0x0] 04:04:44 INFO - ++DOMWINDOW == 36 (0x1214b1000) [pid = 1722] [serial = 1891] [outer = 0x1214a9000] 04:04:46 INFO - --DOCSHELL 0x112604000 == 14 [pid = 1722] [id = 778] 04:04:46 INFO - --DOCSHELL 0x1135a7800 == 13 [pid = 1722] [id = 779] 04:04:46 INFO - --DOCSHELL 0x121882800 == 12 [pid = 1722] [id = 785] 04:04:46 INFO - --DOCSHELL 0x11346d800 == 11 [pid = 1722] [id = 780] 04:04:46 INFO - --DOMWINDOW == 35 (0x122122000) [pid = 1722] [serial = 1872] [outer = 0x0] [url = about:blank] 04:04:46 INFO - --DOMWINDOW == 34 (0x120d25400) [pid = 1722] [serial = 1870] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:46 INFO - --DOMWINDOW == 33 (0x1203e1000) [pid = 1722] [serial = 1888] [outer = 0x0] [url = about:blank] 04:04:46 INFO - --DOMWINDOW == 32 (0x113e05800) [pid = 1722] [serial = 1885] [outer = 0x0] [url = about:blank] 04:04:46 INFO - --DOMWINDOW == 31 (0x113e03c00) [pid = 1722] [serial = 1876] [outer = 0x0] [url = about:blank] 04:04:46 INFO - --DOMWINDOW == 30 (0x113164c00) [pid = 1722] [serial = 1874] [outer = 0x0] [url = about:blank] 04:04:46 INFO - --DOMWINDOW == 29 (0x113e0f800) [pid = 1722] [serial = 1877] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:46 INFO - --DOMWINDOW == 28 (0x12115b800) [pid = 1722] [serial = 1880] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:46 INFO - --DOMWINDOW == 27 (0x113450000) [pid = 1722] [serial = 1875] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20for%20console.log('%ccustom%20styles',%20'color:red')] 04:04:46 INFO - --DOMWINDOW == 26 (0x112c9fc00) [pid = 1722] [serial = 1873] [outer = 0x0] [url = about:blank] 04:04:46 INFO - MEMORY STAT | vsize 3449MB | residentFast 531MB | heapAllocated 116MB 04:04:46 INFO - 363 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_extras.js | took 2215ms 04:04:46 INFO - ++DOCSHELL 0x112ba0000 == 12 [pid = 1722] [id = 786] 04:04:46 INFO - ++DOMWINDOW == 27 (0x112c9fc00) [pid = 1722] [serial = 1892] [outer = 0x0] 04:04:46 INFO - ++DOMWINDOW == 28 (0x113163c00) [pid = 1722] [serial = 1893] [outer = 0x112c9fc00] 04:04:46 INFO - 364 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_logging_api.js 04:04:46 INFO - ++DOCSHELL 0x113511000 == 13 [pid = 1722] [id = 787] 04:04:46 INFO - ++DOMWINDOW == 29 (0x1135f1c00) [pid = 1722] [serial = 1894] [outer = 0x0] 04:04:46 INFO - ++DOMWINDOW == 30 (0x113e05800) [pid = 1722] [serial = 1895] [outer = 0x1135f1c00] 04:04:46 INFO - ++DOMWINDOW == 31 (0x12130d800) [pid = 1722] [serial = 1896] [outer = 0x1135f1c00] 04:04:46 INFO - ++DOCSHELL 0x112cd4800 == 14 [pid = 1722] [id = 788] 04:04:46 INFO - ++DOMWINDOW == 32 (0x11f715c00) [pid = 1722] [serial = 1897] [outer = 0x0] 04:04:46 INFO - ++DOMWINDOW == 33 (0x120264c00) [pid = 1722] [serial = 1898] [outer = 0x11f715c00] 04:04:46 INFO - ++DOMWINDOW == 34 (0x120d25400) [pid = 1722] [serial = 1899] [outer = 0x11f715c00] 04:04:46 INFO - ++DOCSHELL 0x120eb8800 == 15 [pid = 1722] [id = 789] 04:04:46 INFO - ++DOMWINDOW == 35 (0x121319000) [pid = 1722] [serial = 1900] [outer = 0x0] 04:04:46 INFO - ++DOMWINDOW == 36 (0x1214ab800) [pid = 1722] [serial = 1901] [outer = 0x121319000] 04:04:49 INFO - --DOCSHELL 0x11284f000 == 14 [pid = 1722] [id = 782] 04:04:49 INFO - --DOCSHELL 0x114b6e000 == 13 [pid = 1722] [id = 783] 04:04:49 INFO - --DOCSHELL 0x120eb8800 == 12 [pid = 1722] [id = 789] 04:04:49 INFO - --DOCSHELL 0x11eb9a800 == 11 [pid = 1722] [id = 784] 04:04:49 INFO - --DOMWINDOW == 35 (0x12130d400) [pid = 1722] [serial = 1881] [outer = 0x0] [url = about:blank] 04:04:49 INFO - --DOMWINDOW == 34 (0x1202e4000) [pid = 1722] [serial = 1879] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:49 INFO - --DOMWINDOW == 33 (0x11315a400) [pid = 1722] [serial = 1883] [outer = 0x0] [url = about:blank] 04:04:49 INFO - --DOMWINDOW == 32 (0x113e05800) [pid = 1722] [serial = 1895] [outer = 0x0] [url = about:blank] 04:04:49 INFO - --DOMWINDOW == 31 (0x120264c00) [pid = 1722] [serial = 1898] [outer = 0x0] [url = about:blank] 04:04:49 INFO - --DOMWINDOW == 30 (0x1203dec00) [pid = 1722] [serial = 1887] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:49 INFO - --DOMWINDOW == 29 (0x1214a9000) [pid = 1722] [serial = 1890] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:49 INFO - --DOMWINDOW == 28 (0x112f41800) [pid = 1722] [serial = 1882] [outer = 0x0] [url = about:blank] 04:04:49 INFO - --DOMWINDOW == 27 (0x11344f000) [pid = 1722] [serial = 1884] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-extras.html] 04:04:49 INFO - MEMORY STAT | vsize 3450MB | residentFast 532MB | heapAllocated 116MB 04:04:49 INFO - 365 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_logging_api.js | took 3287ms 04:04:49 INFO - ++DOCSHELL 0x112cb8000 == 12 [pid = 1722] [id = 790] 04:04:49 INFO - ++DOMWINDOW == 28 (0x112f42800) [pid = 1722] [serial = 1902] [outer = 0x0] 04:04:49 INFO - ++DOMWINDOW == 29 (0x113164c00) [pid = 1722] [serial = 1903] [outer = 0x112f42800] 04:04:49 INFO - 366 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_logging_workers_api.js 04:04:49 INFO - ++DOCSHELL 0x113e46000 == 13 [pid = 1722] [id = 791] 04:04:49 INFO - ++DOMWINDOW == 30 (0x113450400) [pid = 1722] [serial = 1904] [outer = 0x0] 04:04:49 INFO - ++DOMWINDOW == 31 (0x113e08400) [pid = 1722] [serial = 1905] [outer = 0x113450400] 04:04:49 INFO - ++DOMWINDOW == 32 (0x11e7ad000) [pid = 1722] [serial = 1906] [outer = 0x113450400] 04:04:50 INFO - ++DOCSHELL 0x11268a800 == 14 [pid = 1722] [id = 792] 04:04:50 INFO - ++DOMWINDOW == 33 (0x1203dfc00) [pid = 1722] [serial = 1907] [outer = 0x0] 04:04:50 INFO - ++DOMWINDOW == 34 (0x120d1e000) [pid = 1722] [serial = 1908] [outer = 0x1203dfc00] 04:04:50 INFO - ++DOMWINDOW == 35 (0x120fe6800) [pid = 1722] [serial = 1909] [outer = 0x1203dfc00] 04:04:50 INFO - ++DOCSHELL 0x124691000 == 15 [pid = 1722] [id = 793] 04:04:50 INFO - ++DOMWINDOW == 36 (0x122122000) [pid = 1722] [serial = 1910] [outer = 0x0] 04:04:50 INFO - ++DOMWINDOW == 37 (0x1225d6000) [pid = 1722] [serial = 1911] [outer = 0x122122000] 04:04:51 INFO - --DOCSHELL 0x112ba0000 == 14 [pid = 1722] [id = 786] 04:04:51 INFO - --DOCSHELL 0x112cd4800 == 13 [pid = 1722] [id = 788] 04:04:51 INFO - --DOCSHELL 0x124691000 == 12 [pid = 1722] [id = 793] 04:04:51 INFO - --DOCSHELL 0x113511000 == 11 [pid = 1722] [id = 787] 04:04:51 INFO - --DOMWINDOW == 36 (0x120e2b000) [pid = 1722] [serial = 1889] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:51 INFO - --DOMWINDOW == 35 (0x1214b1000) [pid = 1722] [serial = 1891] [outer = 0x0] [url = about:blank] 04:04:51 INFO - --DOMWINDOW == 34 (0x11e798400) [pid = 1722] [serial = 1886] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-extras.html] 04:04:51 INFO - --DOMWINDOW == 33 (0x113163c00) [pid = 1722] [serial = 1893] [outer = 0x0] [url = about:blank] 04:04:51 INFO - --DOMWINDOW == 32 (0x113e08400) [pid = 1722] [serial = 1905] [outer = 0x0] [url = about:blank] 04:04:51 INFO - --DOMWINDOW == 31 (0x120d1e000) [pid = 1722] [serial = 1908] [outer = 0x0] [url = about:blank] 04:04:51 INFO - --DOMWINDOW == 30 (0x1135f1c00) [pid = 1722] [serial = 1894] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:04:51 INFO - --DOMWINDOW == 29 (0x112c9fc00) [pid = 1722] [serial = 1892] [outer = 0x0] [url = about:blank] 04:04:51 INFO - njn: RemoveSharedWorker 04:04:51 INFO - --DOMWINDOW == 28 (0x12130d800) [pid = 1722] [serial = 1896] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:04:51 INFO - MEMORY STAT | vsize 3455MB | residentFast 534MB | heapAllocated 117MB 04:04:52 INFO - 367 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_logging_workers_api.js | took 2181ms 04:04:52 INFO - ++DOCSHELL 0x112cc5800 == 12 [pid = 1722] [id = 794] 04:04:52 INFO - ++DOMWINDOW == 29 (0x112f41400) [pid = 1722] [serial = 1912] [outer = 0x0] 04:04:52 INFO - ++DOMWINDOW == 30 (0x113163c00) [pid = 1722] [serial = 1913] [outer = 0x112f41400] 04:04:52 INFO - 368 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_trace_async.js 04:04:52 INFO - ++DOCSHELL 0x11e81d000 == 13 [pid = 1722] [id = 795] 04:04:52 INFO - ++DOMWINDOW == 31 (0x113d0ac00) [pid = 1722] [serial = 1914] [outer = 0x0] 04:04:52 INFO - ++DOMWINDOW == 32 (0x113e11800) [pid = 1722] [serial = 1915] [outer = 0x113d0ac00] 04:04:52 INFO - ++DOCSHELL 0x11eb8a800 == 14 [pid = 1722] [id = 796] 04:04:52 INFO - ++DOMWINDOW == 33 (0x114b57000) [pid = 1722] [serial = 1916] [outer = 0x0] 04:04:52 INFO - ++DOMWINDOW == 34 (0x11ebb9400) [pid = 1722] [serial = 1917] [outer = 0x114b57000] 04:04:52 INFO - ++DOMWINDOW == 35 (0x120e25000) [pid = 1722] [serial = 1918] [outer = 0x114b57000] 04:04:52 INFO - ++DOCSHELL 0x12188b000 == 15 [pid = 1722] [id = 797] 04:04:52 INFO - ++DOMWINDOW == 36 (0x1214a9c00) [pid = 1722] [serial = 1919] [outer = 0x0] 04:04:52 INFO - ++DOMWINDOW == 37 (0x1214b1000) [pid = 1722] [serial = 1920] [outer = 0x1214a9c00] 04:04:53 INFO - ++DOMWINDOW == 38 (0x12830d400) [pid = 1722] [serial = 1921] [outer = 0x113d0ac00] 04:04:53 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:04:53 INFO - MEMORY STAT | vsize 3457MB | residentFast 536MB | heapAllocated 124MB 04:04:53 INFO - 369 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_trace_async.js | took 1772ms 04:04:53 INFO - ++DOCSHELL 0x112b43800 == 16 [pid = 1722] [id = 798] 04:04:53 INFO - ++DOMWINDOW == 39 (0x12110c000) [pid = 1722] [serial = 1922] [outer = 0x0] 04:04:53 INFO - ++DOMWINDOW == 40 (0x12130dc00) [pid = 1722] [serial = 1923] [outer = 0x12110c000] 04:04:54 INFO - 370 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_trace_duplicates.js 04:04:54 INFO - ++DOCSHELL 0x1128cb000 == 17 [pid = 1722] [id = 799] 04:04:54 INFO - ++DOMWINDOW == 41 (0x11288bc00) [pid = 1722] [serial = 1924] [outer = 0x0] 04:04:54 INFO - ++DOMWINDOW == 42 (0x112c94400) [pid = 1722] [serial = 1925] [outer = 0x11288bc00] 04:04:54 INFO - ++DOCSHELL 0x1135ae000 == 18 [pid = 1722] [id = 800] 04:04:54 INFO - ++DOMWINDOW == 43 (0x112f42400) [pid = 1722] [serial = 1926] [outer = 0x0] 04:04:54 INFO - ++DOMWINDOW == 44 (0x11ef16000) [pid = 1722] [serial = 1927] [outer = 0x112f42400] 04:04:54 INFO - ++DOMWINDOW == 45 (0x120fe4800) [pid = 1722] [serial = 1928] [outer = 0x112f42400] 04:04:54 INFO - ++DOCSHELL 0x124f1b000 == 19 [pid = 1722] [id = 801] 04:04:54 INFO - ++DOMWINDOW == 46 (0x1247c3000) [pid = 1722] [serial = 1929] [outer = 0x0] 04:04:54 INFO - ++DOMWINDOW == 47 (0x1247c9400) [pid = 1722] [serial = 1930] [outer = 0x1247c3000] 04:04:55 INFO - ++DOMWINDOW == 48 (0x129392400) [pid = 1722] [serial = 1931] [outer = 0x11288bc00] 04:04:55 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:04:56 INFO - --DOCSHELL 0x113e46000 == 18 [pid = 1722] [id = 791] 04:04:56 INFO - --DOCSHELL 0x112cc5800 == 17 [pid = 1722] [id = 794] 04:04:56 INFO - --DOCSHELL 0x11268a800 == 16 [pid = 1722] [id = 792] 04:04:56 INFO - --DOCSHELL 0x112cb8000 == 15 [pid = 1722] [id = 790] 04:04:56 INFO - --DOCSHELL 0x11e81d000 == 14 [pid = 1722] [id = 795] 04:04:56 INFO - --DOCSHELL 0x11eb8a800 == 13 [pid = 1722] [id = 796] 04:04:56 INFO - --DOCSHELL 0x12188b000 == 12 [pid = 1722] [id = 797] 04:04:56 INFO - --DOCSHELL 0x124f1b000 == 11 [pid = 1722] [id = 801] 04:04:56 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 04:04:56 INFO - --DOMWINDOW == 47 (0x113d0ac00) [pid = 1722] [serial = 1914] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-trace-async.html] 04:04:56 INFO - --DOMWINDOW == 46 (0x112f41400) [pid = 1722] [serial = 1912] [outer = 0x0] [url = about:blank] 04:04:56 INFO - --DOMWINDOW == 45 (0x113163c00) [pid = 1722] [serial = 1913] [outer = 0x0] [url = about:blank] 04:04:56 INFO - --DOMWINDOW == 44 (0x121319000) [pid = 1722] [serial = 1900] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:56 INFO - --DOMWINDOW == 43 (0x114b57000) [pid = 1722] [serial = 1916] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:56 INFO - --DOMWINDOW == 42 (0x122122000) [pid = 1722] [serial = 1910] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:56 INFO - --DOMWINDOW == 41 (0x11f715c00) [pid = 1722] [serial = 1897] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:56 INFO - --DOMWINDOW == 40 (0x1203dfc00) [pid = 1722] [serial = 1907] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:04:56 INFO - --DOMWINDOW == 39 (0x113450400) [pid = 1722] [serial = 1904] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-workers.html] 04:04:56 INFO - --DOMWINDOW == 38 (0x112f42800) [pid = 1722] [serial = 1902] [outer = 0x0] [url = about:blank] 04:04:56 INFO - --DOMWINDOW == 37 (0x11ef16000) [pid = 1722] [serial = 1927] [outer = 0x0] [url = about:blank] 04:04:56 INFO - --DOMWINDOW == 36 (0x1214a9c00) [pid = 1722] [serial = 1919] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:04:56 INFO - --DOMWINDOW == 35 (0x113e11800) [pid = 1722] [serial = 1915] [outer = 0x0] [url = about:blank] 04:04:56 INFO - --DOMWINDOW == 34 (0x113164c00) [pid = 1722] [serial = 1903] [outer = 0x0] [url = about:blank] 04:04:56 INFO - --DOMWINDOW == 33 (0x11ebb9400) [pid = 1722] [serial = 1917] [outer = 0x0] [url = about:blank] 04:04:57 INFO - --DOMWINDOW == 32 (0x11e7ad000) [pid = 1722] [serial = 1906] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-workers.html] 04:04:57 INFO - MEMORY STAT | vsize 3456MB | residentFast 533MB | heapAllocated 122MB 04:04:57 INFO - 371 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_trace_duplicates.js | took 3084ms 04:04:57 INFO - ++DOCSHELL 0x112ba8800 == 12 [pid = 1722] [id = 802] 04:04:57 INFO - ++DOMWINDOW == 33 (0x11344dc00) [pid = 1722] [serial = 1932] [outer = 0x0] 04:04:57 INFO - ++DOMWINDOW == 34 (0x113e08400) [pid = 1722] [serial = 1933] [outer = 0x11344dc00] 04:04:57 INFO - 372 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_context_menu_open_in_var_view.js 04:04:57 INFO - ++DOCSHELL 0x11f639000 == 13 [pid = 1722] [id = 803] 04:04:57 INFO - ++DOMWINDOW == 35 (0x11ee55800) [pid = 1722] [serial = 1934] [outer = 0x0] 04:04:57 INFO - ++DOMWINDOW == 36 (0x11f111400) [pid = 1722] [serial = 1935] [outer = 0x11ee55800] 04:04:57 INFO - ++DOCSHELL 0x1135a3800 == 14 [pid = 1722] [id = 804] 04:04:57 INFO - ++DOMWINDOW == 37 (0x11f70e000) [pid = 1722] [serial = 1936] [outer = 0x0] 04:04:57 INFO - ++DOMWINDOW == 38 (0x120e2b800) [pid = 1722] [serial = 1937] [outer = 0x11f70e000] 04:04:57 INFO - ++DOMWINDOW == 39 (0x120ffd800) [pid = 1722] [serial = 1938] [outer = 0x11f70e000] 04:04:57 INFO - ++DOCSHELL 0x12469f800 == 15 [pid = 1722] [id = 805] 04:04:57 INFO - ++DOMWINDOW == 40 (0x122ea8c00) [pid = 1722] [serial = 1939] [outer = 0x0] 04:04:57 INFO - ++DOMWINDOW == 41 (0x12434a000) [pid = 1722] [serial = 1940] [outer = 0x122ea8c00] 04:04:58 INFO - MEMORY STAT | vsize 3458MB | residentFast 535MB | heapAllocated 127MB 04:04:58 INFO - 373 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_context_menu_open_in_var_view.js | took 1647ms 04:04:58 INFO - ++DOCSHELL 0x112ba5000 == 16 [pid = 1722] [id = 806] 04:04:58 INFO - ++DOMWINDOW == 42 (0x120e2b400) [pid = 1722] [serial = 1941] [outer = 0x0] 04:04:59 INFO - ++DOMWINDOW == 43 (0x1214ab400) [pid = 1722] [serial = 1942] [outer = 0x120e2b400] 04:04:59 INFO - 374 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_context_menu_store_as_global.js 04:04:59 INFO - ++DOCSHELL 0x128220000 == 17 [pid = 1722] [id = 807] 04:04:59 INFO - ++DOMWINDOW == 44 (0x122e99400) [pid = 1722] [serial = 1943] [outer = 0x0] 04:04:59 INFO - ++DOMWINDOW == 45 (0x1247c8400) [pid = 1722] [serial = 1944] [outer = 0x122e99400] 04:04:59 INFO - ++DOCSHELL 0x124691000 == 18 [pid = 1722] [id = 808] 04:04:59 INFO - ++DOMWINDOW == 46 (0x1266eac00) [pid = 1722] [serial = 1945] [outer = 0x0] 04:04:59 INFO - ++DOMWINDOW == 47 (0x1266f6c00) [pid = 1722] [serial = 1946] [outer = 0x1266eac00] 04:04:59 INFO - ++DOMWINDOW == 48 (0x127329400) [pid = 1722] [serial = 1947] [outer = 0x1266eac00] 04:04:59 INFO - ++DOCSHELL 0x124ac0000 == 19 [pid = 1722] [id = 809] 04:04:59 INFO - ++DOMWINDOW == 49 (0x126144800) [pid = 1722] [serial = 1948] [outer = 0x0] 04:04:59 INFO - ++DOMWINDOW == 50 (0x128273000) [pid = 1722] [serial = 1949] [outer = 0x126144800] 04:05:00 INFO - MEMORY STAT | vsize 3459MB | residentFast 536MB | heapAllocated 134MB 04:05:00 INFO - 375 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_context_menu_store_as_global.js | took 1641ms 04:05:00 INFO - ++DOCSHELL 0x129667800 == 20 [pid = 1722] [id = 810] 04:05:00 INFO - ++DOMWINDOW == 51 (0x1276ad400) [pid = 1722] [serial = 1950] [outer = 0x0] 04:05:00 INFO - ++DOMWINDOW == 52 (0x1276c6800) [pid = 1722] [serial = 1951] [outer = 0x1276ad400] 04:05:00 INFO - 376 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_count.js 04:05:00 INFO - ++DOCSHELL 0x112cc8000 == 21 [pid = 1722] [id = 811] 04:05:00 INFO - ++DOMWINDOW == 53 (0x112673400) [pid = 1722] [serial = 1952] [outer = 0x0] 04:05:00 INFO - ++DOMWINDOW == 54 (0x1129be000) [pid = 1722] [serial = 1953] [outer = 0x112673400] 04:05:01 INFO - ++DOMWINDOW == 55 (0x11344c000) [pid = 1722] [serial = 1954] [outer = 0x112673400] 04:05:01 INFO - ++DOCSHELL 0x120ea2800 == 22 [pid = 1722] [id = 812] 04:05:01 INFO - ++DOMWINDOW == 56 (0x120d21c00) [pid = 1722] [serial = 1955] [outer = 0x0] 04:05:01 INFO - ++DOMWINDOW == 57 (0x120e26400) [pid = 1722] [serial = 1956] [outer = 0x120d21c00] 04:05:01 INFO - ++DOMWINDOW == 58 (0x121115800) [pid = 1722] [serial = 1957] [outer = 0x120d21c00] 04:05:01 INFO - ++DOCSHELL 0x1293ca000 == 23 [pid = 1722] [id = 813] 04:05:01 INFO - ++DOMWINDOW == 59 (0x126487800) [pid = 1722] [serial = 1958] [outer = 0x0] 04:05:01 INFO - ++DOMWINDOW == 60 (0x1264af000) [pid = 1722] [serial = 1959] [outer = 0x126487800] 04:05:03 INFO - --DOCSHELL 0x112ba8800 == 22 [pid = 1722] [id = 802] 04:05:03 INFO - --DOCSHELL 0x11f639000 == 21 [pid = 1722] [id = 803] 04:05:03 INFO - --DOCSHELL 0x1135a3800 == 20 [pid = 1722] [id = 804] 04:05:03 INFO - --DOCSHELL 0x12469f800 == 19 [pid = 1722] [id = 805] 04:05:03 INFO - --DOCSHELL 0x1128cb000 == 18 [pid = 1722] [id = 799] 04:05:03 INFO - --DOCSHELL 0x112b43800 == 17 [pid = 1722] [id = 798] 04:05:03 INFO - --DOCSHELL 0x112ba5000 == 16 [pid = 1722] [id = 806] 04:05:03 INFO - --DOCSHELL 0x128220000 == 15 [pid = 1722] [id = 807] 04:05:03 INFO - --DOCSHELL 0x124691000 == 14 [pid = 1722] [id = 808] 04:05:03 INFO - --DOCSHELL 0x124ac0000 == 13 [pid = 1722] [id = 809] 04:05:03 INFO - --DOCSHELL 0x1135ae000 == 12 [pid = 1722] [id = 800] 04:05:03 INFO - --DOCSHELL 0x1293ca000 == 11 [pid = 1722] [id = 813] 04:05:03 INFO - --DOMWINDOW == 59 (0x120fe6800) [pid = 1722] [serial = 1909] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:03 INFO - --DOMWINDOW == 58 (0x120e25000) [pid = 1722] [serial = 1918] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:03 INFO - --DOMWINDOW == 57 (0x1214b1000) [pid = 1722] [serial = 1920] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 56 (0x1225d6000) [pid = 1722] [serial = 1911] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 55 (0x12830d400) [pid = 1722] [serial = 1921] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-trace-async.html] 04:05:03 INFO - --DOMWINDOW == 54 (0x1214ab800) [pid = 1722] [serial = 1901] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 53 (0x120d25400) [pid = 1722] [serial = 1899] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:03 INFO - --DOMWINDOW == 52 (0x12110c000) [pid = 1722] [serial = 1922] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 51 (0x11288bc00) [pid = 1722] [serial = 1924] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_939783_console_trace_duplicates.html] 04:05:03 INFO - --DOMWINDOW == 50 (0x11344dc00) [pid = 1722] [serial = 1932] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 49 (0x11ee55800) [pid = 1722] [serial = 1934] [outer = 0x0] [url = data:text/html,<script>%20%20console.log("foo");%20%20console.log("foo",%20window);</script>] 04:05:03 INFO - --DOMWINDOW == 48 (0x120e2b400) [pid = 1722] [serial = 1941] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 47 (0x1266f6c00) [pid = 1722] [serial = 1946] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 46 (0x1266eac00) [pid = 1722] [serial = 1945] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:03 INFO - --DOMWINDOW == 45 (0x122ea8c00) [pid = 1722] [serial = 1939] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:03 INFO - --DOMWINDOW == 44 (0x1214ab400) [pid = 1722] [serial = 1942] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 43 (0x1247c8400) [pid = 1722] [serial = 1944] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 42 (0x122e99400) [pid = 1722] [serial = 1943] [outer = 0x0] [url = data:text/html,<script>%20%20window.bar%20=%20{%20baz:%201%20};%20%20console.log("foo");%20%20console.log("foo",%20window.bar);</script>] 04:05:03 INFO - --DOMWINDOW == 41 (0x126144800) [pid = 1722] [serial = 1948] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:03 INFO - --DOMWINDOW == 40 (0x11f70e000) [pid = 1722] [serial = 1936] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:03 INFO - --DOMWINDOW == 39 (0x1247c3000) [pid = 1722] [serial = 1929] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:03 INFO - --DOMWINDOW == 38 (0x112f42400) [pid = 1722] [serial = 1926] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:03 INFO - --DOMWINDOW == 37 (0x120e26400) [pid = 1722] [serial = 1956] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 36 (0x1129be000) [pid = 1722] [serial = 1953] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 35 (0x120e2b800) [pid = 1722] [serial = 1937] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 34 (0x12130dc00) [pid = 1722] [serial = 1923] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 33 (0x112c94400) [pid = 1722] [serial = 1925] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 32 (0x113e08400) [pid = 1722] [serial = 1933] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 31 (0x11f111400) [pid = 1722] [serial = 1935] [outer = 0x0] [url = about:blank] 04:05:03 INFO - --DOMWINDOW == 30 (0x129392400) [pid = 1722] [serial = 1931] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_939783_console_trace_duplicates.html] 04:05:04 INFO - MEMORY STAT | vsize 3456MB | residentFast 533MB | heapAllocated 122MB 04:05:04 INFO - 377 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_count.js | took 3094ms 04:05:04 INFO - ++DOCSHELL 0x112cd1800 == 12 [pid = 1722] [id = 814] 04:05:04 INFO - ++DOMWINDOW == 31 (0x112f45c00) [pid = 1722] [serial = 1960] [outer = 0x0] 04:05:04 INFO - ++DOMWINDOW == 32 (0x11318ac00) [pid = 1722] [serial = 1961] [outer = 0x112f45c00] 04:05:04 INFO - 378 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_dont_navigate_on_doubleclick.js 04:05:04 INFO - ++DOCSHELL 0x113e3e000 == 13 [pid = 1722] [id = 815] 04:05:04 INFO - ++DOMWINDOW == 33 (0x113d0ac00) [pid = 1722] [serial = 1962] [outer = 0x0] 04:05:04 INFO - ++DOMWINDOW == 34 (0x113e09400) [pid = 1722] [serial = 1963] [outer = 0x113d0ac00] 04:05:04 INFO - ++DOCSHELL 0x11351d800 == 14 [pid = 1722] [id = 816] 04:05:04 INFO - ++DOMWINDOW == 35 (0x114b23800) [pid = 1722] [serial = 1964] [outer = 0x0] 04:05:04 INFO - ++DOMWINDOW == 36 (0x11ebb8400) [pid = 1722] [serial = 1965] [outer = 0x114b23800] 04:05:04 INFO - ++DOMWINDOW == 37 (0x120e24c00) [pid = 1722] [serial = 1966] [outer = 0x114b23800] 04:05:04 INFO - ++DOCSHELL 0x120ead800 == 15 [pid = 1722] [id = 817] 04:05:04 INFO - ++DOMWINDOW == 38 (0x1214aa800) [pid = 1722] [serial = 1967] [outer = 0x0] 04:05:04 INFO - ++DOMWINDOW == 39 (0x1214b1000) [pid = 1722] [serial = 1968] [outer = 0x1214aa800] 04:05:05 INFO - ++DOMWINDOW == 40 (0x1296cd400) [pid = 1722] [serial = 1969] [outer = 0x113d0ac00] 04:05:05 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:06 INFO - --DOCSHELL 0x120ead800 == 14 [pid = 1722] [id = 817] 04:05:06 INFO - --DOCSHELL 0x129667800 == 13 [pid = 1722] [id = 810] 04:05:06 INFO - --DOCSHELL 0x112cc8000 == 12 [pid = 1722] [id = 811] 04:05:06 INFO - --DOCSHELL 0x120ea2800 == 11 [pid = 1722] [id = 812] 04:05:06 INFO - --DOMWINDOW == 39 (0x1247c9400) [pid = 1722] [serial = 1930] [outer = 0x0] [url = about:blank] 04:05:06 INFO - --DOMWINDOW == 38 (0x120fe4800) [pid = 1722] [serial = 1928] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:06 INFO - --DOMWINDOW == 37 (0x128273000) [pid = 1722] [serial = 1949] [outer = 0x0] [url = about:blank] 04:05:06 INFO - --DOMWINDOW == 36 (0x127329400) [pid = 1722] [serial = 1947] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:06 INFO - --DOMWINDOW == 35 (0x12434a000) [pid = 1722] [serial = 1940] [outer = 0x0] [url = about:blank] 04:05:06 INFO - --DOMWINDOW == 34 (0x120ffd800) [pid = 1722] [serial = 1938] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:06 INFO - --DOMWINDOW == 33 (0x1276ad400) [pid = 1722] [serial = 1950] [outer = 0x0] [url = about:blank] 04:05:06 INFO - --DOMWINDOW == 32 (0x11ebb8400) [pid = 1722] [serial = 1965] [outer = 0x0] [url = about:blank] 04:05:06 INFO - --DOMWINDOW == 31 (0x1276c6800) [pid = 1722] [serial = 1951] [outer = 0x0] [url = about:blank] 04:05:06 INFO - --DOMWINDOW == 30 (0x126487800) [pid = 1722] [serial = 1958] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:06 INFO - --DOMWINDOW == 29 (0x120d21c00) [pid = 1722] [serial = 1955] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:06 INFO - --DOMWINDOW == 28 (0x112673400) [pid = 1722] [serial = 1952] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-count.html] 04:05:06 INFO - MEMORY STAT | vsize 3459MB | residentFast 533MB | heapAllocated 123MB 04:05:06 INFO - 379 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_dont_navigate_on_doubleclick.js | took 2492ms 04:05:06 INFO - ++DOCSHELL 0x11295a000 == 12 [pid = 1722] [id = 818] 04:05:06 INFO - ++DOMWINDOW == 29 (0x113d1d400) [pid = 1722] [serial = 1970] [outer = 0x0] 04:05:06 INFO - ++DOMWINDOW == 30 (0x114bfb400) [pid = 1722] [serial = 1971] [outer = 0x113d1d400] 04:05:06 INFO - 380 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_exception_stackframe.js 04:05:06 INFO - ++DOCSHELL 0x11efc2800 == 13 [pid = 1722] [id = 819] 04:05:06 INFO - ++DOMWINDOW == 31 (0x11344c800) [pid = 1722] [serial = 1972] [outer = 0x0] 04:05:06 INFO - ++DOMWINDOW == 32 (0x11ebba400) [pid = 1722] [serial = 1973] [outer = 0x11344c800] 04:05:06 INFO - ++DOMWINDOW == 33 (0x1202e4400) [pid = 1722] [serial = 1974] [outer = 0x11344c800] 04:05:07 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html, line 21: ReferenceError: nonExistingMethodCall is not defined 04:05:07 INFO - ++DOCSHELL 0x112ccc800 == 14 [pid = 1722] [id = 820] 04:05:07 INFO - ++DOMWINDOW == 34 (0x120fe4c00) [pid = 1722] [serial = 1975] [outer = 0x0] 04:05:07 INFO - ++DOMWINDOW == 35 (0x120fe6400) [pid = 1722] [serial = 1976] [outer = 0x120fe4c00] 04:05:07 INFO - ++DOMWINDOW == 36 (0x120ffc000) [pid = 1722] [serial = 1977] [outer = 0x120fe4c00] 04:05:07 INFO - ++DOCSHELL 0x124883800 == 15 [pid = 1722] [id = 821] 04:05:07 INFO - ++DOMWINDOW == 37 (0x1225e1400) [pid = 1722] [serial = 1978] [outer = 0x0] 04:05:07 INFO - ++DOMWINDOW == 38 (0x122e99400) [pid = 1722] [serial = 1979] [outer = 0x1225e1400] 04:05:08 INFO - --DOCSHELL 0x112cd1800 == 14 [pid = 1722] [id = 814] 04:05:08 INFO - --DOCSHELL 0x124883800 == 13 [pid = 1722] [id = 821] 04:05:08 INFO - --DOCSHELL 0x113e3e000 == 12 [pid = 1722] [id = 815] 04:05:08 INFO - --DOCSHELL 0x11351d800 == 11 [pid = 1722] [id = 816] 04:05:08 INFO - --DOMWINDOW == 37 (0x1264af000) [pid = 1722] [serial = 1959] [outer = 0x0] [url = about:blank] 04:05:08 INFO - --DOMWINDOW == 36 (0x121115800) [pid = 1722] [serial = 1957] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:08 INFO - --DOMWINDOW == 35 (0x11344c000) [pid = 1722] [serial = 1954] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-count.html] 04:05:08 INFO - --DOMWINDOW == 34 (0x120fe6400) [pid = 1722] [serial = 1976] [outer = 0x0] [url = about:blank] 04:05:08 INFO - --DOMWINDOW == 33 (0x11ebba400) [pid = 1722] [serial = 1973] [outer = 0x0] [url = about:blank] 04:05:08 INFO - --DOMWINDOW == 32 (0x113e09400) [pid = 1722] [serial = 1963] [outer = 0x0] [url = about:blank] 04:05:08 INFO - --DOMWINDOW == 31 (0x11318ac00) [pid = 1722] [serial = 1961] [outer = 0x0] [url = about:blank] 04:05:08 INFO - --DOMWINDOW == 30 (0x1214aa800) [pid = 1722] [serial = 1967] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:08 INFO - --DOMWINDOW == 29 (0x114b23800) [pid = 1722] [serial = 1964] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:08 INFO - --DOMWINDOW == 28 (0x113d0ac00) [pid = 1722] [serial = 1962] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_uniq=1446552304160] 04:05:08 INFO - --DOMWINDOW == 27 (0x112f45c00) [pid = 1722] [serial = 1960] [outer = 0x0] [url = about:blank] 04:05:08 INFO - --DOMWINDOW == 26 (0x1296cd400) [pid = 1722] [serial = 1969] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_uniq=1446552304160] 04:05:08 INFO - MEMORY STAT | vsize 3458MB | residentFast 533MB | heapAllocated 122MB 04:05:08 INFO - 381 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_exception_stackframe.js | took 2231ms 04:05:09 INFO - ++DOCSHELL 0x11268a800 == 12 [pid = 1722] [id = 822] 04:05:09 INFO - ++DOMWINDOW == 27 (0x112f45c00) [pid = 1722] [serial = 1980] [outer = 0x0] 04:05:09 INFO - ++DOMWINDOW == 28 (0x113163c00) [pid = 1722] [serial = 1981] [outer = 0x112f45c00] 04:05:09 INFO - 382 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_execution_scope.js 04:05:09 INFO - ++DOCSHELL 0x113511000 == 13 [pid = 1722] [id = 823] 04:05:09 INFO - ++DOMWINDOW == 29 (0x113450000) [pid = 1722] [serial = 1982] [outer = 0x0] 04:05:09 INFO - ++DOMWINDOW == 30 (0x113e05800) [pid = 1722] [serial = 1983] [outer = 0x113450000] 04:05:09 INFO - ++DOMWINDOW == 31 (0x1223e6400) [pid = 1722] [serial = 1984] [outer = 0x113450000] 04:05:09 INFO - ++DOCSHELL 0x112cbb800 == 14 [pid = 1722] [id = 824] 04:05:09 INFO - ++DOMWINDOW == 32 (0x1202e4000) [pid = 1722] [serial = 1985] [outer = 0x0] 04:05:09 INFO - ++DOMWINDOW == 33 (0x1203de800) [pid = 1722] [serial = 1986] [outer = 0x1202e4000] 04:05:09 INFO - ++DOMWINDOW == 34 (0x120e32c00) [pid = 1722] [serial = 1987] [outer = 0x1202e4000] 04:05:09 INFO - ++DOCSHELL 0x122183000 == 15 [pid = 1722] [id = 825] 04:05:09 INFO - ++DOMWINDOW == 35 (0x1214b4800) [pid = 1722] [serial = 1988] [outer = 0x0] 04:05:09 INFO - ++DOMWINDOW == 36 (0x12232a400) [pid = 1722] [serial = 1989] [outer = 0x1214b4800] 04:05:11 INFO - --DOCSHELL 0x11295a000 == 14 [pid = 1722] [id = 818] 04:05:11 INFO - --DOCSHELL 0x11efc2800 == 13 [pid = 1722] [id = 819] 04:05:11 INFO - --DOCSHELL 0x122183000 == 12 [pid = 1722] [id = 825] 04:05:11 INFO - --DOCSHELL 0x112ccc800 == 11 [pid = 1722] [id = 820] 04:05:11 INFO - --DOMWINDOW == 35 (0x1214b1000) [pid = 1722] [serial = 1968] [outer = 0x0] [url = about:blank] 04:05:11 INFO - --DOMWINDOW == 34 (0x120e24c00) [pid = 1722] [serial = 1966] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:11 INFO - --DOMWINDOW == 33 (0x1203de800) [pid = 1722] [serial = 1986] [outer = 0x0] [url = about:blank] 04:05:11 INFO - --DOMWINDOW == 32 (0x113e05800) [pid = 1722] [serial = 1983] [outer = 0x0] [url = about:blank] 04:05:11 INFO - --DOMWINDOW == 31 (0x114bfb400) [pid = 1722] [serial = 1971] [outer = 0x0] [url = about:blank] 04:05:11 INFO - --DOMWINDOW == 30 (0x1225e1400) [pid = 1722] [serial = 1978] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:11 INFO - --DOMWINDOW == 29 (0x120fe4c00) [pid = 1722] [serial = 1975] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:11 INFO - --DOMWINDOW == 28 (0x11344c800) [pid = 1722] [serial = 1972] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html] 04:05:11 INFO - --DOMWINDOW == 27 (0x113d1d400) [pid = 1722] [serial = 1970] [outer = 0x0] [url = about:blank] 04:05:11 INFO - --DOMWINDOW == 26 (0x1202e4400) [pid = 1722] [serial = 1974] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html] 04:05:11 INFO - MEMORY STAT | vsize 3458MB | residentFast 533MB | heapAllocated 122MB 04:05:11 INFO - 383 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_execution_scope.js | took 2262ms 04:05:11 INFO - ++DOCSHELL 0x112cc8000 == 12 [pid = 1722] [id = 826] 04:05:11 INFO - ++DOMWINDOW == 27 (0x112f48400) [pid = 1722] [serial = 1990] [outer = 0x0] 04:05:11 INFO - ++DOMWINDOW == 28 (0x113394800) [pid = 1722] [serial = 1991] [outer = 0x112f48400] 04:05:11 INFO - 384 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_expandable_timestamps.js 04:05:11 INFO - ++DOCSHELL 0x114b7b800 == 13 [pid = 1722] [id = 827] 04:05:11 INFO - ++DOMWINDOW == 29 (0x113d1d400) [pid = 1722] [serial = 1992] [outer = 0x0] 04:05:11 INFO - ++DOMWINDOW == 30 (0x114bf1800) [pid = 1722] [serial = 1993] [outer = 0x113d1d400] 04:05:11 INFO - ++DOCSHELL 0x1140bd800 == 14 [pid = 1722] [id = 828] 04:05:11 INFO - ++DOMWINDOW == 31 (0x114dbc800) [pid = 1722] [serial = 1994] [outer = 0x0] 04:05:11 INFO - ++DOMWINDOW == 32 (0x1202ed000) [pid = 1722] [serial = 1995] [outer = 0x114dbc800] 04:05:11 INFO - ++DOMWINDOW == 33 (0x120fe0400) [pid = 1722] [serial = 1996] [outer = 0x114dbc800] 04:05:11 INFO - ++DOCSHELL 0x121880800 == 15 [pid = 1722] [id = 829] 04:05:11 INFO - ++DOMWINDOW == 34 (0x121811400) [pid = 1722] [serial = 1997] [outer = 0x0] 04:05:11 INFO - ++DOMWINDOW == 35 (0x122336c00) [pid = 1722] [serial = 1998] [outer = 0x121811400] 04:05:12 INFO - ++DOCSHELL 0x124ac4800 == 16 [pid = 1722] [id = 830] 04:05:12 INFO - ++DOMWINDOW == 36 (0x122e9b800) [pid = 1722] [serial = 1999] [outer = 0x0] 04:05:12 INFO - ++DOMWINDOW == 37 (0x122ea1000) [pid = 1722] [serial = 2000] [outer = 0x122e9b800] 04:05:13 INFO - Handler function threw an exception: TypeError: this.disableJSNode is null 04:05:13 INFO - Stack: OptionsPanel.prototype.populatePreferences/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox-options.js:320:9 04:05:13 INFO - DebuggerClient.prototype.attachTab/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:433:39 04:05:13 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 04:05:13 INFO - Line: 320, column: 9 04:05:13 INFO - --DOCSHELL 0x113511000 == 15 [pid = 1722] [id = 823] 04:05:13 INFO - --DOCSHELL 0x112cbb800 == 14 [pid = 1722] [id = 824] 04:05:13 INFO - --DOCSHELL 0x121880800 == 13 [pid = 1722] [id = 829] 04:05:13 INFO - --DOCSHELL 0x11268a800 == 12 [pid = 1722] [id = 822] 04:05:13 INFO - --DOCSHELL 0x124ac4800 == 11 [pid = 1722] [id = 830] 04:05:13 INFO - --DOMWINDOW == 36 (0x122e99400) [pid = 1722] [serial = 1979] [outer = 0x0] [url = about:blank] 04:05:13 INFO - --DOMWINDOW == 35 (0x120ffc000) [pid = 1722] [serial = 1977] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:13 INFO - --DOMWINDOW == 34 (0x113163c00) [pid = 1722] [serial = 1981] [outer = 0x0] [url = about:blank] 04:05:13 INFO - --DOMWINDOW == 33 (0x1202ed000) [pid = 1722] [serial = 1995] [outer = 0x0] [url = about:blank] 04:05:13 INFO - --DOMWINDOW == 32 (0x1202e4000) [pid = 1722] [serial = 1985] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:13 INFO - --DOMWINDOW == 31 (0x1214b4800) [pid = 1722] [serial = 1988] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:13 INFO - --DOMWINDOW == 30 (0x113450000) [pid = 1722] [serial = 1982] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:13 INFO - --DOMWINDOW == 29 (0x112f45c00) [pid = 1722] [serial = 1980] [outer = 0x0] [url = about:blank] 04:05:13 INFO - --DOMWINDOW == 28 (0x1223e6400) [pid = 1722] [serial = 1984] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:13 INFO - MEMORY STAT | vsize 3457MB | residentFast 532MB | heapAllocated 122MB 04:05:13 INFO - 385 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_expandable_timestamps.js | took 2345ms 04:05:13 INFO - ++DOCSHELL 0x112ba8800 == 12 [pid = 1722] [id = 831] 04:05:13 INFO - ++DOMWINDOW == 29 (0x112c97c00) [pid = 1722] [serial = 2001] [outer = 0x0] 04:05:13 INFO - ++DOMWINDOW == 30 (0x112f45c00) [pid = 1722] [serial = 2002] [outer = 0x112c97c00] 04:05:13 INFO - 386 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_filter_buttons_contextmenu.js 04:05:13 INFO - ++DOCSHELL 0x11e81c800 == 13 [pid = 1722] [id = 832] 04:05:13 INFO - ++DOMWINDOW == 31 (0x113450000) [pid = 1722] [serial = 2003] [outer = 0x0] 04:05:13 INFO - ++DOMWINDOW == 32 (0x113e05800) [pid = 1722] [serial = 2004] [outer = 0x113450000] 04:05:14 INFO - ++DOMWINDOW == 33 (0x11ebba400) [pid = 1722] [serial = 2005] [outer = 0x113450000] 04:05:14 INFO - ++DOCSHELL 0x11efd3000 == 14 [pid = 1722] [id = 833] 04:05:14 INFO - ++DOMWINDOW == 34 (0x1203df800) [pid = 1722] [serial = 2006] [outer = 0x0] 04:05:14 INFO - ++DOMWINDOW == 35 (0x120d16400) [pid = 1722] [serial = 2007] [outer = 0x1203df800] 04:05:14 INFO - ++DOMWINDOW == 36 (0x120e2b800) [pid = 1722] [serial = 2008] [outer = 0x1203df800] 04:05:14 INFO - ++DOCSHELL 0x12469d800 == 15 [pid = 1722] [id = 834] 04:05:14 INFO - ++DOMWINDOW == 37 (0x12232fc00) [pid = 1722] [serial = 2009] [outer = 0x0] 04:05:14 INFO - ++DOMWINDOW == 38 (0x1225d6800) [pid = 1722] [serial = 2010] [outer = 0x12232fc00] 04:05:16 INFO - --DOCSHELL 0x1140bd800 == 14 [pid = 1722] [id = 828] 04:05:16 INFO - --DOCSHELL 0x12469d800 == 13 [pid = 1722] [id = 834] 04:05:16 INFO - --DOCSHELL 0x112cc8000 == 12 [pid = 1722] [id = 826] 04:05:16 INFO - --DOCSHELL 0x114b7b800 == 11 [pid = 1722] [id = 827] 04:05:16 INFO - --DOMWINDOW == 37 (0x12232a400) [pid = 1722] [serial = 1989] [outer = 0x0] [url = about:blank] 04:05:16 INFO - --DOMWINDOW == 36 (0x120e32c00) [pid = 1722] [serial = 1987] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:16 INFO - --DOMWINDOW == 35 (0x113e05800) [pid = 1722] [serial = 2004] [outer = 0x0] [url = about:blank] 04:05:16 INFO - --DOMWINDOW == 34 (0x114bf1800) [pid = 1722] [serial = 1993] [outer = 0x0] [url = about:blank] 04:05:16 INFO - --DOMWINDOW == 33 (0x113394800) [pid = 1722] [serial = 1991] [outer = 0x0] [url = about:blank] 04:05:16 INFO - --DOMWINDOW == 32 (0x120d16400) [pid = 1722] [serial = 2007] [outer = 0x0] [url = about:blank] 04:05:16 INFO - --DOMWINDOW == 31 (0x122e9b800) [pid = 1722] [serial = 1999] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox-options.xul] 04:05:16 INFO - --DOMWINDOW == 30 (0x114dbc800) [pid = 1722] [serial = 1994] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:16 INFO - --DOMWINDOW == 29 (0x121811400) [pid = 1722] [serial = 1997] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:16 INFO - --DOMWINDOW == 28 (0x113d1d400) [pid = 1722] [serial = 1992] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20722267%20-%20preference%20for%20toggling%20timestamps%20in%20messages] 04:05:16 INFO - --DOMWINDOW == 27 (0x112f48400) [pid = 1722] [serial = 1990] [outer = 0x0] [url = about:blank] 04:05:16 INFO - MEMORY STAT | vsize 3458MB | residentFast 532MB | heapAllocated 123MB 04:05:16 INFO - 387 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_filter_buttons_contextmenu.js | took 2727ms 04:05:16 INFO - ++DOCSHELL 0x112cbd000 == 12 [pid = 1722] [id = 835] 04:05:16 INFO - ++DOMWINDOW == 28 (0x112f41000) [pid = 1722] [serial = 2011] [outer = 0x0] 04:05:16 INFO - ++DOMWINDOW == 29 (0x113394800) [pid = 1722] [serial = 2012] [outer = 0x112f41000] 04:05:16 INFO - 388 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_for_of.js 04:05:16 INFO - ++DOCSHELL 0x1140bd800 == 13 [pid = 1722] [id = 836] 04:05:16 INFO - ++DOMWINDOW == 30 (0x113d10400) [pid = 1722] [serial = 2013] [outer = 0x0] 04:05:16 INFO - ++DOMWINDOW == 31 (0x114b5a800) [pid = 1722] [serial = 2014] [outer = 0x113d10400] 04:05:16 INFO - ++DOMWINDOW == 32 (0x11eefbc00) [pid = 1722] [serial = 2015] [outer = 0x113d10400] 04:05:17 INFO - ++DOCSHELL 0x11268a800 == 14 [pid = 1722] [id = 837] 04:05:17 INFO - ++DOMWINDOW == 33 (0x1203e1000) [pid = 1722] [serial = 2016] [outer = 0x0] 04:05:17 INFO - ++DOMWINDOW == 34 (0x120d1e000) [pid = 1722] [serial = 2017] [outer = 0x1203e1000] 04:05:17 INFO - ++DOMWINDOW == 35 (0x120e32c00) [pid = 1722] [serial = 2018] [outer = 0x1203e1000] 04:05:17 INFO - ++DOCSHELL 0x124867000 == 15 [pid = 1722] [id = 838] 04:05:17 INFO - ++DOMWINDOW == 36 (0x12211a400) [pid = 1722] [serial = 2019] [outer = 0x0] 04:05:17 INFO - ++DOMWINDOW == 37 (0x122336400) [pid = 1722] [serial = 2020] [outer = 0x12211a400] 04:05:18 INFO - --DOCSHELL 0x11e81c800 == 14 [pid = 1722] [id = 832] 04:05:18 INFO - --DOCSHELL 0x11efd3000 == 13 [pid = 1722] [id = 833] 04:05:18 INFO - --DOCSHELL 0x124867000 == 12 [pid = 1722] [id = 838] 04:05:18 INFO - --DOCSHELL 0x112ba8800 == 11 [pid = 1722] [id = 831] 04:05:18 INFO - --DOMWINDOW == 36 (0x122ea1000) [pid = 1722] [serial = 2000] [outer = 0x0] [url = about:blank] 04:05:18 INFO - --DOMWINDOW == 35 (0x122336c00) [pid = 1722] [serial = 1998] [outer = 0x0] [url = about:blank] 04:05:18 INFO - --DOMWINDOW == 34 (0x120fe0400) [pid = 1722] [serial = 1996] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:18 INFO - --DOMWINDOW == 33 (0x11ebba400) [pid = 1722] [serial = 2005] [outer = 0x0] [url = http://example.com/] 04:05:18 INFO - --DOMWINDOW == 32 (0x112f45c00) [pid = 1722] [serial = 2002] [outer = 0x0] [url = about:blank] 04:05:18 INFO - --DOMWINDOW == 31 (0x114b5a800) [pid = 1722] [serial = 2014] [outer = 0x0] [url = about:blank] 04:05:18 INFO - --DOMWINDOW == 30 (0x120d1e000) [pid = 1722] [serial = 2017] [outer = 0x0] [url = about:blank] 04:05:18 INFO - --DOMWINDOW == 29 (0x12232fc00) [pid = 1722] [serial = 2009] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:18 INFO - --DOMWINDOW == 28 (0x1203df800) [pid = 1722] [serial = 2006] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:18 INFO - --DOMWINDOW == 27 (0x113450000) [pid = 1722] [serial = 2003] [outer = 0x0] [url = http://example.com/] 04:05:18 INFO - --DOMWINDOW == 26 (0x112c97c00) [pid = 1722] [serial = 2001] [outer = 0x0] [url = about:blank] 04:05:19 INFO - MEMORY STAT | vsize 3458MB | residentFast 533MB | heapAllocated 122MB 04:05:19 INFO - 389 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_for_of.js | took 2213ms 04:05:19 INFO - ++DOCSHELL 0x112ba2800 == 12 [pid = 1722] [id = 839] 04:05:19 INFO - ++DOMWINDOW == 27 (0x112f45c00) [pid = 1722] [serial = 2021] [outer = 0x0] 04:05:19 INFO - ++DOMWINDOW == 28 (0x113163c00) [pid = 1722] [serial = 2022] [outer = 0x112f45c00] 04:05:19 INFO - 390 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_history.js 04:05:19 INFO - ++DOCSHELL 0x11e35b000 == 13 [pid = 1722] [id = 840] 04:05:19 INFO - ++DOMWINDOW == 29 (0x113e03c00) [pid = 1722] [serial = 2023] [outer = 0x0] 04:05:19 INFO - ++DOMWINDOW == 30 (0x114dbc800) [pid = 1722] [serial = 2024] [outer = 0x113e03c00] 04:05:19 INFO - ++DOMWINDOW == 31 (0x122334000) [pid = 1722] [serial = 2025] [outer = 0x113e03c00] 04:05:19 INFO - ++DOCSHELL 0x1135af000 == 14 [pid = 1722] [id = 841] 04:05:19 INFO - ++DOMWINDOW == 32 (0x1202ed000) [pid = 1722] [serial = 2026] [outer = 0x0] 04:05:19 INFO - ++DOMWINDOW == 33 (0x1203dd800) [pid = 1722] [serial = 2027] [outer = 0x1202ed000] 04:05:19 INFO - ++DOMWINDOW == 34 (0x120fe5c00) [pid = 1722] [serial = 2028] [outer = 0x1202ed000] 04:05:19 INFO - ++DOCSHELL 0x124ac8800 == 15 [pid = 1722] [id = 842] 04:05:19 INFO - ++DOMWINDOW == 35 (0x12232fc00) [pid = 1722] [serial = 2029] [outer = 0x0] 04:05:19 INFO - ++DOMWINDOW == 36 (0x1225e1400) [pid = 1722] [serial = 2030] [outer = 0x12232fc00] 04:05:21 INFO - --DOCSHELL 0x1140bd800 == 14 [pid = 1722] [id = 836] 04:05:21 INFO - --DOCSHELL 0x112cbd000 == 13 [pid = 1722] [id = 835] 04:05:21 INFO - --DOCSHELL 0x124ac8800 == 12 [pid = 1722] [id = 842] 04:05:21 INFO - --DOCSHELL 0x11268a800 == 11 [pid = 1722] [id = 837] 04:05:21 INFO - --DOMWINDOW == 35 (0x1225d6800) [pid = 1722] [serial = 2010] [outer = 0x0] [url = about:blank] 04:05:21 INFO - --DOMWINDOW == 34 (0x120e2b800) [pid = 1722] [serial = 2008] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:21 INFO - --DOMWINDOW == 33 (0x1203e1000) [pid = 1722] [serial = 2016] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:21 INFO - --DOMWINDOW == 32 (0x114dbc800) [pid = 1722] [serial = 2024] [outer = 0x0] [url = about:blank] 04:05:21 INFO - --DOMWINDOW == 31 (0x113394800) [pid = 1722] [serial = 2012] [outer = 0x0] [url = about:blank] 04:05:21 INFO - --DOMWINDOW == 30 (0x1203dd800) [pid = 1722] [serial = 2027] [outer = 0x0] [url = about:blank] 04:05:21 INFO - --DOMWINDOW == 29 (0x12211a400) [pid = 1722] [serial = 2019] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:21 INFO - --DOMWINDOW == 28 (0x113d10400) [pid = 1722] [serial = 2013] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-for-of.html] 04:05:21 INFO - --DOMWINDOW == 27 (0x112f41000) [pid = 1722] [serial = 2011] [outer = 0x0] [url = about:blank] 04:05:21 INFO - --DOMWINDOW == 26 (0x11eefbc00) [pid = 1722] [serial = 2015] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-for-of.html] 04:05:21 INFO - MEMORY STAT | vsize 3458MB | residentFast 533MB | heapAllocated 123MB 04:05:21 INFO - 391 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_history.js | took 2491ms 04:05:21 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 843] 04:05:21 INFO - ++DOMWINDOW == 27 (0x112f45000) [pid = 1722] [serial = 2031] [outer = 0x0] 04:05:21 INFO - ++DOMWINDOW == 28 (0x1132e9c00) [pid = 1722] [serial = 2032] [outer = 0x112f45000] 04:05:21 INFO - 392 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_hpkp_invalid-headers.js 04:05:21 INFO - ++DOCSHELL 0x11efd5000 == 13 [pid = 1722] [id = 844] 04:05:21 INFO - ++DOMWINDOW == 29 (0x113d1d000) [pid = 1722] [serial = 2033] [outer = 0x0] 04:05:21 INFO - ++DOMWINDOW == 30 (0x114dbc800) [pid = 1722] [serial = 2034] [outer = 0x113d1d000] 04:05:21 INFO - ++DOCSHELL 0x112ccc800 == 14 [pid = 1722] [id = 845] 04:05:21 INFO - ++DOMWINDOW == 31 (0x11d465400) [pid = 1722] [serial = 2035] [outer = 0x0] 04:05:21 INFO - ++DOMWINDOW == 32 (0x12025b400) [pid = 1722] [serial = 2036] [outer = 0x11d465400] 04:05:22 INFO - ++DOMWINDOW == 33 (0x120e26400) [pid = 1722] [serial = 2037] [outer = 0x11d465400] 04:05:22 INFO - ++DOCSHELL 0x124864800 == 15 [pid = 1722] [id = 846] 04:05:22 INFO - ++DOMWINDOW == 34 (0x1214b1000) [pid = 1722] [serial = 2038] [outer = 0x0] 04:05:22 INFO - ++DOMWINDOW == 35 (0x122124800) [pid = 1722] [serial = 2039] [outer = 0x1214b1000] 04:05:23 INFO - ++DOMWINDOW == 36 (0x128383400) [pid = 1722] [serial = 2040] [outer = 0x113d1d000] 04:05:23 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:23 INFO - ++DOMWINDOW == 37 (0x1283f3400) [pid = 1722] [serial = 2041] [outer = 0x113d1d000] 04:05:23 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:23 INFO - ++DOMWINDOW == 38 (0x129392800) [pid = 1722] [serial = 2042] [outer = 0x113d1d000] 04:05:23 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:23 INFO - ++DOMWINDOW == 39 (0x1296d7c00) [pid = 1722] [serial = 2043] [outer = 0x113d1d000] 04:05:23 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:24 INFO - ++DOMWINDOW == 40 (0x12c36c000) [pid = 1722] [serial = 2044] [outer = 0x113d1d000] 04:05:24 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:24 INFO - ++DOMWINDOW == 41 (0x12d406800) [pid = 1722] [serial = 2045] [outer = 0x113d1d000] 04:05:24 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:24 INFO - ++DOMWINDOW == 42 (0x12e062c00) [pid = 1722] [serial = 2046] [outer = 0x113d1d000] 04:05:24 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:25 INFO - ++DOMWINDOW == 43 (0x12ee0f400) [pid = 1722] [serial = 2047] [outer = 0x113d1d000] 04:05:25 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:25 INFO - ++DOMWINDOW == 44 (0x112916400) [pid = 1722] [serial = 2048] [outer = 0x113d1d000] 04:05:25 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:26 INFO - --DOCSHELL 0x11e35b000 == 14 [pid = 1722] [id = 840] 04:05:26 INFO - --DOCSHELL 0x112ba2800 == 13 [pid = 1722] [id = 839] 04:05:26 INFO - --DOCSHELL 0x1135af000 == 12 [pid = 1722] [id = 841] 04:05:26 INFO - --DOCSHELL 0x112ccc800 == 11 [pid = 1722] [id = 845] 04:05:26 INFO - --DOCSHELL 0x124864800 == 10 [pid = 1722] [id = 846] 04:05:26 INFO - --DOMWINDOW == 43 (0x120e32c00) [pid = 1722] [serial = 2018] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:26 INFO - --DOMWINDOW == 42 (0x122336400) [pid = 1722] [serial = 2020] [outer = 0x0] [url = about:blank] 04:05:26 INFO - --DOMWINDOW == 41 (0x1202ed000) [pid = 1722] [serial = 2026] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:26 INFO - --DOMWINDOW == 40 (0x113163c00) [pid = 1722] [serial = 2022] [outer = 0x0] [url = about:blank] 04:05:26 INFO - --DOMWINDOW == 39 (0x114dbc800) [pid = 1722] [serial = 2034] [outer = 0x0] [url = about:blank] 04:05:26 INFO - --DOMWINDOW == 38 (0x128383400) [pid = 1722] [serial = 2040] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?badSyntax] 04:05:26 INFO - --DOMWINDOW == 37 (0x1283f3400) [pid = 1722] [serial = 2041] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?noMaxAge] 04:05:26 INFO - --DOMWINDOW == 36 (0x129392800) [pid = 1722] [serial = 2042] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?invalidIncludeSubDomains] 04:05:26 INFO - --DOMWINDOW == 35 (0x1296d7c00) [pid = 1722] [serial = 2043] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?invalidMaxAge] 04:05:26 INFO - --DOMWINDOW == 34 (0x12c36c000) [pid = 1722] [serial = 2044] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleIncludeSubDomains] 04:05:26 INFO - --DOMWINDOW == 33 (0x12025b400) [pid = 1722] [serial = 2036] [outer = 0x0] [url = about:blank] 04:05:26 INFO - --DOMWINDOW == 32 (0x12ee0f400) [pid = 1722] [serial = 2047] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch] 04:05:26 INFO - --DOMWINDOW == 31 (0x12d406800) [pid = 1722] [serial = 2045] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleMaxAge] 04:05:26 INFO - --DOMWINDOW == 30 (0x12e062c00) [pid = 1722] [serial = 2046] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleReportURIs] 04:05:26 INFO - --DOMWINDOW == 29 (0x12232fc00) [pid = 1722] [serial = 2029] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:26 INFO - --DOMWINDOW == 28 (0x112f45c00) [pid = 1722] [serial = 2021] [outer = 0x0] [url = about:blank] 04:05:26 INFO - --DOMWINDOW == 27 (0x113e03c00) [pid = 1722] [serial = 2023] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:26 INFO - --DOMWINDOW == 26 (0x122334000) [pid = 1722] [serial = 2025] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:26 INFO - MEMORY STAT | vsize 3454MB | residentFast 528MB | heapAllocated 123MB 04:05:26 INFO - 393 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_hpkp_invalid-headers.js | took 5136ms 04:05:26 INFO - ++DOCSHELL 0x112ba5800 == 11 [pid = 1722] [id = 847] 04:05:26 INFO - ++DOMWINDOW == 27 (0x113448800) [pid = 1722] [serial = 2049] [outer = 0x0] 04:05:26 INFO - ++DOMWINDOW == 28 (0x11344f000) [pid = 1722] [serial = 2050] [outer = 0x113448800] 04:05:27 INFO - 394 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_hsts_invalid-headers.js 04:05:27 INFO - ++DOCSHELL 0x11efca800 == 12 [pid = 1722] [id = 848] 04:05:27 INFO - ++DOMWINDOW == 29 (0x11e78a800) [pid = 1722] [serial = 2051] [outer = 0x0] 04:05:27 INFO - ++DOMWINDOW == 30 (0x11ebb6800) [pid = 1722] [serial = 2052] [outer = 0x11e78a800] 04:05:27 INFO - ++DOCSHELL 0x11295a000 == 13 [pid = 1722] [id = 849] 04:05:27 INFO - ++DOMWINDOW == 31 (0x11ebbf400) [pid = 1722] [serial = 2053] [outer = 0x0] 04:05:27 INFO - ++DOMWINDOW == 32 (0x1203dd800) [pid = 1722] [serial = 2054] [outer = 0x11ebbf400] 04:05:27 INFO - ++DOMWINDOW == 33 (0x120e32000) [pid = 1722] [serial = 2055] [outer = 0x11ebbf400] 04:05:27 INFO - ++DOCSHELL 0x124691000 == 14 [pid = 1722] [id = 850] 04:05:27 INFO - ++DOMWINDOW == 34 (0x1214ab400) [pid = 1722] [serial = 2056] [outer = 0x0] 04:05:27 INFO - ++DOMWINDOW == 35 (0x1214b1400) [pid = 1722] [serial = 2057] [outer = 0x1214ab400] 04:05:28 INFO - ++DOMWINDOW == 36 (0x1283eac00) [pid = 1722] [serial = 2058] [outer = 0x11e78a800] 04:05:28 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:28 INFO - ++DOMWINDOW == 37 (0x128386400) [pid = 1722] [serial = 2059] [outer = 0x11e78a800] 04:05:28 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:28 INFO - ++DOMWINDOW == 38 (0x1283f5000) [pid = 1722] [serial = 2060] [outer = 0x11e78a800] 04:05:28 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:29 INFO - ++DOMWINDOW == 39 (0x1296ce400) [pid = 1722] [serial = 2061] [outer = 0x11e78a800] 04:05:29 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:29 INFO - ++DOMWINDOW == 40 (0x129d11000) [pid = 1722] [serial = 2062] [outer = 0x11e78a800] 04:05:29 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:29 INFO - ++DOMWINDOW == 41 (0x12c4e0000) [pid = 1722] [serial = 2063] [outer = 0x11e78a800] 04:05:29 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:30 INFO - --DOCSHELL 0x11efd5000 == 13 [pid = 1722] [id = 844] 04:05:30 INFO - --DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 843] 04:05:30 INFO - --DOCSHELL 0x124691000 == 11 [pid = 1722] [id = 850] 04:05:30 INFO - --DOMWINDOW == 40 (0x120fe5c00) [pid = 1722] [serial = 2028] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:30 INFO - --DOMWINDOW == 39 (0x1225e1400) [pid = 1722] [serial = 2030] [outer = 0x0] [url = about:blank] 04:05:30 INFO - --DOMWINDOW == 38 (0x11d465400) [pid = 1722] [serial = 2035] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:30 INFO - --DOMWINDOW == 37 (0x1132e9c00) [pid = 1722] [serial = 2032] [outer = 0x0] [url = about:blank] 04:05:30 INFO - --DOMWINDOW == 36 (0x112916400) [pid = 1722] [serial = 2048] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch] 04:05:30 INFO - --DOMWINDOW == 35 (0x11ebb6800) [pid = 1722] [serial = 2052] [outer = 0x0] [url = about:blank] 04:05:30 INFO - --DOMWINDOW == 34 (0x1283eac00) [pid = 1722] [serial = 2058] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?badSyntax] 04:05:30 INFO - --DOMWINDOW == 33 (0x128386400) [pid = 1722] [serial = 2059] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?noMaxAge] 04:05:30 INFO - --DOMWINDOW == 32 (0x1283f5000) [pid = 1722] [serial = 2060] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?invalidIncludeSubDomains] 04:05:30 INFO - --DOMWINDOW == 31 (0x1296ce400) [pid = 1722] [serial = 2061] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?invalidMaxAge] 04:05:30 INFO - --DOMWINDOW == 30 (0x1203dd800) [pid = 1722] [serial = 2054] [outer = 0x0] [url = about:blank] 04:05:30 INFO - --DOMWINDOW == 29 (0x129d11000) [pid = 1722] [serial = 2062] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleIncludeSubDomains] 04:05:30 INFO - --DOMWINDOW == 28 (0x1214b1000) [pid = 1722] [serial = 2038] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:30 INFO - --DOMWINDOW == 27 (0x112f45000) [pid = 1722] [serial = 2031] [outer = 0x0] [url = about:blank] 04:05:30 INFO - --DOMWINDOW == 26 (0x113d1d000) [pid = 1722] [serial = 2033] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch] 04:05:30 INFO - MEMORY STAT | vsize 3455MB | residentFast 531MB | heapAllocated 124MB 04:05:30 INFO - 395 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_hsts_invalid-headers.js | took 3974ms 04:05:30 INFO - ++DOCSHELL 0x112cc7800 == 12 [pid = 1722] [id = 851] 04:05:30 INFO - ++DOMWINDOW == 27 (0x113163c00) [pid = 1722] [serial = 2064] [outer = 0x0] 04:05:31 INFO - ++DOMWINDOW == 28 (0x113449000) [pid = 1722] [serial = 2065] [outer = 0x113163c00] 04:05:31 INFO - 396 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_input_field_focus_on_panel_select.js 04:05:31 INFO - ++DOCSHELL 0x11f969800 == 13 [pid = 1722] [id = 852] 04:05:31 INFO - ++DOMWINDOW == 29 (0x11513f800) [pid = 1722] [serial = 2066] [outer = 0x0] 04:05:31 INFO - ++DOMWINDOW == 30 (0x11e795000) [pid = 1722] [serial = 2067] [outer = 0x11513f800] 04:05:31 INFO - ++DOCSHELL 0x12184d800 == 14 [pid = 1722] [id = 853] 04:05:31 INFO - ++DOMWINDOW == 31 (0x11e7aa000) [pid = 1722] [serial = 2068] [outer = 0x0] 04:05:31 INFO - ++DOMWINDOW == 32 (0x1202ecc00) [pid = 1722] [serial = 2069] [outer = 0x11e7aa000] 04:05:31 INFO - ++DOMWINDOW == 33 (0x120e32400) [pid = 1722] [serial = 2070] [outer = 0x11e7aa000] 04:05:31 INFO - ++DOCSHELL 0x124f09000 == 15 [pid = 1722] [id = 854] 04:05:31 INFO - ++DOMWINDOW == 34 (0x1214af800) [pid = 1722] [serial = 2071] [outer = 0x0] 04:05:31 INFO - ++DOMWINDOW == 35 (0x1214b7c00) [pid = 1722] [serial = 2072] [outer = 0x1214af800] 04:05:32 INFO - ++DOCSHELL 0x129665000 == 16 [pid = 1722] [id = 855] 04:05:32 INFO - ++DOMWINDOW == 36 (0x120fe0400) [pid = 1722] [serial = 2073] [outer = 0x0] 04:05:32 INFO - ++DOMWINDOW == 37 (0x1273e1400) [pid = 1722] [serial = 2074] [outer = 0x120fe0400] 04:05:32 INFO - ++DOCSHELL 0x124f19800 == 17 [pid = 1722] [id = 856] 04:05:32 INFO - ++DOMWINDOW == 38 (0x120ff2800) [pid = 1722] [serial = 2075] [outer = 0x0] 04:05:32 INFO - ++DOMWINDOW == 39 (0x120ffd400) [pid = 1722] [serial = 2076] [outer = 0x120ff2800] 04:05:33 INFO - --DOCSHELL 0x11295a000 == 16 [pid = 1722] [id = 849] 04:05:33 INFO - --DOCSHELL 0x112ba5800 == 15 [pid = 1722] [id = 847] 04:05:33 INFO - --DOCSHELL 0x124f09000 == 14 [pid = 1722] [id = 854] 04:05:33 INFO - --DOCSHELL 0x11efca800 == 13 [pid = 1722] [id = 848] 04:05:33 INFO - --DOCSHELL 0x129665000 == 12 [pid = 1722] [id = 855] 04:05:33 INFO - --DOCSHELL 0x124f19800 == 11 [pid = 1722] [id = 856] 04:05:33 INFO - --DOMWINDOW == 38 (0x122124800) [pid = 1722] [serial = 2039] [outer = 0x0] [url = about:blank] 04:05:33 INFO - --DOMWINDOW == 37 (0x120e26400) [pid = 1722] [serial = 2037] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:33 INFO - --DOMWINDOW == 36 (0x1202ecc00) [pid = 1722] [serial = 2069] [outer = 0x0] [url = about:blank] 04:05:33 INFO - --DOMWINDOW == 35 (0x11ebbf400) [pid = 1722] [serial = 2053] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:33 INFO - --DOMWINDOW == 34 (0x12c4e0000) [pid = 1722] [serial = 2063] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleMaxAge] 04:05:33 INFO - --DOMWINDOW == 33 (0x11344f000) [pid = 1722] [serial = 2050] [outer = 0x0] [url = about:blank] 04:05:33 INFO - --DOMWINDOW == 32 (0x1214ab400) [pid = 1722] [serial = 2056] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:33 INFO - --DOMWINDOW == 31 (0x11e78a800) [pid = 1722] [serial = 2051] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleMaxAge] 04:05:33 INFO - --DOMWINDOW == 30 (0x113448800) [pid = 1722] [serial = 2049] [outer = 0x0] [url = about:blank] 04:05:33 INFO - MEMORY STAT | vsize 3456MB | residentFast 533MB | heapAllocated 125MB 04:05:33 INFO - 397 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_input_field_focus_on_panel_select.js | took 2657ms 04:05:33 INFO - ++DOCSHELL 0x112cbf000 == 12 [pid = 1722] [id = 857] 04:05:33 INFO - ++DOMWINDOW == 31 (0x112f41000) [pid = 1722] [serial = 2077] [outer = 0x0] 04:05:33 INFO - ++DOMWINDOW == 32 (0x112f4a400) [pid = 1722] [serial = 2078] [outer = 0x112f41000] 04:05:33 INFO - 398 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_inspect-parsed-documents.js 04:05:33 INFO - ++DOCSHELL 0x11e812800 == 13 [pid = 1722] [id = 858] 04:05:33 INFO - ++DOMWINDOW == 33 (0x113d0c800) [pid = 1722] [serial = 2079] [outer = 0x0] 04:05:33 INFO - ++DOMWINDOW == 34 (0x114b57000) [pid = 1722] [serial = 2080] [outer = 0x113d0c800] 04:05:34 INFO - ++DOCSHELL 0x112604000 == 14 [pid = 1722] [id = 859] 04:05:34 INFO - ++DOMWINDOW == 35 (0x114dbd800) [pid = 1722] [serial = 2081] [outer = 0x0] 04:05:34 INFO - ++DOMWINDOW == 36 (0x11f70e400) [pid = 1722] [serial = 2082] [outer = 0x114dbd800] 04:05:34 INFO - ++DOMWINDOW == 37 (0x120e23400) [pid = 1722] [serial = 2083] [outer = 0x114dbd800] 04:05:34 INFO - ++DOCSHELL 0x124874000 == 15 [pid = 1722] [id = 860] 04:05:34 INFO - ++DOMWINDOW == 38 (0x1214ab800) [pid = 1722] [serial = 2084] [outer = 0x0] 04:05:34 INFO - ++DOMWINDOW == 39 (0x1214b1000) [pid = 1722] [serial = 2085] [outer = 0x1214ab800] 04:05:35 INFO - ++DOCSHELL 0x11eb98000 == 16 [pid = 1722] [id = 861] 04:05:35 INFO - ++DOMWINDOW == 40 (0x122ea5400) [pid = 1722] [serial = 2086] [outer = 0x0] 04:05:35 INFO - ++DOMWINDOW == 41 (0x1241de000) [pid = 1722] [serial = 2087] [outer = 0x122ea5400] 04:05:35 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 04:05:35 INFO - ++DOCSHELL 0x12d436800 == 17 [pid = 1722] [id = 862] 04:05:35 INFO - ++DOMWINDOW == 42 (0x128308400) [pid = 1722] [serial = 2088] [outer = 0x0] 04:05:35 INFO - ++DOMWINDOW == 43 (0x12830ac00) [pid = 1722] [serial = 2089] [outer = 0x128308400] 04:05:35 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 04:05:36 INFO - ++DOCSHELL 0x129661800 == 18 [pid = 1722] [id = 863] 04:05:36 INFO - ++DOMWINDOW == 44 (0x129393400) [pid = 1722] [serial = 2090] [outer = 0x0] 04:05:36 INFO - ++DOMWINDOW == 45 (0x129396400) [pid = 1722] [serial = 2091] [outer = 0x129393400] 04:05:36 INFO - [1722] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 04:05:37 INFO - MEMORY STAT | vsize 3459MB | residentFast 536MB | heapAllocated 140MB 04:05:37 INFO - 399 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_inspect-parsed-documents.js | took 3150ms 04:05:37 INFO - ++DOCSHELL 0x12f112800 == 19 [pid = 1722] [id = 864] 04:05:37 INFO - ++DOMWINDOW == 46 (0x1247c4c00) [pid = 1722] [serial = 2092] [outer = 0x0] 04:05:37 INFO - ++DOMWINDOW == 47 (0x126484c00) [pid = 1722] [serial = 2093] [outer = 0x1247c4c00] 04:05:37 INFO - 400 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_js_input_expansion.js 04:05:37 INFO - ++DOCSHELL 0x120e10000 == 20 [pid = 1722] [id = 865] 04:05:37 INFO - ++DOMWINDOW == 48 (0x1296cdc00) [pid = 1722] [serial = 2094] [outer = 0x0] 04:05:37 INFO - ++DOMWINDOW == 49 (0x1296d1400) [pid = 1722] [serial = 2095] [outer = 0x1296cdc00] 04:05:37 INFO - ++DOMWINDOW == 50 (0x12d4f3400) [pid = 1722] [serial = 2096] [outer = 0x1296cdc00] 04:05:37 INFO - ++DOCSHELL 0x11e819000 == 21 [pid = 1722] [id = 866] 04:05:37 INFO - ++DOMWINDOW == 51 (0x1296d2800) [pid = 1722] [serial = 2097] [outer = 0x0] 04:05:37 INFO - ++DOMWINDOW == 52 (0x12a16cc00) [pid = 1722] [serial = 2098] [outer = 0x1296d2800] 04:05:37 INFO - ++DOMWINDOW == 53 (0x11ebb8400) [pid = 1722] [serial = 2099] [outer = 0x1296d2800] 04:05:37 INFO - ++DOCSHELL 0x122187800 == 22 [pid = 1722] [id = 867] 04:05:37 INFO - ++DOMWINDOW == 54 (0x11ee5c400) [pid = 1722] [serial = 2100] [outer = 0x0] 04:05:37 INFO - ++DOMWINDOW == 55 (0x1250b4400) [pid = 1722] [serial = 2101] [outer = 0x11ee5c400] 04:05:39 INFO - --DOCSHELL 0x11f969800 == 21 [pid = 1722] [id = 852] 04:05:39 INFO - --DOCSHELL 0x124874000 == 20 [pid = 1722] [id = 860] 04:05:39 INFO - --DOCSHELL 0x12184d800 == 19 [pid = 1722] [id = 853] 04:05:39 INFO - --DOCSHELL 0x11eb98000 == 18 [pid = 1722] [id = 861] 04:05:39 INFO - --DOCSHELL 0x112cc7800 == 17 [pid = 1722] [id = 851] 04:05:39 INFO - --DOCSHELL 0x12d436800 == 16 [pid = 1722] [id = 862] 04:05:39 INFO - --DOCSHELL 0x129661800 == 15 [pid = 1722] [id = 863] 04:05:39 INFO - --DOCSHELL 0x122187800 == 14 [pid = 1722] [id = 867] 04:05:39 INFO - --DOMWINDOW == 54 (0x1214b1400) [pid = 1722] [serial = 2057] [outer = 0x0] [url = about:blank] 04:05:39 INFO - --DOMWINDOW == 53 (0x120e32000) [pid = 1722] [serial = 2055] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:39 INFO - --DOMWINDOW == 52 (0x11e7aa000) [pid = 1722] [serial = 2068] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:39 INFO - --DOMWINDOW == 51 (0x120ff2800) [pid = 1722] [serial = 2075] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:05:39 INFO - --DOMWINDOW == 50 (0x120fe0400) [pid = 1722] [serial = 2073] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 04:05:39 INFO - --DOMWINDOW == 49 (0x11513f800) [pid = 1722] [serial = 2066] [outer = 0x0] [url = data:text/html;charset=utf8,<p>hello] 04:05:39 INFO - --DOMWINDOW == 48 (0x113163c00) [pid = 1722] [serial = 2064] [outer = 0x0] [url = about:blank] 04:05:39 INFO - --DOMWINDOW == 47 (0x122ea5400) [pid = 1722] [serial = 2086] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:05:39 INFO - --DOMWINDOW == 46 (0x128308400) [pid = 1722] [serial = 2088] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:05:39 INFO - --DOMWINDOW == 45 (0x129393400) [pid = 1722] [serial = 2090] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:05:39 INFO - --DOMWINDOW == 44 (0x113d0c800) [pid = 1722] [serial = 2079] [outer = 0x0] [url = data:text/html;charset=utf8,browser_webconsole_inspect-parsed-documents.js] 04:05:39 INFO - --DOMWINDOW == 43 (0x112f41000) [pid = 1722] [serial = 2077] [outer = 0x0] [url = about:blank] 04:05:39 INFO - --DOMWINDOW == 42 (0x112f4a400) [pid = 1722] [serial = 2078] [outer = 0x0] [url = about:blank] 04:05:39 INFO - --DOMWINDOW == 41 (0x1296d1400) [pid = 1722] [serial = 2095] [outer = 0x0] [url = about:blank] 04:05:39 INFO - --DOMWINDOW == 40 (0x1214af800) [pid = 1722] [serial = 2071] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:39 INFO - --DOMWINDOW == 39 (0x12a16cc00) [pid = 1722] [serial = 2098] [outer = 0x0] [url = about:blank] 04:05:39 INFO - --DOMWINDOW == 38 (0x11e795000) [pid = 1722] [serial = 2067] [outer = 0x0] [url = about:blank] 04:05:39 INFO - --DOMWINDOW == 37 (0x113449000) [pid = 1722] [serial = 2065] [outer = 0x0] [url = about:blank] 04:05:39 INFO - --DOMWINDOW == 36 (0x11f70e400) [pid = 1722] [serial = 2082] [outer = 0x0] [url = about:blank] 04:05:40 INFO - MEMORY STAT | vsize 3451MB | residentFast 533MB | heapAllocated 125MB 04:05:40 INFO - 401 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_js_input_expansion.js | took 2906ms 04:05:40 INFO - ++DOCSHELL 0x112cd1000 == 15 [pid = 1722] [id = 868] 04:05:40 INFO - ++DOMWINDOW == 37 (0x112f41800) [pid = 1722] [serial = 2102] [outer = 0x0] 04:05:40 INFO - ++DOMWINDOW == 38 (0x11315bc00) [pid = 1722] [serial = 2103] [outer = 0x112f41800] 04:05:40 INFO - 402 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_jsterm.js 04:05:40 INFO - ++DOCSHELL 0x11f638800 == 16 [pid = 1722] [id = 869] 04:05:40 INFO - ++DOMWINDOW == 39 (0x113e03c00) [pid = 1722] [serial = 2104] [outer = 0x0] 04:05:40 INFO - ++DOMWINDOW == 40 (0x11513f800) [pid = 1722] [serial = 2105] [outer = 0x113e03c00] 04:05:40 INFO - ++DOMWINDOW == 41 (0x1221be000) [pid = 1722] [serial = 2106] [outer = 0x113e03c00] 04:05:40 INFO - ++DOCSHELL 0x11e351800 == 17 [pid = 1722] [id = 870] 04:05:40 INFO - ++DOMWINDOW == 42 (0x1203ea000) [pid = 1722] [serial = 2107] [outer = 0x0] 04:05:40 INFO - ++DOMWINDOW == 43 (0x120d16c00) [pid = 1722] [serial = 2108] [outer = 0x1203ea000] 04:05:40 INFO - ++DOMWINDOW == 44 (0x120ff2800) [pid = 1722] [serial = 2109] [outer = 0x1203ea000] 04:05:40 INFO - ++DOCSHELL 0x124f21000 == 18 [pid = 1722] [id = 871] 04:05:40 INFO - ++DOMWINDOW == 45 (0x12232fc00) [pid = 1722] [serial = 2110] [outer = 0x0] 04:05:40 INFO - ++DOMWINDOW == 46 (0x1225d6000) [pid = 1722] [serial = 2111] [outer = 0x12232fc00] 04:05:43 INFO - --DOCSHELL 0x112cbf000 == 17 [pid = 1722] [id = 857] 04:05:43 INFO - --DOCSHELL 0x112604000 == 16 [pid = 1722] [id = 859] 04:05:43 INFO - --DOCSHELL 0x124f21000 == 15 [pid = 1722] [id = 871] 04:05:43 INFO - --DOCSHELL 0x12f112800 == 14 [pid = 1722] [id = 864] 04:05:43 INFO - --DOCSHELL 0x11e812800 == 13 [pid = 1722] [id = 858] 04:05:43 INFO - --DOCSHELL 0x120e10000 == 12 [pid = 1722] [id = 865] 04:05:43 INFO - --DOCSHELL 0x11e819000 == 11 [pid = 1722] [id = 866] 04:05:43 INFO - --DOMWINDOW == 45 (0x120e32400) [pid = 1722] [serial = 2070] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:43 INFO - --DOMWINDOW == 44 (0x1214b7c00) [pid = 1722] [serial = 2072] [outer = 0x0] [url = about:blank] 04:05:43 INFO - --DOMWINDOW == 43 (0x1273e1400) [pid = 1722] [serial = 2074] [outer = 0x0] [url = about:blank] 04:05:43 INFO - --DOMWINDOW == 42 (0x114b57000) [pid = 1722] [serial = 2080] [outer = 0x0] [url = about:blank] 04:05:43 INFO - --DOMWINDOW == 41 (0x129396400) [pid = 1722] [serial = 2091] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:05:43 INFO - --DOMWINDOW == 40 (0x12830ac00) [pid = 1722] [serial = 2089] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:05:43 INFO - --DOMWINDOW == 39 (0x1241de000) [pid = 1722] [serial = 2087] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:05:43 INFO - --DOMWINDOW == 38 (0x120ffd400) [pid = 1722] [serial = 2076] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:05:43 INFO - --DOMWINDOW == 37 (0x1296d2800) [pid = 1722] [serial = 2097] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:43 INFO - --DOMWINDOW == 36 (0x114dbd800) [pid = 1722] [serial = 2081] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:43 INFO - --DOMWINDOW == 35 (0x126484c00) [pid = 1722] [serial = 2093] [outer = 0x0] [url = about:blank] 04:05:43 INFO - --DOMWINDOW == 34 (0x11513f800) [pid = 1722] [serial = 2105] [outer = 0x0] [url = about:blank] 04:05:43 INFO - --DOMWINDOW == 33 (0x120d16c00) [pid = 1722] [serial = 2108] [outer = 0x0] [url = about:blank] 04:05:43 INFO - --DOMWINDOW == 32 (0x11ee5c400) [pid = 1722] [serial = 2100] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:43 INFO - --DOMWINDOW == 31 (0x1214ab800) [pid = 1722] [serial = 2084] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:43 INFO - --DOMWINDOW == 30 (0x1247c4c00) [pid = 1722] [serial = 2092] [outer = 0x0] [url = about:blank] 04:05:43 INFO - --DOMWINDOW == 29 (0x1296cdc00) [pid = 1722] [serial = 2094] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:43 INFO - --DOMWINDOW == 28 (0x12d4f3400) [pid = 1722] [serial = 2096] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:44 INFO - MEMORY STAT | vsize 3451MB | residentFast 533MB | heapAllocated 120MB 04:05:44 INFO - 403 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_jsterm.js | took 3846ms 04:05:44 INFO - ++DOCSHELL 0x112ccf800 == 12 [pid = 1722] [id = 872] 04:05:44 INFO - ++DOMWINDOW == 29 (0x112f45000) [pid = 1722] [serial = 2112] [outer = 0x0] 04:05:44 INFO - ++DOMWINDOW == 30 (0x113163c00) [pid = 1722] [serial = 2113] [outer = 0x112f45000] 04:05:44 INFO - 404 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_live_filtering_of_message_types.js 04:05:44 INFO - ++DOCSHELL 0x120d49000 == 13 [pid = 1722] [id = 873] 04:05:44 INFO - ++DOMWINDOW == 31 (0x1135f1c00) [pid = 1722] [serial = 2114] [outer = 0x0] 04:05:44 INFO - ++DOMWINDOW == 32 (0x114b23800) [pid = 1722] [serial = 2115] [outer = 0x1135f1c00] 04:05:44 INFO - ++DOMWINDOW == 33 (0x121811400) [pid = 1722] [serial = 2116] [outer = 0x1135f1c00] 04:05:44 INFO - ++DOCSHELL 0x112cc9000 == 14 [pid = 1722] [id = 874] 04:05:44 INFO - ++DOMWINDOW == 34 (0x1203df800) [pid = 1722] [serial = 2117] [outer = 0x0] 04:05:44 INFO - ++DOMWINDOW == 35 (0x1203e5000) [pid = 1722] [serial = 2118] [outer = 0x1203df800] 04:05:44 INFO - ++DOMWINDOW == 36 (0x120fe4800) [pid = 1722] [serial = 2119] [outer = 0x1203df800] 04:05:44 INFO - ++DOCSHELL 0x124f1f800 == 15 [pid = 1722] [id = 875] 04:05:44 INFO - ++DOMWINDOW == 37 (0x12152bc00) [pid = 1722] [serial = 2120] [outer = 0x0] 04:05:44 INFO - ++DOMWINDOW == 38 (0x1221bdc00) [pid = 1722] [serial = 2121] [outer = 0x12152bc00] 04:05:46 INFO - --DOCSHELL 0x124f1f800 == 14 [pid = 1722] [id = 875] 04:05:46 INFO - --DOCSHELL 0x11e351800 == 13 [pid = 1722] [id = 870] 04:05:46 INFO - --DOCSHELL 0x112cd1000 == 12 [pid = 1722] [id = 868] 04:05:46 INFO - --DOCSHELL 0x11f638800 == 11 [pid = 1722] [id = 869] 04:05:46 INFO - --DOMWINDOW == 37 (0x1250b4400) [pid = 1722] [serial = 2101] [outer = 0x0] [url = about:blank] 04:05:46 INFO - --DOMWINDOW == 36 (0x11ebb8400) [pid = 1722] [serial = 2099] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:46 INFO - --DOMWINDOW == 35 (0x1214b1000) [pid = 1722] [serial = 2085] [outer = 0x0] [url = about:blank] 04:05:46 INFO - --DOMWINDOW == 34 (0x120e23400) [pid = 1722] [serial = 2083] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:46 INFO - --DOMWINDOW == 33 (0x12232fc00) [pid = 1722] [serial = 2110] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:46 INFO - --DOMWINDOW == 32 (0x113e03c00) [pid = 1722] [serial = 2104] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:46 INFO - --DOMWINDOW == 31 (0x1203ea000) [pid = 1722] [serial = 2107] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:46 INFO - --DOMWINDOW == 30 (0x112f41800) [pid = 1722] [serial = 2102] [outer = 0x0] [url = about:blank] 04:05:46 INFO - --DOMWINDOW == 29 (0x11315bc00) [pid = 1722] [serial = 2103] [outer = 0x0] [url = about:blank] 04:05:46 INFO - --DOMWINDOW == 28 (0x1203e5000) [pid = 1722] [serial = 2118] [outer = 0x0] [url = about:blank] 04:05:46 INFO - --DOMWINDOW == 27 (0x114b23800) [pid = 1722] [serial = 2115] [outer = 0x0] [url = about:blank] 04:05:46 INFO - --DOMWINDOW == 26 (0x1221be000) [pid = 1722] [serial = 2106] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:46 INFO - MEMORY STAT | vsize 3452MB | residentFast 534MB | heapAllocated 119MB 04:05:46 INFO - 405 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_live_filtering_of_message_types.js | took 2487ms 04:05:46 INFO - ++DOCSHELL 0x112cc7800 == 12 [pid = 1722] [id = 876] 04:05:46 INFO - ++DOMWINDOW == 27 (0x112c98400) [pid = 1722] [serial = 2122] [outer = 0x0] 04:05:46 INFO - ++DOMWINDOW == 28 (0x112f49c00) [pid = 1722] [serial = 2123] [outer = 0x112c98400] 04:05:46 INFO - 406 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_live_filtering_on_search_strings.js 04:05:46 INFO - ++DOCSHELL 0x11f63f800 == 13 [pid = 1722] [id = 877] 04:05:46 INFO - ++DOMWINDOW == 29 (0x113e08400) [pid = 1722] [serial = 2124] [outer = 0x0] 04:05:46 INFO - ++DOMWINDOW == 30 (0x115145c00) [pid = 1722] [serial = 2125] [outer = 0x113e08400] 04:05:46 INFO - ++DOMWINDOW == 31 (0x121314000) [pid = 1722] [serial = 2126] [outer = 0x113e08400] 04:05:47 INFO - ++DOCSHELL 0x112e22800 == 14 [pid = 1722] [id = 878] 04:05:47 INFO - ++DOMWINDOW == 32 (0x120d16800) [pid = 1722] [serial = 2127] [outer = 0x0] 04:05:47 INFO - ++DOMWINDOW == 33 (0x120d20400) [pid = 1722] [serial = 2128] [outer = 0x120d16800] 04:05:47 INFO - ++DOMWINDOW == 34 (0x120d18800) [pid = 1722] [serial = 2129] [outer = 0x120d16800] 04:05:47 INFO - ++DOCSHELL 0x124f20800 == 15 [pid = 1722] [id = 879] 04:05:47 INFO - ++DOMWINDOW == 35 (0x1214b1000) [pid = 1722] [serial = 2130] [outer = 0x0] 04:05:47 INFO - ++DOMWINDOW == 36 (0x1221b4c00) [pid = 1722] [serial = 2131] [outer = 0x1214b1000] 04:05:49 INFO - --DOCSHELL 0x112ccf800 == 14 [pid = 1722] [id = 872] 04:05:49 INFO - --DOCSHELL 0x120d49000 == 13 [pid = 1722] [id = 873] 04:05:49 INFO - --DOCSHELL 0x124f20800 == 12 [pid = 1722] [id = 879] 04:05:49 INFO - --DOCSHELL 0x112cc9000 == 11 [pid = 1722] [id = 874] 04:05:49 INFO - --DOMWINDOW == 35 (0x1225d6000) [pid = 1722] [serial = 2111] [outer = 0x0] [url = about:blank] 04:05:49 INFO - --DOMWINDOW == 34 (0x120ff2800) [pid = 1722] [serial = 2109] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:49 INFO - --DOMWINDOW == 33 (0x1203df800) [pid = 1722] [serial = 2117] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:49 INFO - --DOMWINDOW == 32 (0x120d20400) [pid = 1722] [serial = 2128] [outer = 0x0] [url = about:blank] 04:05:49 INFO - --DOMWINDOW == 31 (0x12152bc00) [pid = 1722] [serial = 2120] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:49 INFO - --DOMWINDOW == 30 (0x1135f1c00) [pid = 1722] [serial = 2114] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:49 INFO - --DOMWINDOW == 29 (0x112f45000) [pid = 1722] [serial = 2112] [outer = 0x0] [url = about:blank] 04:05:49 INFO - --DOMWINDOW == 28 (0x115145c00) [pid = 1722] [serial = 2125] [outer = 0x0] [url = about:blank] 04:05:49 INFO - --DOMWINDOW == 27 (0x113163c00) [pid = 1722] [serial = 2113] [outer = 0x0] [url = about:blank] 04:05:49 INFO - --DOMWINDOW == 26 (0x121811400) [pid = 1722] [serial = 2116] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:49 INFO - MEMORY STAT | vsize 3452MB | residentFast 534MB | heapAllocated 119MB 04:05:49 INFO - 407 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_live_filtering_on_search_strings.js | took 2838ms 04:05:49 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 880] 04:05:49 INFO - ++DOMWINDOW == 27 (0x112c9cc00) [pid = 1722] [serial = 2132] [outer = 0x0] 04:05:49 INFO - ++DOMWINDOW == 28 (0x112f4a800) [pid = 1722] [serial = 2133] [outer = 0x112c9cc00] 04:05:49 INFO - 408 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_log_file_filter.js 04:05:49 INFO - ++DOCSHELL 0x1203c2800 == 13 [pid = 1722] [id = 881] 04:05:49 INFO - ++DOMWINDOW == 29 (0x113d0cc00) [pid = 1722] [serial = 2134] [outer = 0x0] 04:05:49 INFO - ++DOMWINDOW == 30 (0x114b5a800) [pid = 1722] [serial = 2135] [outer = 0x113d0cc00] 04:05:49 INFO - ++DOMWINDOW == 31 (0x11f5c0c00) [pid = 1722] [serial = 2136] [outer = 0x113d0cc00] 04:05:50 INFO - ++DOCSHELL 0x120e11000 == 14 [pid = 1722] [id = 882] 04:05:50 INFO - ++DOMWINDOW == 32 (0x120e24c00) [pid = 1722] [serial = 2137] [outer = 0x0] 04:05:50 INFO - ++DOMWINDOW == 33 (0x120e26000) [pid = 1722] [serial = 2138] [outer = 0x120e24c00] 04:05:50 INFO - ++DOMWINDOW == 34 (0x120ff4800) [pid = 1722] [serial = 2139] [outer = 0x120e24c00] 04:05:50 INFO - ++DOCSHELL 0x12820e000 == 15 [pid = 1722] [id = 883] 04:05:50 INFO - ++DOMWINDOW == 35 (0x1221bbc00) [pid = 1722] [serial = 2140] [outer = 0x0] 04:05:50 INFO - ++DOMWINDOW == 36 (0x122335c00) [pid = 1722] [serial = 2141] [outer = 0x1221bbc00] 04:05:51 INFO - --DOCSHELL 0x112cc7800 == 14 [pid = 1722] [id = 876] 04:05:51 INFO - --DOCSHELL 0x112e22800 == 13 [pid = 1722] [id = 878] 04:05:51 INFO - --DOCSHELL 0x11f63f800 == 12 [pid = 1722] [id = 877] 04:05:51 INFO - --DOCSHELL 0x12820e000 == 11 [pid = 1722] [id = 883] 04:05:51 INFO - --DOMWINDOW == 35 (0x1221bdc00) [pid = 1722] [serial = 2121] [outer = 0x0] [url = about:blank] 04:05:51 INFO - --DOMWINDOW == 34 (0x120fe4800) [pid = 1722] [serial = 2119] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:51 INFO - --DOMWINDOW == 33 (0x114b5a800) [pid = 1722] [serial = 2135] [outer = 0x0] [url = about:blank] 04:05:51 INFO - --DOMWINDOW == 32 (0x112f49c00) [pid = 1722] [serial = 2123] [outer = 0x0] [url = about:blank] 04:05:51 INFO - --DOMWINDOW == 31 (0x120e26000) [pid = 1722] [serial = 2138] [outer = 0x0] [url = about:blank] 04:05:51 INFO - --DOMWINDOW == 30 (0x1214b1000) [pid = 1722] [serial = 2130] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:51 INFO - --DOMWINDOW == 29 (0x120d16800) [pid = 1722] [serial = 2127] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:51 INFO - --DOMWINDOW == 28 (0x113e08400) [pid = 1722] [serial = 2124] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:51 INFO - --DOMWINDOW == 27 (0x112c98400) [pid = 1722] [serial = 2122] [outer = 0x0] [url = about:blank] 04:05:51 INFO - --DOMWINDOW == 26 (0x121314000) [pid = 1722] [serial = 2126] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:52 INFO - MEMORY STAT | vsize 3451MB | residentFast 533MB | heapAllocated 118MB 04:05:52 INFO - 409 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_log_file_filter.js | took 2261ms 04:05:52 INFO - ++DOCSHELL 0x112cc8000 == 12 [pid = 1722] [id = 884] 04:05:52 INFO - ++DOMWINDOW == 27 (0x112c9e800) [pid = 1722] [serial = 2142] [outer = 0x0] 04:05:52 INFO - ++DOMWINDOW == 28 (0x112f4c000) [pid = 1722] [serial = 2143] [outer = 0x112c9e800] 04:05:52 INFO - 410 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_message_node_id.js 04:05:52 INFO - ++DOCSHELL 0x11f646800 == 13 [pid = 1722] [id = 885] 04:05:52 INFO - ++DOMWINDOW == 29 (0x113e03c00) [pid = 1722] [serial = 2144] [outer = 0x0] 04:05:52 INFO - ++DOMWINDOW == 30 (0x114dbec00) [pid = 1722] [serial = 2145] [outer = 0x113e03c00] 04:05:52 INFO - ++DOMWINDOW == 31 (0x1221bb000) [pid = 1722] [serial = 2146] [outer = 0x113e03c00] 04:05:52 INFO - ++DOCSHELL 0x112e23800 == 14 [pid = 1722] [id = 886] 04:05:52 INFO - ++DOMWINDOW == 32 (0x1203eac00) [pid = 1722] [serial = 2147] [outer = 0x0] 04:05:52 INFO - ++DOMWINDOW == 33 (0x120d1e000) [pid = 1722] [serial = 2148] [outer = 0x1203eac00] 04:05:52 INFO - ++DOMWINDOW == 34 (0x120fe6400) [pid = 1722] [serial = 2149] [outer = 0x1203eac00] 04:05:52 INFO - ++DOCSHELL 0x126296000 == 15 [pid = 1722] [id = 887] 04:05:52 INFO - ++DOMWINDOW == 35 (0x1221bb800) [pid = 1722] [serial = 2150] [outer = 0x0] 04:05:52 INFO - ++DOMWINDOW == 36 (0x12232fc00) [pid = 1722] [serial = 2151] [outer = 0x1221bb800] 04:05:54 INFO - --DOCSHELL 0x112cc4000 == 14 [pid = 1722] [id = 880] 04:05:54 INFO - --DOCSHELL 0x120e11000 == 13 [pid = 1722] [id = 882] 04:05:54 INFO - --DOCSHELL 0x126296000 == 12 [pid = 1722] [id = 887] 04:05:54 INFO - --DOCSHELL 0x1203c2800 == 11 [pid = 1722] [id = 881] 04:05:54 INFO - --DOMWINDOW == 35 (0x1221b4c00) [pid = 1722] [serial = 2131] [outer = 0x0] [url = about:blank] 04:05:54 INFO - --DOMWINDOW == 34 (0x120d18800) [pid = 1722] [serial = 2129] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:54 INFO - --DOMWINDOW == 33 (0x114dbec00) [pid = 1722] [serial = 2145] [outer = 0x0] [url = about:blank] 04:05:54 INFO - --DOMWINDOW == 32 (0x112f4a800) [pid = 1722] [serial = 2133] [outer = 0x0] [url = about:blank] 04:05:54 INFO - --DOMWINDOW == 31 (0x120d1e000) [pid = 1722] [serial = 2148] [outer = 0x0] [url = about:blank] 04:05:54 INFO - --DOMWINDOW == 30 (0x120e24c00) [pid = 1722] [serial = 2137] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:54 INFO - --DOMWINDOW == 29 (0x1221bbc00) [pid = 1722] [serial = 2140] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:54 INFO - --DOMWINDOW == 28 (0x113d0cc00) [pid = 1722] [serial = 2134] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_923281_console_log_filter.html] 04:05:54 INFO - --DOMWINDOW == 27 (0x112c9cc00) [pid = 1722] [serial = 2132] [outer = 0x0] [url = about:blank] 04:05:54 INFO - --DOMWINDOW == 26 (0x11f5c0c00) [pid = 1722] [serial = 2136] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_923281_console_log_filter.html] 04:05:54 INFO - MEMORY STAT | vsize 3451MB | residentFast 533MB | heapAllocated 118MB 04:05:54 INFO - 411 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_message_node_id.js | took 2294ms 04:05:54 INFO - ++DOCSHELL 0x112cc9000 == 12 [pid = 1722] [id = 888] 04:05:54 INFO - ++DOMWINDOW == 27 (0x11315bc00) [pid = 1722] [serial = 2152] [outer = 0x0] 04:05:54 INFO - ++DOMWINDOW == 28 (0x11344a400) [pid = 1722] [serial = 2153] [outer = 0x11315bc00] 04:05:54 INFO - 412 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging.js 04:05:54 INFO - ++DOCSHELL 0x120e0a800 == 13 [pid = 1722] [id = 889] 04:05:54 INFO - ++DOMWINDOW == 29 (0x114dbec00) [pid = 1722] [serial = 2154] [outer = 0x0] 04:05:54 INFO - ++DOMWINDOW == 30 (0x11ebb6400) [pid = 1722] [serial = 2155] [outer = 0x114dbec00] 04:05:54 INFO - ++DOCSHELL 0x122187800 == 14 [pid = 1722] [id = 890] 04:05:54 INFO - ++DOMWINDOW == 31 (0x112936800) [pid = 1722] [serial = 2156] [outer = 0x0] 04:05:54 INFO - ++DOMWINDOW == 32 (0x1203e4800) [pid = 1722] [serial = 2157] [outer = 0x112936800] 04:05:54 INFO - ++DOMWINDOW == 33 (0x120ff1000) [pid = 1722] [serial = 2158] [outer = 0x112936800] 04:05:54 INFO - ++DOCSHELL 0x124f21000 == 15 [pid = 1722] [id = 891] 04:05:54 INFO - ++DOMWINDOW == 34 (0x12232a400) [pid = 1722] [serial = 2159] [outer = 0x0] 04:05:54 INFO - ++DOMWINDOW == 35 (0x1223e7000) [pid = 1722] [serial = 2160] [outer = 0x12232a400] 04:05:55 INFO - ++DOMWINDOW == 36 (0x124492000) [pid = 1722] [serial = 2161] [outer = 0x114dbec00] 04:05:55 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:55 INFO - ++DOMWINDOW == 37 (0x127076000) [pid = 1722] [serial = 2162] [outer = 0x114dbec00] 04:05:56 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:56 INFO - ++DOMWINDOW == 38 (0x12826ac00) [pid = 1722] [serial = 2163] [outer = 0x114dbec00] 04:05:56 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:56 INFO - ++DOCSHELL 0x129671000 == 16 [pid = 1722] [id = 892] 04:05:56 INFO - ++DOMWINDOW == 39 (0x120ff7400) [pid = 1722] [serial = 2164] [outer = 0x0] 04:05:56 INFO - ++DOMWINDOW == 40 (0x128273000) [pid = 1722] [serial = 2165] [outer = 0x120ff7400] 04:05:56 INFO - ++DOCSHELL 0x12c447800 == 17 [pid = 1722] [id = 893] 04:05:56 INFO - ++DOMWINDOW == 41 (0x128387400) [pid = 1722] [serial = 2166] [outer = 0x0] 04:05:56 INFO - ++DOMWINDOW == 42 (0x128388000) [pid = 1722] [serial = 2167] [outer = 0x128387400] 04:05:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:05:57 INFO - --DOCSHELL 0x12c447800 == 16 [pid = 1722] [id = 893] 04:05:57 INFO - --DOCSHELL 0x112cc8000 == 15 [pid = 1722] [id = 884] 04:05:57 INFO - --DOCSHELL 0x11f646800 == 14 [pid = 1722] [id = 885] 04:05:57 INFO - --DOCSHELL 0x112e23800 == 13 [pid = 1722] [id = 886] 04:05:57 INFO - --DOCSHELL 0x124f21000 == 12 [pid = 1722] [id = 891] 04:05:57 INFO - --DOCSHELL 0x129671000 == 11 [pid = 1722] [id = 892] 04:05:57 INFO - --DOMWINDOW == 41 (0x122335c00) [pid = 1722] [serial = 2141] [outer = 0x0] [url = about:blank] 04:05:57 INFO - --DOMWINDOW == 40 (0x120ff4800) [pid = 1722] [serial = 2139] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:57 INFO - --DOMWINDOW == 39 (0x1221bb800) [pid = 1722] [serial = 2150] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:05:57 INFO - --DOMWINDOW == 38 (0x1203eac00) [pid = 1722] [serial = 2147] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:05:57 INFO - --DOMWINDOW == 37 (0x113e03c00) [pid = 1722] [serial = 2144] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:57 INFO - --DOMWINDOW == 36 (0x112c9e800) [pid = 1722] [serial = 2142] [outer = 0x0] [url = about:blank] 04:05:57 INFO - --DOMWINDOW == 35 (0x112f4c000) [pid = 1722] [serial = 2143] [outer = 0x0] [url = about:blank] 04:05:57 INFO - --DOMWINDOW == 34 (0x1203e4800) [pid = 1722] [serial = 2157] [outer = 0x0] [url = about:blank] 04:05:57 INFO - --DOMWINDOW == 33 (0x128387400) [pid = 1722] [serial = 2166] [outer = 0x0] [url = about:blank] 04:05:57 INFO - --DOMWINDOW == 32 (0x128388000) [pid = 1722] [serial = 2167] [outer = 0x0] [url = about:blank] 04:05:58 INFO - --DOMWINDOW == 31 (0x124492000) [pid = 1722] [serial = 2161] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:05:58 INFO - --DOMWINDOW == 30 (0x1221bb000) [pid = 1722] [serial = 2146] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:05:58 INFO - MEMORY STAT | vsize 3452MB | residentFast 533MB | heapAllocated 121MB 04:05:58 INFO - 413 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging.js | took 3560ms 04:05:58 INFO - ++DOCSHELL 0x11321f800 == 12 [pid = 1722] [id = 894] 04:05:58 INFO - ++DOMWINDOW == 31 (0x112f4c000) [pid = 1722] [serial = 2168] [outer = 0x0] 04:05:58 INFO - ++DOMWINDOW == 32 (0x11344f000) [pid = 1722] [serial = 2169] [outer = 0x112f4c000] 04:05:58 INFO - 414 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging_reset_filter.js 04:05:58 INFO - ++DOCSHELL 0x120eb8800 == 13 [pid = 1722] [id = 895] 04:05:58 INFO - ++DOMWINDOW == 33 (0x11ebb8400) [pid = 1722] [serial = 2170] [outer = 0x0] 04:05:58 INFO - ++DOMWINDOW == 34 (0x11f715c00) [pid = 1722] [serial = 2171] [outer = 0x11ebb8400] 04:05:58 INFO - ++DOCSHELL 0x1128cb000 == 14 [pid = 1722] [id = 896] 04:05:58 INFO - ++DOMWINDOW == 35 (0x12025a000) [pid = 1722] [serial = 2172] [outer = 0x0] 04:05:58 INFO - ++DOMWINDOW == 36 (0x120d21000) [pid = 1722] [serial = 2173] [outer = 0x12025a000] 04:05:58 INFO - ++DOMWINDOW == 37 (0x120ffc000) [pid = 1722] [serial = 2174] [outer = 0x12025a000] 04:05:58 INFO - ++DOCSHELL 0x12734c800 == 15 [pid = 1722] [id = 897] 04:05:58 INFO - ++DOMWINDOW == 38 (0x1221bec00) [pid = 1722] [serial = 2175] [outer = 0x0] 04:05:58 INFO - ++DOMWINDOW == 39 (0x1223e6c00) [pid = 1722] [serial = 2176] [outer = 0x1221bec00] 04:05:59 INFO - ++DOMWINDOW == 40 (0x122ea0800) [pid = 1722] [serial = 2177] [outer = 0x11ebb8400] 04:05:59 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:05:59 INFO - ++DOCSHELL 0x129659000 == 16 [pid = 1722] [id = 898] 04:05:59 INFO - ++DOMWINDOW == 41 (0x120ffd400) [pid = 1722] [serial = 2178] [outer = 0x0] 04:05:59 INFO - ++DOMWINDOW == 42 (0x1247cb000) [pid = 1722] [serial = 2179] [outer = 0x120ffd400] 04:05:59 INFO - ++DOCSHELL 0x120175800 == 17 [pid = 1722] [id = 899] 04:05:59 INFO - ++DOMWINDOW == 43 (0x128305000) [pid = 1722] [serial = 2180] [outer = 0x0] 04:05:59 INFO - ++DOMWINDOW == 44 (0x1273e6800) [pid = 1722] [serial = 2181] [outer = 0x128305000] 04:06:00 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:00 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:00 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:00 INFO - --DOCSHELL 0x120175800 == 16 [pid = 1722] [id = 899] 04:06:01 INFO - --DOCSHELL 0x112cc9000 == 15 [pid = 1722] [id = 888] 04:06:01 INFO - --DOCSHELL 0x1128cb000 == 14 [pid = 1722] [id = 896] 04:06:01 INFO - --DOCSHELL 0x12734c800 == 13 [pid = 1722] [id = 897] 04:06:01 INFO - --DOCSHELL 0x122187800 == 12 [pid = 1722] [id = 890] 04:06:01 INFO - --DOCSHELL 0x120e0a800 == 11 [pid = 1722] [id = 889] 04:06:01 INFO - --DOCSHELL 0x129659000 == 10 [pid = 1722] [id = 898] 04:06:01 INFO - --DOMWINDOW == 43 (0x12232fc00) [pid = 1722] [serial = 2151] [outer = 0x0] [url = about:blank] 04:06:01 INFO - --DOMWINDOW == 42 (0x120fe6400) [pid = 1722] [serial = 2149] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:01 INFO - --DOMWINDOW == 41 (0x120ff7400) [pid = 1722] [serial = 2164] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 04:06:01 INFO - --DOMWINDOW == 40 (0x128305000) [pid = 1722] [serial = 2180] [outer = 0x0] [url = about:blank] 04:06:01 INFO - --DOMWINDOW == 39 (0x1221bec00) [pid = 1722] [serial = 2175] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:01 INFO - --DOMWINDOW == 38 (0x1273e6800) [pid = 1722] [serial = 2181] [outer = 0x0] [url = about:blank] 04:06:01 INFO - --DOMWINDOW == 37 (0x12232a400) [pid = 1722] [serial = 2159] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:01 INFO - --DOMWINDOW == 36 (0x112936800) [pid = 1722] [serial = 2156] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:01 INFO - --DOMWINDOW == 35 (0x114dbec00) [pid = 1722] [serial = 2154] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:06:01 INFO - --DOMWINDOW == 34 (0x11315bc00) [pid = 1722] [serial = 2152] [outer = 0x0] [url = about:blank] 04:06:01 INFO - --DOMWINDOW == 33 (0x120d21000) [pid = 1722] [serial = 2173] [outer = 0x0] [url = about:blank] 04:06:01 INFO - --DOMWINDOW == 32 (0x11ebb6400) [pid = 1722] [serial = 2155] [outer = 0x0] [url = about:blank] 04:06:01 INFO - --DOMWINDOW == 31 (0x11344a400) [pid = 1722] [serial = 2153] [outer = 0x0] [url = about:blank] 04:06:01 INFO - MEMORY STAT | vsize 3446MB | residentFast 526MB | heapAllocated 122MB 04:06:01 INFO - 415 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging_reset_filter.js | took 3364ms 04:06:01 INFO - ++DOCSHELL 0x112e7a800 == 11 [pid = 1722] [id = 900] 04:06:01 INFO - ++DOMWINDOW == 32 (0x113165400) [pid = 1722] [serial = 2182] [outer = 0x0] 04:06:01 INFO - ++DOMWINDOW == 33 (0x113448c00) [pid = 1722] [serial = 2183] [outer = 0x113165400] 04:06:01 INFO - 416 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_notifications.js 04:06:01 INFO - ++DOCSHELL 0x120e11000 == 12 [pid = 1722] [id = 901] 04:06:01 INFO - ++DOMWINDOW == 34 (0x11e795000) [pid = 1722] [serial = 2184] [outer = 0x0] 04:06:01 INFO - ++DOMWINDOW == 35 (0x11ebb6400) [pid = 1722] [serial = 2185] [outer = 0x11e795000] 04:06:01 INFO - ++DOCSHELL 0x12469f800 == 13 [pid = 1722] [id = 902] 04:06:01 INFO - ++DOMWINDOW == 36 (0x110d58c00) [pid = 1722] [serial = 2186] [outer = 0x0] 04:06:01 INFO - ++DOMWINDOW == 37 (0x120d16800) [pid = 1722] [serial = 2187] [outer = 0x110d58c00] 04:06:02 INFO - ++DOMWINDOW == 38 (0x120ff3800) [pid = 1722] [serial = 2188] [outer = 0x110d58c00] 04:06:02 INFO - ++DOCSHELL 0x12734a000 == 14 [pid = 1722] [id = 903] 04:06:02 INFO - ++DOMWINDOW == 39 (0x121803c00) [pid = 1722] [serial = 2189] [outer = 0x0] 04:06:02 INFO - ++DOMWINDOW == 40 (0x121810800) [pid = 1722] [serial = 2190] [outer = 0x121803c00] 04:06:03 INFO - --DOCSHELL 0x120eb8800 == 13 [pid = 1722] [id = 895] 04:06:03 INFO - --DOCSHELL 0x12734a000 == 12 [pid = 1722] [id = 903] 04:06:03 INFO - --DOMWINDOW == 39 (0x1223e6c00) [pid = 1722] [serial = 2176] [outer = 0x0] [url = about:blank] 04:06:03 INFO - --DOMWINDOW == 38 (0x1223e7000) [pid = 1722] [serial = 2160] [outer = 0x0] [url = about:blank] 04:06:03 INFO - --DOMWINDOW == 37 (0x120ff1000) [pid = 1722] [serial = 2158] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:03 INFO - --DOMWINDOW == 36 (0x12826ac00) [pid = 1722] [serial = 2163] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:06:03 INFO - --DOMWINDOW == 35 (0x127076000) [pid = 1722] [serial = 2162] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:06:03 INFO - --DOMWINDOW == 34 (0x128273000) [pid = 1722] [serial = 2165] [outer = 0x0] [url = about:blank] 04:06:03 INFO - --DOMWINDOW == 33 (0x11f715c00) [pid = 1722] [serial = 2171] [outer = 0x0] [url = about:blank] 04:06:03 INFO - --DOMWINDOW == 32 (0x11344f000) [pid = 1722] [serial = 2169] [outer = 0x0] [url = about:blank] 04:06:03 INFO - --DOMWINDOW == 31 (0x120d16800) [pid = 1722] [serial = 2187] [outer = 0x0] [url = about:blank] 04:06:03 INFO - --DOMWINDOW == 30 (0x12025a000) [pid = 1722] [serial = 2172] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:03 INFO - --DOMWINDOW == 29 (0x11ebb8400) [pid = 1722] [serial = 2170] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 04:06:03 INFO - --DOMWINDOW == 28 (0x112f4c000) [pid = 1722] [serial = 2168] [outer = 0x0] [url = about:blank] 04:06:03 INFO - --DOMWINDOW == 27 (0x120ffd400) [pid = 1722] [serial = 2178] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 04:06:03 INFO - --DOMWINDOW == 26 (0x122ea0800) [pid = 1722] [serial = 2177] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 04:06:03 INFO - MEMORY STAT | vsize 3447MB | residentFast 527MB | heapAllocated 121MB 04:06:03 INFO - 417 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_notifications.js | took 2157ms 04:06:03 INFO - ++DOCSHELL 0x112cc6000 == 13 [pid = 1722] [id = 904] 04:06:03 INFO - ++DOMWINDOW == 27 (0x112f41000) [pid = 1722] [serial = 2191] [outer = 0x0] 04:06:03 INFO - ++DOMWINDOW == 28 (0x11315e800) [pid = 1722] [serial = 2192] [outer = 0x112f41000] 04:06:04 INFO - 418 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_open-links-without-callback.js 04:06:04 INFO - ++DOCSHELL 0x120dc4800 == 14 [pid = 1722] [id = 905] 04:06:04 INFO - ++DOMWINDOW == 29 (0x11e713c00) [pid = 1722] [serial = 2193] [outer = 0x0] 04:06:04 INFO - ++DOMWINDOW == 30 (0x11e7ab800) [pid = 1722] [serial = 2194] [outer = 0x11e713c00] 04:06:04 INFO - ++DOMWINDOW == 31 (0x12211a800) [pid = 1722] [serial = 2195] [outer = 0x11e713c00] 04:06:04 INFO - ++DOCSHELL 0x112e8c800 == 15 [pid = 1722] [id = 906] 04:06:04 INFO - ++DOMWINDOW == 32 (0x120e26400) [pid = 1722] [serial = 2196] [outer = 0x0] 04:06:04 INFO - ++DOMWINDOW == 33 (0x120e2c800) [pid = 1722] [serial = 2197] [outer = 0x120e26400] 04:06:04 INFO - ++DOMWINDOW == 34 (0x120ffdc00) [pid = 1722] [serial = 2198] [outer = 0x120e26400] 04:06:04 INFO - ++DOCSHELL 0x12821e800 == 16 [pid = 1722] [id = 907] 04:06:04 INFO - ++DOMWINDOW == 35 (0x12211c000) [pid = 1722] [serial = 2199] [outer = 0x0] 04:06:04 INFO - ++DOMWINDOW == 36 (0x1225e1400) [pid = 1722] [serial = 2200] [outer = 0x12211c000] 04:06:06 INFO - --DOCSHELL 0x12821e800 == 15 [pid = 1722] [id = 907] 04:06:06 INFO - --DOCSHELL 0x120e11000 == 14 [pid = 1722] [id = 901] 04:06:06 INFO - --DOCSHELL 0x12469f800 == 13 [pid = 1722] [id = 902] 04:06:06 INFO - --DOCSHELL 0x11321f800 == 12 [pid = 1722] [id = 894] 04:06:06 INFO - --DOCSHELL 0x112e7a800 == 11 [pid = 1722] [id = 900] 04:06:06 INFO - --DOMWINDOW == 35 (0x120ffc000) [pid = 1722] [serial = 2174] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:06 INFO - --DOMWINDOW == 34 (0x1247cb000) [pid = 1722] [serial = 2179] [outer = 0x0] [url = about:blank] 04:06:06 INFO - --DOMWINDOW == 33 (0x11e7ab800) [pid = 1722] [serial = 2194] [outer = 0x0] [url = about:blank] 04:06:06 INFO - --DOMWINDOW == 32 (0x11ebb6400) [pid = 1722] [serial = 2185] [outer = 0x0] [url = about:blank] 04:06:06 INFO - --DOMWINDOW == 31 (0x113448c00) [pid = 1722] [serial = 2183] [outer = 0x0] [url = about:blank] 04:06:06 INFO - --DOMWINDOW == 30 (0x120e2c800) [pid = 1722] [serial = 2197] [outer = 0x0] [url = about:blank] 04:06:06 INFO - --DOMWINDOW == 29 (0x110d58c00) [pid = 1722] [serial = 2186] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:06 INFO - --DOMWINDOW == 28 (0x121803c00) [pid = 1722] [serial = 2189] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:06 INFO - --DOMWINDOW == 27 (0x11e795000) [pid = 1722] [serial = 2184] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20notifications] 04:06:06 INFO - --DOMWINDOW == 26 (0x113165400) [pid = 1722] [serial = 2182] [outer = 0x0] [url = about:blank] 04:06:06 INFO - MEMORY STAT | vsize 3449MB | residentFast 529MB | heapAllocated 121MB 04:06:06 INFO - 419 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_open-links-without-callback.js | took 2337ms 04:06:06 INFO - ++DOCSHELL 0x112cc4000 == 12 [pid = 1722] [id = 908] 04:06:06 INFO - ++DOMWINDOW == 27 (0x11344ac00) [pid = 1722] [serial = 2201] [outer = 0x0] 04:06:06 INFO - ++DOMWINDOW == 28 (0x113d0cc00) [pid = 1722] [serial = 2202] [outer = 0x11344ac00] 04:06:06 INFO - 420 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_01.js 04:06:06 INFO - ++DOCSHELL 0x120e10000 == 13 [pid = 1722] [id = 909] 04:06:06 INFO - ++DOMWINDOW == 29 (0x113449c00) [pid = 1722] [serial = 2203] [outer = 0x0] 04:06:06 INFO - ++DOMWINDOW == 30 (0x11ee55800) [pid = 1722] [serial = 2204] [outer = 0x113449c00] 04:06:06 INFO - ++DOCSHELL 0x112cd0800 == 14 [pid = 1722] [id = 910] 04:06:06 INFO - ++DOMWINDOW == 31 (0x11f5c0c00) [pid = 1722] [serial = 2205] [outer = 0x0] 04:06:06 INFO - ++DOMWINDOW == 32 (0x120e23400) [pid = 1722] [serial = 2206] [outer = 0x11f5c0c00] 04:06:06 INFO - ++DOMWINDOW == 33 (0x121115000) [pid = 1722] [serial = 2207] [outer = 0x11f5c0c00] 04:06:06 INFO - ++DOCSHELL 0x12571c800 == 15 [pid = 1722] [id = 911] 04:06:06 INFO - ++DOMWINDOW == 34 (0x122e9a000) [pid = 1722] [serial = 2208] [outer = 0x0] 04:06:06 INFO - ++DOMWINDOW == 35 (0x122ea8400) [pid = 1722] [serial = 2209] [outer = 0x122e9a000] 04:06:09 INFO - ++DOCSHELL 0x124470800 == 16 [pid = 1722] [id = 912] 04:06:09 INFO - ++DOMWINDOW == 36 (0x128380c00) [pid = 1722] [serial = 2210] [outer = 0x0] 04:06:09 INFO - ++DOMWINDOW == 37 (0x12837d400) [pid = 1722] [serial = 2211] [outer = 0x128380c00] 04:06:10 INFO - --DOCSHELL 0x112cc6000 == 15 [pid = 1722] [id = 904] 04:06:10 INFO - --DOCSHELL 0x112e8c800 == 14 [pid = 1722] [id = 906] 04:06:10 INFO - --DOCSHELL 0x12571c800 == 13 [pid = 1722] [id = 911] 04:06:10 INFO - --DOCSHELL 0x120dc4800 == 12 [pid = 1722] [id = 905] 04:06:10 INFO - --DOCSHELL 0x124470800 == 11 [pid = 1722] [id = 912] 04:06:10 INFO - --DOMWINDOW == 36 (0x120ff3800) [pid = 1722] [serial = 2188] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:10 INFO - --DOMWINDOW == 35 (0x121810800) [pid = 1722] [serial = 2190] [outer = 0x0] [url = about:blank] 04:06:10 INFO - --DOMWINDOW == 34 (0x11315e800) [pid = 1722] [serial = 2192] [outer = 0x0] [url = about:blank] 04:06:10 INFO - --DOMWINDOW == 33 (0x120e23400) [pid = 1722] [serial = 2206] [outer = 0x0] [url = about:blank] 04:06:10 INFO - --DOMWINDOW == 32 (0x128380c00) [pid = 1722] [serial = 2210] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:10 INFO - --DOMWINDOW == 31 (0x120e26400) [pid = 1722] [serial = 2196] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:10 INFO - --DOMWINDOW == 30 (0x12211c000) [pid = 1722] [serial = 2199] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:10 INFO - --DOMWINDOW == 29 (0x112f41000) [pid = 1722] [serial = 2191] [outer = 0x0] [url = about:blank] 04:06:10 INFO - --DOMWINDOW == 28 (0x11e713c00) [pid = 1722] [serial = 2193] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:06:10 INFO - --DOMWINDOW == 27 (0x12211a800) [pid = 1722] [serial = 2195] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:06:10 INFO - MEMORY STAT | vsize 3450MB | residentFast 530MB | heapAllocated 122MB 04:06:10 INFO - 421 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_01.js | took 4067ms 04:06:10 INFO - ++DOCSHELL 0x112ccf000 == 12 [pid = 1722] [id = 913] 04:06:10 INFO - ++DOMWINDOW == 28 (0x113165400) [pid = 1722] [serial = 2212] [outer = 0x0] 04:06:10 INFO - ++DOMWINDOW == 29 (0x11344dc00) [pid = 1722] [serial = 2213] [outer = 0x113165400] 04:06:10 INFO - 422 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_02.js 04:06:10 INFO - ++DOCSHELL 0x120e20800 == 13 [pid = 1722] [id = 914] 04:06:10 INFO - ++DOMWINDOW == 30 (0x11e7a4800) [pid = 1722] [serial = 2214] [outer = 0x0] 04:06:10 INFO - ++DOMWINDOW == 31 (0x11ebb9400) [pid = 1722] [serial = 2215] [outer = 0x11e7a4800] 04:06:10 INFO - ++DOMWINDOW == 32 (0x120d18800) [pid = 1722] [serial = 2216] [outer = 0x11e7a4800] 04:06:10 INFO - ++DOCSHELL 0x112cc9000 == 14 [pid = 1722] [id = 915] 04:06:10 INFO - ++DOMWINDOW == 33 (0x120fee800) [pid = 1722] [serial = 2217] [outer = 0x0] 04:06:10 INFO - ++DOMWINDOW == 34 (0x120ff2800) [pid = 1722] [serial = 2218] [outer = 0x120fee800] 04:06:11 INFO - ++DOMWINDOW == 35 (0x121311400) [pid = 1722] [serial = 2219] [outer = 0x120fee800] 04:06:11 INFO - ++DOCSHELL 0x129381800 == 15 [pid = 1722] [id = 916] 04:06:11 INFO - ++DOMWINDOW == 36 (0x122ea7000) [pid = 1722] [serial = 2220] [outer = 0x0] 04:06:11 INFO - ++DOMWINDOW == 37 (0x124395400) [pid = 1722] [serial = 2221] [outer = 0x122ea7000] 04:06:12 INFO - ++DOCSHELL 0x1293cb800 == 16 [pid = 1722] [id = 917] 04:06:12 INFO - ++DOMWINDOW == 38 (0x1276ae800) [pid = 1722] [serial = 2222] [outer = 0x0] 04:06:12 INFO - ++DOMWINDOW == 39 (0x1276b0000) [pid = 1722] [serial = 2223] [outer = 0x1276ae800] 04:06:12 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj28 04:06:12 INFO - ++DOCSHELL 0x12d436000 == 17 [pid = 1722] [id = 918] 04:06:12 INFO - ++DOMWINDOW == 40 (0x128271c00) [pid = 1722] [serial = 2224] [outer = 0x0] 04:06:12 INFO - ++DOMWINDOW == 41 (0x128273800) [pid = 1722] [serial = 2225] [outer = 0x128271c00] 04:06:12 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj31 04:06:12 INFO - ++DOCSHELL 0x12d99d000 == 18 [pid = 1722] [id = 919] 04:06:12 INFO - ++DOMWINDOW == 42 (0x128303000) [pid = 1722] [serial = 2226] [outer = 0x0] 04:06:12 INFO - ++DOMWINDOW == 43 (0x128304800) [pid = 1722] [serial = 2227] [outer = 0x128303000] 04:06:13 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj35 04:06:13 INFO - ++DOCSHELL 0x12ee78000 == 19 [pid = 1722] [id = 920] 04:06:13 INFO - ++DOMWINDOW == 44 (0x12837e800) [pid = 1722] [serial = 2228] [outer = 0x0] 04:06:13 INFO - ++DOMWINDOW == 45 (0x12837fc00) [pid = 1722] [serial = 2229] [outer = 0x12837e800] 04:06:13 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj39 04:06:13 INFO - ++DOCSHELL 0x12f110800 == 20 [pid = 1722] [id = 921] 04:06:13 INFO - ++DOMWINDOW == 46 (0x12938d400) [pid = 1722] [serial = 2230] [outer = 0x0] 04:06:13 INFO - ++DOMWINDOW == 47 (0x12938dc00) [pid = 1722] [serial = 2231] [outer = 0x12938d400] 04:06:13 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj43 04:06:13 INFO - ++DOCSHELL 0x12f235800 == 21 [pid = 1722] [id = 922] 04:06:13 INFO - ++DOMWINDOW == 48 (0x129d0a400) [pid = 1722] [serial = 2232] [outer = 0x0] 04:06:13 INFO - ++DOMWINDOW == 49 (0x12938d800) [pid = 1722] [serial = 2233] [outer = 0x129d0a400] 04:06:13 INFO - ++DOCSHELL 0x12f23b800 == 22 [pid = 1722] [id = 923] 04:06:13 INFO - ++DOMWINDOW == 50 (0x129d0b400) [pid = 1722] [serial = 2234] [outer = 0x0] 04:06:13 INFO - ++DOMWINDOW == 51 (0x129d0c400) [pid = 1722] [serial = 2235] [outer = 0x129d0b400] 04:06:14 INFO - ++DOCSHELL 0x120dcd800 == 23 [pid = 1722] [id = 924] 04:06:14 INFO - ++DOMWINDOW == 52 (0x11344e400) [pid = 1722] [serial = 2236] [outer = 0x0] 04:06:14 INFO - ++DOMWINDOW == 53 (0x113e08400) [pid = 1722] [serial = 2237] [outer = 0x11344e400] 04:06:14 INFO - ++DOCSHELL 0x1293de000 == 24 [pid = 1722] [id = 925] 04:06:14 INFO - ++DOMWINDOW == 54 (0x1240d8c00) [pid = 1722] [serial = 2238] [outer = 0x0] 04:06:14 INFO - ++DOMWINDOW == 55 (0x122ea6800) [pid = 1722] [serial = 2239] [outer = 0x1240d8c00] 04:06:15 INFO - ++DOCSHELL 0x129672000 == 25 [pid = 1722] [id = 926] 04:06:15 INFO - ++DOMWINDOW == 56 (0x1264b7000) [pid = 1722] [serial = 2240] [outer = 0x0] 04:06:15 INFO - ++DOMWINDOW == 57 (0x1264b1400) [pid = 1722] [serial = 2241] [outer = 0x1264b7000] 04:06:15 INFO - ++DOCSHELL 0x12d429800 == 26 [pid = 1722] [id = 927] 04:06:15 INFO - ++DOMWINDOW == 58 (0x128302c00) [pid = 1722] [serial = 2242] [outer = 0x0] 04:06:15 INFO - ++DOMWINDOW == 59 (0x12826cc00) [pid = 1722] [serial = 2243] [outer = 0x128302c00] 04:06:16 INFO - ++DOCSHELL 0x12f122800 == 27 [pid = 1722] [id = 928] 04:06:16 INFO - ++DOMWINDOW == 60 (0x128388800) [pid = 1722] [serial = 2244] [outer = 0x0] 04:06:16 INFO - ++DOMWINDOW == 61 (0x128387400) [pid = 1722] [serial = 2245] [outer = 0x128388800] 04:06:16 INFO - ++DOCSHELL 0x12f5b2000 == 28 [pid = 1722] [id = 929] 04:06:16 INFO - ++DOMWINDOW == 62 (0x129d12800) [pid = 1722] [serial = 2246] [outer = 0x0] 04:06:16 INFO - ++DOMWINDOW == 63 (0x12a074000) [pid = 1722] [serial = 2247] [outer = 0x129d12800] 04:06:16 INFO - ++DOCSHELL 0x12f5bf800 == 29 [pid = 1722] [id = 930] 04:06:16 INFO - ++DOMWINDOW == 64 (0x12d4f2000) [pid = 1722] [serial = 2248] [outer = 0x0] 04:06:17 INFO - ++DOMWINDOW == 65 (0x12d4f1c00) [pid = 1722] [serial = 2249] [outer = 0x12d4f2000] 04:06:17 INFO - ++DOCSHELL 0x12f903000 == 30 [pid = 1722] [id = 931] 04:06:17 INFO - ++DOMWINDOW == 66 (0x12dd81400) [pid = 1722] [serial = 2250] [outer = 0x0] 04:06:17 INFO - ++DOMWINDOW == 67 (0x12e05d800) [pid = 1722] [serial = 2251] [outer = 0x12dd81400] 04:06:18 INFO - --DOCSHELL 0x112cc4000 == 29 [pid = 1722] [id = 908] 04:06:18 INFO - --DOCSHELL 0x120e10000 == 28 [pid = 1722] [id = 909] 04:06:18 INFO - --DOCSHELL 0x112cc9000 == 27 [pid = 1722] [id = 915] 04:06:18 INFO - --DOCSHELL 0x112cd0800 == 26 [pid = 1722] [id = 910] 04:06:18 INFO - --DOCSHELL 0x129381800 == 25 [pid = 1722] [id = 916] 04:06:18 INFO - --DOCSHELL 0x1293cb800 == 24 [pid = 1722] [id = 917] 04:06:18 INFO - --DOCSHELL 0x12d436000 == 23 [pid = 1722] [id = 918] 04:06:18 INFO - --DOCSHELL 0x12d99d000 == 22 [pid = 1722] [id = 919] 04:06:18 INFO - --DOCSHELL 0x12ee78000 == 21 [pid = 1722] [id = 920] 04:06:18 INFO - --DOCSHELL 0x12f110800 == 20 [pid = 1722] [id = 921] 04:06:18 INFO - --DOCSHELL 0x12f235800 == 19 [pid = 1722] [id = 922] 04:06:18 INFO - --DOCSHELL 0x12f23b800 == 18 [pid = 1722] [id = 923] 04:06:18 INFO - --DOCSHELL 0x120dcd800 == 17 [pid = 1722] [id = 924] 04:06:18 INFO - --DOCSHELL 0x1293de000 == 16 [pid = 1722] [id = 925] 04:06:18 INFO - --DOCSHELL 0x129672000 == 15 [pid = 1722] [id = 926] 04:06:18 INFO - --DOMWINDOW == 66 (0x120ffdc00) [pid = 1722] [serial = 2198] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:18 INFO - --DOMWINDOW == 65 (0x1225e1400) [pid = 1722] [serial = 2200] [outer = 0x0] [url = about:blank] 04:06:18 INFO - --DOMWINDOW == 64 (0x12837d400) [pid = 1722] [serial = 2211] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:18 INFO - --DOMWINDOW == 63 (0x11f5c0c00) [pid = 1722] [serial = 2205] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:18 INFO - --DOMWINDOW == 62 (0x122e9a000) [pid = 1722] [serial = 2208] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:18 INFO - --DOMWINDOW == 61 (0x11344ac00) [pid = 1722] [serial = 2201] [outer = 0x0] [url = about:blank] 04:06:18 INFO - --DOMWINDOW == 60 (0x113449c00) [pid = 1722] [serial = 2203] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2001] 04:06:18 INFO - --DOMWINDOW == 59 (0x1276ae800) [pid = 1722] [serial = 2222] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:18 INFO - --DOMWINDOW == 58 (0x128271c00) [pid = 1722] [serial = 2224] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:18 INFO - --DOMWINDOW == 57 (0x128303000) [pid = 1722] [serial = 2226] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:18 INFO - --DOMWINDOW == 56 (0x129d0a400) [pid = 1722] [serial = 2232] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:18 INFO - --DOMWINDOW == 55 (0x12938d400) [pid = 1722] [serial = 2230] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:18 INFO - --DOMWINDOW == 54 (0x12837e800) [pid = 1722] [serial = 2228] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:18 INFO - --DOMWINDOW == 53 (0x129d0b400) [pid = 1722] [serial = 2234] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:18 INFO - --DOMWINDOW == 52 (0x113d0cc00) [pid = 1722] [serial = 2202] [outer = 0x0] [url = about:blank] 04:06:18 INFO - --DOMWINDOW == 51 (0x11ee55800) [pid = 1722] [serial = 2204] [outer = 0x0] [url = about:blank] 04:06:18 INFO - --DOMWINDOW == 50 (0x11ebb9400) [pid = 1722] [serial = 2215] [outer = 0x0] [url = about:blank] 04:06:18 INFO - --DOMWINDOW == 49 (0x120ff2800) [pid = 1722] [serial = 2218] [outer = 0x0] [url = about:blank] 04:06:18 INFO - MEMORY STAT | vsize 3453MB | residentFast 533MB | heapAllocated 127MB 04:06:18 INFO - 423 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_02.js | took 7863ms 04:06:18 INFO - ++DOCSHELL 0x112cbf800 == 16 [pid = 1722] [id = 932] 04:06:18 INFO - ++DOMWINDOW == 50 (0x1133a3c00) [pid = 1722] [serial = 2252] [outer = 0x0] 04:06:18 INFO - ++DOMWINDOW == 51 (0x113d1d000) [pid = 1722] [serial = 2253] [outer = 0x1133a3c00] 04:06:18 INFO - 424 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_03.js 04:06:18 INFO - ++DOCSHELL 0x120e05000 == 17 [pid = 1722] [id = 933] 04:06:18 INFO - ++DOMWINDOW == 52 (0x11ebbf400) [pid = 1722] [serial = 2254] [outer = 0x0] 04:06:18 INFO - ++DOMWINDOW == 53 (0x11f70e000) [pid = 1722] [serial = 2255] [outer = 0x11ebbf400] 04:06:18 INFO - ++DOMWINDOW == 54 (0x120d22800) [pid = 1722] [serial = 2256] [outer = 0x11ebbf400] 04:06:18 INFO - ++DOCSHELL 0x11284f000 == 18 [pid = 1722] [id = 934] 04:06:18 INFO - ++DOMWINDOW == 55 (0x120ff3800) [pid = 1722] [serial = 2257] [outer = 0x0] 04:06:18 INFO - ++DOMWINDOW == 56 (0x120ff7400) [pid = 1722] [serial = 2258] [outer = 0x120ff3800] 04:06:19 INFO - ++DOMWINDOW == 57 (0x121311000) [pid = 1722] [serial = 2259] [outer = 0x120ff3800] 04:06:19 INFO - ++DOCSHELL 0x12822a800 == 19 [pid = 1722] [id = 935] 04:06:19 INFO - ++DOMWINDOW == 58 (0x1221bdc00) [pid = 1722] [serial = 2260] [outer = 0x0] 04:06:19 INFO - ++DOMWINDOW == 59 (0x122336c00) [pid = 1722] [serial = 2261] [outer = 0x1221bdc00] 04:06:20 INFO - ++DOCSHELL 0x12965c000 == 20 [pid = 1722] [id = 936] 04:06:20 INFO - ++DOMWINDOW == 60 (0x1283eac00) [pid = 1722] [serial = 2262] [outer = 0x0] 04:06:20 INFO - ++DOMWINDOW == 61 (0x1283f5800) [pid = 1722] [serial = 2263] [outer = 0x1283eac00] 04:06:21 INFO - ++DOCSHELL 0x129d33800 == 21 [pid = 1722] [id = 937] 04:06:21 INFO - ++DOMWINDOW == 62 (0x1283f8800) [pid = 1722] [serial = 2264] [outer = 0x0] 04:06:21 INFO - ++DOMWINDOW == 63 (0x1296d1000) [pid = 1722] [serial = 2265] [outer = 0x1283f8800] 04:06:21 INFO - ++DOCSHELL 0x12f22c000 == 22 [pid = 1722] [id = 938] 04:06:21 INFO - ++DOMWINDOW == 64 (0x12c3a7c00) [pid = 1722] [serial = 2266] [outer = 0x0] 04:06:21 INFO - ++DOMWINDOW == 65 (0x12d403000) [pid = 1722] [serial = 2267] [outer = 0x12c3a7c00] 04:06:21 INFO - ++DOCSHELL 0x12f5ae000 == 23 [pid = 1722] [id = 939] 04:06:21 INFO - ++DOMWINDOW == 66 (0x12d4f1400) [pid = 1722] [serial = 2268] [outer = 0x0] 04:06:21 INFO - ++DOMWINDOW == 67 (0x12dd16c00) [pid = 1722] [serial = 2269] [outer = 0x12d4f1400] 04:06:22 INFO - ++DOCSHELL 0x12f5c3800 == 24 [pid = 1722] [id = 940] 04:06:22 INFO - ++DOMWINDOW == 68 (0x12e064c00) [pid = 1722] [serial = 2270] [outer = 0x0] 04:06:22 INFO - ++DOMWINDOW == 69 (0x12e065400) [pid = 1722] [serial = 2271] [outer = 0x12e064c00] 04:06:23 INFO - ++DOCSHELL 0x1293dd000 == 25 [pid = 1722] [id = 941] 04:06:23 INFO - ++DOMWINDOW == 70 (0x124778c00) [pid = 1722] [serial = 2272] [outer = 0x0] 04:06:23 INFO - ++DOMWINDOW == 71 (0x12623cc00) [pid = 1722] [serial = 2273] [outer = 0x124778c00] 04:06:23 INFO - ++DOCSHELL 0x12d99d800 == 26 [pid = 1722] [id = 942] 04:06:23 INFO - ++DOMWINDOW == 72 (0x128387800) [pid = 1722] [serial = 2274] [outer = 0x0] 04:06:23 INFO - ++DOMWINDOW == 73 (0x128386400) [pid = 1722] [serial = 2275] [outer = 0x128387800] 04:06:24 INFO - ++DOCSHELL 0x12f11e000 == 27 [pid = 1722] [id = 943] 04:06:24 INFO - ++DOMWINDOW == 74 (0x12a16a000) [pid = 1722] [serial = 2276] [outer = 0x0] 04:06:24 INFO - ++DOMWINDOW == 75 (0x1296d8c00) [pid = 1722] [serial = 2277] [outer = 0x12a16a000] 04:06:24 INFO - ++DOCSHELL 0x12f5be800 == 28 [pid = 1722] [id = 944] 04:06:24 INFO - ++DOMWINDOW == 76 (0x12ee0d000) [pid = 1722] [serial = 2278] [outer = 0x0] 04:06:24 INFO - ++DOMWINDOW == 77 (0x12ee15c00) [pid = 1722] [serial = 2279] [outer = 0x12ee0d000] 04:06:25 INFO - --DOCSHELL 0x12f122800 == 27 [pid = 1722] [id = 928] 04:06:25 INFO - --DOCSHELL 0x11284f000 == 26 [pid = 1722] [id = 934] 04:06:25 INFO - --DOCSHELL 0x112ccf000 == 25 [pid = 1722] [id = 913] 04:06:25 INFO - --DOCSHELL 0x12d429800 == 24 [pid = 1722] [id = 927] 04:06:25 INFO - --DOCSHELL 0x12822a800 == 23 [pid = 1722] [id = 935] 04:06:25 INFO - --DOCSHELL 0x12f5bf800 == 22 [pid = 1722] [id = 930] 04:06:25 INFO - --DOCSHELL 0x12f5b2000 == 21 [pid = 1722] [id = 929] 04:06:25 INFO - --DOCSHELL 0x12f903000 == 20 [pid = 1722] [id = 931] 04:06:25 INFO - --DOCSHELL 0x120e20800 == 19 [pid = 1722] [id = 914] 04:06:25 INFO - --DOCSHELL 0x12965c000 == 18 [pid = 1722] [id = 936] 04:06:25 INFO - --DOCSHELL 0x129d33800 == 17 [pid = 1722] [id = 937] 04:06:25 INFO - --DOCSHELL 0x12f22c000 == 16 [pid = 1722] [id = 938] 04:06:25 INFO - --DOCSHELL 0x12f5ae000 == 15 [pid = 1722] [id = 939] 04:06:25 INFO - --DOCSHELL 0x12f5c3800 == 14 [pid = 1722] [id = 940] 04:06:25 INFO - --DOCSHELL 0x1293dd000 == 13 [pid = 1722] [id = 941] 04:06:25 INFO - --DOCSHELL 0x12d99d800 == 12 [pid = 1722] [id = 942] 04:06:25 INFO - --DOCSHELL 0x12f11e000 == 11 [pid = 1722] [id = 943] 04:06:25 INFO - --DOMWINDOW == 76 (0x121115000) [pid = 1722] [serial = 2207] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:25 INFO - --DOMWINDOW == 75 (0x122ea8400) [pid = 1722] [serial = 2209] [outer = 0x0] [url = about:blank] 04:06:25 INFO - --DOMWINDOW == 74 (0x128273800) [pid = 1722] [serial = 2225] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 73 (0x12938dc00) [pid = 1722] [serial = 2231] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 72 (0x12837fc00) [pid = 1722] [serial = 2229] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 71 (0x128304800) [pid = 1722] [serial = 2227] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 70 (0x12938d800) [pid = 1722] [serial = 2233] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 69 (0x1276b0000) [pid = 1722] [serial = 2223] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 68 (0x129d0c400) [pid = 1722] [serial = 2235] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 67 (0x12dd81400) [pid = 1722] [serial = 2250] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 66 (0x12d4f2000) [pid = 1722] [serial = 2248] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 65 (0x129d12800) [pid = 1722] [serial = 2246] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 64 (0x128388800) [pid = 1722] [serial = 2244] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 63 (0x128302c00) [pid = 1722] [serial = 2242] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 62 (0x1264b7000) [pid = 1722] [serial = 2240] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 61 (0x1240d8c00) [pid = 1722] [serial = 2238] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 60 (0x11344e400) [pid = 1722] [serial = 2236] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 59 (0x12c3a7c00) [pid = 1722] [serial = 2266] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 58 (0x1283f8800) [pid = 1722] [serial = 2264] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 57 (0x12d4f1400) [pid = 1722] [serial = 2268] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 56 (0x1283eac00) [pid = 1722] [serial = 2262] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 55 (0x122ea7000) [pid = 1722] [serial = 2220] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:25 INFO - --DOMWINDOW == 54 (0x120fee800) [pid = 1722] [serial = 2217] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:25 INFO - --DOMWINDOW == 53 (0x113165400) [pid = 1722] [serial = 2212] [outer = 0x0] [url = about:blank] 04:06:25 INFO - --DOMWINDOW == 52 (0x11e7a4800) [pid = 1722] [serial = 2214] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-02.html] 04:06:25 INFO - --DOMWINDOW == 51 (0x11344dc00) [pid = 1722] [serial = 2213] [outer = 0x0] [url = about:blank] 04:06:25 INFO - --DOMWINDOW == 50 (0x11f70e000) [pid = 1722] [serial = 2255] [outer = 0x0] [url = about:blank] 04:06:25 INFO - --DOMWINDOW == 49 (0x120ff7400) [pid = 1722] [serial = 2258] [outer = 0x0] [url = about:blank] 04:06:25 INFO - --DOMWINDOW == 48 (0x12e064c00) [pid = 1722] [serial = 2270] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:25 INFO - --DOMWINDOW == 47 (0x120d18800) [pid = 1722] [serial = 2216] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-02.html] 04:06:25 INFO - MEMORY STAT | vsize 3453MB | residentFast 533MB | heapAllocated 128MB 04:06:25 INFO - 425 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_03.js | took 7270ms 04:06:25 INFO - ++DOCSHELL 0x112baf800 == 12 [pid = 1722] [id = 945] 04:06:25 INFO - ++DOMWINDOW == 48 (0x11326ac00) [pid = 1722] [serial = 2280] [outer = 0x0] 04:06:25 INFO - ++DOMWINDOW == 49 (0x113450000) [pid = 1722] [serial = 2281] [outer = 0x11326ac00] 04:06:26 INFO - 426 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_04.js 04:06:26 INFO - ++DOCSHELL 0x120e1a000 == 13 [pid = 1722] [id = 946] 04:06:26 INFO - ++DOMWINDOW == 50 (0x11ebb8400) [pid = 1722] [serial = 2282] [outer = 0x0] 04:06:26 INFO - ++DOMWINDOW == 51 (0x11f110800) [pid = 1722] [serial = 2283] [outer = 0x11ebb8400] 04:06:26 INFO - ++DOMWINDOW == 52 (0x120e23400) [pid = 1722] [serial = 2284] [outer = 0x11ebb8400] 04:06:26 INFO - ++DOCSHELL 0x11294f000 == 14 [pid = 1722] [id = 947] 04:06:26 INFO - ++DOMWINDOW == 53 (0x121109400) [pid = 1722] [serial = 2285] [outer = 0x0] 04:06:26 INFO - ++DOMWINDOW == 54 (0x12110c800) [pid = 1722] [serial = 2286] [outer = 0x121109400] 04:06:26 INFO - ++DOMWINDOW == 55 (0x121315800) [pid = 1722] [serial = 2287] [outer = 0x121109400] 04:06:26 INFO - ++DOCSHELL 0x12937c000 == 15 [pid = 1722] [id = 948] 04:06:26 INFO - ++DOMWINDOW == 56 (0x1223efc00) [pid = 1722] [serial = 2288] [outer = 0x0] 04:06:26 INFO - ++DOMWINDOW == 57 (0x122d42400) [pid = 1722] [serial = 2289] [outer = 0x1223efc00] 04:06:27 INFO - ++DOCSHELL 0x12c433800 == 16 [pid = 1722] [id = 949] 04:06:27 INFO - ++DOMWINDOW == 58 (0x1283ed800) [pid = 1722] [serial = 2290] [outer = 0x0] 04:06:28 INFO - ++DOMWINDOW == 59 (0x1283f0400) [pid = 1722] [serial = 2291] [outer = 0x1283ed800] 04:06:28 INFO - ++DOCSHELL 0x12f112800 == 17 [pid = 1722] [id = 950] 04:06:28 INFO - ++DOMWINDOW == 60 (0x129d0a400) [pid = 1722] [serial = 2292] [outer = 0x0] 04:06:28 INFO - ++DOMWINDOW == 61 (0x129d0c400) [pid = 1722] [serial = 2293] [outer = 0x129d0a400] 04:06:28 INFO - ++DOCSHELL 0x12f23d800 == 18 [pid = 1722] [id = 951] 04:06:28 INFO - ++DOMWINDOW == 62 (0x12d4f0400) [pid = 1722] [serial = 2294] [outer = 0x0] 04:06:28 INFO - ++DOMWINDOW == 63 (0x12dd18400) [pid = 1722] [serial = 2295] [outer = 0x12d4f0400] 04:06:29 INFO - ++DOCSHELL 0x12f5b7800 == 19 [pid = 1722] [id = 952] 04:06:29 INFO - ++DOMWINDOW == 64 (0x1283ec800) [pid = 1722] [serial = 2296] [outer = 0x0] 04:06:29 INFO - ++DOMWINDOW == 65 (0x12ee0ec00) [pid = 1722] [serial = 2297] [outer = 0x1283ec800] 04:06:29 INFO - ++DOCSHELL 0x129670000 == 20 [pid = 1722] [id = 953] 04:06:29 INFO - ++DOMWINDOW == 66 (0x12f2be400) [pid = 1722] [serial = 2298] [outer = 0x0] 04:06:29 INFO - ++DOMWINDOW == 67 (0x12f2bec00) [pid = 1722] [serial = 2299] [outer = 0x12f2be400] 04:06:30 INFO - ++DOCSHELL 0x128224800 == 21 [pid = 1722] [id = 954] 04:06:30 INFO - ++DOMWINDOW == 68 (0x120ff0800) [pid = 1722] [serial = 2300] [outer = 0x0] 04:06:30 INFO - ++DOMWINDOW == 69 (0x120ffd800) [pid = 1722] [serial = 2301] [outer = 0x120ff0800] 04:06:30 INFO - ++DOCSHELL 0x129668000 == 22 [pid = 1722] [id = 955] 04:06:30 INFO - ++DOMWINDOW == 70 (0x124780800) [pid = 1722] [serial = 2302] [outer = 0x0] 04:06:30 INFO - ++DOMWINDOW == 71 (0x12477cc00) [pid = 1722] [serial = 2303] [outer = 0x124780800] 04:06:31 INFO - ++DOCSHELL 0x12d42f800 == 23 [pid = 1722] [id = 956] 04:06:31 INFO - ++DOMWINDOW == 72 (0x1276cb000) [pid = 1722] [serial = 2304] [outer = 0x0] 04:06:31 INFO - ++DOMWINDOW == 73 (0x1276c3c00) [pid = 1722] [serial = 2305] [outer = 0x1276cb000] 04:06:31 INFO - --DOCSHELL 0x11294f000 == 22 [pid = 1722] [id = 947] 04:06:31 INFO - --DOCSHELL 0x12937c000 == 21 [pid = 1722] [id = 948] 04:06:31 INFO - --DOCSHELL 0x12f5be800 == 20 [pid = 1722] [id = 944] 04:06:31 INFO - --DOCSHELL 0x12c433800 == 19 [pid = 1722] [id = 949] 04:06:31 INFO - --DOCSHELL 0x120e05000 == 18 [pid = 1722] [id = 933] 04:06:31 INFO - --DOCSHELL 0x12f112800 == 17 [pid = 1722] [id = 950] 04:06:31 INFO - --DOCSHELL 0x12f23d800 == 16 [pid = 1722] [id = 951] 04:06:31 INFO - --DOCSHELL 0x12f5b7800 == 15 [pid = 1722] [id = 952] 04:06:31 INFO - --DOCSHELL 0x129670000 == 14 [pid = 1722] [id = 953] 04:06:31 INFO - --DOCSHELL 0x128224800 == 13 [pid = 1722] [id = 954] 04:06:31 INFO - --DOCSHELL 0x129668000 == 12 [pid = 1722] [id = 955] 04:06:31 INFO - --DOCSHELL 0x112cbf800 == 11 [pid = 1722] [id = 932] 04:06:32 INFO - --DOMWINDOW == 72 (0x12dd16c00) [pid = 1722] [serial = 2269] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 71 (0x1296d1000) [pid = 1722] [serial = 2265] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 70 (0x12e065400) [pid = 1722] [serial = 2271] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 69 (0x1283f5800) [pid = 1722] [serial = 2263] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 68 (0x12d403000) [pid = 1722] [serial = 2267] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 67 (0x124395400) [pid = 1722] [serial = 2221] [outer = 0x0] [url = about:blank] 04:06:32 INFO - --DOMWINDOW == 66 (0x121311400) [pid = 1722] [serial = 2219] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:32 INFO - --DOMWINDOW == 65 (0x12e05d800) [pid = 1722] [serial = 2251] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 64 (0x12d4f1c00) [pid = 1722] [serial = 2249] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 63 (0x12a074000) [pid = 1722] [serial = 2247] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 62 (0x128387400) [pid = 1722] [serial = 2245] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 61 (0x12826cc00) [pid = 1722] [serial = 2243] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 60 (0x1264b1400) [pid = 1722] [serial = 2241] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 59 (0x122ea6800) [pid = 1722] [serial = 2239] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 58 (0x113e08400) [pid = 1722] [serial = 2237] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 57 (0x113d1d000) [pid = 1722] [serial = 2253] [outer = 0x0] [url = about:blank] 04:06:32 INFO - --DOMWINDOW == 56 (0x11f110800) [pid = 1722] [serial = 2283] [outer = 0x0] [url = about:blank] 04:06:32 INFO - --DOMWINDOW == 55 (0x12110c800) [pid = 1722] [serial = 2286] [outer = 0x0] [url = about:blank] 04:06:32 INFO - --DOMWINDOW == 54 (0x12ee0d000) [pid = 1722] [serial = 2278] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 53 (0x1221bdc00) [pid = 1722] [serial = 2260] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:32 INFO - --DOMWINDOW == 52 (0x1133a3c00) [pid = 1722] [serial = 2252] [outer = 0x0] [url = about:blank] 04:06:32 INFO - --DOMWINDOW == 51 (0x1283ed800) [pid = 1722] [serial = 2290] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 50 (0x12a16a000) [pid = 1722] [serial = 2276] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 49 (0x124778c00) [pid = 1722] [serial = 2272] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 48 (0x120ff3800) [pid = 1722] [serial = 2257] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:32 INFO - --DOMWINDOW == 47 (0x11ebbf400) [pid = 1722] [serial = 2254] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-03.html] 04:06:32 INFO - --DOMWINDOW == 46 (0x128387800) [pid = 1722] [serial = 2274] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 45 (0x1283ec800) [pid = 1722] [serial = 2296] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 44 (0x129d0a400) [pid = 1722] [serial = 2292] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 43 (0x12d4f0400) [pid = 1722] [serial = 2294] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:32 INFO - --DOMWINDOW == 42 (0x120d22800) [pid = 1722] [serial = 2256] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-03.html] 04:06:32 INFO - MEMORY STAT | vsize 3452MB | residentFast 532MB | heapAllocated 126MB 04:06:32 INFO - 427 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_04.js | took 6269ms 04:06:32 INFO - ++DOCSHELL 0x112cbe000 == 12 [pid = 1722] [id = 957] 04:06:32 INFO - ++DOMWINDOW == 43 (0x11318ac00) [pid = 1722] [serial = 2306] [outer = 0x0] 04:06:32 INFO - ++DOMWINDOW == 44 (0x113d0cc00) [pid = 1722] [serial = 2307] [outer = 0x11318ac00] 04:06:32 INFO - 428 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_05.js 04:06:32 INFO - ++DOCSHELL 0x120e11000 == 13 [pid = 1722] [id = 958] 04:06:32 INFO - ++DOMWINDOW == 45 (0x11ebb5400) [pid = 1722] [serial = 2308] [outer = 0x0] 04:06:32 INFO - ++DOMWINDOW == 46 (0x11eefbc00) [pid = 1722] [serial = 2309] [outer = 0x11ebb5400] 04:06:32 INFO - ++DOCSHELL 0x112951000 == 14 [pid = 1722] [id = 959] 04:06:32 INFO - ++DOMWINDOW == 47 (0x120258400) [pid = 1722] [serial = 2310] [outer = 0x0] 04:06:32 INFO - ++DOMWINDOW == 48 (0x120e2c000) [pid = 1722] [serial = 2311] [outer = 0x120258400] 04:06:32 INFO - ++DOMWINDOW == 49 (0x120ffe000) [pid = 1722] [serial = 2312] [outer = 0x120258400] 04:06:32 INFO - ++DOCSHELL 0x128215800 == 15 [pid = 1722] [id = 960] 04:06:32 INFO - ++DOMWINDOW == 50 (0x122124000) [pid = 1722] [serial = 2313] [outer = 0x0] 04:06:32 INFO - ++DOMWINDOW == 51 (0x1221b5000) [pid = 1722] [serial = 2314] [outer = 0x122124000] 04:06:33 INFO - ++DOCSHELL 0x129376000 == 16 [pid = 1722] [id = 961] 04:06:33 INFO - ++DOMWINDOW == 52 (0x121314c00) [pid = 1722] [serial = 2315] [outer = 0x0] 04:06:33 INFO - ++DOMWINDOW == 53 (0x122ea5400) [pid = 1722] [serial = 2316] [outer = 0x121314c00] 04:06:34 INFO - ++DOCSHELL 0x12d992800 == 17 [pid = 1722] [id = 962] 04:06:34 INFO - ++DOMWINDOW == 54 (0x121312000) [pid = 1722] [serial = 2317] [outer = 0x0] 04:06:34 INFO - ++DOMWINDOW == 55 (0x1283f4000) [pid = 1722] [serial = 2318] [outer = 0x121312000] 04:06:34 INFO - ++DOCSHELL 0x12ee68800 == 18 [pid = 1722] [id = 963] 04:06:34 INFO - ++DOMWINDOW == 56 (0x12938e000) [pid = 1722] [serial = 2319] [outer = 0x0] 04:06:34 INFO - ++DOMWINDOW == 57 (0x129393800) [pid = 1722] [serial = 2320] [outer = 0x12938e000] 04:06:35 INFO - ++DOCSHELL 0x12ee77000 == 19 [pid = 1722] [id = 964] 04:06:35 INFO - ++DOMWINDOW == 58 (0x1296d1400) [pid = 1722] [serial = 2321] [outer = 0x0] 04:06:35 INFO - ++DOMWINDOW == 59 (0x1296d2800) [pid = 1722] [serial = 2322] [outer = 0x1296d1400] 04:06:35 INFO - ++DOCSHELL 0x12f112800 == 20 [pid = 1722] [id = 965] 04:06:35 INFO - ++DOMWINDOW == 60 (0x1296da400) [pid = 1722] [serial = 2323] [outer = 0x0] 04:06:35 INFO - ++DOMWINDOW == 61 (0x129707400) [pid = 1722] [serial = 2324] [outer = 0x1296da400] 04:06:35 INFO - ++DOCSHELL 0x12f226000 == 21 [pid = 1722] [id = 966] 04:06:35 INFO - ++DOMWINDOW == 62 (0x12d403c00) [pid = 1722] [serial = 2325] [outer = 0x0] 04:06:35 INFO - ++DOMWINDOW == 63 (0x12d404400) [pid = 1722] [serial = 2326] [outer = 0x12d403c00] 04:06:36 INFO - ++DOCSHELL 0x11321b800 == 22 [pid = 1722] [id = 967] 04:06:36 INFO - ++DOMWINDOW == 64 (0x112ca3800) [pid = 1722] [serial = 2327] [outer = 0x0] 04:06:36 INFO - ++DOMWINDOW == 65 (0x112f41400) [pid = 1722] [serial = 2328] [outer = 0x112ca3800] 04:06:36 INFO - ++DOCSHELL 0x128227000 == 23 [pid = 1722] [id = 968] 04:06:36 INFO - ++DOMWINDOW == 66 (0x12211c000) [pid = 1722] [serial = 2329] [outer = 0x0] 04:06:36 INFO - ++DOMWINDOW == 67 (0x12211a800) [pid = 1722] [serial = 2330] [outer = 0x12211c000] 04:06:36 INFO - ++DOCSHELL 0x129668000 == 24 [pid = 1722] [id = 969] 04:06:36 INFO - ++DOMWINDOW == 68 (0x127329400) [pid = 1722] [serial = 2331] [outer = 0x0] 04:06:36 INFO - ++DOMWINDOW == 69 (0x12706d400) [pid = 1722] [serial = 2332] [outer = 0x127329400] 04:06:37 INFO - ++DOCSHELL 0x12c433800 == 25 [pid = 1722] [id = 970] 04:06:37 INFO - ++DOMWINDOW == 70 (0x1283efc00) [pid = 1722] [serial = 2333] [outer = 0x0] 04:06:37 INFO - --DOCSHELL 0x12c433800 == 24 [pid = 1722] [id = 970] 04:06:37 INFO - [1722] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 04:06:37 INFO - --DOMWINDOW == 69 (0x1283efc00) [pid = 1722] [serial = 2333] [outer = 0x0] [url = ] 04:06:38 INFO - --DOCSHELL 0x120e1a000 == 23 [pid = 1722] [id = 946] 04:06:38 INFO - --DOCSHELL 0x112951000 == 22 [pid = 1722] [id = 959] 04:06:38 INFO - --DOCSHELL 0x112baf800 == 21 [pid = 1722] [id = 945] 04:06:38 INFO - --DOCSHELL 0x128215800 == 20 [pid = 1722] [id = 960] 04:06:38 INFO - --DOCSHELL 0x12d42f800 == 19 [pid = 1722] [id = 956] 04:06:38 INFO - --DOCSHELL 0x129376000 == 18 [pid = 1722] [id = 961] 04:06:38 INFO - --DOCSHELL 0x12d992800 == 17 [pid = 1722] [id = 962] 04:06:38 INFO - --DOCSHELL 0x12ee68800 == 16 [pid = 1722] [id = 963] 04:06:38 INFO - --DOCSHELL 0x12ee77000 == 15 [pid = 1722] [id = 964] 04:06:38 INFO - --DOCSHELL 0x12f112800 == 14 [pid = 1722] [id = 965] 04:06:38 INFO - --DOCSHELL 0x12f226000 == 13 [pid = 1722] [id = 966] 04:06:38 INFO - --DOCSHELL 0x11321b800 == 12 [pid = 1722] [id = 967] 04:06:38 INFO - --DOCSHELL 0x128227000 == 11 [pid = 1722] [id = 968] 04:06:38 INFO - --DOCSHELL 0x129668000 == 10 [pid = 1722] [id = 969] 04:06:38 INFO - --DOMWINDOW == 68 (0x121311000) [pid = 1722] [serial = 2259] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:38 INFO - --DOMWINDOW == 67 (0x122336c00) [pid = 1722] [serial = 2261] [outer = 0x0] [url = about:blank] 04:06:38 INFO - --DOMWINDOW == 66 (0x129d0c400) [pid = 1722] [serial = 2293] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 65 (0x12dd18400) [pid = 1722] [serial = 2295] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 64 (0x1283f0400) [pid = 1722] [serial = 2291] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 63 (0x12ee0ec00) [pid = 1722] [serial = 2297] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 62 (0x12ee15c00) [pid = 1722] [serial = 2279] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 61 (0x1296d8c00) [pid = 1722] [serial = 2277] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 60 (0x128386400) [pid = 1722] [serial = 2275] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 59 (0x12623cc00) [pid = 1722] [serial = 2273] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 58 (0x1276cb000) [pid = 1722] [serial = 2304] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 57 (0x124780800) [pid = 1722] [serial = 2302] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 56 (0x120ff0800) [pid = 1722] [serial = 2300] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 55 (0x12f2be400) [pid = 1722] [serial = 2298] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 54 (0x121109400) [pid = 1722] [serial = 2285] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:38 INFO - --DOMWINDOW == 53 (0x1223efc00) [pid = 1722] [serial = 2288] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:38 INFO - --DOMWINDOW == 52 (0x11326ac00) [pid = 1722] [serial = 2280] [outer = 0x0] [url = about:blank] 04:06:38 INFO - --DOMWINDOW == 51 (0x11ebb8400) [pid = 1722] [serial = 2282] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-04.html] 04:06:38 INFO - --DOMWINDOW == 50 (0x120e2c000) [pid = 1722] [serial = 2311] [outer = 0x0] [url = about:blank] 04:06:38 INFO - --DOMWINDOW == 49 (0x112ca3800) [pid = 1722] [serial = 2327] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 48 (0x1296d1400) [pid = 1722] [serial = 2321] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 47 (0x1296da400) [pid = 1722] [serial = 2323] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 46 (0x121314c00) [pid = 1722] [serial = 2315] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 45 (0x12938e000) [pid = 1722] [serial = 2319] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 44 (0x12d403c00) [pid = 1722] [serial = 2325] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 43 (0x121312000) [pid = 1722] [serial = 2317] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:38 INFO - --DOMWINDOW == 42 (0x113450000) [pid = 1722] [serial = 2281] [outer = 0x0] [url = about:blank] 04:06:38 INFO - MEMORY STAT | vsize 3452MB | residentFast 532MB | heapAllocated 126MB 04:06:38 INFO - 429 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_05.js | took 6012ms 04:06:38 INFO - ++DOCSHELL 0x112ccc800 == 11 [pid = 1722] [id = 971] 04:06:38 INFO - ++DOMWINDOW == 43 (0x114b5a800) [pid = 1722] [serial = 2334] [outer = 0x0] 04:06:38 INFO - ++DOMWINDOW == 44 (0x11e714800) [pid = 1722] [serial = 2335] [outer = 0x114b5a800] 04:06:38 INFO - 430 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_06.js 04:06:38 INFO - ++DOCSHELL 0x12156a000 == 12 [pid = 1722] [id = 972] 04:06:38 INFO - ++DOMWINDOW == 45 (0x11326ac00) [pid = 1722] [serial = 2336] [outer = 0x0] 04:06:38 INFO - ++DOMWINDOW == 46 (0x1203dfc00) [pid = 1722] [serial = 2337] [outer = 0x11326ac00] 04:06:38 INFO - ++DOCSHELL 0x11284f000 == 13 [pid = 1722] [id = 973] 04:06:38 INFO - ++DOMWINDOW == 47 (0x1203e7000) [pid = 1722] [serial = 2338] [outer = 0x0] 04:06:38 INFO - ++DOMWINDOW == 48 (0x120e32000) [pid = 1722] [serial = 2339] [outer = 0x1203e7000] 04:06:38 INFO - ++DOMWINDOW == 49 (0x12130d400) [pid = 1722] [serial = 2340] [outer = 0x1203e7000] 04:06:39 INFO - ++DOCSHELL 0x128227000 == 14 [pid = 1722] [id = 974] 04:06:39 INFO - ++DOMWINDOW == 50 (0x1223e7000) [pid = 1722] [serial = 2341] [outer = 0x0] 04:06:39 INFO - ++DOMWINDOW == 51 (0x1225e1400) [pid = 1722] [serial = 2342] [outer = 0x1223e7000] 04:06:40 INFO - ++DOCSHELL 0x113306800 == 15 [pid = 1722] [id = 975] 04:06:40 INFO - ++DOMWINDOW == 52 (0x124c34c00) [pid = 1722] [serial = 2343] [outer = 0x0] 04:06:40 INFO - ++DOMWINDOW == 53 (0x12504d000) [pid = 1722] [serial = 2344] [outer = 0x124c34c00] 04:06:40 INFO - ++DOCSHELL 0x12c262000 == 16 [pid = 1722] [id = 976] 04:06:40 INFO - ++DOMWINDOW == 54 (0x128278000) [pid = 1722] [serial = 2345] [outer = 0x0] 04:06:40 INFO - ++DOMWINDOW == 55 (0x128307c00) [pid = 1722] [serial = 2346] [outer = 0x128278000] 04:06:40 INFO - ++DOCSHELL 0x12ee66000 == 17 [pid = 1722] [id = 977] 04:06:40 INFO - ++DOMWINDOW == 56 (0x1283f0400) [pid = 1722] [serial = 2347] [outer = 0x0] 04:06:40 INFO - ++DOMWINDOW == 57 (0x1283f1800) [pid = 1722] [serial = 2348] [outer = 0x1283f0400] 04:06:40 INFO - ++DOCSHELL 0x12ee71800 == 18 [pid = 1722] [id = 978] 04:06:40 INFO - ++DOMWINDOW == 58 (0x124884800) [pid = 1722] [serial = 2349] [outer = 0x0] 04:06:40 INFO - ++DOMWINDOW == 59 (0x1296cfc00) [pid = 1722] [serial = 2350] [outer = 0x124884800] 04:06:41 INFO - ++DOCSHELL 0x12f124800 == 19 [pid = 1722] [id = 979] 04:06:41 INFO - ++DOMWINDOW == 60 (0x1296dac00) [pid = 1722] [serial = 2351] [outer = 0x0] 04:06:41 INFO - ++DOMWINDOW == 61 (0x129d06800) [pid = 1722] [serial = 2352] [outer = 0x1296dac00] 04:06:41 INFO - ++DOCSHELL 0x12f239000 == 20 [pid = 1722] [id = 980] 04:06:41 INFO - ++DOMWINDOW == 62 (0x12c371000) [pid = 1722] [serial = 2353] [outer = 0x0] 04:06:41 INFO - ++DOMWINDOW == 63 (0x12c376c00) [pid = 1722] [serial = 2354] [outer = 0x12c371000] 04:06:41 INFO - ++DOCSHELL 0x129659000 == 21 [pid = 1722] [id = 981] 04:06:41 INFO - ++DOMWINDOW == 64 (0x12d406000) [pid = 1722] [serial = 2355] [outer = 0x0] 04:06:41 INFO - ++DOMWINDOW == 65 (0x12d406800) [pid = 1722] [serial = 2356] [outer = 0x12d406000] 04:06:41 INFO - ++DOCSHELL 0x12f5c0800 == 22 [pid = 1722] [id = 982] 04:06:41 INFO - ++DOMWINDOW == 66 (0x12e05e400) [pid = 1722] [serial = 2357] [outer = 0x0] 04:06:41 INFO - ++DOMWINDOW == 67 (0x12e05f400) [pid = 1722] [serial = 2358] [outer = 0x12e05e400] 04:06:42 INFO - ++DOCSHELL 0x120e0a800 == 23 [pid = 1722] [id = 983] 04:06:42 INFO - ++DOMWINDOW == 68 (0x11f110800) [pid = 1722] [serial = 2359] [outer = 0x0] 04:06:42 INFO - ++DOMWINDOW == 69 (0x11ec99000) [pid = 1722] [serial = 2360] [outer = 0x11f110800] 04:06:42 INFO - ++DOCSHELL 0x1293c7000 == 24 [pid = 1722] [id = 984] 04:06:42 INFO - ++DOMWINDOW == 70 (0x121316800) [pid = 1722] [serial = 2361] [outer = 0x0] 04:06:42 INFO - ++DOMWINDOW == 71 (0x1245be400) [pid = 1722] [serial = 2362] [outer = 0x121316800] 04:06:43 INFO - ++DOCSHELL 0x12d421800 == 25 [pid = 1722] [id = 985] 04:06:43 INFO - ++DOMWINDOW == 72 (0x1273e6400) [pid = 1722] [serial = 2363] [outer = 0x0] 04:06:43 INFO - ++DOMWINDOW == 73 (0x128270c00) [pid = 1722] [serial = 2364] [outer = 0x1273e6400] 04:06:43 INFO - ++DOCSHELL 0x12ee77000 == 26 [pid = 1722] [id = 986] 04:06:43 INFO - ++DOMWINDOW == 74 (0x129709000) [pid = 1722] [serial = 2365] [outer = 0x0] 04:06:43 INFO - --DOCSHELL 0x12ee77000 == 25 [pid = 1722] [id = 986] 04:06:43 INFO - [1722] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 04:06:43 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 391: TypeError: this._tabs is null 04:06:43 INFO - --DOMWINDOW == 73 (0x129709000) [pid = 1722] [serial = 2365] [outer = 0x0] [url = ] 04:06:43 INFO - ++DOCSHELL 0x12f226000 == 26 [pid = 1722] [id = 987] 04:06:43 INFO - ++DOMWINDOW == 74 (0x12c36bc00) [pid = 1722] [serial = 2366] [outer = 0x0] 04:06:43 INFO - --DOCSHELL 0x12f226000 == 25 [pid = 1722] [id = 987] 04:06:43 INFO - [1722] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 04:06:43 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 391: TypeError: this._tabs is null 04:06:43 INFO - --DOMWINDOW == 73 (0x12c36bc00) [pid = 1722] [serial = 2366] [outer = 0x0] [url = ] 04:06:44 INFO - ++DOCSHELL 0x12f122800 == 26 [pid = 1722] [id = 988] 04:06:44 INFO - ++DOMWINDOW == 74 (0x12e062c00) [pid = 1722] [serial = 2367] [outer = 0x0] 04:06:44 INFO - --DOCSHELL 0x12f122800 == 25 [pid = 1722] [id = 988] 04:06:44 INFO - [1722] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 04:06:44 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 391: TypeError: this._tabs is null 04:06:44 INFO - --DOMWINDOW == 73 (0x12e062c00) [pid = 1722] [serial = 2367] [outer = 0x0] [url = ] 04:06:44 INFO - ++DOCSHELL 0x12f5a9800 == 26 [pid = 1722] [id = 989] 04:06:44 INFO - ++DOMWINDOW == 74 (0x12e06b400) [pid = 1722] [serial = 2368] [outer = 0x0] 04:06:44 INFO - ++DOMWINDOW == 75 (0x12e0ef400) [pid = 1722] [serial = 2369] [outer = 0x12e06b400] 04:06:44 INFO - ++DOCSHELL 0x12f903000 == 27 [pid = 1722] [id = 990] 04:06:44 INFO - ++DOMWINDOW == 76 (0x12f25bc00) [pid = 1722] [serial = 2370] [outer = 0x0] 04:06:44 INFO - ++DOMWINDOW == 77 (0x12f25d000) [pid = 1722] [serial = 2371] [outer = 0x12f25bc00] 04:06:45 INFO - --DOCSHELL 0x11284f000 == 26 [pid = 1722] [id = 973] 04:06:45 INFO - --DOCSHELL 0x128227000 == 25 [pid = 1722] [id = 974] 04:06:45 INFO - --DOCSHELL 0x113306800 == 24 [pid = 1722] [id = 975] 04:06:45 INFO - --DOCSHELL 0x12c262000 == 23 [pid = 1722] [id = 976] 04:06:45 INFO - --DOCSHELL 0x12ee66000 == 22 [pid = 1722] [id = 977] 04:06:45 INFO - --DOCSHELL 0x12ee71800 == 21 [pid = 1722] [id = 978] 04:06:45 INFO - --DOCSHELL 0x12f124800 == 20 [pid = 1722] [id = 979] 04:06:45 INFO - --DOCSHELL 0x12f239000 == 19 [pid = 1722] [id = 980] 04:06:45 INFO - --DOCSHELL 0x120e11000 == 18 [pid = 1722] [id = 958] 04:06:45 INFO - --DOCSHELL 0x112cbe000 == 17 [pid = 1722] [id = 957] 04:06:45 INFO - --DOCSHELL 0x129659000 == 16 [pid = 1722] [id = 981] 04:06:45 INFO - --DOCSHELL 0x12f5c0800 == 15 [pid = 1722] [id = 982] 04:06:45 INFO - --DOCSHELL 0x120e0a800 == 14 [pid = 1722] [id = 983] 04:06:45 INFO - --DOCSHELL 0x1293c7000 == 13 [pid = 1722] [id = 984] 04:06:45 INFO - --DOCSHELL 0x12d421800 == 12 [pid = 1722] [id = 985] 04:06:45 INFO - --DOMWINDOW == 76 (0x121315800) [pid = 1722] [serial = 2287] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:45 INFO - --DOMWINDOW == 75 (0x122d42400) [pid = 1722] [serial = 2289] [outer = 0x0] [url = about:blank] 04:06:45 INFO - --DOMWINDOW == 74 (0x120e23400) [pid = 1722] [serial = 2284] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-04.html] 04:06:45 INFO - --DOMWINDOW == 73 (0x1276c3c00) [pid = 1722] [serial = 2305] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 72 (0x12477cc00) [pid = 1722] [serial = 2303] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 71 (0x120ffd800) [pid = 1722] [serial = 2301] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 70 (0x12f2bec00) [pid = 1722] [serial = 2299] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 69 (0x112f41400) [pid = 1722] [serial = 2328] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 68 (0x129707400) [pid = 1722] [serial = 2324] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 67 (0x1296d2800) [pid = 1722] [serial = 2322] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 66 (0x122ea5400) [pid = 1722] [serial = 2316] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 65 (0x1283f4000) [pid = 1722] [serial = 2318] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 64 (0x12d404400) [pid = 1722] [serial = 2326] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 63 (0x129393800) [pid = 1722] [serial = 2320] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 62 (0x127329400) [pid = 1722] [serial = 2331] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 61 (0x12211c000) [pid = 1722] [serial = 2329] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 60 (0x11318ac00) [pid = 1722] [serial = 2306] [outer = 0x0] [url = about:blank] 04:06:45 INFO - --DOMWINDOW == 59 (0x11ebb5400) [pid = 1722] [serial = 2308] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2005] 04:06:45 INFO - --DOMWINDOW == 58 (0x120e32000) [pid = 1722] [serial = 2339] [outer = 0x0] [url = about:blank] 04:06:45 INFO - --DOMWINDOW == 57 (0x12c371000) [pid = 1722] [serial = 2353] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 56 (0x1296dac00) [pid = 1722] [serial = 2351] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 55 (0x12e05e400) [pid = 1722] [serial = 2357] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 54 (0x12d406000) [pid = 1722] [serial = 2355] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 53 (0x1283f0400) [pid = 1722] [serial = 2347] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 52 (0x128278000) [pid = 1722] [serial = 2345] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 51 (0x124c34c00) [pid = 1722] [serial = 2343] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 50 (0x124884800) [pid = 1722] [serial = 2349] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:45 INFO - --DOMWINDOW == 49 (0x122124000) [pid = 1722] [serial = 2313] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:45 INFO - --DOMWINDOW == 48 (0x120258400) [pid = 1722] [serial = 2310] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:45 INFO - --DOMWINDOW == 47 (0x113d0cc00) [pid = 1722] [serial = 2307] [outer = 0x0] [url = about:blank] 04:06:45 INFO - MEMORY STAT | vsize 3454MB | residentFast 534MB | heapAllocated 127MB 04:06:45 INFO - 431 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_06.js | took 7335ms 04:06:45 INFO - ++DOCSHELL 0x112cbe000 == 13 [pid = 1722] [id = 991] 04:06:45 INFO - ++DOMWINDOW == 48 (0x11318ac00) [pid = 1722] [serial = 2372] [outer = 0x0] 04:06:45 INFO - ++DOMWINDOW == 49 (0x11344c000) [pid = 1722] [serial = 2373] [outer = 0x11318ac00] 04:06:46 INFO - 432 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_copy_newlines.js 04:06:46 INFO - ++DOCSHELL 0x120ea4800 == 14 [pid = 1722] [id = 992] 04:06:46 INFO - ++DOMWINDOW == 50 (0x11ebb9400) [pid = 1722] [serial = 2374] [outer = 0x0] 04:06:46 INFO - ++DOMWINDOW == 51 (0x12025b000) [pid = 1722] [serial = 2375] [outer = 0x11ebb9400] 04:06:46 INFO - ++DOCSHELL 0x112cbf800 == 15 [pid = 1722] [id = 993] 04:06:46 INFO - ++DOMWINDOW == 52 (0x1202eec00) [pid = 1722] [serial = 2376] [outer = 0x0] 04:06:46 INFO - ++DOMWINDOW == 53 (0x120e32400) [pid = 1722] [serial = 2377] [outer = 0x1202eec00] 04:06:46 INFO - ++DOMWINDOW == 54 (0x12130d800) [pid = 1722] [serial = 2378] [outer = 0x1202eec00] 04:06:46 INFO - ++DOCSHELL 0x128228800 == 16 [pid = 1722] [id = 994] 04:06:46 INFO - ++DOMWINDOW == 55 (0x1223f3400) [pid = 1722] [serial = 2379] [outer = 0x0] 04:06:46 INFO - ++DOMWINDOW == 56 (0x1225e1c00) [pid = 1722] [serial = 2380] [outer = 0x1223f3400] 04:06:48 INFO - --DOCSHELL 0x12156a000 == 15 [pid = 1722] [id = 972] 04:06:48 INFO - --DOCSHELL 0x112ccc800 == 14 [pid = 1722] [id = 971] 04:06:48 INFO - --DOCSHELL 0x128228800 == 13 [pid = 1722] [id = 994] 04:06:48 INFO - --DOCSHELL 0x12f903000 == 12 [pid = 1722] [id = 990] 04:06:48 INFO - --DOCSHELL 0x12f5a9800 == 11 [pid = 1722] [id = 989] 04:06:48 INFO - --DOMWINDOW == 55 (0x1221b5000) [pid = 1722] [serial = 2314] [outer = 0x0] [url = about:blank] 04:06:48 INFO - --DOMWINDOW == 54 (0x120ffe000) [pid = 1722] [serial = 2312] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:48 INFO - --DOMWINDOW == 53 (0x12706d400) [pid = 1722] [serial = 2332] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 52 (0x12211a800) [pid = 1722] [serial = 2330] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 51 (0x12c376c00) [pid = 1722] [serial = 2354] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 50 (0x129d06800) [pid = 1722] [serial = 2352] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 49 (0x12d406800) [pid = 1722] [serial = 2356] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 48 (0x12e05f400) [pid = 1722] [serial = 2358] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 47 (0x11eefbc00) [pid = 1722] [serial = 2309] [outer = 0x0] [url = about:blank] 04:06:48 INFO - --DOMWINDOW == 46 (0x1283f1800) [pid = 1722] [serial = 2348] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 45 (0x128307c00) [pid = 1722] [serial = 2346] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 44 (0x12504d000) [pid = 1722] [serial = 2344] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 43 (0x1296cfc00) [pid = 1722] [serial = 2350] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 42 (0x12f25bc00) [pid = 1722] [serial = 2370] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 41 (0x12e06b400) [pid = 1722] [serial = 2368] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 40 (0x1273e6400) [pid = 1722] [serial = 2363] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 39 (0x121316800) [pid = 1722] [serial = 2361] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 38 (0x11f110800) [pid = 1722] [serial = 2359] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:48 INFO - --DOMWINDOW == 37 (0x11326ac00) [pid = 1722] [serial = 2336] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2006] 04:06:48 INFO - --DOMWINDOW == 36 (0x1203dfc00) [pid = 1722] [serial = 2337] [outer = 0x0] [url = about:blank] 04:06:48 INFO - --DOMWINDOW == 35 (0x114b5a800) [pid = 1722] [serial = 2334] [outer = 0x0] [url = about:blank] 04:06:48 INFO - --DOMWINDOW == 34 (0x11e714800) [pid = 1722] [serial = 2335] [outer = 0x0] [url = about:blank] 04:06:48 INFO - --DOMWINDOW == 33 (0x120e32400) [pid = 1722] [serial = 2377] [outer = 0x0] [url = about:blank] 04:06:48 INFO - --DOMWINDOW == 32 (0x1223e7000) [pid = 1722] [serial = 2341] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:48 INFO - --DOMWINDOW == 31 (0x1203e7000) [pid = 1722] [serial = 2338] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:48 INFO - MEMORY STAT | vsize 3450MB | residentFast 530MB | heapAllocated 123MB 04:06:48 INFO - 433 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_copy_newlines.js | took 2254ms 04:06:48 INFO - ++DOCSHELL 0x112ba5800 == 12 [pid = 1722] [id = 995] 04:06:48 INFO - ++DOMWINDOW == 32 (0x112f42800) [pid = 1722] [serial = 2381] [outer = 0x0] 04:06:48 INFO - ++DOMWINDOW == 33 (0x113165400) [pid = 1722] [serial = 2382] [outer = 0x112f42800] 04:06:48 INFO - 434 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_01.js 04:06:48 INFO - ++DOCSHELL 0x121853800 == 13 [pid = 1722] [id = 996] 04:06:48 INFO - ++DOMWINDOW == 34 (0x115146000) [pid = 1722] [serial = 2383] [outer = 0x0] 04:06:48 INFO - ++DOMWINDOW == 35 (0x11e7aa000) [pid = 1722] [serial = 2384] [outer = 0x115146000] 04:06:48 INFO - ++DOMWINDOW == 36 (0x120d18800) [pid = 1722] [serial = 2385] [outer = 0x115146000] 04:06:48 INFO - ++DOCSHELL 0x12820e000 == 14 [pid = 1722] [id = 997] 04:06:48 INFO - ++DOMWINDOW == 37 (0x120e32400) [pid = 1722] [serial = 2386] [outer = 0x0] 04:06:48 INFO - ++DOMWINDOW == 38 (0x120ff7400) [pid = 1722] [serial = 2387] [outer = 0x120e32400] 04:06:48 INFO - ++DOCSHELL 0x12469d800 == 15 [pid = 1722] [id = 998] 04:06:48 INFO - ++DOMWINDOW == 39 (0x12110d800) [pid = 1722] [serial = 2388] [outer = 0x0] 04:06:48 INFO - ++DOMWINDOW == 40 (0x121115c00) [pid = 1722] [serial = 2389] [outer = 0x12110d800] 04:06:48 INFO - ++DOMWINDOW == 41 (0x121318c00) [pid = 1722] [serial = 2390] [outer = 0x12110d800] 04:06:48 INFO - ++DOCSHELL 0x12965a000 == 16 [pid = 1722] [id = 999] 04:06:48 INFO - ++DOMWINDOW == 42 (0x1225d6800) [pid = 1722] [serial = 2391] [outer = 0x0] 04:06:48 INFO - ++DOMWINDOW == 43 (0x122d4a000) [pid = 1722] [serial = 2392] [outer = 0x1225d6800] 04:06:53 INFO - --DOCSHELL 0x112cbe000 == 15 [pid = 1722] [id = 991] 04:06:53 INFO - --DOCSHELL 0x112cbf800 == 14 [pid = 1722] [id = 993] 04:06:53 INFO - --DOCSHELL 0x120ea4800 == 13 [pid = 1722] [id = 992] 04:06:53 INFO - --DOCSHELL 0x12469d800 == 12 [pid = 1722] [id = 998] 04:06:53 INFO - --DOCSHELL 0x12965a000 == 11 [pid = 1722] [id = 999] 04:06:53 INFO - --DOMWINDOW == 42 (0x12130d400) [pid = 1722] [serial = 2340] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:53 INFO - --DOMWINDOW == 41 (0x1225e1400) [pid = 1722] [serial = 2342] [outer = 0x0] [url = about:blank] 04:06:53 INFO - --DOMWINDOW == 40 (0x12f25d000) [pid = 1722] [serial = 2371] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:53 INFO - --DOMWINDOW == 39 (0x12e0ef400) [pid = 1722] [serial = 2369] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:53 INFO - --DOMWINDOW == 38 (0x128270c00) [pid = 1722] [serial = 2364] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:53 INFO - --DOMWINDOW == 37 (0x1245be400) [pid = 1722] [serial = 2362] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:53 INFO - --DOMWINDOW == 36 (0x11ec99000) [pid = 1722] [serial = 2360] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:06:53 INFO - --DOMWINDOW == 35 (0x1202eec00) [pid = 1722] [serial = 2376] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:06:53 INFO - --DOMWINDOW == 34 (0x1223f3400) [pid = 1722] [serial = 2379] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:06:53 INFO - --DOMWINDOW == 33 (0x11318ac00) [pid = 1722] [serial = 2372] [outer = 0x0] [url = about:blank] 04:06:53 INFO - --DOMWINDOW == 32 (0x11ebb9400) [pid = 1722] [serial = 2374] [outer = 0x0] [url = data:text/html;charset=utf8,<p>hello%20world,%20bug%20916997] 04:06:53 INFO - --DOMWINDOW == 31 (0x11344c000) [pid = 1722] [serial = 2373] [outer = 0x0] [url = about:blank] 04:06:53 INFO - --DOMWINDOW == 30 (0x12025b000) [pid = 1722] [serial = 2375] [outer = 0x0] [url = about:blank] 04:06:53 INFO - --DOMWINDOW == 29 (0x11e7aa000) [pid = 1722] [serial = 2384] [outer = 0x0] [url = about:blank] 04:06:53 INFO - --DOMWINDOW == 28 (0x121115c00) [pid = 1722] [serial = 2389] [outer = 0x0] [url = about:blank] 04:06:53 INFO - --DOCSHELL 0x12820e000 == 10 [pid = 1722] [id = 997] 04:06:53 INFO - MEMORY STAT | vsize 3450MB | residentFast 530MB | heapAllocated 123MB 04:06:53 INFO - 435 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_01.js | took 5370ms 04:06:53 INFO - ++DOCSHELL 0x112ba8800 == 11 [pid = 1722] [id = 1000] 04:06:53 INFO - ++DOMWINDOW == 29 (0x113e11c00) [pid = 1722] [serial = 2393] [outer = 0x0] 04:06:53 INFO - ++DOMWINDOW == 30 (0x115145000) [pid = 1722] [serial = 2394] [outer = 0x113e11c00] 04:06:53 INFO - 436 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_02.js 04:06:53 INFO - ++DOCSHELL 0x12184d800 == 12 [pid = 1722] [id = 1001] 04:06:53 INFO - ++DOMWINDOW == 31 (0x113399400) [pid = 1722] [serial = 2395] [outer = 0x0] 04:06:54 INFO - ++DOMWINDOW == 32 (0x1202e4000) [pid = 1722] [serial = 2396] [outer = 0x113399400] 04:06:54 INFO - ++DOMWINDOW == 33 (0x12449d000) [pid = 1722] [serial = 2397] [outer = 0x113399400] 04:06:54 INFO - ++DOCSHELL 0x126190800 == 13 [pid = 1722] [id = 1002] 04:06:54 INFO - ++DOMWINDOW == 34 (0x113447000) [pid = 1722] [serial = 2398] [outer = 0x0] 04:06:54 INFO - ++DOMWINDOW == 35 (0x120fe6400) [pid = 1722] [serial = 2399] [outer = 0x113447000] 04:06:54 INFO - ++DOCSHELL 0x12156b000 == 14 [pid = 1722] [id = 1003] 04:06:54 INFO - ++DOMWINDOW == 36 (0x121108800) [pid = 1722] [serial = 2400] [outer = 0x0] 04:06:54 INFO - ++DOMWINDOW == 37 (0x12110b400) [pid = 1722] [serial = 2401] [outer = 0x121108800] 04:06:54 INFO - ++DOMWINDOW == 38 (0x121318400) [pid = 1722] [serial = 2402] [outer = 0x121108800] 04:06:54 INFO - ++DOCSHELL 0x1293cc000 == 15 [pid = 1722] [id = 1004] 04:06:54 INFO - ++DOMWINDOW == 39 (0x1225e1800) [pid = 1722] [serial = 2403] [outer = 0x0] 04:06:54 INFO - ++DOMWINDOW == 40 (0x122d4f000) [pid = 1722] [serial = 2404] [outer = 0x1225e1800] 04:06:55 INFO - ++DOCSHELL 0x1293dc000 == 16 [pid = 1722] [id = 1005] 04:06:55 INFO - ++DOMWINDOW == 41 (0x128276400) [pid = 1722] [serial = 2405] [outer = 0x0] 04:06:55 INFO - ++DOMWINDOW == 42 (0x128277800) [pid = 1722] [serial = 2406] [outer = 0x128276400] 04:06:55 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:55 INFO - ++DOCSHELL 0x12ee6d000 == 17 [pid = 1722] [id = 1006] 04:06:55 INFO - ++DOMWINDOW == 43 (0x1283f8400) [pid = 1722] [serial = 2407] [outer = 0x0] 04:06:55 INFO - ++DOMWINDOW == 44 (0x1283f8c00) [pid = 1722] [serial = 2408] [outer = 0x1283f8400] 04:06:55 INFO - ++DOCSHELL 0x12ee73000 == 18 [pid = 1722] [id = 1007] 04:06:55 INFO - ++DOMWINDOW == 45 (0x129389800) [pid = 1722] [serial = 2409] [outer = 0x0] 04:06:55 INFO - ++DOCSHELL 0x12ee74000 == 19 [pid = 1722] [id = 1008] 04:06:55 INFO - ++DOMWINDOW == 46 (0x12938a000) [pid = 1722] [serial = 2410] [outer = 0x0] 04:06:55 INFO - ++DOCSHELL 0x12ee74800 == 20 [pid = 1722] [id = 1009] 04:06:55 INFO - ++DOMWINDOW == 47 (0x12938a800) [pid = 1722] [serial = 2411] [outer = 0x0] 04:06:55 INFO - ++DOCSHELL 0x12ee75000 == 21 [pid = 1722] [id = 1010] 04:06:55 INFO - ++DOMWINDOW == 48 (0x12938cc00) [pid = 1722] [serial = 2412] [outer = 0x0] 04:06:55 INFO - ++DOCSHELL 0x110edd000 == 22 [pid = 1722] [id = 1011] 04:06:55 INFO - ++DOMWINDOW == 49 (0x12938d800) [pid = 1722] [serial = 2413] [outer = 0x0] 04:06:55 INFO - ++DOMWINDOW == 50 (0x120fee000) [pid = 1722] [serial = 2414] [outer = 0x129389800] 04:06:55 INFO - ++DOMWINDOW == 51 (0x128279c00) [pid = 1722] [serial = 2415] [outer = 0x12938a000] 04:06:55 INFO - ++DOMWINDOW == 52 (0x128305c00) [pid = 1722] [serial = 2416] [outer = 0x12938a800] 04:06:55 INFO - ++DOMWINDOW == 53 (0x128307c00) [pid = 1722] [serial = 2417] [outer = 0x12938cc00] 04:06:55 INFO - ++DOMWINDOW == 54 (0x128308c00) [pid = 1722] [serial = 2418] [outer = 0x12938d800] 04:06:55 INFO - ++DOCSHELL 0x12f5b9800 == 23 [pid = 1722] [id = 1012] 04:06:55 INFO - ++DOMWINDOW == 55 (0x129d0b800) [pid = 1722] [serial = 2419] [outer = 0x0] 04:06:55 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:55 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:55 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:55 INFO - ++DOCSHELL 0x12f6d5000 == 24 [pid = 1722] [id = 1013] 04:06:55 INFO - ++DOMWINDOW == 56 (0x12c4e5c00) [pid = 1722] [serial = 2420] [outer = 0x0] 04:06:55 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:55 INFO - ++DOMWINDOW == 57 (0x12d404c00) [pid = 1722] [serial = 2421] [outer = 0x129d0b800] 04:06:56 INFO - ++DOMWINDOW == 58 (0x12dd17000) [pid = 1722] [serial = 2422] [outer = 0x12c4e5c00] 04:06:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:56 INFO - ++DOCSHELL 0x12ee7b800 == 25 [pid = 1722] [id = 1014] 04:06:56 INFO - ++DOMWINDOW == 59 (0x128278c00) [pid = 1722] [serial = 2423] [outer = 0x0] 04:06:56 INFO - ++DOCSHELL 0x12ee7f800 == 26 [pid = 1722] [id = 1015] 04:06:56 INFO - ++DOMWINDOW == 60 (0x12e05f000) [pid = 1722] [serial = 2424] [outer = 0x0] 04:06:56 INFO - ++DOCSHELL 0x12f119800 == 27 [pid = 1722] [id = 1016] 04:06:56 INFO - ++DOMWINDOW == 61 (0x12e060400) [pid = 1722] [serial = 2425] [outer = 0x0] 04:06:56 INFO - ++DOCSHELL 0x12f11e000 == 28 [pid = 1722] [id = 1017] 04:06:56 INFO - ++DOMWINDOW == 62 (0x128386400) [pid = 1722] [serial = 2426] [outer = 0x0] 04:06:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:06:56 INFO - ++DOCSHELL 0x12f122800 == 29 [pid = 1722] [id = 1018] 04:06:56 INFO - ++DOMWINDOW == 63 (0x12e061800) [pid = 1722] [serial = 2427] [outer = 0x0] 04:06:56 INFO - ++DOMWINDOW == 64 (0x12e062400) [pid = 1722] [serial = 2428] [outer = 0x12e061800] 04:06:56 INFO - ++DOMWINDOW == 65 (0x12f5a3000) [pid = 1722] [serial = 2429] [outer = 0x128278c00] 04:06:56 INFO - ++DOMWINDOW == 66 (0x12f5a5800) [pid = 1722] [serial = 2430] [outer = 0x12e05f000] 04:06:56 INFO - ++DOMWINDOW == 67 (0x12f790000) [pid = 1722] [serial = 2431] [outer = 0x12e060400] 04:06:56 INFO - ++DOMWINDOW == 68 (0x12f795400) [pid = 1722] [serial = 2432] [outer = 0x128386400] 04:06:56 INFO - ++DOMWINDOW == 69 (0x12f798c00) [pid = 1722] [serial = 2433] [outer = 0x12e061800] 04:07:01 INFO - --DOCSHELL 0x12f122800 == 28 [pid = 1722] [id = 1018] 04:07:01 INFO - --DOCSHELL 0x112ba5800 == 27 [pid = 1722] [id = 995] 04:07:02 INFO - --DOCSHELL 0x12ee7f800 == 26 [pid = 1722] [id = 1015] 04:07:02 INFO - --DOCSHELL 0x12f119800 == 25 [pid = 1722] [id = 1016] 04:07:02 INFO - --DOCSHELL 0x12ee7b800 == 24 [pid = 1722] [id = 1014] 04:07:02 INFO - --DOCSHELL 0x12f11e000 == 23 [pid = 1722] [id = 1017] 04:07:02 INFO - --DOCSHELL 0x12f6d5000 == 22 [pid = 1722] [id = 1013] 04:07:02 INFO - --DOCSHELL 0x12f5b9800 == 21 [pid = 1722] [id = 1012] 04:07:02 INFO - --DOCSHELL 0x1293dc000 == 20 [pid = 1722] [id = 1005] 04:07:02 INFO - --DOCSHELL 0x1293cc000 == 19 [pid = 1722] [id = 1004] 04:07:03 INFO - --DOCSHELL 0x121853800 == 18 [pid = 1722] [id = 996] 04:07:03 INFO - --DOCSHELL 0x12ee73000 == 17 [pid = 1722] [id = 1007] 04:07:03 INFO - --DOCSHELL 0x12ee74000 == 16 [pid = 1722] [id = 1008] 04:07:03 INFO - --DOCSHELL 0x12ee74800 == 15 [pid = 1722] [id = 1009] 04:07:03 INFO - --DOCSHELL 0x12ee75000 == 14 [pid = 1722] [id = 1010] 04:07:03 INFO - --DOCSHELL 0x110edd000 == 13 [pid = 1722] [id = 1011] 04:07:03 INFO - --DOCSHELL 0x12ee6d000 == 12 [pid = 1722] [id = 1006] 04:07:03 INFO - --DOMWINDOW == 68 (0x1225e1c00) [pid = 1722] [serial = 2380] [outer = 0x0] [url = about:blank] 04:07:03 INFO - --DOMWINDOW == 67 (0x12130d800) [pid = 1722] [serial = 2378] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:03 INFO - --DOMWINDOW == 66 (0x12110d800) [pid = 1722] [serial = 2388] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:03 INFO - --DOMWINDOW == 65 (0x112f42800) [pid = 1722] [serial = 2381] [outer = 0x0] [url = about:blank] 04:07:03 INFO - --DOMWINDOW == 64 (0x120e32400) [pid = 1722] [serial = 2386] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 04:07:03 INFO - --DOMWINDOW == 63 (0x115146000) [pid = 1722] [serial = 2383] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 04:07:03 INFO - --DOMWINDOW == 62 (0x12e061800) [pid = 1722] [serial = 2427] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:03 INFO - --DOMWINDOW == 61 (0x129389800) [pid = 1722] [serial = 2409] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:03 INFO - --DOMWINDOW == 60 (0x128386400) [pid = 1722] [serial = 2426] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:03 INFO - --DOMWINDOW == 59 (0x12e060400) [pid = 1722] [serial = 2425] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:03 INFO - --DOMWINDOW == 58 (0x12e05f000) [pid = 1722] [serial = 2424] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:03 INFO - --DOMWINDOW == 57 (0x129d0b800) [pid = 1722] [serial = 2419] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:03 INFO - --DOMWINDOW == 56 (0x12938cc00) [pid = 1722] [serial = 2412] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:03 INFO - --DOMWINDOW == 55 (0x12938a800) [pid = 1722] [serial = 2411] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:03 INFO - --DOMWINDOW == 54 (0x12938a000) [pid = 1722] [serial = 2410] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:03 INFO - --DOMWINDOW == 53 (0x1225d6800) [pid = 1722] [serial = 2391] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:03 INFO - --DOMWINDOW == 52 (0x12110b400) [pid = 1722] [serial = 2401] [outer = 0x0] [url = about:blank] 04:07:03 INFO - --DOMWINDOW == 51 (0x1202e4000) [pid = 1722] [serial = 2396] [outer = 0x0] [url = about:blank] 04:07:03 INFO - --DOMWINDOW == 50 (0x120ff7400) [pid = 1722] [serial = 2387] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 04:07:03 INFO - --DOMWINDOW == 49 (0x12f798c00) [pid = 1722] [serial = 2433] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:03 INFO - --DOMWINDOW == 48 (0x12e062400) [pid = 1722] [serial = 2428] [outer = 0x0] [url = about:blank] 04:07:03 INFO - --DOMWINDOW == 47 (0x113165400) [pid = 1722] [serial = 2382] [outer = 0x0] [url = about:blank] 04:07:03 INFO - --DOCSHELL 0x126190800 == 11 [pid = 1722] [id = 1002] 04:07:03 INFO - --DOMWINDOW == 46 (0x128305c00) [pid = 1722] [serial = 2416] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:03 INFO - --DOMWINDOW == 45 (0x120d18800) [pid = 1722] [serial = 2385] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 04:07:03 INFO - MEMORY STAT | vsize 3450MB | residentFast 530MB | heapAllocated 125MB 04:07:03 INFO - 437 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_02.js | took 9902ms 04:07:03 INFO - ++DOCSHELL 0x112ba5800 == 12 [pid = 1722] [id = 1019] 04:07:03 INFO - ++DOMWINDOW == 46 (0x112ca3800) [pid = 1722] [serial = 2434] [outer = 0x0] 04:07:03 INFO - ++DOMWINDOW == 47 (0x112f44c00) [pid = 1722] [serial = 2435] [outer = 0x112ca3800] 04:07:03 INFO - 438 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_03.js 04:07:04 INFO - ++DOCSHELL 0x112e7c800 == 13 [pid = 1722] [id = 1020] 04:07:04 INFO - ++DOMWINDOW == 48 (0x113399c00) [pid = 1722] [serial = 2436] [outer = 0x0] 04:07:04 INFO - ++DOMWINDOW == 49 (0x113447800) [pid = 1722] [serial = 2437] [outer = 0x113399c00] 04:07:04 INFO - ++DOMWINDOW == 50 (0x120fed400) [pid = 1722] [serial = 2438] [outer = 0x113399c00] 04:07:04 INFO - ++DOCSHELL 0x113454800 == 14 [pid = 1722] [id = 1021] 04:07:04 INFO - ++DOMWINDOW == 51 (0x113e08c00) [pid = 1722] [serial = 2439] [outer = 0x0] 04:07:04 INFO - ++DOMWINDOW == 52 (0x114dbec00) [pid = 1722] [serial = 2440] [outer = 0x113e08c00] 04:07:04 INFO - ++DOCSHELL 0x113307800 == 15 [pid = 1722] [id = 1022] 04:07:04 INFO - ++DOMWINDOW == 53 (0x11e7ae800) [pid = 1722] [serial = 2441] [outer = 0x0] 04:07:04 INFO - ++DOMWINDOW == 54 (0x11ebb6c00) [pid = 1722] [serial = 2442] [outer = 0x11e7ae800] 04:07:04 INFO - ++DOMWINDOW == 55 (0x120159800) [pid = 1722] [serial = 2443] [outer = 0x11e7ae800] 04:07:04 INFO - ++DOCSHELL 0x113518800 == 16 [pid = 1722] [id = 1023] 04:07:04 INFO - ++DOMWINDOW == 56 (0x120ffd000) [pid = 1722] [serial = 2444] [outer = 0x0] 04:07:04 INFO - ++DOMWINDOW == 57 (0x12110b400) [pid = 1722] [serial = 2445] [outer = 0x120ffd000] 04:07:05 INFO - ++DOCSHELL 0x113e50800 == 17 [pid = 1722] [id = 1024] 04:07:05 INFO - ++DOMWINDOW == 58 (0x126137400) [pid = 1722] [serial = 2446] [outer = 0x0] 04:07:05 INFO - ++DOMWINDOW == 59 (0x12613d400) [pid = 1722] [serial = 2447] [outer = 0x126137400] 04:07:05 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:05 INFO - ++DOCSHELL 0x11fcc2000 == 18 [pid = 1722] [id = 1025] 04:07:05 INFO - ++DOMWINDOW == 60 (0x1276a8000) [pid = 1722] [serial = 2448] [outer = 0x0] 04:07:05 INFO - ++DOMWINDOW == 61 (0x1273e2000) [pid = 1722] [serial = 2449] [outer = 0x1276a8000] 04:07:05 INFO - ++DOCSHELL 0x120d4a000 == 19 [pid = 1722] [id = 1026] 04:07:05 INFO - ++DOMWINDOW == 62 (0x1276c1800) [pid = 1722] [serial = 2450] [outer = 0x0] 04:07:05 INFO - ++DOCSHELL 0x120dc4800 == 20 [pid = 1722] [id = 1027] 04:07:05 INFO - ++DOMWINDOW == 63 (0x1276c8c00) [pid = 1722] [serial = 2451] [outer = 0x0] 04:07:05 INFO - ++DOCSHELL 0x120dc6000 == 21 [pid = 1722] [id = 1028] 04:07:05 INFO - ++DOMWINDOW == 64 (0x12826b000) [pid = 1722] [serial = 2452] [outer = 0x0] 04:07:05 INFO - ++DOCSHELL 0x120dca000 == 22 [pid = 1722] [id = 1029] 04:07:05 INFO - ++DOMWINDOW == 65 (0x12826ec00) [pid = 1722] [serial = 2453] [outer = 0x0] 04:07:05 INFO - ++DOCSHELL 0x120dcd000 == 23 [pid = 1722] [id = 1030] 04:07:05 INFO - ++DOMWINDOW == 66 (0x128276800) [pid = 1722] [serial = 2454] [outer = 0x0] 04:07:05 INFO - ++DOMWINDOW == 67 (0x128279400) [pid = 1722] [serial = 2455] [outer = 0x1276c1800] 04:07:05 INFO - ++DOMWINDOW == 68 (0x128304800) [pid = 1722] [serial = 2456] [outer = 0x1276c8c00] 04:07:05 INFO - ++DOMWINDOW == 69 (0x128308000) [pid = 1722] [serial = 2457] [outer = 0x12826b000] 04:07:05 INFO - ++DOMWINDOW == 70 (0x12830a000) [pid = 1722] [serial = 2458] [outer = 0x12826ec00] 04:07:05 INFO - ++DOMWINDOW == 71 (0x12830b400) [pid = 1722] [serial = 2459] [outer = 0x128276800] 04:07:05 INFO - ++DOCSHELL 0x124f05800 == 24 [pid = 1722] [id = 1031] 04:07:05 INFO - ++DOMWINDOW == 72 (0x128386c00) [pid = 1722] [serial = 2460] [outer = 0x0] 04:07:05 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:05 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:05 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:05 INFO - ++DOCSHELL 0x124f18800 == 25 [pid = 1722] [id = 1032] 04:07:05 INFO - ++DOMWINDOW == 73 (0x126144000) [pid = 1722] [serial = 2461] [outer = 0x0] 04:07:05 INFO - ++DOCSHELL 0x124f19800 == 26 [pid = 1722] [id = 1033] 04:07:05 INFO - ++DOMWINDOW == 74 (0x1283edc00) [pid = 1722] [serial = 2462] [outer = 0x0] 04:07:05 INFO - ++DOCSHELL 0x124f1a000 == 27 [pid = 1722] [id = 1034] 04:07:05 INFO - ++DOMWINDOW == 75 (0x1283eec00) [pid = 1722] [serial = 2463] [outer = 0x0] 04:07:05 INFO - ++DOCSHELL 0x124f1a800 == 28 [pid = 1722] [id = 1035] 04:07:05 INFO - ++DOMWINDOW == 76 (0x1283ef400) [pid = 1722] [serial = 2464] [outer = 0x0] 04:07:05 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:05 INFO - ++DOCSHELL 0x124f1b000 == 29 [pid = 1722] [id = 1036] 04:07:05 INFO - ++DOMWINDOW == 77 (0x1283f0000) [pid = 1722] [serial = 2465] [outer = 0x0] 04:07:05 INFO - ++DOMWINDOW == 78 (0x1283f0c00) [pid = 1722] [serial = 2466] [outer = 0x1283f0000] 04:07:05 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:05 INFO - ++DOCSHELL 0x12570d800 == 30 [pid = 1722] [id = 1037] 04:07:05 INFO - ++DOMWINDOW == 79 (0x126485000) [pid = 1722] [serial = 2467] [outer = 0x0] 04:07:05 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:05 INFO - ++DOMWINDOW == 80 (0x1283f8000) [pid = 1722] [serial = 2468] [outer = 0x128386c00] 04:07:05 INFO - ++DOMWINDOW == 81 (0x1296ccc00) [pid = 1722] [serial = 2469] [outer = 0x126144000] 04:07:05 INFO - ++DOMWINDOW == 82 (0x1296ce000) [pid = 1722] [serial = 2470] [outer = 0x1283edc00] 04:07:05 INFO - ++DOMWINDOW == 83 (0x1296cf000) [pid = 1722] [serial = 2471] [outer = 0x1283eec00] 04:07:05 INFO - ++DOMWINDOW == 84 (0x1296d0000) [pid = 1722] [serial = 2472] [outer = 0x1283ef400] 04:07:05 INFO - ++DOMWINDOW == 85 (0x1296d1800) [pid = 1722] [serial = 2473] [outer = 0x1283f0000] 04:07:06 INFO - ++DOMWINDOW == 86 (0x1296d4000) [pid = 1722] [serial = 2474] [outer = 0x126485000] 04:07:06 INFO - --DOCSHELL 0x124f19800 == 29 [pid = 1722] [id = 1033] 04:07:06 INFO - --DOCSHELL 0x124f1a000 == 28 [pid = 1722] [id = 1034] 04:07:06 INFO - --DOCSHELL 0x124f18800 == 27 [pid = 1722] [id = 1032] 04:07:06 INFO - --DOCSHELL 0x124f1a800 == 26 [pid = 1722] [id = 1035] 04:07:06 INFO - --DOCSHELL 0x12570d800 == 25 [pid = 1722] [id = 1037] 04:07:06 INFO - --DOCSHELL 0x124f05800 == 24 [pid = 1722] [id = 1031] 04:07:07 INFO - --DOCSHELL 0x124f1b000 == 23 [pid = 1722] [id = 1036] 04:07:07 INFO - --DOCSHELL 0x12184d800 == 22 [pid = 1722] [id = 1001] 04:07:07 INFO - --DOCSHELL 0x113518800 == 21 [pid = 1722] [id = 1023] 04:07:07 INFO - --DOCSHELL 0x12156b000 == 20 [pid = 1722] [id = 1003] 04:07:07 INFO - --DOCSHELL 0x113e50800 == 19 [pid = 1722] [id = 1024] 04:07:07 INFO - --DOCSHELL 0x112ba8800 == 18 [pid = 1722] [id = 1000] 04:07:07 INFO - --DOCSHELL 0x11fcc2000 == 17 [pid = 1722] [id = 1025] 04:07:07 INFO - --DOMWINDOW == 85 (0x121318c00) [pid = 1722] [serial = 2390] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:07 INFO - --DOMWINDOW == 84 (0x122d4a000) [pid = 1722] [serial = 2392] [outer = 0x0] [url = about:blank] 04:07:07 INFO - --DOMWINDOW == 83 (0x120fee000) [pid = 1722] [serial = 2414] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:07 INFO - --DOMWINDOW == 82 (0x128279c00) [pid = 1722] [serial = 2415] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:07 INFO - --DOMWINDOW == 81 (0x12d404c00) [pid = 1722] [serial = 2421] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:07 INFO - --DOMWINDOW == 80 (0x12f5a5800) [pid = 1722] [serial = 2430] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:07 INFO - --DOMWINDOW == 79 (0x12f790000) [pid = 1722] [serial = 2431] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:07 INFO - --DOMWINDOW == 78 (0x12f795400) [pid = 1722] [serial = 2432] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:07 INFO - --DOMWINDOW == 77 (0x128307c00) [pid = 1722] [serial = 2417] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:07 INFO - --DOMWINDOW == 76 (0x128278c00) [pid = 1722] [serial = 2423] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:07 INFO - --DOMWINDOW == 75 (0x12c4e5c00) [pid = 1722] [serial = 2420] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:07 INFO - --DOMWINDOW == 74 (0x1283f8400) [pid = 1722] [serial = 2407] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:07:07 INFO - --DOMWINDOW == 73 (0x1225e1800) [pid = 1722] [serial = 2403] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:07 INFO - --DOMWINDOW == 72 (0x128276400) [pid = 1722] [serial = 2405] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:07:07 INFO - --DOMWINDOW == 71 (0x121108800) [pid = 1722] [serial = 2400] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:07 INFO - --DOMWINDOW == 70 (0x12938d800) [pid = 1722] [serial = 2413] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:07 INFO - --DOMWINDOW == 69 (0x113e11c00) [pid = 1722] [serial = 2393] [outer = 0x0] [url = about:blank] 04:07:07 INFO - --DOMWINDOW == 68 (0x113399400) [pid = 1722] [serial = 2395] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 04:07:07 INFO - --DOMWINDOW == 67 (0x113447000) [pid = 1722] [serial = 2398] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 04:07:07 INFO - --DOMWINDOW == 66 (0x1283ef400) [pid = 1722] [serial = 2464] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:07 INFO - --DOMWINDOW == 65 (0x1276c1800) [pid = 1722] [serial = 2450] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:07 INFO - --DOMWINDOW == 64 (0x128386c00) [pid = 1722] [serial = 2460] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:07 INFO - --DOMWINDOW == 63 (0x126485000) [pid = 1722] [serial = 2467] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:07 INFO - --DOMWINDOW == 62 (0x12826b000) [pid = 1722] [serial = 2452] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:07 INFO - --DOMWINDOW == 61 (0x12826ec00) [pid = 1722] [serial = 2453] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:07 INFO - --DOMWINDOW == 60 (0x1296d1800) [pid = 1722] [serial = 2473] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:07 INFO - --DOMWINDOW == 59 (0x1283f0c00) [pid = 1722] [serial = 2466] [outer = 0x0] [url = about:blank] 04:07:07 INFO - --DOMWINDOW == 58 (0x1283f0000) [pid = 1722] [serial = 2465] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:07 INFO - --DOMWINDOW == 57 (0x1276c8c00) [pid = 1722] [serial = 2451] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:07 INFO - --DOMWINDOW == 56 (0x115145000) [pid = 1722] [serial = 2394] [outer = 0x0] [url = about:blank] 04:07:07 INFO - --DOMWINDOW == 55 (0x120fe6400) [pid = 1722] [serial = 2399] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 04:07:07 INFO - --DOMWINDOW == 54 (0x113447800) [pid = 1722] [serial = 2437] [outer = 0x0] [url = about:blank] 04:07:07 INFO - --DOMWINDOW == 53 (0x11ebb6c00) [pid = 1722] [serial = 2442] [outer = 0x0] [url = about:blank] 04:07:07 INFO - --DOMWINDOW == 52 (0x1283edc00) [pid = 1722] [serial = 2462] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:07 INFO - --DOMWINDOW == 51 (0x126144000) [pid = 1722] [serial = 2461] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:07 INFO - --DOMWINDOW == 50 (0x128308000) [pid = 1722] [serial = 2457] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:07 INFO - --DOMWINDOW == 49 (0x128308c00) [pid = 1722] [serial = 2418] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:07 INFO - --DOMWINDOW == 48 (0x12449d000) [pid = 1722] [serial = 2397] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 04:07:08 INFO - MEMORY STAT | vsize 3453MB | residentFast 533MB | heapAllocated 127MB 04:07:08 INFO - 439 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_03.js | took 4046ms 04:07:08 INFO - ++DOCSHELL 0x112cba800 == 18 [pid = 1722] [id = 1038] 04:07:08 INFO - ++DOMWINDOW == 49 (0x112f4cc00) [pid = 1722] [serial = 2475] [outer = 0x0] 04:07:08 INFO - ++DOMWINDOW == 50 (0x113395000) [pid = 1722] [serial = 2476] [outer = 0x112f4cc00] 04:07:08 INFO - 440 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_04.js 04:07:08 INFO - ++DOCSHELL 0x113319800 == 19 [pid = 1722] [id = 1039] 04:07:08 INFO - ++DOMWINDOW == 51 (0x113d09000) [pid = 1722] [serial = 2477] [outer = 0x0] 04:07:08 INFO - ++DOMWINDOW == 52 (0x113e05800) [pid = 1722] [serial = 2478] [outer = 0x113d09000] 04:07:08 INFO - ++DOMWINDOW == 53 (0x1214b1000) [pid = 1722] [serial = 2479] [outer = 0x113d09000] 04:07:08 INFO - ++DOCSHELL 0x113515800 == 20 [pid = 1722] [id = 1040] 04:07:08 INFO - ++DOMWINDOW == 54 (0x11318cc00) [pid = 1722] [serial = 2480] [outer = 0x0] 04:07:08 INFO - ++DOMWINDOW == 55 (0x11eefb000) [pid = 1722] [serial = 2481] [outer = 0x11318cc00] 04:07:08 INFO - ++DOCSHELL 0x11345d800 == 21 [pid = 1722] [id = 1041] 04:07:08 INFO - ++DOMWINDOW == 56 (0x113e0c000) [pid = 1722] [serial = 2482] [outer = 0x0] 04:07:08 INFO - ++DOMWINDOW == 57 (0x1202e4c00) [pid = 1722] [serial = 2483] [outer = 0x113e0c000] 04:07:08 INFO - ++DOMWINDOW == 58 (0x120e25400) [pid = 1722] [serial = 2484] [outer = 0x113e0c000] 04:07:08 INFO - ++DOCSHELL 0x11eb98000 == 22 [pid = 1722] [id = 1042] 04:07:08 INFO - ++DOMWINDOW == 59 (0x121803c00) [pid = 1722] [serial = 2485] [outer = 0x0] 04:07:08 INFO - ++DOMWINDOW == 60 (0x122124800) [pid = 1722] [serial = 2486] [outer = 0x121803c00] 04:07:10 INFO - ++DOMWINDOW == 61 (0x1283f8800) [pid = 1722] [serial = 2487] [outer = 0x113d09000] 04:07:10 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:07:10 INFO - ++DOCSHELL 0x11eb94800 == 23 [pid = 1722] [id = 1043] 04:07:10 INFO - ++DOMWINDOW == 62 (0x12938a400) [pid = 1722] [serial = 2488] [outer = 0x0] 04:07:10 INFO - ++DOMWINDOW == 63 (0x12938cc00) [pid = 1722] [serial = 2489] [outer = 0x12938a400] 04:07:10 INFO - ++DOCSHELL 0x12570d800 == 24 [pid = 1722] [id = 1044] 04:07:10 INFO - ++DOMWINDOW == 64 (0x12c371000) [pid = 1722] [serial = 2490] [outer = 0x0] 04:07:10 INFO - ++DOMWINDOW == 65 (0x12c3aac00) [pid = 1722] [serial = 2491] [outer = 0x12c371000] 04:07:10 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:10 INFO - ++DOCSHELL 0x112e89800 == 25 [pid = 1722] [id = 1045] 04:07:10 INFO - ++DOMWINDOW == 66 (0x112f46000) [pid = 1722] [serial = 2492] [outer = 0x0] 04:07:10 INFO - ++DOMWINDOW == 67 (0x112f4e000) [pid = 1722] [serial = 2493] [outer = 0x112f46000] 04:07:10 INFO - ++DOCSHELL 0x11345e800 == 26 [pid = 1722] [id = 1046] 04:07:10 INFO - ++DOMWINDOW == 68 (0x113163c00) [pid = 1722] [serial = 2494] [outer = 0x0] 04:07:10 INFO - ++DOCSHELL 0x11346a800 == 27 [pid = 1722] [id = 1047] 04:07:10 INFO - ++DOMWINDOW == 69 (0x113195400) [pid = 1722] [serial = 2495] [outer = 0x0] 04:07:10 INFO - ++DOCSHELL 0x11346f000 == 28 [pid = 1722] [id = 1048] 04:07:10 INFO - ++DOMWINDOW == 70 (0x113448800) [pid = 1722] [serial = 2496] [outer = 0x0] 04:07:10 INFO - ++DOCSHELL 0x113470000 == 29 [pid = 1722] [id = 1049] 04:07:10 INFO - ++DOMWINDOW == 71 (0x11344c000) [pid = 1722] [serial = 2497] [outer = 0x0] 04:07:10 INFO - ++DOCSHELL 0x113470800 == 30 [pid = 1722] [id = 1050] 04:07:10 INFO - ++DOMWINDOW == 72 (0x11344dc00) [pid = 1722] [serial = 2498] [outer = 0x0] 04:07:10 INFO - ++DOMWINDOW == 73 (0x113e08400) [pid = 1722] [serial = 2499] [outer = 0x113163c00] 04:07:10 INFO - ++DOMWINDOW == 74 (0x114b57000) [pid = 1722] [serial = 2500] [outer = 0x113195400] 04:07:10 INFO - ++DOMWINDOW == 75 (0x114dc6800) [pid = 1722] [serial = 2501] [outer = 0x113448800] 04:07:10 INFO - ++DOMWINDOW == 76 (0x11e714000) [pid = 1722] [serial = 2502] [outer = 0x11344c000] 04:07:10 INFO - ++DOMWINDOW == 77 (0x11e78a800) [pid = 1722] [serial = 2503] [outer = 0x11344dc00] 04:07:10 INFO - ++DOCSHELL 0x124867000 == 31 [pid = 1722] [id = 1051] 04:07:10 INFO - ++DOMWINDOW == 78 (0x1240da400) [pid = 1722] [serial = 2504] [outer = 0x0] 04:07:10 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:10 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:11 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:11 INFO - ++DOCSHELL 0x124f0b000 == 32 [pid = 1722] [id = 1052] 04:07:11 INFO - ++DOMWINDOW == 79 (0x126485400) [pid = 1722] [serial = 2505] [outer = 0x0] 04:07:11 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:11 INFO - ++DOMWINDOW == 80 (0x128310400) [pid = 1722] [serial = 2506] [outer = 0x1240da400] 04:07:11 INFO - ++DOMWINDOW == 81 (0x12838a000) [pid = 1722] [serial = 2507] [outer = 0x126485400] 04:07:11 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:11 INFO - ++DOCSHELL 0x113e4a000 == 33 [pid = 1722] [id = 1053] 04:07:11 INFO - ++DOMWINDOW == 82 (0x113e0f800) [pid = 1722] [serial = 2508] [outer = 0x0] 04:07:11 INFO - ++DOCSHELL 0x113e4a800 == 34 [pid = 1722] [id = 1054] 04:07:11 INFO - ++DOMWINDOW == 83 (0x120e23800) [pid = 1722] [serial = 2509] [outer = 0x0] 04:07:11 INFO - ++DOCSHELL 0x113e4e800 == 35 [pid = 1722] [id = 1055] 04:07:11 INFO - ++DOMWINDOW == 84 (0x11e789400) [pid = 1722] [serial = 2510] [outer = 0x0] 04:07:11 INFO - ++DOCSHELL 0x115192000 == 36 [pid = 1722] [id = 1056] 04:07:11 INFO - ++DOMWINDOW == 85 (0x12159a400) [pid = 1722] [serial = 2511] [outer = 0x0] 04:07:11 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:11 INFO - ++DOCSHELL 0x11e351800 == 37 [pid = 1722] [id = 1057] 04:07:11 INFO - ++DOMWINDOW == 86 (0x1215dd400) [pid = 1722] [serial = 2512] [outer = 0x0] 04:07:11 INFO - ++DOMWINDOW == 87 (0x121806000) [pid = 1722] [serial = 2513] [outer = 0x1215dd400] 04:07:11 INFO - ++DOMWINDOW == 88 (0x113d23000) [pid = 1722] [serial = 2514] [outer = 0x113e0f800] 04:07:11 INFO - ++DOMWINDOW == 89 (0x1214b5400) [pid = 1722] [serial = 2515] [outer = 0x120e23800] 04:07:11 INFO - ++DOMWINDOW == 90 (0x12ff24800) [pid = 1722] [serial = 2516] [outer = 0x11e789400] 04:07:11 INFO - ++DOMWINDOW == 91 (0x12ff44c00) [pid = 1722] [serial = 2517] [outer = 0x12159a400] 04:07:11 INFO - ++DOMWINDOW == 92 (0x12ff45c00) [pid = 1722] [serial = 2518] [outer = 0x1215dd400] 04:07:12 INFO - --DOCSHELL 0x113e4a800 == 36 [pid = 1722] [id = 1054] 04:07:12 INFO - --DOCSHELL 0x113e4e800 == 35 [pid = 1722] [id = 1055] 04:07:12 INFO - --DOCSHELL 0x113e4a000 == 34 [pid = 1722] [id = 1053] 04:07:12 INFO - --DOCSHELL 0x115192000 == 33 [pid = 1722] [id = 1056] 04:07:12 INFO - --DOCSHELL 0x124f0b000 == 32 [pid = 1722] [id = 1052] 04:07:12 INFO - --DOCSHELL 0x124867000 == 31 [pid = 1722] [id = 1051] 04:07:13 INFO - --DOCSHELL 0x113454800 == 30 [pid = 1722] [id = 1021] 04:07:13 INFO - --DOCSHELL 0x11e351800 == 29 [pid = 1722] [id = 1057] 04:07:13 INFO - --DOCSHELL 0x112e7c800 == 28 [pid = 1722] [id = 1020] 04:07:13 INFO - --DOCSHELL 0x113515800 == 27 [pid = 1722] [id = 1040] 04:07:13 INFO - --DOCSHELL 0x11eb98000 == 26 [pid = 1722] [id = 1042] 04:07:13 INFO - --DOCSHELL 0x12570d800 == 25 [pid = 1722] [id = 1044] 04:07:13 INFO - --DOCSHELL 0x120d4a000 == 24 [pid = 1722] [id = 1026] 04:07:13 INFO - --DOCSHELL 0x120dc4800 == 23 [pid = 1722] [id = 1027] 04:07:13 INFO - --DOCSHELL 0x112e89800 == 22 [pid = 1722] [id = 1045] 04:07:13 INFO - --DOCSHELL 0x112ba5800 == 21 [pid = 1722] [id = 1019] 04:07:13 INFO - --DOCSHELL 0x113307800 == 20 [pid = 1722] [id = 1022] 04:07:13 INFO - --DOCSHELL 0x120dc6000 == 19 [pid = 1722] [id = 1028] 04:07:13 INFO - --DOCSHELL 0x120dca000 == 18 [pid = 1722] [id = 1029] 04:07:13 INFO - --DOCSHELL 0x120dcd000 == 17 [pid = 1722] [id = 1030] 04:07:13 INFO - --DOMWINDOW == 91 (0x128277800) [pid = 1722] [serial = 2406] [outer = 0x0] [url = about:blank] 04:07:13 INFO - --DOMWINDOW == 90 (0x122d4f000) [pid = 1722] [serial = 2404] [outer = 0x0] [url = about:blank] 04:07:13 INFO - --DOMWINDOW == 89 (0x121318400) [pid = 1722] [serial = 2402] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:13 INFO - --DOMWINDOW == 88 (0x12f5a3000) [pid = 1722] [serial = 2429] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:13 INFO - --DOMWINDOW == 87 (0x12dd17000) [pid = 1722] [serial = 2422] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:13 INFO - --DOMWINDOW == 86 (0x1283f8c00) [pid = 1722] [serial = 2408] [outer = 0x0] [url = about:blank] 04:07:13 INFO - --DOMWINDOW == 85 (0x1296d0000) [pid = 1722] [serial = 2472] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:13 INFO - --DOMWINDOW == 84 (0x128279400) [pid = 1722] [serial = 2455] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:13 INFO - --DOMWINDOW == 83 (0x1283f8000) [pid = 1722] [serial = 2468] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:13 INFO - --DOMWINDOW == 82 (0x1296d4000) [pid = 1722] [serial = 2474] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:13 INFO - --DOMWINDOW == 81 (0x12830a000) [pid = 1722] [serial = 2458] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:13 INFO - --DOMWINDOW == 80 (0x128304800) [pid = 1722] [serial = 2456] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:13 INFO - --DOMWINDOW == 79 (0x1296ce000) [pid = 1722] [serial = 2470] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:13 INFO - --DOMWINDOW == 78 (0x1296ccc00) [pid = 1722] [serial = 2469] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:14 INFO - --DOMWINDOW == 77 (0x1283eec00) [pid = 1722] [serial = 2463] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:14 INFO - --DOMWINDOW == 76 (0x1276a8000) [pid = 1722] [serial = 2448] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:07:14 INFO - --DOMWINDOW == 75 (0x11eefb000) [pid = 1722] [serial = 2481] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 04:07:14 INFO - --DOMWINDOW == 74 (0x11e7ae800) [pid = 1722] [serial = 2441] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:14 INFO - --DOMWINDOW == 73 (0x126137400) [pid = 1722] [serial = 2446] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:07:14 INFO - --DOMWINDOW == 72 (0x120ffd000) [pid = 1722] [serial = 2444] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:14 INFO - --DOMWINDOW == 71 (0x113e08c00) [pid = 1722] [serial = 2439] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 04:07:14 INFO - --DOMWINDOW == 70 (0x113399c00) [pid = 1722] [serial = 2436] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 04:07:14 INFO - --DOMWINDOW == 69 (0x112ca3800) [pid = 1722] [serial = 2434] [outer = 0x0] [url = about:blank] 04:07:14 INFO - --DOMWINDOW == 68 (0x128276800) [pid = 1722] [serial = 2454] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:14 INFO - --DOMWINDOW == 67 (0x1240da400) [pid = 1722] [serial = 2504] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:14 INFO - --DOMWINDOW == 66 (0x126485400) [pid = 1722] [serial = 2505] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:14 INFO - --DOMWINDOW == 65 (0x113e05800) [pid = 1722] [serial = 2478] [outer = 0x0] [url = about:blank] 04:07:14 INFO - --DOMWINDOW == 64 (0x114dbec00) [pid = 1722] [serial = 2440] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 04:07:14 INFO - --DOMWINDOW == 63 (0x112f44c00) [pid = 1722] [serial = 2435] [outer = 0x0] [url = about:blank] 04:07:14 INFO - --DOMWINDOW == 62 (0x11344c000) [pid = 1722] [serial = 2497] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:14 INFO - --DOMWINDOW == 61 (0x113448800) [pid = 1722] [serial = 2496] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:14 INFO - --DOMWINDOW == 60 (0x113195400) [pid = 1722] [serial = 2495] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:14 INFO - --DOMWINDOW == 59 (0x11318cc00) [pid = 1722] [serial = 2480] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 04:07:14 INFO - --DOMWINDOW == 58 (0x120e23800) [pid = 1722] [serial = 2509] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:14 INFO - --DOMWINDOW == 57 (0x12159a400) [pid = 1722] [serial = 2511] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:14 INFO - --DOMWINDOW == 56 (0x1215dd400) [pid = 1722] [serial = 2512] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:14 INFO - --DOMWINDOW == 55 (0x121806000) [pid = 1722] [serial = 2513] [outer = 0x0] [url = about:blank] 04:07:14 INFO - --DOMWINDOW == 54 (0x12ff45c00) [pid = 1722] [serial = 2518] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:14 INFO - --DOMWINDOW == 53 (0x1202e4c00) [pid = 1722] [serial = 2483] [outer = 0x0] [url = about:blank] 04:07:14 INFO - --DOCSHELL 0x11eb94800 == 16 [pid = 1722] [id = 1043] 04:07:14 INFO - --DOMWINDOW == 52 (0x1214b1000) [pid = 1722] [serial = 2479] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 04:07:14 INFO - --DOMWINDOW == 51 (0x120fed400) [pid = 1722] [serial = 2438] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 04:07:14 INFO - --DOMWINDOW == 50 (0x12830b400) [pid = 1722] [serial = 2459] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:14 INFO - --DOMWINDOW == 49 (0x114dc6800) [pid = 1722] [serial = 2501] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:14 INFO - MEMORY STAT | vsize 3455MB | residentFast 534MB | heapAllocated 128MB 04:07:14 INFO - 441 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_04.js | took 6086ms 04:07:14 INFO - ++DOCSHELL 0x112cb7800 == 17 [pid = 1722] [id = 1058] 04:07:14 INFO - ++DOMWINDOW == 50 (0x112f44c00) [pid = 1722] [serial = 2519] [outer = 0x0] 04:07:14 INFO - ++DOMWINDOW == 51 (0x11315bc00) [pid = 1722] [serial = 2520] [outer = 0x112f44c00] 04:07:14 INFO - 442 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_events.js 04:07:14 INFO - ++DOCSHELL 0x113456800 == 18 [pid = 1722] [id = 1059] 04:07:14 INFO - ++DOMWINDOW == 52 (0x11344f800) [pid = 1722] [serial = 2521] [outer = 0x0] 04:07:14 INFO - ++DOMWINDOW == 53 (0x113d1d000) [pid = 1722] [serial = 2522] [outer = 0x11344f800] 04:07:14 INFO - ++DOMWINDOW == 54 (0x11d46f800) [pid = 1722] [serial = 2523] [outer = 0x11344f800] 04:07:14 INFO - ++DOCSHELL 0x112cd0800 == 19 [pid = 1722] [id = 1060] 04:07:14 INFO - ++DOMWINDOW == 55 (0x11f70e400) [pid = 1722] [serial = 2524] [outer = 0x0] 04:07:14 INFO - ++DOMWINDOW == 56 (0x120258400) [pid = 1722] [serial = 2525] [outer = 0x11f70e400] 04:07:14 INFO - ++DOMWINDOW == 57 (0x120d1e000) [pid = 1722] [serial = 2526] [outer = 0x11f70e400] 04:07:14 INFO - ++DOCSHELL 0x11ec5b800 == 20 [pid = 1722] [id = 1061] 04:07:14 INFO - ++DOMWINDOW == 58 (0x121311c00) [pid = 1722] [serial = 2527] [outer = 0x0] 04:07:14 INFO - ++DOMWINDOW == 59 (0x121317000) [pid = 1722] [serial = 2528] [outer = 0x121311c00] 04:07:16 INFO - --DOCSHELL 0x11345d800 == 19 [pid = 1722] [id = 1041] 04:07:16 INFO - --DOCSHELL 0x113319800 == 18 [pid = 1722] [id = 1039] 04:07:16 INFO - --DOCSHELL 0x112cba800 == 17 [pid = 1722] [id = 1038] 04:07:16 INFO - --DOCSHELL 0x11345e800 == 16 [pid = 1722] [id = 1046] 04:07:16 INFO - --DOCSHELL 0x11346a800 == 15 [pid = 1722] [id = 1047] 04:07:16 INFO - --DOCSHELL 0x11346f000 == 14 [pid = 1722] [id = 1048] 04:07:16 INFO - --DOCSHELL 0x113470000 == 13 [pid = 1722] [id = 1049] 04:07:16 INFO - --DOCSHELL 0x113470800 == 12 [pid = 1722] [id = 1050] 04:07:16 INFO - --DOMWINDOW == 58 (0x120159800) [pid = 1722] [serial = 2443] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:16 INFO - --DOMWINDOW == 57 (0x1296cf000) [pid = 1722] [serial = 2471] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:16 INFO - --DOMWINDOW == 56 (0x1273e2000) [pid = 1722] [serial = 2449] [outer = 0x0] [url = about:blank] 04:07:16 INFO - --DOMWINDOW == 55 (0x128310400) [pid = 1722] [serial = 2506] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:16 INFO - --DOMWINDOW == 54 (0x11e714000) [pid = 1722] [serial = 2502] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:16 INFO - --DOMWINDOW == 53 (0x114b57000) [pid = 1722] [serial = 2500] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:16 INFO - --DOMWINDOW == 52 (0x12613d400) [pid = 1722] [serial = 2447] [outer = 0x0] [url = about:blank] 04:07:16 INFO - --DOMWINDOW == 51 (0x12110b400) [pid = 1722] [serial = 2445] [outer = 0x0] [url = about:blank] 04:07:16 INFO - --DOMWINDOW == 50 (0x1214b5400) [pid = 1722] [serial = 2515] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:16 INFO - --DOMWINDOW == 49 (0x12ff44c00) [pid = 1722] [serial = 2517] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:16 INFO - --DOMWINDOW == 48 (0x12838a000) [pid = 1722] [serial = 2507] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:16 INFO - --DOMWINDOW == 47 (0x113e0f800) [pid = 1722] [serial = 2508] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:16 INFO - --DOMWINDOW == 46 (0x121803c00) [pid = 1722] [serial = 2485] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:16 INFO - --DOMWINDOW == 45 (0x112f46000) [pid = 1722] [serial = 2492] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:07:16 INFO - --DOMWINDOW == 44 (0x11e789400) [pid = 1722] [serial = 2510] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:16 INFO - --DOMWINDOW == 43 (0x113163c00) [pid = 1722] [serial = 2494] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:16 INFO - --DOMWINDOW == 42 (0x12c371000) [pid = 1722] [serial = 2490] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:07:16 INFO - --DOMWINDOW == 41 (0x11344dc00) [pid = 1722] [serial = 2498] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:16 INFO - --DOMWINDOW == 40 (0x120258400) [pid = 1722] [serial = 2525] [outer = 0x0] [url = about:blank] 04:07:16 INFO - --DOMWINDOW == 39 (0x113e0c000) [pid = 1722] [serial = 2482] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:16 INFO - --DOMWINDOW == 38 (0x113d09000) [pid = 1722] [serial = 2477] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 04:07:16 INFO - --DOMWINDOW == 37 (0x12938cc00) [pid = 1722] [serial = 2489] [outer = 0x0] [url = about:blank] 04:07:16 INFO - --DOMWINDOW == 36 (0x113d1d000) [pid = 1722] [serial = 2522] [outer = 0x0] [url = about:blank] 04:07:16 INFO - --DOMWINDOW == 35 (0x112f4cc00) [pid = 1722] [serial = 2475] [outer = 0x0] [url = about:blank] 04:07:16 INFO - --DOMWINDOW == 34 (0x12938a400) [pid = 1722] [serial = 2488] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 04:07:16 INFO - --DOMWINDOW == 33 (0x11e78a800) [pid = 1722] [serial = 2503] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:16 INFO - --DOMWINDOW == 32 (0x1283f8800) [pid = 1722] [serial = 2487] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 04:07:16 INFO - MEMORY STAT | vsize 3452MB | residentFast 531MB | heapAllocated 123MB 04:07:16 INFO - 443 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_events.js | took 2420ms 04:07:16 INFO - ++DOCSHELL 0x112cc6000 == 13 [pid = 1722] [id = 1062] 04:07:16 INFO - ++DOMWINDOW == 33 (0x112f45c00) [pid = 1722] [serial = 2529] [outer = 0x0] 04:07:16 INFO - ++DOMWINDOW == 34 (0x112f4ec00) [pid = 1722] [serial = 2530] [outer = 0x112f45c00] 04:07:16 INFO - 444 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_order.js 04:07:16 INFO - ++DOCSHELL 0x113454800 == 14 [pid = 1722] [id = 1063] 04:07:16 INFO - ++DOMWINDOW == 35 (0x11344c000) [pid = 1722] [serial = 2531] [outer = 0x0] 04:07:16 INFO - ++DOMWINDOW == 36 (0x113450000) [pid = 1722] [serial = 2532] [outer = 0x11344c000] 04:07:17 INFO - ++DOMWINDOW == 37 (0x12115ac00) [pid = 1722] [serial = 2533] [outer = 0x11344c000] 04:07:17 INFO - ++DOCSHELL 0x112968800 == 15 [pid = 1722] [id = 1064] 04:07:17 INFO - ++DOMWINDOW == 38 (0x11ebb7c00) [pid = 1722] [serial = 2534] [outer = 0x0] 04:07:17 INFO - ++DOMWINDOW == 39 (0x11ebba400) [pid = 1722] [serial = 2535] [outer = 0x11ebb7c00] 04:07:17 INFO - ++DOMWINDOW == 40 (0x120262800) [pid = 1722] [serial = 2536] [outer = 0x11ebb7c00] 04:07:17 INFO - ++DOCSHELL 0x11e35b000 == 16 [pid = 1722] [id = 1065] 04:07:17 INFO - ++DOMWINDOW == 41 (0x121115c00) [pid = 1722] [serial = 2537] [outer = 0x0] 04:07:17 INFO - ++DOMWINDOW == 42 (0x12130dc00) [pid = 1722] [serial = 2538] [outer = 0x121115c00] 04:07:18 INFO - --DOCSHELL 0x11ec5b800 == 15 [pid = 1722] [id = 1061] 04:07:18 INFO - --DOCSHELL 0x113456800 == 14 [pid = 1722] [id = 1059] 04:07:18 INFO - --DOCSHELL 0x112cb7800 == 13 [pid = 1722] [id = 1058] 04:07:18 INFO - --DOCSHELL 0x112cd0800 == 12 [pid = 1722] [id = 1060] 04:07:18 INFO - --DOMWINDOW == 41 (0x122124800) [pid = 1722] [serial = 2486] [outer = 0x0] [url = about:blank] 04:07:18 INFO - --DOMWINDOW == 40 (0x12c3aac00) [pid = 1722] [serial = 2491] [outer = 0x0] [url = about:blank] 04:07:18 INFO - --DOMWINDOW == 39 (0x120e25400) [pid = 1722] [serial = 2484] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:18 INFO - --DOMWINDOW == 38 (0x113e08400) [pid = 1722] [serial = 2499] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:18 INFO - --DOMWINDOW == 37 (0x12ff24800) [pid = 1722] [serial = 2516] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:18 INFO - --DOMWINDOW == 36 (0x113d23000) [pid = 1722] [serial = 2514] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:18 INFO - --DOMWINDOW == 35 (0x112f4e000) [pid = 1722] [serial = 2493] [outer = 0x0] [url = about:blank] 04:07:18 INFO - --DOMWINDOW == 34 (0x113395000) [pid = 1722] [serial = 2476] [outer = 0x0] [url = about:blank] 04:07:19 INFO - --DOMWINDOW == 33 (0x112f44c00) [pid = 1722] [serial = 2519] [outer = 0x0] [url = about:blank] 04:07:19 INFO - --DOMWINDOW == 32 (0x11f70e400) [pid = 1722] [serial = 2524] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:19 INFO - --DOMWINDOW == 31 (0x11344f800) [pid = 1722] [serial = 2521] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-events.html] 04:07:19 INFO - --DOMWINDOW == 30 (0x11ebba400) [pid = 1722] [serial = 2535] [outer = 0x0] [url = about:blank] 04:07:19 INFO - --DOMWINDOW == 29 (0x113450000) [pid = 1722] [serial = 2532] [outer = 0x0] [url = about:blank] 04:07:19 INFO - --DOMWINDOW == 28 (0x121311c00) [pid = 1722] [serial = 2527] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:19 INFO - MEMORY STAT | vsize 3454MB | residentFast 533MB | heapAllocated 122MB 04:07:19 INFO - 445 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_order.js | took 2240ms 04:07:19 INFO - ++DOCSHELL 0x112cbd000 == 13 [pid = 1722] [id = 1066] 04:07:19 INFO - ++DOMWINDOW == 29 (0x112f43400) [pid = 1722] [serial = 2539] [outer = 0x0] 04:07:19 INFO - ++DOMWINDOW == 30 (0x112f4b000) [pid = 1722] [serial = 2540] [outer = 0x112f43400] 04:07:19 INFO - 446 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_regexp.js 04:07:19 INFO - ++DOCSHELL 0x11331c800 == 14 [pid = 1722] [id = 1067] 04:07:19 INFO - ++DOMWINDOW == 31 (0x113448800) [pid = 1722] [serial = 2541] [outer = 0x0] 04:07:19 INFO - ++DOMWINDOW == 32 (0x11344e400) [pid = 1722] [serial = 2542] [outer = 0x113448800] 04:07:19 INFO - ++DOMWINDOW == 33 (0x114b2a400) [pid = 1722] [serial = 2543] [outer = 0x113448800] 04:07:19 INFO - ++DOCSHELL 0x112e91000 == 15 [pid = 1722] [id = 1068] 04:07:19 INFO - ++DOMWINDOW == 34 (0x11ebba400) [pid = 1722] [serial = 2544] [outer = 0x0] 04:07:19 INFO - ++DOMWINDOW == 35 (0x11ee18000) [pid = 1722] [serial = 2545] [outer = 0x11ebba400] 04:07:19 INFO - ++DOMWINDOW == 36 (0x1203dd800) [pid = 1722] [serial = 2546] [outer = 0x11ebba400] 04:07:19 INFO - ++DOCSHELL 0x11ee2e800 == 16 [pid = 1722] [id = 1069] 04:07:19 INFO - ++DOMWINDOW == 37 (0x121115000) [pid = 1722] [serial = 2547] [outer = 0x0] 04:07:19 INFO - ++DOMWINDOW == 38 (0x12130d400) [pid = 1722] [serial = 2548] [outer = 0x121115000] 04:07:20 INFO - ++DOCSHELL 0x11f636000 == 17 [pid = 1722] [id = 1070] 04:07:20 INFO - ++DOMWINDOW == 39 (0x120e26000) [pid = 1722] [serial = 2549] [outer = 0x0] 04:07:20 INFO - ++DOMWINDOW == 40 (0x12130c000) [pid = 1722] [serial = 2550] [outer = 0x120e26000] 04:07:21 INFO - --DOCSHELL 0x11e35b000 == 16 [pid = 1722] [id = 1065] 04:07:21 INFO - --DOCSHELL 0x112cc6000 == 15 [pid = 1722] [id = 1062] 04:07:21 INFO - --DOCSHELL 0x113454800 == 14 [pid = 1722] [id = 1063] 04:07:21 INFO - --DOCSHELL 0x11ee2e800 == 13 [pid = 1722] [id = 1069] 04:07:21 INFO - --DOCSHELL 0x112968800 == 12 [pid = 1722] [id = 1064] 04:07:21 INFO - --DOCSHELL 0x11f636000 == 11 [pid = 1722] [id = 1070] 04:07:21 INFO - --DOMWINDOW == 39 (0x121317000) [pid = 1722] [serial = 2528] [outer = 0x0] [url = about:blank] 04:07:21 INFO - --DOMWINDOW == 38 (0x120d1e000) [pid = 1722] [serial = 2526] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:21 INFO - --DOMWINDOW == 37 (0x11315bc00) [pid = 1722] [serial = 2520] [outer = 0x0] [url = about:blank] 04:07:21 INFO - --DOMWINDOW == 36 (0x11d46f800) [pid = 1722] [serial = 2523] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-events.html] 04:07:21 INFO - --DOMWINDOW == 35 (0x11344e400) [pid = 1722] [serial = 2542] [outer = 0x0] [url = about:blank] 04:07:21 INFO - --DOMWINDOW == 34 (0x112f4ec00) [pid = 1722] [serial = 2530] [outer = 0x0] [url = about:blank] 04:07:21 INFO - --DOMWINDOW == 33 (0x11ee18000) [pid = 1722] [serial = 2545] [outer = 0x0] [url = about:blank] 04:07:21 INFO - --DOMWINDOW == 32 (0x120e26000) [pid = 1722] [serial = 2549] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:07:21 INFO - --DOMWINDOW == 31 (0x121115c00) [pid = 1722] [serial = 2537] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:21 INFO - --DOMWINDOW == 30 (0x11ebb7c00) [pid = 1722] [serial = 2534] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:21 INFO - --DOMWINDOW == 29 (0x11344c000) [pid = 1722] [serial = 2531] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:07:21 INFO - --DOMWINDOW == 28 (0x112f45c00) [pid = 1722] [serial = 2529] [outer = 0x0] [url = about:blank] 04:07:21 INFO - --DOMWINDOW == 27 (0x12115ac00) [pid = 1722] [serial = 2533] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 04:07:21 INFO - MEMORY STAT | vsize 3454MB | residentFast 533MB | heapAllocated 122MB 04:07:21 INFO - 447 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_regexp.js | took 2494ms 04:07:21 INFO - ++DOCSHELL 0x112cbb800 == 12 [pid = 1722] [id = 1071] 04:07:21 INFO - ++DOMWINDOW == 28 (0x112f42800) [pid = 1722] [serial = 2551] [outer = 0x0] 04:07:21 INFO - ++DOMWINDOW == 29 (0x112f4cc00) [pid = 1722] [serial = 2552] [outer = 0x112f42800] 04:07:21 INFO - 448 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_table.js 04:07:21 INFO - ++DOCSHELL 0x113453800 == 13 [pid = 1722] [id = 1072] 04:07:21 INFO - ++DOMWINDOW == 30 (0x113448400) [pid = 1722] [serial = 2553] [outer = 0x0] 04:07:21 INFO - ++DOMWINDOW == 31 (0x11344e400) [pid = 1722] [serial = 2554] [outer = 0x113448400] 04:07:22 INFO - ++DOMWINDOW == 32 (0x114b24400) [pid = 1722] [serial = 2555] [outer = 0x113448400] 04:07:22 INFO - ++DOCSHELL 0x113212000 == 14 [pid = 1722] [id = 1073] 04:07:22 INFO - ++DOMWINDOW == 33 (0x11ebb8400) [pid = 1722] [serial = 2556] [outer = 0x0] 04:07:22 INFO - ++DOMWINDOW == 34 (0x11eefb000) [pid = 1722] [serial = 2557] [outer = 0x11ebb8400] 04:07:22 INFO - ++DOMWINDOW == 35 (0x1203dd400) [pid = 1722] [serial = 2558] [outer = 0x11ebb8400] 04:07:22 INFO - ++DOCSHELL 0x11eeb5800 == 15 [pid = 1722] [id = 1074] 04:07:22 INFO - ++DOMWINDOW == 36 (0x121115800) [pid = 1722] [serial = 2559] [outer = 0x0] 04:07:22 INFO - ++DOMWINDOW == 37 (0x121162000) [pid = 1722] [serial = 2560] [outer = 0x121115800] 04:07:25 INFO - MEMORY STAT | vsize 3457MB | residentFast 537MB | heapAllocated 134MB 04:07:25 INFO - 449 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_table.js | took 3123ms 04:07:25 INFO - ++DOCSHELL 0x11eb8a800 == 16 [pid = 1722] [id = 1075] 04:07:25 INFO - ++DOMWINDOW == 38 (0x1202e8400) [pid = 1722] [serial = 2561] [outer = 0x0] 04:07:25 INFO - ++DOMWINDOW == 39 (0x120e2ec00) [pid = 1722] [serial = 2562] [outer = 0x1202e8400] 04:07:25 INFO - 450 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_promise.js 04:07:25 INFO - ++DOCSHELL 0x124ac4000 == 17 [pid = 1722] [id = 1076] 04:07:25 INFO - ++DOMWINDOW == 40 (0x120fee800) [pid = 1722] [serial = 2563] [outer = 0x0] 04:07:25 INFO - ++DOMWINDOW == 41 (0x120ff4400) [pid = 1722] [serial = 2564] [outer = 0x120fee800] 04:07:25 INFO - ++DOCSHELL 0x125065800 == 18 [pid = 1722] [id = 1077] 04:07:25 INFO - ++DOMWINDOW == 42 (0x11e714000) [pid = 1722] [serial = 2565] [outer = 0x0] 04:07:25 INFO - ++DOMWINDOW == 43 (0x1247c4c00) [pid = 1722] [serial = 2566] [outer = 0x11e714000] 04:07:25 INFO - ++DOMWINDOW == 44 (0x12837e800) [pid = 1722] [serial = 2567] [outer = 0x11e714000] 04:07:25 INFO - ++DOCSHELL 0x112cd7000 == 19 [pid = 1722] [id = 1078] 04:07:25 INFO - ++DOMWINDOW == 45 (0x112bb5000) [pid = 1722] [serial = 2568] [outer = 0x0] 04:07:25 INFO - ++DOMWINDOW == 46 (0x112f45c00) [pid = 1722] [serial = 2569] [outer = 0x112bb5000] 04:07:26 INFO - ++DOCSHELL 0x113e50000 == 20 [pid = 1722] [id = 1079] 04:07:26 INFO - ++DOMWINDOW == 47 (0x1276cb000) [pid = 1722] [serial = 2570] [outer = 0x0] 04:07:26 INFO - ++DOMWINDOW == 48 (0x1276cd000) [pid = 1722] [serial = 2571] [outer = 0x1276cb000] 04:07:27 INFO - --DOCSHELL 0x11331c800 == 19 [pid = 1722] [id = 1067] 04:07:27 INFO - --DOCSHELL 0x112cbd000 == 18 [pid = 1722] [id = 1066] 04:07:27 INFO - --DOCSHELL 0x112e91000 == 17 [pid = 1722] [id = 1068] 04:07:27 INFO - --DOCSHELL 0x11eeb5800 == 16 [pid = 1722] [id = 1074] 04:07:27 INFO - --DOCSHELL 0x112cd7000 == 15 [pid = 1722] [id = 1078] 04:07:27 INFO - --DOCSHELL 0x113e50000 == 14 [pid = 1722] [id = 1079] 04:07:27 INFO - --DOMWINDOW == 47 (0x12130c000) [pid = 1722] [serial = 2550] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:07:27 INFO - --DOMWINDOW == 46 (0x120262800) [pid = 1722] [serial = 2536] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:27 INFO - --DOMWINDOW == 45 (0x12130dc00) [pid = 1722] [serial = 2538] [outer = 0x0] [url = about:blank] 04:07:27 INFO - --DOMWINDOW == 44 (0x113448400) [pid = 1722] [serial = 2553] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-table.html] 04:07:27 INFO - --DOMWINDOW == 43 (0x1247c4c00) [pid = 1722] [serial = 2566] [outer = 0x0] [url = about:blank] 04:07:27 INFO - --DOMWINDOW == 42 (0x121115000) [pid = 1722] [serial = 2547] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:27 INFO - --DOMWINDOW == 41 (0x11ebba400) [pid = 1722] [serial = 2544] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:27 INFO - --DOMWINDOW == 40 (0x112f43400) [pid = 1722] [serial = 2539] [outer = 0x0] [url = about:blank] 04:07:27 INFO - --DOMWINDOW == 39 (0x113448800) [pid = 1722] [serial = 2541] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-regexp.html] 04:07:27 INFO - --DOMWINDOW == 38 (0x112f42800) [pid = 1722] [serial = 2551] [outer = 0x0] [url = about:blank] 04:07:27 INFO - --DOMWINDOW == 37 (0x11eefb000) [pid = 1722] [serial = 2557] [outer = 0x0] [url = about:blank] 04:07:27 INFO - --DOMWINDOW == 36 (0x112f4b000) [pid = 1722] [serial = 2540] [outer = 0x0] [url = about:blank] 04:07:27 INFO - --DOMWINDOW == 35 (0x112f4cc00) [pid = 1722] [serial = 2552] [outer = 0x0] [url = about:blank] 04:07:27 INFO - --DOMWINDOW == 34 (0x11344e400) [pid = 1722] [serial = 2554] [outer = 0x0] [url = about:blank] 04:07:27 INFO - --DOMWINDOW == 33 (0x1276cb000) [pid = 1722] [serial = 2570] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:07:27 INFO - --DOMWINDOW == 32 (0x114b2a400) [pid = 1722] [serial = 2543] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-regexp.html] 04:07:27 INFO - --DOMWINDOW == 31 (0x114b24400) [pid = 1722] [serial = 2555] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-table.html] 04:07:27 INFO - MEMORY STAT | vsize 3457MB | residentFast 536MB | heapAllocated 124MB 04:07:27 INFO - 451 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_promise.js | took 2767ms 04:07:27 INFO - ++DOCSHELL 0x112cc6000 == 15 [pid = 1722] [id = 1080] 04:07:27 INFO - ++DOMWINDOW == 32 (0x112f42800) [pid = 1722] [serial = 2572] [outer = 0x0] 04:07:27 INFO - ++DOMWINDOW == 33 (0x112f4f800) [pid = 1722] [serial = 2573] [outer = 0x112f42800] 04:07:28 INFO - 452 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_property_provider.js 04:07:28 INFO - ++DOCSHELL 0x11345c800 == 16 [pid = 1722] [id = 1081] 04:07:28 INFO - ++DOMWINDOW == 34 (0x113446c00) [pid = 1722] [serial = 2574] [outer = 0x0] 04:07:28 INFO - ++DOMWINDOW == 35 (0x11344e800) [pid = 1722] [serial = 2575] [outer = 0x113446c00] 04:07:28 INFO - [1722] WARNING: Too large an index passed to GetChildAt: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4056 04:07:28 INFO - [1722] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4061 04:07:28 INFO - MEMORY STAT | vsize 3457MB | residentFast 537MB | heapAllocated 127MB 04:07:28 INFO - 453 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_property_provider.js | took 419ms 04:07:28 INFO - ++DOCSHELL 0x112854800 == 17 [pid = 1722] [id = 1082] 04:07:28 INFO - ++DOMWINDOW == 36 (0x12025b000) [pid = 1722] [serial = 2576] [outer = 0x0] 04:07:28 INFO - ++DOMWINDOW == 37 (0x120d22800) [pid = 1722] [serial = 2577] [outer = 0x12025b000] 04:07:28 INFO - 454 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_reflow.js 04:07:28 INFO - ++DOCSHELL 0x11ec58000 == 18 [pid = 1722] [id = 1083] 04:07:28 INFO - ++DOMWINDOW == 38 (0x12110a400) [pid = 1722] [serial = 2578] [outer = 0x0] 04:07:28 INFO - ++DOMWINDOW == 39 (0x12115d000) [pid = 1722] [serial = 2579] [outer = 0x12110a400] 04:07:28 INFO - ++DOCSHELL 0x113465000 == 19 [pid = 1722] [id = 1084] 04:07:28 INFO - ++DOMWINDOW == 40 (0x120e24c00) [pid = 1722] [serial = 2580] [outer = 0x0] 04:07:28 INFO - ++DOMWINDOW == 41 (0x121317c00) [pid = 1722] [serial = 2581] [outer = 0x120e24c00] 04:07:28 INFO - ++DOMWINDOW == 42 (0x122337400) [pid = 1722] [serial = 2582] [outer = 0x120e24c00] 04:07:29 INFO - ++DOCSHELL 0x121853800 == 20 [pid = 1722] [id = 1085] 04:07:29 INFO - ++DOMWINDOW == 43 (0x126241c00) [pid = 1722] [serial = 2583] [outer = 0x0] 04:07:29 INFO - ++DOMWINDOW == 44 (0x126403400) [pid = 1722] [serial = 2584] [outer = 0x126241c00] 04:07:30 INFO - --DOCSHELL 0x113453800 == 19 [pid = 1722] [id = 1072] 04:07:30 INFO - --DOCSHELL 0x112cbb800 == 18 [pid = 1722] [id = 1071] 04:07:30 INFO - --DOCSHELL 0x121853800 == 17 [pid = 1722] [id = 1085] 04:07:30 INFO - --DOCSHELL 0x11eb8a800 == 16 [pid = 1722] [id = 1075] 04:07:30 INFO - --DOCSHELL 0x124ac4000 == 15 [pid = 1722] [id = 1076] 04:07:30 INFO - --DOCSHELL 0x113212000 == 14 [pid = 1722] [id = 1073] 04:07:30 INFO - --DOCSHELL 0x125065800 == 13 [pid = 1722] [id = 1077] 04:07:30 INFO - --DOMWINDOW == 43 (0x12130d400) [pid = 1722] [serial = 2548] [outer = 0x0] [url = about:blank] 04:07:30 INFO - --DOMWINDOW == 42 (0x1203dd800) [pid = 1722] [serial = 2546] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:30 INFO - --DOMWINDOW == 41 (0x1276cd000) [pid = 1722] [serial = 2571] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:07:30 INFO - --DOMWINDOW == 40 (0x120fee800) [pid = 1722] [serial = 2563] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20console%20and%20promises] 04:07:30 INFO - --DOMWINDOW == 39 (0x11344e800) [pid = 1722] [serial = 2575] [outer = 0x0] [url = about:blank] 04:07:30 INFO - --DOMWINDOW == 38 (0x112f4f800) [pid = 1722] [serial = 2573] [outer = 0x0] [url = about:blank] 04:07:30 INFO - --DOMWINDOW == 37 (0x120e2ec00) [pid = 1722] [serial = 2562] [outer = 0x0] [url = about:blank] 04:07:30 INFO - --DOMWINDOW == 36 (0x121317c00) [pid = 1722] [serial = 2581] [outer = 0x0] [url = about:blank] 04:07:30 INFO - --DOMWINDOW == 35 (0x11e714000) [pid = 1722] [serial = 2565] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:30 INFO - --DOMWINDOW == 34 (0x121115800) [pid = 1722] [serial = 2559] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:30 INFO - --DOMWINDOW == 33 (0x11ebb8400) [pid = 1722] [serial = 2556] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:30 INFO - --DOMWINDOW == 32 (0x112bb5000) [pid = 1722] [serial = 2568] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:30 INFO - --DOMWINDOW == 31 (0x113446c00) [pid = 1722] [serial = 2574] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20the%20JS%20property%20provider] 04:07:30 INFO - --DOMWINDOW == 30 (0x112f42800) [pid = 1722] [serial = 2572] [outer = 0x0] [url = about:blank] 04:07:30 INFO - --DOMWINDOW == 29 (0x1202e8400) [pid = 1722] [serial = 2561] [outer = 0x0] [url = about:blank] 04:07:30 INFO - MEMORY STAT | vsize 3455MB | residentFast 535MB | heapAllocated 123MB 04:07:30 INFO - 455 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_reflow.js | took 2235ms 04:07:30 INFO - ++DOCSHELL 0x112cc5800 == 14 [pid = 1722] [id = 1086] 04:07:30 INFO - ++DOMWINDOW == 30 (0x112f42800) [pid = 1722] [serial = 2585] [outer = 0x0] 04:07:30 INFO - ++DOMWINDOW == 31 (0x112f47800) [pid = 1722] [serial = 2586] [outer = 0x112f42800] 04:07:30 INFO - 456 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_scratchpad_panel_link.js 04:07:31 INFO - ++DOCSHELL 0x113459800 == 15 [pid = 1722] [id = 1087] 04:07:31 INFO - ++DOMWINDOW == 32 (0x113445800) [pid = 1722] [serial = 2587] [outer = 0x0] 04:07:31 INFO - ++DOMWINDOW == 33 (0x113449400) [pid = 1722] [serial = 2588] [outer = 0x113445800] 04:07:31 INFO - ++DOCSHELL 0x11295a000 == 16 [pid = 1722] [id = 1088] 04:07:31 INFO - ++DOMWINDOW == 34 (0x114bfb400) [pid = 1722] [serial = 2589] [outer = 0x0] 04:07:31 INFO - ++DOMWINDOW == 35 (0x11e7aa000) [pid = 1722] [serial = 2590] [outer = 0x114bfb400] 04:07:31 INFO - ++DOCSHELL 0x113e47000 == 17 [pid = 1722] [id = 1089] 04:07:31 INFO - ++DOMWINDOW == 36 (0x11ebb6c00) [pid = 1722] [serial = 2591] [outer = 0x0] 04:07:31 INFO - ++DOMWINDOW == 37 (0x120264c00) [pid = 1722] [serial = 2592] [outer = 0x11ebb6c00] 04:07:31 INFO - ++DOMWINDOW == 38 (0x121161400) [pid = 1722] [serial = 2593] [outer = 0x11ebb6c00] 04:07:31 INFO - ++DOCSHELL 0x120e07800 == 18 [pid = 1722] [id = 1090] 04:07:31 INFO - ++DOMWINDOW == 39 (0x122e99800) [pid = 1722] [serial = 2594] [outer = 0x0] 04:07:31 INFO - ++DOMWINDOW == 40 (0x122ea4c00) [pid = 1722] [serial = 2595] [outer = 0x122e99800] 04:07:32 INFO - ++DOCSHELL 0x122183000 == 19 [pid = 1722] [id = 1091] 04:07:32 INFO - ++DOMWINDOW == 41 (0x12706dc00) [pid = 1722] [serial = 2596] [outer = 0x0] 04:07:32 INFO - ++DOMWINDOW == 42 (0x122ea0800) [pid = 1722] [serial = 2597] [outer = 0x12706dc00] 04:07:33 INFO - ++DOCSHELL 0x124f03800 == 20 [pid = 1722] [id = 1092] 04:07:33 INFO - ++DOMWINDOW == 43 (0x121164400) [pid = 1722] [serial = 2598] [outer = 0x0] 04:07:33 INFO - ++DOMWINDOW == 44 (0x12f1b3400) [pid = 1722] [serial = 2599] [outer = 0x121164400] 04:07:33 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 04:07:33 INFO - MEMORY STAT | vsize 3482MB | residentFast 551MB | heapAllocated 177MB 04:07:33 INFO - 457 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_scratchpad_panel_link.js | took 2903ms 04:07:33 INFO - ++DOCSHELL 0x120dc4800 == 21 [pid = 1722] [id = 1093] 04:07:33 INFO - ++DOMWINDOW == 45 (0x11e78a000) [pid = 1722] [serial = 2600] [outer = 0x0] 04:07:33 INFO - ++DOMWINDOW == 46 (0x11eefb000) [pid = 1722] [serial = 2601] [outer = 0x11e78a000] 04:07:34 INFO - 458 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_show_subresource_security_errors.js 04:07:34 INFO - ++DOCSHELL 0x121853800 == 22 [pid = 1722] [id = 1094] 04:07:34 INFO - ++DOMWINDOW == 47 (0x122122c00) [pid = 1722] [serial = 2602] [outer = 0x0] 04:07:34 INFO - ++DOMWINDOW == 48 (0x122ea7000) [pid = 1722] [serial = 2603] [outer = 0x122122c00] 04:07:34 INFO - ++DOCSHELL 0x114b6b800 == 23 [pid = 1722] [id = 1095] 04:07:34 INFO - ++DOMWINDOW == 49 (0x124349400) [pid = 1722] [serial = 2604] [outer = 0x0] 04:07:34 INFO - ++DOMWINDOW == 50 (0x1250b4400) [pid = 1722] [serial = 2605] [outer = 0x124349400] 04:07:34 INFO - ++DOMWINDOW == 51 (0x12477f400) [pid = 1722] [serial = 2606] [outer = 0x124349400] 04:07:34 INFO - ++DOCSHELL 0x12ee79800 == 24 [pid = 1722] [id = 1096] 04:07:34 INFO - ++DOMWINDOW == 52 (0x1273eac00) [pid = 1722] [serial = 2607] [outer = 0x0] 04:07:34 INFO - ++DOMWINDOW == 53 (0x12ee0ec00) [pid = 1722] [serial = 2608] [outer = 0x1273eac00] 04:07:35 INFO - ++DOMWINDOW == 54 (0x13000dc00) [pid = 1722] [serial = 2609] [outer = 0x122122c00] 04:07:35 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:07:36 INFO - --DOCSHELL 0x11345c800 == 23 [pid = 1722] [id = 1081] 04:07:36 INFO - --DOCSHELL 0x112cc6000 == 22 [pid = 1722] [id = 1080] 04:07:36 INFO - --DOCSHELL 0x113465000 == 21 [pid = 1722] [id = 1084] 04:07:36 INFO - --DOCSHELL 0x12ee79800 == 20 [pid = 1722] [id = 1096] 04:07:36 INFO - --DOCSHELL 0x112854800 == 19 [pid = 1722] [id = 1082] 04:07:36 INFO - --DOCSHELL 0x11ec58000 == 18 [pid = 1722] [id = 1083] 04:07:36 INFO - --DOCSHELL 0x120e07800 == 17 [pid = 1722] [id = 1090] 04:07:36 INFO - --DOCSHELL 0x122183000 == 16 [pid = 1722] [id = 1091] 04:07:36 INFO - --DOCSHELL 0x124f03800 == 15 [pid = 1722] [id = 1092] 04:07:36 INFO - --DOCSHELL 0x113e47000 == 14 [pid = 1722] [id = 1089] 04:07:36 INFO - --DOCSHELL 0x11295a000 == 13 [pid = 1722] [id = 1088] 04:07:36 INFO - --DOMWINDOW == 53 (0x1203dd400) [pid = 1722] [serial = 2558] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:36 INFO - --DOMWINDOW == 52 (0x121162000) [pid = 1722] [serial = 2560] [outer = 0x0] [url = about:blank] 04:07:36 INFO - --DOMWINDOW == 51 (0x12837e800) [pid = 1722] [serial = 2567] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:36 INFO - --DOMWINDOW == 50 (0x112f45c00) [pid = 1722] [serial = 2569] [outer = 0x0] [url = about:blank] 04:07:36 INFO - --DOMWINDOW == 49 (0x120ff4400) [pid = 1722] [serial = 2564] [outer = 0x0] [url = about:blank] 04:07:37 INFO - --DOMWINDOW == 48 (0x12025b000) [pid = 1722] [serial = 2576] [outer = 0x0] [url = about:blank] 04:07:37 INFO - --DOMWINDOW == 47 (0x12110a400) [pid = 1722] [serial = 2578] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20reflow%20activity] 04:07:37 INFO - --DOMWINDOW == 46 (0x113445800) [pid = 1722] [serial = 2587] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20Scratchpad%20panel%20linking</p>] 04:07:37 INFO - --DOMWINDOW == 45 (0x122e99800) [pid = 1722] [serial = 2594] [outer = 0x0] [url = chrome://devtools/content/scratchpad/scratchpad.xul] 04:07:37 INFO - --DOMWINDOW == 44 (0x114bfb400) [pid = 1722] [serial = 2589] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox-window.xul] 04:07:37 INFO - --DOMWINDOW == 43 (0x121164400) [pid = 1722] [serial = 2598] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:37 INFO - --DOMWINDOW == 42 (0x12706dc00) [pid = 1722] [serial = 2596] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:37 INFO - --DOMWINDOW == 41 (0x120e24c00) [pid = 1722] [serial = 2580] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:37 INFO - --DOMWINDOW == 40 (0x11ebb6c00) [pid = 1722] [serial = 2591] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:37 INFO - --DOMWINDOW == 39 (0x126241c00) [pid = 1722] [serial = 2583] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:37 INFO - --DOMWINDOW == 38 (0x112f47800) [pid = 1722] [serial = 2586] [outer = 0x0] [url = about:blank] 04:07:37 INFO - --DOMWINDOW == 37 (0x112f42800) [pid = 1722] [serial = 2585] [outer = 0x0] [url = about:blank] 04:07:37 INFO - --DOMWINDOW == 36 (0x1250b4400) [pid = 1722] [serial = 2605] [outer = 0x0] [url = about:blank] 04:07:37 INFO - --DOMWINDOW == 35 (0x120264c00) [pid = 1722] [serial = 2592] [outer = 0x0] [url = about:blank] 04:07:37 INFO - --DOMWINDOW == 34 (0x120d22800) [pid = 1722] [serial = 2577] [outer = 0x0] [url = about:blank] 04:07:37 INFO - --DOMWINDOW == 33 (0x12115d000) [pid = 1722] [serial = 2579] [outer = 0x0] [url = about:blank] 04:07:37 INFO - --DOMWINDOW == 32 (0x113449400) [pid = 1722] [serial = 2588] [outer = 0x0] [url = about:blank] 04:07:37 INFO - MEMORY STAT | vsize 3453MB | residentFast 536MB | heapAllocated 124MB 04:07:37 INFO - 459 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_show_subresource_security_errors.js | took 3293ms 04:07:37 INFO - ++DOCSHELL 0x112e90800 == 14 [pid = 1722] [id = 1097] 04:07:37 INFO - ++DOMWINDOW == 33 (0x1132e9c00) [pid = 1722] [serial = 2610] [outer = 0x0] 04:07:37 INFO - ++DOMWINDOW == 34 (0x11344ac00) [pid = 1722] [serial = 2611] [outer = 0x1132e9c00] 04:07:37 INFO - 460 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_shows_reqs_in_netmonitor.js 04:07:37 INFO - ++DOCSHELL 0x113e3c800 == 15 [pid = 1722] [id = 1098] 04:07:37 INFO - ++DOMWINDOW == 35 (0x114b21800) [pid = 1722] [serial = 2612] [outer = 0x0] 04:07:37 INFO - ++DOMWINDOW == 36 (0x114bfb400) [pid = 1722] [serial = 2613] [outer = 0x114b21800] 04:07:37 INFO - ++DOCSHELL 0x11320e000 == 16 [pid = 1722] [id = 1099] 04:07:37 INFO - ++DOMWINDOW == 37 (0x11ef53000) [pid = 1722] [serial = 2614] [outer = 0x0] 04:07:37 INFO - ++DOMWINDOW == 38 (0x12025b400) [pid = 1722] [serial = 2615] [outer = 0x11ef53000] 04:07:37 INFO - ++DOMWINDOW == 39 (0x120e24800) [pid = 1722] [serial = 2616] [outer = 0x11ef53000] 04:07:37 INFO - ++DOCSHELL 0x11f96b800 == 17 [pid = 1722] [id = 1100] 04:07:37 INFO - ++DOMWINDOW == 40 (0x1214b0400) [pid = 1722] [serial = 2617] [outer = 0x0] 04:07:37 INFO - ++DOMWINDOW == 41 (0x121828800) [pid = 1722] [serial = 2618] [outer = 0x1214b0400] 04:07:38 INFO - ++DOCSHELL 0x129368800 == 18 [pid = 1722] [id = 1101] 04:07:38 INFO - ++DOMWINDOW == 42 (0x12640cc00) [pid = 1722] [serial = 2619] [outer = 0x0] 04:07:38 INFO - ++DOMWINDOW == 43 (0x1273dd400) [pid = 1722] [serial = 2620] [outer = 0x12640cc00] 04:07:38 INFO - ++DOMWINDOW == 44 (0x120e32800) [pid = 1722] [serial = 2621] [outer = 0x114b21800] 04:07:38 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:07:38 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:39 INFO - ++DOCSHELL 0x129370000 == 19 [pid = 1722] [id = 1102] 04:07:39 INFO - ++DOMWINDOW == 45 (0x120e25000) [pid = 1722] [serial = 2622] [outer = 0x0] 04:07:39 INFO - ++DOMWINDOW == 46 (0x124776000) [pid = 1722] [serial = 2623] [outer = 0x120e25000] 04:07:39 INFO - --DOCSHELL 0x129368800 == 18 [pid = 1722] [id = 1101] 04:07:39 INFO - MEMORY STAT | vsize 3456MB | residentFast 539MB | heapAllocated 132MB 04:07:39 INFO - 461 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_shows_reqs_in_netmonitor.js | took 2211ms 04:07:39 INFO - ++DOCSHELL 0x120dcf000 == 19 [pid = 1722] [id = 1103] 04:07:39 INFO - ++DOMWINDOW == 47 (0x121811400) [pid = 1722] [serial = 2624] [outer = 0x0] 04:07:39 INFO - ++DOMWINDOW == 48 (0x1240d8c00) [pid = 1722] [serial = 2625] [outer = 0x121811400] 04:07:39 INFO - 462 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split.js 04:07:39 INFO - ++DOCSHELL 0x11e350000 == 20 [pid = 1722] [id = 1104] 04:07:39 INFO - ++DOMWINDOW == 49 (0x1247ca000) [pid = 1722] [serial = 2626] [outer = 0x0] 04:07:39 INFO - ++DOMWINDOW == 50 (0x124c36400) [pid = 1722] [serial = 2627] [outer = 0x1247ca000] 04:07:40 INFO - ++DOCSHELL 0x12d426800 == 21 [pid = 1722] [id = 1105] 04:07:40 INFO - ++DOMWINDOW == 51 (0x1276c7400) [pid = 1722] [serial = 2628] [outer = 0x0] 04:07:40 INFO - ++DOMWINDOW == 52 (0x1276cdc00) [pid = 1722] [serial = 2629] [outer = 0x1276c7400] 04:07:40 INFO - ++DOMWINDOW == 53 (0x12826e000) [pid = 1722] [serial = 2630] [outer = 0x1276c7400] 04:07:40 INFO - ++DOCSHELL 0x12ee67800 == 22 [pid = 1722] [id = 1106] 04:07:40 INFO - ++DOMWINDOW == 54 (0x12830e400) [pid = 1722] [serial = 2631] [outer = 0x0] 04:07:40 INFO - ++DOMWINDOW == 55 (0x12c4dc800) [pid = 1722] [serial = 2632] [outer = 0x12830e400] 04:07:41 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:41 INFO - ++DOCSHELL 0x11321f800 == 23 [pid = 1722] [id = 1107] 04:07:41 INFO - ++DOMWINDOW == 56 (0x112f41400) [pid = 1722] [serial = 2633] [outer = 0x0] 04:07:41 INFO - ++DOMWINDOW == 57 (0x112f45c00) [pid = 1722] [serial = 2634] [outer = 0x112f41400] 04:07:41 INFO - ++DOCSHELL 0x113472000 == 24 [pid = 1722] [id = 1108] 04:07:41 INFO - ++DOMWINDOW == 58 (0x113443400) [pid = 1722] [serial = 2635] [outer = 0x0] 04:07:41 INFO - ++DOCSHELL 0x11351d800 == 25 [pid = 1722] [id = 1109] 04:07:41 INFO - ++DOMWINDOW == 59 (0x113448400) [pid = 1722] [serial = 2636] [outer = 0x0] 04:07:41 INFO - ++DOCSHELL 0x113522000 == 26 [pid = 1722] [id = 1110] 04:07:41 INFO - ++DOMWINDOW == 60 (0x11344d400) [pid = 1722] [serial = 2637] [outer = 0x0] 04:07:41 INFO - ++DOCSHELL 0x1135aa000 == 27 [pid = 1722] [id = 1111] 04:07:41 INFO - ++DOMWINDOW == 61 (0x113d0fc00) [pid = 1722] [serial = 2638] [outer = 0x0] 04:07:41 INFO - ++DOCSHELL 0x1135ae000 == 28 [pid = 1722] [id = 1112] 04:07:41 INFO - ++DOMWINDOW == 62 (0x113e10800) [pid = 1722] [serial = 2639] [outer = 0x0] 04:07:41 INFO - ++DOMWINDOW == 63 (0x11e713000) [pid = 1722] [serial = 2640] [outer = 0x113443400] 04:07:41 INFO - ++DOMWINDOW == 64 (0x11ebb7c00) [pid = 1722] [serial = 2641] [outer = 0x113448400] 04:07:41 INFO - ++DOMWINDOW == 65 (0x120259c00) [pid = 1722] [serial = 2642] [outer = 0x11344d400] 04:07:41 INFO - ++DOMWINDOW == 66 (0x120264c00) [pid = 1722] [serial = 2643] [outer = 0x113d0fc00] 04:07:41 INFO - ++DOMWINDOW == 67 (0x1203dd800) [pid = 1722] [serial = 2644] [outer = 0x113e10800] 04:07:41 INFO - ++DOCSHELL 0x12ee71800 == 29 [pid = 1722] [id = 1113] 04:07:41 INFO - ++DOMWINDOW == 68 (0x124390400) [pid = 1722] [serial = 2645] [outer = 0x0] 04:07:41 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:41 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:41 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:41 INFO - ++DOCSHELL 0x12f126800 == 30 [pid = 1722] [id = 1114] 04:07:41 INFO - ++DOMWINDOW == 69 (0x1250b5000) [pid = 1722] [serial = 2646] [outer = 0x0] 04:07:41 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:41 INFO - ++DOMWINDOW == 70 (0x1266ea400) [pid = 1722] [serial = 2647] [outer = 0x124390400] 04:07:41 INFO - ++DOMWINDOW == 71 (0x113e11800) [pid = 1722] [serial = 2648] [outer = 0x1250b5000] 04:07:41 INFO - ++DOCSHELL 0x120e0a800 == 31 [pid = 1722] [id = 1115] 04:07:41 INFO - ++DOMWINDOW == 72 (0x12c4de400) [pid = 1722] [serial = 2649] [outer = 0x0] 04:07:41 INFO - ++DOMWINDOW == 73 (0x12d402400) [pid = 1722] [serial = 2650] [outer = 0x12c4de400] 04:07:41 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:41 INFO - ++DOCSHELL 0x12f5bf800 == 32 [pid = 1722] [id = 1116] 04:07:41 INFO - ++DOMWINDOW == 74 (0x126242400) [pid = 1722] [serial = 2651] [outer = 0x0] 04:07:41 INFO - ++DOCSHELL 0x12f5c0000 == 33 [pid = 1722] [id = 1117] 04:07:41 INFO - ++DOMWINDOW == 75 (0x12dd86400) [pid = 1722] [serial = 2652] [outer = 0x0] 04:07:41 INFO - ++DOCSHELL 0x12f5c0800 == 34 [pid = 1722] [id = 1118] 04:07:41 INFO - ++DOMWINDOW == 76 (0x12e05ec00) [pid = 1722] [serial = 2653] [outer = 0x0] 04:07:41 INFO - ++DOCSHELL 0x12f5c2000 == 35 [pid = 1722] [id = 1119] 04:07:41 INFO - ++DOMWINDOW == 77 (0x12e060000) [pid = 1722] [serial = 2654] [outer = 0x0] 04:07:41 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:41 INFO - ++DOCSHELL 0x12f5be800 == 36 [pid = 1722] [id = 1120] 04:07:41 INFO - ++DOMWINDOW == 78 (0x12e061000) [pid = 1722] [serial = 2655] [outer = 0x0] 04:07:41 INFO - ++DOMWINDOW == 79 (0x12e061800) [pid = 1722] [serial = 2656] [outer = 0x12e061000] 04:07:41 INFO - ++DOMWINDOW == 80 (0x12f599000) [pid = 1722] [serial = 2657] [outer = 0x126242400] 04:07:41 INFO - ++DOMWINDOW == 81 (0x12f59c800) [pid = 1722] [serial = 2658] [outer = 0x12dd86400] 04:07:41 INFO - ++DOMWINDOW == 82 (0x12f5a0400) [pid = 1722] [serial = 2659] [outer = 0x12e05ec00] 04:07:41 INFO - ++DOMWINDOW == 83 (0x12f5a1800) [pid = 1722] [serial = 2660] [outer = 0x12e060000] 04:07:41 INFO - ++DOMWINDOW == 84 (0x12f5a4800) [pid = 1722] [serial = 2661] [outer = 0x12e061000] 04:07:42 INFO - ++DOCSHELL 0x112ba2800 == 37 [pid = 1722] [id = 1121] 04:07:42 INFO - ++DOMWINDOW == 85 (0x13009dc00) [pid = 1722] [serial = 2662] [outer = 0x0] 04:07:42 INFO - ++DOMWINDOW == 86 (0x1300a2400) [pid = 1722] [serial = 2663] [outer = 0x13009dc00] 04:07:42 INFO - ++DOCSHELL 0x1301b7800 == 38 [pid = 1722] [id = 1122] 04:07:42 INFO - ++DOMWINDOW == 87 (0x130418000) [pid = 1722] [serial = 2664] [outer = 0x0] 04:07:43 INFO - ++DOMWINDOW == 88 (0x13052a800) [pid = 1722] [serial = 2665] [outer = 0x130418000] 04:07:43 INFO - ++DOCSHELL 0x12f91c800 == 39 [pid = 1722] [id = 1123] 04:07:43 INFO - ++DOMWINDOW == 89 (0x132654c00) [pid = 1722] [serial = 2666] [outer = 0x0] 04:07:43 INFO - ++DOMWINDOW == 90 (0x132655c00) [pid = 1722] [serial = 2667] [outer = 0x132654c00] 04:07:44 INFO - --DOCSHELL 0x113459800 == 38 [pid = 1722] [id = 1087] 04:07:44 INFO - --DOCSHELL 0x121853800 == 37 [pid = 1722] [id = 1094] 04:07:44 INFO - --DOCSHELL 0x112cc5800 == 36 [pid = 1722] [id = 1086] 04:07:44 INFO - --DOCSHELL 0x114b6b800 == 35 [pid = 1722] [id = 1095] 04:07:44 INFO - --DOCSHELL 0x11f96b800 == 34 [pid = 1722] [id = 1100] 04:07:44 INFO - --DOCSHELL 0x129370000 == 33 [pid = 1722] [id = 1102] 04:07:44 INFO - --DOCSHELL 0x12f5be800 == 32 [pid = 1722] [id = 1120] 04:07:44 INFO - --DOMWINDOW == 89 (0x122337400) [pid = 1722] [serial = 2582] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:44 INFO - --DOMWINDOW == 88 (0x126403400) [pid = 1722] [serial = 2584] [outer = 0x0] [url = about:blank] 04:07:44 INFO - --DOMWINDOW == 87 (0x121161400) [pid = 1722] [serial = 2593] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:44 INFO - --DOMWINDOW == 86 (0x12f1b3400) [pid = 1722] [serial = 2599] [outer = 0x0] [url = about:blank] 04:07:44 INFO - --DOMWINDOW == 85 (0x122ea0800) [pid = 1722] [serial = 2597] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:44 INFO - --DOMWINDOW == 84 (0x122ea4c00) [pid = 1722] [serial = 2595] [outer = 0x0] [url = about:blank] 04:07:44 INFO - --DOMWINDOW == 83 (0x11e7aa000) [pid = 1722] [serial = 2590] [outer = 0x0] [url = about:blank] 04:07:44 INFO - ++DOCSHELL 0x11331c800 == 33 [pid = 1722] [id = 1124] 04:07:44 INFO - ++DOMWINDOW == 84 (0x11ec99400) [pid = 1722] [serial = 2668] [outer = 0x0] 04:07:44 INFO - ++DOMWINDOW == 85 (0x11ee5c400) [pid = 1722] [serial = 2669] [outer = 0x11ec99400] 04:07:45 INFO - ++DOCSHELL 0x121853800 == 34 [pid = 1722] [id = 1125] 04:07:45 INFO - ++DOMWINDOW == 86 (0x124c37c00) [pid = 1722] [serial = 2670] [outer = 0x0] 04:07:45 INFO - ++DOMWINDOW == 87 (0x124fb7000) [pid = 1722] [serial = 2671] [outer = 0x124c37c00] 04:07:45 INFO - ++DOCSHELL 0x122180000 == 35 [pid = 1722] [id = 1126] 04:07:45 INFO - ++DOMWINDOW == 88 (0x1276c8c00) [pid = 1722] [serial = 2672] [outer = 0x0] 04:07:45 INFO - ++DOMWINDOW == 89 (0x1221bb800) [pid = 1722] [serial = 2673] [outer = 0x1276c8c00] 04:07:45 INFO - ++DOCSHELL 0x121850800 == 36 [pid = 1722] [id = 1127] 04:07:45 INFO - ++DOMWINDOW == 90 (0x128704400) [pid = 1722] [serial = 2674] [outer = 0x0] 04:07:45 INFO - ++DOMWINDOW == 91 (0x128706400) [pid = 1722] [serial = 2675] [outer = 0x128704400] 04:07:46 INFO - [1722] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 04:07:46 INFO - [1722] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 04:07:46 INFO - ++DOCSHELL 0x12185c000 == 37 [pid = 1722] [id = 1128] 04:07:46 INFO - ++DOMWINDOW == 92 (0x12d408c00) [pid = 1722] [serial = 2676] [outer = 0x0] 04:07:46 INFO - ++DOMWINDOW == 93 (0x12d40f400) [pid = 1722] [serial = 2677] [outer = 0x12d408c00] 04:07:46 INFO - ++DOCSHELL 0x129667000 == 38 [pid = 1722] [id = 1129] 04:07:46 INFO - ++DOMWINDOW == 94 (0x130417800) [pid = 1722] [serial = 2678] [outer = 0x0] 04:07:46 INFO - ++DOMWINDOW == 95 (0x132658000) [pid = 1722] [serial = 2679] [outer = 0x130417800] 04:07:46 INFO - [1722] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 04:07:46 INFO - [1722] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 04:07:46 INFO - ++DOCSHELL 0x12d436000 == 39 [pid = 1722] [id = 1130] 04:07:46 INFO - ++DOMWINDOW == 96 (0x130417400) [pid = 1722] [serial = 2680] [outer = 0x0] 04:07:46 INFO - ++DOMWINDOW == 97 (0x13bc84800) [pid = 1722] [serial = 2681] [outer = 0x130417400] 04:07:46 INFO - [1722] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 04:07:46 INFO - [1722] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 04:07:46 INFO - --DOCSHELL 0x12f5c0000 == 38 [pid = 1722] [id = 1117] 04:07:46 INFO - --DOCSHELL 0x12f5c0800 == 37 [pid = 1722] [id = 1118] 04:07:46 INFO - --DOCSHELL 0x12f5bf800 == 36 [pid = 1722] [id = 1116] 04:07:46 INFO - --DOCSHELL 0x12f5c2000 == 35 [pid = 1722] [id = 1119] 04:07:46 INFO - --DOCSHELL 0x12f126800 == 34 [pid = 1722] [id = 1114] 04:07:46 INFO - --DOCSHELL 0x12ee71800 == 33 [pid = 1722] [id = 1113] 04:07:46 INFO - --DOCSHELL 0x11321f800 == 32 [pid = 1722] [id = 1107] 04:07:46 INFO - --DOCSHELL 0x1301b7800 == 31 [pid = 1722] [id = 1122] 04:07:47 INFO - --DOCSHELL 0x122180000 == 30 [pid = 1722] [id = 1126] 04:07:47 INFO - --DOCSHELL 0x12185c000 == 29 [pid = 1722] [id = 1128] 04:07:47 INFO - --DOCSHELL 0x12ee67800 == 28 [pid = 1722] [id = 1106] 04:07:47 INFO - --DOCSHELL 0x120e0a800 == 27 [pid = 1722] [id = 1115] 04:07:47 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 04:07:48 INFO - --DOCSHELL 0x112e90800 == 26 [pid = 1722] [id = 1097] 04:07:48 INFO - --DOCSHELL 0x11331c800 == 25 [pid = 1722] [id = 1124] 04:07:48 INFO - --DOCSHELL 0x121853800 == 24 [pid = 1722] [id = 1125] 04:07:48 INFO - --DOCSHELL 0x113e3c800 == 23 [pid = 1722] [id = 1098] 04:07:48 INFO - --DOCSHELL 0x112ba2800 == 22 [pid = 1722] [id = 1121] 04:07:48 INFO - --DOCSHELL 0x120dc4800 == 21 [pid = 1722] [id = 1093] 04:07:48 INFO - --DOCSHELL 0x113472000 == 20 [pid = 1722] [id = 1108] 04:07:48 INFO - --DOCSHELL 0x11351d800 == 19 [pid = 1722] [id = 1109] 04:07:48 INFO - --DOCSHELL 0x113522000 == 18 [pid = 1722] [id = 1110] 04:07:48 INFO - --DOCSHELL 0x1135aa000 == 17 [pid = 1722] [id = 1111] 04:07:48 INFO - --DOCSHELL 0x1135ae000 == 16 [pid = 1722] [id = 1112] 04:07:48 INFO - --DOCSHELL 0x11320e000 == 15 [pid = 1722] [id = 1099] 04:07:48 INFO - --DOCSHELL 0x12f91c800 == 14 [pid = 1722] [id = 1123] 04:07:48 INFO - ++DOCSHELL 0x11284f800 == 15 [pid = 1722] [id = 1131] 04:07:48 INFO - ++DOMWINDOW == 98 (0x1129be000) [pid = 1722] [serial = 2682] [outer = 0x0] 04:07:48 INFO - ++DOMWINDOW == 99 (0x112bc1000) [pid = 1722] [serial = 2683] [outer = 0x1129be000] 04:07:48 INFO - --DOMWINDOW == 98 (0x1214b0400) [pid = 1722] [serial = 2617] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 04:07:48 INFO - --DOMWINDOW == 97 (0x1132e9c00) [pid = 1722] [serial = 2610] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 96 (0x12640cc00) [pid = 1722] [serial = 2619] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 95 (0x11e78a000) [pid = 1722] [serial = 2600] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 94 (0x122122c00) [pid = 1722] [serial = 2602] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug1092055_shouldwarn.html] 04:07:48 INFO - --DOMWINDOW == 93 (0x114b21800) [pid = 1722] [serial = 2612] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:07:48 INFO - --DOMWINDOW == 92 (0x12e061000) [pid = 1722] [serial = 2655] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:48 INFO - --DOMWINDOW == 91 (0x130417800) [pid = 1722] [serial = 2678] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 90 (0x128704400) [pid = 1722] [serial = 2674] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 89 (0x113e10800) [pid = 1722] [serial = 2639] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:48 INFO - --DOMWINDOW == 88 (0x1276cdc00) [pid = 1722] [serial = 2629] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 87 (0x113443400) [pid = 1722] [serial = 2635] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:48 INFO - --DOMWINDOW == 86 (0x113448400) [pid = 1722] [serial = 2636] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:48 INFO - --DOMWINDOW == 85 (0x11344d400) [pid = 1722] [serial = 2637] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:48 INFO - --DOMWINDOW == 84 (0x113d0fc00) [pid = 1722] [serial = 2638] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:48 INFO - --DOMWINDOW == 83 (0x1276c8c00) [pid = 1722] [serial = 2672] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 82 (0x12d408c00) [pid = 1722] [serial = 2676] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox-window.xul] 04:07:48 INFO - --DOMWINDOW == 81 (0x1250b5000) [pid = 1722] [serial = 2646] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:48 INFO - --DOMWINDOW == 80 (0x124390400) [pid = 1722] [serial = 2645] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:48 INFO - --DOMWINDOW == 79 (0x1221bb800) [pid = 1722] [serial = 2673] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 78 (0x12e060000) [pid = 1722] [serial = 2654] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:48 INFO - --DOMWINDOW == 77 (0x12e05ec00) [pid = 1722] [serial = 2653] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:48 INFO - --DOMWINDOW == 76 (0x12dd86400) [pid = 1722] [serial = 2652] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:48 INFO - --DOMWINDOW == 75 (0x126242400) [pid = 1722] [serial = 2651] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:48 INFO - --DOMWINDOW == 74 (0x13bc84800) [pid = 1722] [serial = 2681] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 73 (0x130417400) [pid = 1722] [serial = 2680] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 72 (0x130418000) [pid = 1722] [serial = 2664] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:48 INFO - --DOMWINDOW == 71 (0x11ef53000) [pid = 1722] [serial = 2614] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:48 INFO - --DOMWINDOW == 70 (0x120e25000) [pid = 1722] [serial = 2622] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:48 INFO - --DOMWINDOW == 69 (0x124349400) [pid = 1722] [serial = 2604] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:48 INFO - --DOMWINDOW == 68 (0x1273eac00) [pid = 1722] [serial = 2607] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:48 INFO - --DOMWINDOW == 67 (0x12e061800) [pid = 1722] [serial = 2656] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 66 (0x132658000) [pid = 1722] [serial = 2679] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 65 (0x128706400) [pid = 1722] [serial = 2675] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 64 (0x11344ac00) [pid = 1722] [serial = 2611] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 63 (0x12025b400) [pid = 1722] [serial = 2615] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 62 (0x1273dd400) [pid = 1722] [serial = 2620] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 61 (0x11eefb000) [pid = 1722] [serial = 2601] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 60 (0x122ea7000) [pid = 1722] [serial = 2603] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 59 (0x114bfb400) [pid = 1722] [serial = 2613] [outer = 0x0] [url = about:blank] 04:07:48 INFO - --DOMWINDOW == 58 (0x12f5a4800) [pid = 1722] [serial = 2661] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:48 INFO - --DOMWINDOW == 57 (0x1203dd800) [pid = 1722] [serial = 2644] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:48 INFO - --DOMWINDOW == 56 (0x120259c00) [pid = 1722] [serial = 2642] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:48 INFO - --DOMWINDOW == 55 (0x13000dc00) [pid = 1722] [serial = 2609] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug1092055_shouldwarn.html] 04:07:48 INFO - --DOMWINDOW == 54 (0x120e32800) [pid = 1722] [serial = 2621] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 04:07:48 INFO - ++DOMWINDOW == 55 (0x113443400) [pid = 1722] [serial = 2684] [outer = 0x1129be000] 04:07:49 INFO - ++DOCSHELL 0x113456800 == 16 [pid = 1722] [id = 1132] 04:07:49 INFO - ++DOMWINDOW == 56 (0x112c9e800) [pid = 1722] [serial = 2685] [outer = 0x0] 04:07:49 INFO - ++DOMWINDOW == 57 (0x122ea0000) [pid = 1722] [serial = 2686] [outer = 0x112c9e800] 04:07:49 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:49 INFO - ++DOCSHELL 0x124f18800 == 17 [pid = 1722] [id = 1133] 04:07:49 INFO - ++DOMWINDOW == 58 (0x1276ad800) [pid = 1722] [serial = 2687] [outer = 0x0] 04:07:49 INFO - ++DOMWINDOW == 59 (0x1276b0000) [pid = 1722] [serial = 2688] [outer = 0x1276ad800] 04:07:49 INFO - ++DOCSHELL 0x12570a000 == 18 [pid = 1722] [id = 1134] 04:07:49 INFO - ++DOMWINDOW == 60 (0x1276c1c00) [pid = 1722] [serial = 2689] [outer = 0x0] 04:07:49 INFO - ++DOCSHELL 0x126190800 == 19 [pid = 1722] [id = 1135] 04:07:49 INFO - ++DOMWINDOW == 61 (0x1276c3c00) [pid = 1722] [serial = 2690] [outer = 0x0] 04:07:49 INFO - ++DOCSHELL 0x12645a000 == 20 [pid = 1722] [id = 1136] 04:07:49 INFO - ++DOMWINDOW == 62 (0x1276c8800) [pid = 1722] [serial = 2691] [outer = 0x0] 04:07:49 INFO - ++DOCSHELL 0x11eb96800 == 21 [pid = 1722] [id = 1137] 04:07:49 INFO - ++DOMWINDOW == 63 (0x1276cbc00) [pid = 1722] [serial = 2692] [outer = 0x0] 04:07:49 INFO - ++DOCSHELL 0x12820c800 == 22 [pid = 1722] [id = 1138] 04:07:49 INFO - ++DOMWINDOW == 64 (0x1276cd400) [pid = 1722] [serial = 2693] [outer = 0x0] 04:07:49 INFO - ++DOMWINDOW == 65 (0x12826b400) [pid = 1722] [serial = 2694] [outer = 0x1276c1c00] 04:07:49 INFO - ++DOMWINDOW == 66 (0x12826e800) [pid = 1722] [serial = 2695] [outer = 0x1276c3c00] 04:07:49 INFO - ++DOMWINDOW == 67 (0x128270000) [pid = 1722] [serial = 2696] [outer = 0x1276c8800] 04:07:49 INFO - ++DOMWINDOW == 68 (0x128271800) [pid = 1722] [serial = 2697] [outer = 0x1276cbc00] 04:07:49 INFO - ++DOMWINDOW == 69 (0x128273c00) [pid = 1722] [serial = 2698] [outer = 0x1276cd400] 04:07:49 INFO - ++DOCSHELL 0x11ec43000 == 23 [pid = 1722] [id = 1139] 04:07:49 INFO - ++DOMWINDOW == 70 (0x113449400) [pid = 1722] [serial = 2699] [outer = 0x0] 04:07:49 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:49 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:49 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:49 INFO - ++DOCSHELL 0x124f20800 == 24 [pid = 1722] [id = 1140] 04:07:49 INFO - ++DOMWINDOW == 71 (0x113e0f800) [pid = 1722] [serial = 2700] [outer = 0x0] 04:07:49 INFO - ++DOCSHELL 0x12820e000 == 25 [pid = 1722] [id = 1141] 04:07:49 INFO - ++DOMWINDOW == 72 (0x124392000) [pid = 1722] [serial = 2701] [outer = 0x0] 04:07:49 INFO - ++DOCSHELL 0x12c447800 == 26 [pid = 1722] [id = 1142] 04:07:49 INFO - ++DOMWINDOW == 73 (0x12449a400) [pid = 1722] [serial = 2702] [outer = 0x0] 04:07:49 INFO - ++DOCSHELL 0x12d421800 == 27 [pid = 1722] [id = 1143] 04:07:49 INFO - ++DOMWINDOW == 74 (0x1245bb800) [pid = 1722] [serial = 2703] [outer = 0x0] 04:07:49 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:49 INFO - ++DOCSHELL 0x12d429800 == 28 [pid = 1722] [id = 1144] 04:07:49 INFO - ++DOMWINDOW == 75 (0x126143800) [pid = 1722] [serial = 2704] [outer = 0x0] 04:07:49 INFO - ++DOMWINDOW == 76 (0x126237800) [pid = 1722] [serial = 2705] [outer = 0x126143800] 04:07:49 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:49 INFO - ++DOCSHELL 0x12d99d800 == 29 [pid = 1722] [id = 1145] 04:07:49 INFO - ++DOMWINDOW == 77 (0x12623cc00) [pid = 1722] [serial = 2706] [outer = 0x0] 04:07:49 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:49 INFO - ++DOMWINDOW == 78 (0x1215eb400) [pid = 1722] [serial = 2707] [outer = 0x113449400] 04:07:49 INFO - ++DOMWINDOW == 79 (0x1273e4400) [pid = 1722] [serial = 2708] [outer = 0x113e0f800] 04:07:49 INFO - ++DOMWINDOW == 80 (0x128279c00) [pid = 1722] [serial = 2709] [outer = 0x124392000] 04:07:49 INFO - ++DOMWINDOW == 81 (0x128308400) [pid = 1722] [serial = 2710] [outer = 0x12449a400] 04:07:49 INFO - ++DOMWINDOW == 82 (0x12838ac00) [pid = 1722] [serial = 2711] [outer = 0x1245bb800] 04:07:49 INFO - ++DOMWINDOW == 83 (0x1283eac00) [pid = 1722] [serial = 2712] [outer = 0x126143800] 04:07:49 INFO - ++DOMWINDOW == 84 (0x1283f1800) [pid = 1722] [serial = 2713] [outer = 0x12623cc00] 04:07:50 INFO - --DOCSHELL 0x129667000 == 28 [pid = 1722] [id = 1129] 04:07:50 INFO - --DOCSHELL 0x113456800 == 27 [pid = 1722] [id = 1132] 04:07:50 INFO - --DOCSHELL 0x124f18800 == 26 [pid = 1722] [id = 1133] 04:07:50 INFO - --DOCSHELL 0x121850800 == 25 [pid = 1722] [id = 1127] 04:07:50 INFO - --DOCSHELL 0x12570a000 == 24 [pid = 1722] [id = 1134] 04:07:50 INFO - --DOCSHELL 0x126190800 == 23 [pid = 1722] [id = 1135] 04:07:50 INFO - --DOCSHELL 0x12d426800 == 22 [pid = 1722] [id = 1105] 04:07:50 INFO - --DOCSHELL 0x12d436000 == 21 [pid = 1722] [id = 1130] 04:07:50 INFO - --DOMWINDOW == 83 (0x120e24800) [pid = 1722] [serial = 2616] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:50 INFO - --DOMWINDOW == 82 (0x124776000) [pid = 1722] [serial = 2623] [outer = 0x0] [url = about:blank] 04:07:50 INFO - --DOMWINDOW == 81 (0x12477f400) [pid = 1722] [serial = 2606] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:50 INFO - --DOMWINDOW == 80 (0x12ee0ec00) [pid = 1722] [serial = 2608] [outer = 0x0] [url = about:blank] 04:07:50 INFO - --DOCSHELL 0x12d421800 == 20 [pid = 1722] [id = 1143] 04:07:50 INFO - --DOMWINDOW == 79 (0x121828800) [pid = 1722] [serial = 2618] [outer = 0x0] [url = about:blank] 04:07:50 INFO - --DOMWINDOW == 78 (0x12f599000) [pid = 1722] [serial = 2657] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 77 (0x113e11800) [pid = 1722] [serial = 2648] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 76 (0x1266ea400) [pid = 1722] [serial = 2647] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:50 INFO - --DOMWINDOW == 75 (0x11ebb7c00) [pid = 1722] [serial = 2641] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:50 INFO - --DOMWINDOW == 74 (0x11e713000) [pid = 1722] [serial = 2640] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:50 INFO - --DOCSHELL 0x12c447800 == 19 [pid = 1722] [id = 1142] 04:07:50 INFO - --DOCSHELL 0x12820e000 == 18 [pid = 1722] [id = 1141] 04:07:50 INFO - --DOCSHELL 0x12d99d800 == 17 [pid = 1722] [id = 1145] 04:07:50 INFO - --DOCSHELL 0x124f20800 == 16 [pid = 1722] [id = 1140] 04:07:50 INFO - --DOMWINDOW == 73 (0x12d40f400) [pid = 1722] [serial = 2677] [outer = 0x0] [url = about:blank] 04:07:50 INFO - --DOMWINDOW == 72 (0x12f59c800) [pid = 1722] [serial = 2658] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 71 (0x12f5a0400) [pid = 1722] [serial = 2659] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 70 (0x12f5a1800) [pid = 1722] [serial = 2660] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 69 (0x120264c00) [pid = 1722] [serial = 2643] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:50 INFO - --DOMWINDOW == 68 (0x13052a800) [pid = 1722] [serial = 2665] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:50 INFO - --DOCSHELL 0x12820c800 == 15 [pid = 1722] [id = 1138] 04:07:50 INFO - --DOCSHELL 0x11eb96800 == 14 [pid = 1722] [id = 1137] 04:07:50 INFO - --DOCSHELL 0x12645a000 == 13 [pid = 1722] [id = 1136] 04:07:50 INFO - --DOMWINDOW == 67 (0x1215eb400) [pid = 1722] [serial = 2707] [outer = 0x113449400] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:50 INFO - --DOMWINDOW == 66 (0x1283f1800) [pid = 1722] [serial = 2713] [outer = 0x12623cc00] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 65 (0x12838ac00) [pid = 1722] [serial = 2711] [outer = 0x1245bb800] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 64 (0x1273e4400) [pid = 1722] [serial = 2708] [outer = 0x113e0f800] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 63 (0x128308400) [pid = 1722] [serial = 2710] [outer = 0x12449a400] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 62 (0x128279c00) [pid = 1722] [serial = 2709] [outer = 0x124392000] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:50 INFO - --DOCSHELL 0x12d429800 == 12 [pid = 1722] [id = 1144] 04:07:50 INFO - --DOMWINDOW == 61 (0x113449400) [pid = 1722] [serial = 2699] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:50 INFO - --DOMWINDOW == 60 (0x12623cc00) [pid = 1722] [serial = 2706] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 59 (0x1245bb800) [pid = 1722] [serial = 2703] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 58 (0x113e0f800) [pid = 1722] [serial = 2700] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 57 (0x12449a400) [pid = 1722] [serial = 2702] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:50 INFO - --DOMWINDOW == 56 (0x124392000) [pid = 1722] [serial = 2701] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:50 INFO - --DOCSHELL 0x11ec43000 == 11 [pid = 1722] [id = 1139] 04:07:50 INFO - --DOMWINDOW == 55 (0x11ec99400) [pid = 1722] [serial = 2668] [outer = 0x0] [url = chrome://devtools/content/performance/performance.xul] 04:07:50 INFO - --DOMWINDOW == 54 (0x13009dc00) [pid = 1722] [serial = 2662] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 04:07:50 INFO - --DOMWINDOW == 53 (0x132654c00) [pid = 1722] [serial = 2666] [outer = 0x0] [url = chrome://devtools/content/styleeditor/styleeditor.xul] 04:07:50 INFO - --DOMWINDOW == 52 (0x124c37c00) [pid = 1722] [serial = 2670] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 04:07:50 INFO - --DOMWINDOW == 51 (0x112f41400) [pid = 1722] [serial = 2633] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:07:50 INFO - --DOMWINDOW == 50 (0x126237800) [pid = 1722] [serial = 2705] [outer = 0x0] [url = about:blank] 04:07:50 INFO - --DOMWINDOW == 49 (0x112bc1000) [pid = 1722] [serial = 2683] [outer = 0x0] [url = about:blank] 04:07:50 INFO - --DOMWINDOW == 48 (0x126143800) [pid = 1722] [serial = 2704] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:50 INFO - --DOMWINDOW == 47 (0x1276cbc00) [pid = 1722] [serial = 2692] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:50 INFO - --DOMWINDOW == 46 (0x1276c8800) [pid = 1722] [serial = 2691] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:50 INFO - --DOMWINDOW == 45 (0x1276c3c00) [pid = 1722] [serial = 2690] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:50 INFO - --DOMWINDOW == 44 (0x1276c1c00) [pid = 1722] [serial = 2689] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:50 INFO - --DOMWINDOW == 43 (0x1276c7400) [pid = 1722] [serial = 2628] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:50 INFO - --DOMWINDOW == 42 (0x12830e400) [pid = 1722] [serial = 2631] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:07:50 INFO - --DOMWINDOW == 41 (0x12c4de400) [pid = 1722] [serial = 2649] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:50 INFO - MEMORY STAT | vsize 3452MB | residentFast 532MB | heapAllocated 125MB 04:07:50 INFO - 463 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split.js | took 10997ms 04:07:50 INFO - ++DOCSHELL 0x112cbc000 == 12 [pid = 1722] [id = 1146] 04:07:50 INFO - ++DOMWINDOW == 42 (0x112f41c00) [pid = 1722] [serial = 2714] [outer = 0x0] 04:07:50 INFO - ++DOMWINDOW == 43 (0x112f4a800) [pid = 1722] [serial = 2715] [outer = 0x112f41c00] 04:07:51 INFO - 464 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split_escape_key.js 04:07:51 INFO - ++DOCSHELL 0x113314000 == 13 [pid = 1722] [id = 1147] 04:07:51 INFO - ++DOMWINDOW == 44 (0x11344ac00) [pid = 1722] [serial = 2716] [outer = 0x0] 04:07:51 INFO - ++DOMWINDOW == 45 (0x113d09000) [pid = 1722] [serial = 2717] [outer = 0x11344ac00] 04:07:51 INFO - ++DOCSHELL 0x113454800 == 14 [pid = 1722] [id = 1148] 04:07:51 INFO - ++DOMWINDOW == 46 (0x113d0c800) [pid = 1722] [serial = 2718] [outer = 0x0] 04:07:51 INFO - ++DOMWINDOW == 47 (0x11513f800) [pid = 1722] [serial = 2719] [outer = 0x113d0c800] 04:07:51 INFO - ++DOMWINDOW == 48 (0x1202e6000) [pid = 1722] [serial = 2720] [outer = 0x113d0c800] 04:07:51 INFO - ++DOCSHELL 0x11efc4000 == 15 [pid = 1722] [id = 1149] 04:07:51 INFO - ++DOMWINDOW == 49 (0x126244400) [pid = 1722] [serial = 2721] [outer = 0x0] 04:07:51 INFO - ++DOMWINDOW == 50 (0x1276aa400) [pid = 1722] [serial = 2722] [outer = 0x126244400] 04:07:52 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:52 INFO - ++DOCSHELL 0x121568800 == 16 [pid = 1722] [id = 1150] 04:07:52 INFO - ++DOMWINDOW == 51 (0x120fee000) [pid = 1722] [serial = 2723] [outer = 0x0] 04:07:52 INFO - ++DOMWINDOW == 52 (0x121108800) [pid = 1722] [serial = 2724] [outer = 0x120fee000] 04:07:52 INFO - ++DOCSHELL 0x1223db800 == 17 [pid = 1722] [id = 1151] 04:07:52 INFO - ++DOMWINDOW == 53 (0x121536000) [pid = 1722] [serial = 2725] [outer = 0x0] 04:07:52 INFO - ++DOCSHELL 0x1228d8000 == 18 [pid = 1722] [id = 1152] 04:07:52 INFO - ++DOMWINDOW == 54 (0x121806000) [pid = 1722] [serial = 2726] [outer = 0x0] 04:07:52 INFO - ++DOCSHELL 0x122e3e800 == 19 [pid = 1722] [id = 1153] 04:07:52 INFO - ++DOMWINDOW == 55 (0x12180d800) [pid = 1722] [serial = 2727] [outer = 0x0] 04:07:52 INFO - ++DOCSHELL 0x124471000 == 20 [pid = 1722] [id = 1154] 04:07:52 INFO - ++DOMWINDOW == 56 (0x122120c00) [pid = 1722] [serial = 2728] [outer = 0x0] 04:07:52 INFO - ++DOCSHELL 0x124690800 == 21 [pid = 1722] [id = 1155] 04:07:52 INFO - ++DOMWINDOW == 57 (0x122124400) [pid = 1722] [serial = 2729] [outer = 0x0] 04:07:52 INFO - ++DOMWINDOW == 58 (0x1240d0000) [pid = 1722] [serial = 2730] [outer = 0x121536000] 04:07:52 INFO - ++DOMWINDOW == 59 (0x124776000) [pid = 1722] [serial = 2731] [outer = 0x121806000] 04:07:52 INFO - ++DOMWINDOW == 60 (0x1276b3c00) [pid = 1722] [serial = 2732] [outer = 0x12180d800] 04:07:52 INFO - ++DOMWINDOW == 61 (0x12830d000) [pid = 1722] [serial = 2733] [outer = 0x122120c00] 04:07:52 INFO - ++DOMWINDOW == 62 (0x12830f400) [pid = 1722] [serial = 2734] [outer = 0x122124400] 04:07:52 INFO - ++DOCSHELL 0x121889000 == 22 [pid = 1722] [id = 1156] 04:07:52 INFO - ++DOMWINDOW == 63 (0x1286c9800) [pid = 1722] [serial = 2735] [outer = 0x0] 04:07:52 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:52 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:52 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:52 INFO - ++DOCSHELL 0x124697000 == 23 [pid = 1722] [id = 1157] 04:07:52 INFO - ++DOMWINDOW == 64 (0x1203ddc00) [pid = 1722] [serial = 2736] [outer = 0x0] 04:07:52 INFO - ++DOCSHELL 0x129d32800 == 24 [pid = 1722] [id = 1158] 04:07:52 INFO - ++DOMWINDOW == 65 (0x1286cec00) [pid = 1722] [serial = 2737] [outer = 0x0] 04:07:52 INFO - ++DOCSHELL 0x129d33800 == 25 [pid = 1722] [id = 1159] 04:07:52 INFO - ++DOMWINDOW == 66 (0x1286cf800) [pid = 1722] [serial = 2738] [outer = 0x0] 04:07:52 INFO - ++DOCSHELL 0x129d3b000 == 26 [pid = 1722] [id = 1160] 04:07:52 INFO - ++DOMWINDOW == 67 (0x1286d0000) [pid = 1722] [serial = 2739] [outer = 0x0] 04:07:52 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:52 INFO - ++DOCSHELL 0x129d3d800 == 27 [pid = 1722] [id = 1161] 04:07:52 INFO - ++DOMWINDOW == 68 (0x1286d0c00) [pid = 1722] [serial = 2740] [outer = 0x0] 04:07:52 INFO - ++DOMWINDOW == 69 (0x1286d1400) [pid = 1722] [serial = 2741] [outer = 0x1286d0c00] 04:07:52 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:52 INFO - ++DOCSHELL 0x12c26c800 == 28 [pid = 1722] [id = 1162] 04:07:52 INFO - ++DOMWINDOW == 70 (0x1286d1c00) [pid = 1722] [serial = 2742] [outer = 0x0] 04:07:52 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:52 INFO - ++DOMWINDOW == 71 (0x1286d5c00) [pid = 1722] [serial = 2743] [outer = 0x1286c9800] 04:07:52 INFO - ++DOMWINDOW == 72 (0x12870a000) [pid = 1722] [serial = 2744] [outer = 0x1203ddc00] 04:07:52 INFO - ++DOMWINDOW == 73 (0x12870b800) [pid = 1722] [serial = 2745] [outer = 0x1286cec00] 04:07:52 INFO - ++DOMWINDOW == 74 (0x12870c800) [pid = 1722] [serial = 2746] [outer = 0x1286cf800] 04:07:52 INFO - ++DOMWINDOW == 75 (0x12870e400) [pid = 1722] [serial = 2747] [outer = 0x1286d0000] 04:07:52 INFO - ++DOMWINDOW == 76 (0x12870f400) [pid = 1722] [serial = 2748] [outer = 0x1286d0c00] 04:07:52 INFO - ++DOMWINDOW == 77 (0x128711800) [pid = 1722] [serial = 2749] [outer = 0x1286d1c00] 04:07:52 INFO - ++DOCSHELL 0x12f5af000 == 29 [pid = 1722] [id = 1163] 04:07:52 INFO - ++DOMWINDOW == 78 (0x128732400) [pid = 1722] [serial = 2750] [outer = 0x0] 04:07:52 INFO - ++DOMWINDOW == 79 (0x128734800) [pid = 1722] [serial = 2751] [outer = 0x128732400] 04:07:53 INFO - ++DOCSHELL 0x12c430800 == 30 [pid = 1722] [id = 1164] 04:07:53 INFO - ++DOMWINDOW == 80 (0x12faf4800) [pid = 1722] [serial = 2752] [outer = 0x0] 04:07:53 INFO - ++DOMWINDOW == 81 (0x12faf5400) [pid = 1722] [serial = 2753] [outer = 0x12faf4800] 04:07:53 INFO - ++DOCSHELL 0x12ee68800 == 31 [pid = 1722] [id = 1165] 04:07:53 INFO - ++DOMWINDOW == 82 (0x12fcc6400) [pid = 1722] [serial = 2754] [outer = 0x0] 04:07:53 INFO - ++DOMWINDOW == 83 (0x12faf4c00) [pid = 1722] [serial = 2755] [outer = 0x12fcc6400] 04:07:54 INFO - --DOCSHELL 0x129d32800 == 30 [pid = 1722] [id = 1158] 04:07:54 INFO - --DOCSHELL 0x129d33800 == 29 [pid = 1722] [id = 1159] 04:07:54 INFO - --DOCSHELL 0x124697000 == 28 [pid = 1722] [id = 1157] 04:07:54 INFO - --DOCSHELL 0x129d3b000 == 27 [pid = 1722] [id = 1160] 04:07:54 INFO - --DOCSHELL 0x12c26c800 == 26 [pid = 1722] [id = 1162] 04:07:54 INFO - --DOCSHELL 0x121889000 == 25 [pid = 1722] [id = 1156] 04:07:54 INFO - --DOCSHELL 0x129d3d800 == 24 [pid = 1722] [id = 1161] 04:07:54 INFO - --DOCSHELL 0x11284f800 == 23 [pid = 1722] [id = 1131] 04:07:54 INFO - --DOCSHELL 0x120dcf000 == 22 [pid = 1722] [id = 1103] 04:07:54 INFO - --DOCSHELL 0x11e350000 == 21 [pid = 1722] [id = 1104] 04:07:54 INFO - --DOCSHELL 0x11efc4000 == 20 [pid = 1722] [id = 1149] 04:07:54 INFO - --DOCSHELL 0x121568800 == 19 [pid = 1722] [id = 1150] 04:07:54 INFO - --DOCSHELL 0x12f5af000 == 18 [pid = 1722] [id = 1163] 04:07:54 INFO - --DOCSHELL 0x12c430800 == 17 [pid = 1722] [id = 1164] 04:07:54 INFO - --DOCSHELL 0x12ee68800 == 16 [pid = 1722] [id = 1165] 04:07:54 INFO - --DOCSHELL 0x1223db800 == 15 [pid = 1722] [id = 1151] 04:07:54 INFO - --DOCSHELL 0x1228d8000 == 14 [pid = 1722] [id = 1152] 04:07:54 INFO - --DOCSHELL 0x122e3e800 == 13 [pid = 1722] [id = 1153] 04:07:54 INFO - --DOCSHELL 0x124471000 == 12 [pid = 1722] [id = 1154] 04:07:54 INFO - --DOMWINDOW == 82 (0x112f45c00) [pid = 1722] [serial = 2634] [outer = 0x0] [url = about:blank] 04:07:54 INFO - --DOMWINDOW == 81 (0x12d402400) [pid = 1722] [serial = 2650] [outer = 0x0] [url = about:blank] 04:07:54 INFO - --DOMWINDOW == 80 (0x1300a2400) [pid = 1722] [serial = 2663] [outer = 0x0] [url = about:blank] 04:07:54 INFO - --DOMWINDOW == 79 (0x132655c00) [pid = 1722] [serial = 2667] [outer = 0x0] [url = about:blank] 04:07:54 INFO - --DOMWINDOW == 78 (0x124fb7000) [pid = 1722] [serial = 2671] [outer = 0x0] [url = about:blank] 04:07:54 INFO - --DOMWINDOW == 77 (0x12826b400) [pid = 1722] [serial = 2694] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:54 INFO - --DOMWINDOW == 76 (0x12826e800) [pid = 1722] [serial = 2695] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:54 INFO - --DOMWINDOW == 75 (0x128270000) [pid = 1722] [serial = 2696] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:54 INFO - --DOMWINDOW == 74 (0x128271800) [pid = 1722] [serial = 2697] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:54 INFO - --DOMWINDOW == 73 (0x12826e000) [pid = 1722] [serial = 2630] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:54 INFO - --DOMWINDOW == 72 (0x12c4dc800) [pid = 1722] [serial = 2632] [outer = 0x0] [url = about:blank] 04:07:54 INFO - --DOMWINDOW == 71 (0x1283eac00) [pid = 1722] [serial = 2712] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:54 INFO - --DOMWINDOW == 70 (0x11ee5c400) [pid = 1722] [serial = 2669] [outer = 0x0] [url = about:blank] 04:07:55 INFO - --DOMWINDOW == 69 (0x1276ad800) [pid = 1722] [serial = 2687] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:07:55 INFO - --DOMWINDOW == 68 (0x1129be000) [pid = 1722] [serial = 2682] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:55 INFO - --DOMWINDOW == 67 (0x112c9e800) [pid = 1722] [serial = 2685] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:07:55 INFO - --DOMWINDOW == 66 (0x1276cd400) [pid = 1722] [serial = 2693] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:55 INFO - --DOMWINDOW == 65 (0x121811400) [pid = 1722] [serial = 2624] [outer = 0x0] [url = about:blank] 04:07:55 INFO - --DOMWINDOW == 64 (0x1247ca000) [pid = 1722] [serial = 2626] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20splitting] 04:07:55 INFO - --DOMWINDOW == 63 (0x1286d0c00) [pid = 1722] [serial = 2740] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:55 INFO - --DOMWINDOW == 62 (0x11513f800) [pid = 1722] [serial = 2719] [outer = 0x0] [url = about:blank] 04:07:55 INFO - --DOMWINDOW == 61 (0x1240d8c00) [pid = 1722] [serial = 2625] [outer = 0x0] [url = about:blank] 04:07:55 INFO - --DOMWINDOW == 60 (0x124c36400) [pid = 1722] [serial = 2627] [outer = 0x0] [url = about:blank] 04:07:55 INFO - --DOMWINDOW == 59 (0x1286d1400) [pid = 1722] [serial = 2741] [outer = 0x0] [url = about:blank] 04:07:55 INFO - --DOMWINDOW == 58 (0x12870f400) [pid = 1722] [serial = 2748] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:55 INFO - --DOMWINDOW == 57 (0x1286d0000) [pid = 1722] [serial = 2739] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:55 INFO - --DOMWINDOW == 56 (0x1203ddc00) [pid = 1722] [serial = 2736] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:55 INFO - --DOMWINDOW == 55 (0x1286cec00) [pid = 1722] [serial = 2737] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:55 INFO - --DOMWINDOW == 54 (0x121536000) [pid = 1722] [serial = 2725] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:55 INFO - --DOMWINDOW == 53 (0x1286c9800) [pid = 1722] [serial = 2735] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:55 INFO - --DOMWINDOW == 52 (0x122120c00) [pid = 1722] [serial = 2728] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:55 INFO - --DOMWINDOW == 51 (0x12180d800) [pid = 1722] [serial = 2727] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:55 INFO - --DOMWINDOW == 50 (0x12faf4800) [pid = 1722] [serial = 2752] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:07:55 INFO - --DOMWINDOW == 49 (0x128273c00) [pid = 1722] [serial = 2698] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:55 INFO - --DOMWINDOW == 48 (0x1276b3c00) [pid = 1722] [serial = 2732] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:55 INFO - MEMORY STAT | vsize 3450MB | residentFast 533MB | heapAllocated 127MB 04:07:55 INFO - 465 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split_escape_key.js | took 4297ms 04:07:55 INFO - ++DOCSHELL 0x112cc0800 == 13 [pid = 1722] [id = 1166] 04:07:55 INFO - ++DOMWINDOW == 49 (0x112f41800) [pid = 1722] [serial = 2756] [outer = 0x0] 04:07:55 INFO - ++DOMWINDOW == 50 (0x112f4d400) [pid = 1722] [serial = 2757] [outer = 0x112f41800] 04:07:55 INFO - 466 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split_focus.js 04:07:55 INFO - ++DOCSHELL 0x113e3c800 == 14 [pid = 1722] [id = 1167] 04:07:55 INFO - ++DOMWINDOW == 51 (0x113451000) [pid = 1722] [serial = 2758] [outer = 0x0] 04:07:55 INFO - ++DOMWINDOW == 52 (0x113e04000) [pid = 1722] [serial = 2759] [outer = 0x113451000] 04:07:55 INFO - ++DOCSHELL 0x112cbf800 == 15 [pid = 1722] [id = 1168] 04:07:55 INFO - ++DOMWINDOW == 53 (0x113e0c000) [pid = 1722] [serial = 2760] [outer = 0x0] 04:07:55 INFO - ++DOMWINDOW == 54 (0x11e78a000) [pid = 1722] [serial = 2761] [outer = 0x113e0c000] 04:07:55 INFO - ++DOMWINDOW == 55 (0x120e23400) [pid = 1722] [serial = 2762] [outer = 0x113e0c000] 04:07:56 INFO - ++DOCSHELL 0x120e10800 == 16 [pid = 1722] [id = 1169] 04:07:56 INFO - ++DOMWINDOW == 56 (0x128310400) [pid = 1722] [serial = 2763] [outer = 0x0] 04:07:56 INFO - ++DOMWINDOW == 57 (0x12837d000) [pid = 1722] [serial = 2764] [outer = 0x128310400] 04:07:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:56 INFO - ++DOCSHELL 0x124f03800 == 17 [pid = 1722] [id = 1170] 04:07:56 INFO - ++DOMWINDOW == 58 (0x1214b7c00) [pid = 1722] [serial = 2765] [outer = 0x0] 04:07:56 INFO - ++DOMWINDOW == 59 (0x122e99c00) [pid = 1722] [serial = 2766] [outer = 0x1214b7c00] 04:07:56 INFO - ++DOCSHELL 0x125065800 == 18 [pid = 1722] [id = 1171] 04:07:56 INFO - ++DOMWINDOW == 60 (0x124341000) [pid = 1722] [serial = 2767] [outer = 0x0] 04:07:56 INFO - ++DOCSHELL 0x1252f1000 == 19 [pid = 1722] [id = 1172] 04:07:56 INFO - ++DOMWINDOW == 61 (0x124393c00) [pid = 1722] [serial = 2768] [outer = 0x0] 04:07:56 INFO - ++DOCSHELL 0x12820e000 == 20 [pid = 1722] [id = 1173] 04:07:56 INFO - ++DOMWINDOW == 62 (0x124395c00) [pid = 1722] [serial = 2769] [outer = 0x0] 04:07:56 INFO - ++DOCSHELL 0x128210800 == 21 [pid = 1722] [id = 1174] 04:07:56 INFO - ++DOMWINDOW == 63 (0x12449d000) [pid = 1722] [serial = 2770] [outer = 0x0] 04:07:56 INFO - ++DOCSHELL 0x128213800 == 22 [pid = 1722] [id = 1175] 04:07:56 INFO - ++DOMWINDOW == 64 (0x12477b400) [pid = 1722] [serial = 2771] [outer = 0x0] 04:07:56 INFO - ++DOMWINDOW == 65 (0x1247c8400) [pid = 1722] [serial = 2772] [outer = 0x124341000] 04:07:56 INFO - ++DOMWINDOW == 66 (0x12837ec00) [pid = 1722] [serial = 2773] [outer = 0x124393c00] 04:07:56 INFO - ++DOMWINDOW == 67 (0x1283ee800) [pid = 1722] [serial = 2774] [outer = 0x124395c00] 04:07:56 INFO - ++DOMWINDOW == 68 (0x1283f2800) [pid = 1722] [serial = 2775] [outer = 0x12449d000] 04:07:56 INFO - ++DOMWINDOW == 69 (0x1286c6c00) [pid = 1722] [serial = 2776] [outer = 0x12477b400] 04:07:56 INFO - ++DOCSHELL 0x12ee60800 == 23 [pid = 1722] [id = 1176] 04:07:56 INFO - ++DOMWINDOW == 70 (0x12870e800) [pid = 1722] [serial = 2777] [outer = 0x0] 04:07:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:56 INFO - ++DOCSHELL 0x11efcb000 == 24 [pid = 1722] [id = 1177] 04:07:56 INFO - ++DOMWINDOW == 71 (0x128734400) [pid = 1722] [serial = 2778] [outer = 0x0] 04:07:56 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:56 INFO - ++DOMWINDOW == 72 (0x12873e400) [pid = 1722] [serial = 2779] [outer = 0x12870e800] 04:07:57 INFO - ++DOMWINDOW == 73 (0x12d405c00) [pid = 1722] [serial = 2780] [outer = 0x128734400] 04:07:57 INFO - ++DOCSHELL 0x1293ca800 == 25 [pid = 1722] [id = 1178] 04:07:57 INFO - ++DOMWINDOW == 74 (0x12dd18400) [pid = 1722] [serial = 2781] [outer = 0x0] 04:07:57 INFO - ++DOMWINDOW == 75 (0x12dd19400) [pid = 1722] [serial = 2782] [outer = 0x12dd18400] 04:07:57 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:57 INFO - ++DOCSHELL 0x12f5b4800 == 26 [pid = 1722] [id = 1179] 04:07:57 INFO - ++DOMWINDOW == 76 (0x120e2b000) [pid = 1722] [serial = 2783] [outer = 0x0] 04:07:57 INFO - ++DOCSHELL 0x128220800 == 27 [pid = 1722] [id = 1180] 04:07:57 INFO - ++DOMWINDOW == 77 (0x12efb5400) [pid = 1722] [serial = 2784] [outer = 0x0] 04:07:57 INFO - ++DOCSHELL 0x12f5b6000 == 28 [pid = 1722] [id = 1181] 04:07:57 INFO - ++DOMWINDOW == 78 (0x12efc1c00) [pid = 1722] [serial = 2785] [outer = 0x0] 04:07:57 INFO - ++DOCSHELL 0x12f5b7800 == 29 [pid = 1722] [id = 1182] 04:07:57 INFO - ++DOMWINDOW == 79 (0x12f158400) [pid = 1722] [serial = 2786] [outer = 0x0] 04:07:57 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:07:57 INFO - ++DOCSHELL 0x12f5b8800 == 30 [pid = 1722] [id = 1183] 04:07:57 INFO - ++DOMWINDOW == 80 (0x12f15b800) [pid = 1722] [serial = 2787] [outer = 0x0] 04:07:57 INFO - ++DOMWINDOW == 81 (0x12f162800) [pid = 1722] [serial = 2788] [outer = 0x12f15b800] 04:07:57 INFO - ++DOMWINDOW == 82 (0x128739400) [pid = 1722] [serial = 2789] [outer = 0x120e2b000] 04:07:57 INFO - ++DOMWINDOW == 83 (0x12f5a0400) [pid = 1722] [serial = 2790] [outer = 0x12efb5400] 04:07:57 INFO - ++DOMWINDOW == 84 (0x12f5a1800) [pid = 1722] [serial = 2791] [outer = 0x12efc1c00] 04:07:57 INFO - ++DOMWINDOW == 85 (0x12f5a3c00) [pid = 1722] [serial = 2792] [outer = 0x12f158400] 04:07:57 INFO - ++DOMWINDOW == 86 (0x12f78dc00) [pid = 1722] [serial = 2793] [outer = 0x12f15b800] 04:07:57 INFO - --DOCSHELL 0x128220800 == 29 [pid = 1722] [id = 1180] 04:07:57 INFO - --DOCSHELL 0x12f5b6000 == 28 [pid = 1722] [id = 1181] 04:07:57 INFO - --DOCSHELL 0x12f5b4800 == 27 [pid = 1722] [id = 1179] 04:07:57 INFO - --DOCSHELL 0x12f5b7800 == 26 [pid = 1722] [id = 1182] 04:07:57 INFO - --DOCSHELL 0x11efcb000 == 25 [pid = 1722] [id = 1177] 04:07:57 INFO - --DOCSHELL 0x12ee60800 == 24 [pid = 1722] [id = 1176] 04:07:58 INFO - --DOCSHELL 0x12f5b8800 == 23 [pid = 1722] [id = 1183] 04:07:58 INFO - --DOCSHELL 0x112cbc000 == 22 [pid = 1722] [id = 1146] 04:07:58 INFO - --DOCSHELL 0x113454800 == 21 [pid = 1722] [id = 1148] 04:07:58 INFO - --DOCSHELL 0x120e10800 == 20 [pid = 1722] [id = 1169] 04:07:58 INFO - --DOCSHELL 0x124f03800 == 19 [pid = 1722] [id = 1170] 04:07:58 INFO - --DOCSHELL 0x1293ca800 == 18 [pid = 1722] [id = 1178] 04:07:58 INFO - --DOCSHELL 0x113314000 == 17 [pid = 1722] [id = 1147] 04:07:58 INFO - --DOCSHELL 0x124690800 == 16 [pid = 1722] [id = 1155] 04:07:58 INFO - --DOCSHELL 0x125065800 == 15 [pid = 1722] [id = 1171] 04:07:58 INFO - --DOCSHELL 0x1252f1000 == 14 [pid = 1722] [id = 1172] 04:07:58 INFO - --DOCSHELL 0x12820e000 == 13 [pid = 1722] [id = 1173] 04:07:58 INFO - --DOCSHELL 0x128210800 == 12 [pid = 1722] [id = 1174] 04:07:58 INFO - --DOMWINDOW == 85 (0x12870e400) [pid = 1722] [serial = 2747] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:58 INFO - --DOMWINDOW == 84 (0x12870b800) [pid = 1722] [serial = 2745] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:58 INFO - --DOMWINDOW == 83 (0x1276b0000) [pid = 1722] [serial = 2688] [outer = 0x0] [url = about:blank] 04:07:58 INFO - --DOMWINDOW == 82 (0x122ea0000) [pid = 1722] [serial = 2686] [outer = 0x0] [url = about:blank] 04:07:58 INFO - --DOMWINDOW == 81 (0x12870a000) [pid = 1722] [serial = 2744] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:58 INFO - --DOMWINDOW == 80 (0x1286d5c00) [pid = 1722] [serial = 2743] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:58 INFO - --DOMWINDOW == 79 (0x1240d0000) [pid = 1722] [serial = 2730] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:58 INFO - --DOMWINDOW == 78 (0x113443400) [pid = 1722] [serial = 2684] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:58 INFO - --DOMWINDOW == 77 (0x12830d000) [pid = 1722] [serial = 2733] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:58 INFO - --DOMWINDOW == 76 (0x12faf5400) [pid = 1722] [serial = 2753] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:07:59 INFO - --DOMWINDOW == 75 (0x124341000) [pid = 1722] [serial = 2767] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:07:59 INFO - --DOMWINDOW == 74 (0x124393c00) [pid = 1722] [serial = 2768] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:59 INFO - --DOMWINDOW == 73 (0x124395c00) [pid = 1722] [serial = 2769] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:59 INFO - --DOMWINDOW == 72 (0x12449d000) [pid = 1722] [serial = 2770] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:07:59 INFO - --DOMWINDOW == 71 (0x120e2b000) [pid = 1722] [serial = 2783] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:59 INFO - --DOMWINDOW == 70 (0x12efb5400) [pid = 1722] [serial = 2784] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:07:59 INFO - --DOMWINDOW == 69 (0x12870e800) [pid = 1722] [serial = 2777] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:07:59 INFO - --DOMWINDOW == 68 (0x12f158400) [pid = 1722] [serial = 2786] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:07:59 INFO - --DOMWINDOW == 67 (0x128734400) [pid = 1722] [serial = 2778] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:59 INFO - --DOMWINDOW == 66 (0x1286d1c00) [pid = 1722] [serial = 2742] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:07:59 INFO - --DOMWINDOW == 65 (0x1286cf800) [pid = 1722] [serial = 2738] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:07:59 INFO - --DOMWINDOW == 64 (0x121806000) [pid = 1722] [serial = 2726] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:07:59 INFO - --DOMWINDOW == 63 (0x120fee000) [pid = 1722] [serial = 2723] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:07:59 INFO - --DOMWINDOW == 62 (0x12fcc6400) [pid = 1722] [serial = 2754] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:07:59 INFO - --DOMWINDOW == 61 (0x126244400) [pid = 1722] [serial = 2721] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:07:59 INFO - --DOMWINDOW == 60 (0x113d0c800) [pid = 1722] [serial = 2718] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:07:59 INFO - --DOMWINDOW == 59 (0x128732400) [pid = 1722] [serial = 2750] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:07:59 INFO - --DOMWINDOW == 58 (0x11344ac00) [pid = 1722] [serial = 2716] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting] 04:07:59 INFO - --DOMWINDOW == 57 (0x112f41c00) [pid = 1722] [serial = 2714] [outer = 0x0] [url = about:blank] 04:07:59 INFO - --DOMWINDOW == 56 (0x122124400) [pid = 1722] [serial = 2729] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:59 INFO - --DOMWINDOW == 55 (0x12f15b800) [pid = 1722] [serial = 2787] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:59 INFO - --DOMWINDOW == 54 (0x113d09000) [pid = 1722] [serial = 2717] [outer = 0x0] [url = about:blank] 04:07:59 INFO - --DOMWINDOW == 53 (0x112f4a800) [pid = 1722] [serial = 2715] [outer = 0x0] [url = about:blank] 04:07:59 INFO - --DOMWINDOW == 52 (0x11e78a000) [pid = 1722] [serial = 2761] [outer = 0x0] [url = about:blank] 04:07:59 INFO - --DOMWINDOW == 51 (0x12f78dc00) [pid = 1722] [serial = 2793] [outer = 0x0] [url = data:text/html,<html></html>] 04:07:59 INFO - --DOMWINDOW == 50 (0x12f162800) [pid = 1722] [serial = 2788] [outer = 0x0] [url = about:blank] 04:07:59 INFO - --DOMWINDOW == 49 (0x1283ee800) [pid = 1722] [serial = 2774] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:07:59 INFO - --DOMWINDOW == 48 (0x12830f400) [pid = 1722] [serial = 2734] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:07:59 INFO - MEMORY STAT | vsize 3452MB | residentFast 534MB | heapAllocated 128MB 04:07:59 INFO - 467 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split_focus.js | took 3780ms 04:07:59 INFO - ++DOCSHELL 0x11268b800 == 13 [pid = 1722] [id = 1184] 04:07:59 INFO - ++DOMWINDOW == 49 (0x112f4c400) [pid = 1722] [serial = 2794] [outer = 0x0] 04:07:59 INFO - ++DOMWINDOW == 50 (0x1133a1c00) [pid = 1722] [serial = 2795] [outer = 0x112f4c400] 04:07:59 INFO - 468 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split_persist.js 04:07:59 INFO - ++DOCSHELL 0x114b7f000 == 14 [pid = 1722] [id = 1185] 04:07:59 INFO - ++DOMWINDOW == 51 (0x113e08400) [pid = 1722] [serial = 2796] [outer = 0x0] 04:07:59 INFO - ++DOMWINDOW == 52 (0x114b2a400) [pid = 1722] [serial = 2797] [outer = 0x113e08400] 04:07:59 INFO - ++DOCSHELL 0x112e7b000 == 15 [pid = 1722] [id = 1186] 04:07:59 INFO - ++DOMWINDOW == 53 (0x114bfb400) [pid = 1722] [serial = 2798] [outer = 0x0] 04:07:59 INFO - ++DOMWINDOW == 54 (0x11ebb9400) [pid = 1722] [serial = 2799] [outer = 0x114bfb400] 04:07:59 INFO - ++DOMWINDOW == 55 (0x120e2b000) [pid = 1722] [serial = 2800] [outer = 0x114bfb400] 04:08:00 INFO - ++DOCSHELL 0x11f63c800 == 16 [pid = 1722] [id = 1187] 04:08:00 INFO - ++DOMWINDOW == 56 (0x128311c00) [pid = 1722] [serial = 2801] [outer = 0x0] 04:08:00 INFO - ++DOMWINDOW == 57 (0x128380000) [pid = 1722] [serial = 2802] [outer = 0x128311c00] 04:08:00 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:00 INFO - ++DOCSHELL 0x124871000 == 17 [pid = 1722] [id = 1188] 04:08:00 INFO - ++DOMWINDOW == 58 (0x121805800) [pid = 1722] [serial = 2803] [outer = 0x0] 04:08:00 INFO - ++DOMWINDOW == 59 (0x121809c00) [pid = 1722] [serial = 2804] [outer = 0x121805800] 04:08:00 INFO - ++DOCSHELL 0x1252f6800 == 18 [pid = 1722] [id = 1189] 04:08:00 INFO - ++DOMWINDOW == 60 (0x1240d8c00) [pid = 1722] [serial = 2805] [outer = 0x0] 04:08:00 INFO - ++DOCSHELL 0x12571c800 == 19 [pid = 1722] [id = 1190] 04:08:00 INFO - ++DOMWINDOW == 61 (0x124395400) [pid = 1722] [serial = 2806] [outer = 0x0] 04:08:00 INFO - ++DOCSHELL 0x12645a000 == 20 [pid = 1722] [id = 1191] 04:08:00 INFO - ++DOMWINDOW == 62 (0x12439ac00) [pid = 1722] [serial = 2807] [outer = 0x0] 04:08:00 INFO - ++DOCSHELL 0x12664b000 == 21 [pid = 1722] [id = 1192] 04:08:00 INFO - ++DOMWINDOW == 63 (0x1245be400) [pid = 1722] [serial = 2808] [outer = 0x0] 04:08:00 INFO - ++DOCSHELL 0x128221000 == 22 [pid = 1722] [id = 1193] 04:08:00 INFO - ++DOMWINDOW == 64 (0x12477c000) [pid = 1722] [serial = 2809] [outer = 0x0] 04:08:00 INFO - ++DOMWINDOW == 65 (0x1247c9400) [pid = 1722] [serial = 2810] [outer = 0x1240d8c00] 04:08:00 INFO - ++DOMWINDOW == 66 (0x128382000) [pid = 1722] [serial = 2811] [outer = 0x124395400] 04:08:00 INFO - ++DOMWINDOW == 67 (0x1286d1400) [pid = 1722] [serial = 2812] [outer = 0x12439ac00] 04:08:00 INFO - ++DOMWINDOW == 68 (0x1286d4000) [pid = 1722] [serial = 2813] [outer = 0x1245be400] 04:08:00 INFO - ++DOMWINDOW == 69 (0x128702c00) [pid = 1722] [serial = 2814] [outer = 0x12477c000] 04:08:00 INFO - ++DOCSHELL 0x12d99d000 == 23 [pid = 1722] [id = 1194] 04:08:00 INFO - ++DOMWINDOW == 70 (0x12c4dc800) [pid = 1722] [serial = 2815] [outer = 0x0] 04:08:00 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:00 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:00 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:00 INFO - ++DOCSHELL 0x129369000 == 24 [pid = 1722] [id = 1195] 04:08:00 INFO - ++DOMWINDOW == 71 (0x12180fc00) [pid = 1722] [serial = 2816] [outer = 0x0] 04:08:00 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:00 INFO - ++DOMWINDOW == 72 (0x12d4e9400) [pid = 1722] [serial = 2817] [outer = 0x12c4dc800] 04:08:00 INFO - ++DOMWINDOW == 73 (0x12e060000) [pid = 1722] [serial = 2818] [outer = 0x12180fc00] 04:08:00 INFO - ++DOCSHELL 0x12f5b9000 == 25 [pid = 1722] [id = 1196] 04:08:00 INFO - ++DOMWINDOW == 74 (0x12f157c00) [pid = 1722] [serial = 2819] [outer = 0x0] 04:08:00 INFO - ++DOMWINDOW == 75 (0x12f15b800) [pid = 1722] [serial = 2820] [outer = 0x12f157c00] 04:08:01 INFO - --DOCSHELL 0x129369000 == 24 [pid = 1722] [id = 1195] 04:08:01 INFO - --DOCSHELL 0x112cc0800 == 23 [pid = 1722] [id = 1166] 04:08:01 INFO - --DOCSHELL 0x11f63c800 == 22 [pid = 1722] [id = 1187] 04:08:01 INFO - --DOCSHELL 0x124871000 == 21 [pid = 1722] [id = 1188] 04:08:01 INFO - --DOCSHELL 0x113e3c800 == 20 [pid = 1722] [id = 1167] 04:08:01 INFO - --DOCSHELL 0x1252f6800 == 19 [pid = 1722] [id = 1189] 04:08:01 INFO - --DOCSHELL 0x12571c800 == 18 [pid = 1722] [id = 1190] 04:08:01 INFO - --DOCSHELL 0x12645a000 == 17 [pid = 1722] [id = 1191] 04:08:01 INFO - --DOCSHELL 0x12664b000 == 16 [pid = 1722] [id = 1192] 04:08:01 INFO - --DOCSHELL 0x128213800 == 15 [pid = 1722] [id = 1175] 04:08:01 INFO - --DOCSHELL 0x112cbf800 == 14 [pid = 1722] [id = 1168] 04:08:01 INFO - --DOMWINDOW == 74 (0x12faf4c00) [pid = 1722] [serial = 2755] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 04:08:01 INFO - --DOMWINDOW == 73 (0x128734800) [pid = 1722] [serial = 2751] [outer = 0x0] [url = about:blank] 04:08:01 INFO - --DOMWINDOW == 72 (0x12870c800) [pid = 1722] [serial = 2746] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:08:01 INFO - --DOMWINDOW == 71 (0x1247c8400) [pid = 1722] [serial = 2772] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:08:01 INFO - --DOMWINDOW == 70 (0x1283f2800) [pid = 1722] [serial = 2775] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:08:01 INFO - --DOMWINDOW == 69 (0x12f5a0400) [pid = 1722] [serial = 2790] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:08:01 INFO - --DOMWINDOW == 68 (0x12f5a3c00) [pid = 1722] [serial = 2792] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:08:01 INFO - --DOMWINDOW == 67 (0x124776000) [pid = 1722] [serial = 2731] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:08:01 INFO - --DOMWINDOW == 66 (0x12d405c00) [pid = 1722] [serial = 2780] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:01 INFO - --DOMWINDOW == 65 (0x1202e6000) [pid = 1722] [serial = 2720] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:01 INFO - --DOMWINDOW == 64 (0x128739400) [pid = 1722] [serial = 2789] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:01 INFO - --DOMWINDOW == 63 (0x12873e400) [pid = 1722] [serial = 2779] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:08:01 INFO - --DOMWINDOW == 62 (0x121108800) [pid = 1722] [serial = 2724] [outer = 0x0] [url = about:blank] 04:08:01 INFO - --DOMWINDOW == 61 (0x128711800) [pid = 1722] [serial = 2749] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:01 INFO - --DOMWINDOW == 60 (0x12837ec00) [pid = 1722] [serial = 2773] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:08:01 INFO - --DOMWINDOW == 59 (0x1276aa400) [pid = 1722] [serial = 2722] [outer = 0x0] [url = about:blank] 04:08:01 INFO - --DOCSHELL 0x12d99d000 == 13 [pid = 1722] [id = 1194] 04:08:01 INFO - --DOMWINDOW == 58 (0x12e060000) [pid = 1722] [serial = 2818] [outer = 0x12180fc00] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:01 INFO - --DOMWINDOW == 57 (0x12d4e9400) [pid = 1722] [serial = 2817] [outer = 0x12c4dc800] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:08:01 INFO - --DOMWINDOW == 56 (0x12c4dc800) [pid = 1722] [serial = 2815] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:08:01 INFO - --DOMWINDOW == 55 (0x12180fc00) [pid = 1722] [serial = 2816] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:01 INFO - ++DOCSHELL 0x112cba800 == 14 [pid = 1722] [id = 1197] 04:08:01 INFO - ++DOMWINDOW == 56 (0x110d55000) [pid = 1722] [serial = 2821] [outer = 0x0] 04:08:01 INFO - ++DOMWINDOW == 57 (0x110e32400) [pid = 1722] [serial = 2822] [outer = 0x110d55000] 04:08:01 INFO - --DOMWINDOW == 56 (0x11ebb9400) [pid = 1722] [serial = 2799] [outer = 0x0] [url = about:blank] 04:08:01 INFO - --DOMWINDOW == 55 (0x113e04000) [pid = 1722] [serial = 2759] [outer = 0x0] [url = about:blank] 04:08:01 INFO - --DOMWINDOW == 54 (0x112f4d400) [pid = 1722] [serial = 2757] [outer = 0x0] [url = about:blank] 04:08:01 INFO - --DOMWINDOW == 53 (0x1214b7c00) [pid = 1722] [serial = 2765] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:08:01 INFO - --DOMWINDOW == 52 (0x113e0c000) [pid = 1722] [serial = 2760] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:01 INFO - --DOMWINDOW == 51 (0x12477b400) [pid = 1722] [serial = 2771] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:08:01 INFO - --DOMWINDOW == 50 (0x12dd18400) [pid = 1722] [serial = 2781] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:08:01 INFO - --DOMWINDOW == 49 (0x112f41800) [pid = 1722] [serial = 2756] [outer = 0x0] [url = about:blank] 04:08:01 INFO - --DOMWINDOW == 48 (0x128310400) [pid = 1722] [serial = 2763] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:08:01 INFO - --DOMWINDOW == 47 (0x12efc1c00) [pid = 1722] [serial = 2785] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:08:01 INFO - --DOMWINDOW == 46 (0x113451000) [pid = 1722] [serial = 2758] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 04:08:01 INFO - --DOMWINDOW == 45 (0x1240d8c00) [pid = 1722] [serial = 2805] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:08:01 INFO - --DOMWINDOW == 44 (0x124395400) [pid = 1722] [serial = 2806] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:08:01 INFO - --DOMWINDOW == 43 (0x12439ac00) [pid = 1722] [serial = 2807] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:08:01 INFO - --DOMWINDOW == 42 (0x1245be400) [pid = 1722] [serial = 2808] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:08:01 INFO - --DOMWINDOW == 41 (0x12477c000) [pid = 1722] [serial = 2809] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:08:01 INFO - --DOMWINDOW == 40 (0x1247c9400) [pid = 1722] [serial = 2810] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:08:01 INFO - --DOMWINDOW == 39 (0x1286d4000) [pid = 1722] [serial = 2813] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:08:02 INFO - --DOMWINDOW == 38 (0x1286c6c00) [pid = 1722] [serial = 2776] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:08:02 INFO - --DOMWINDOW == 37 (0x1286d1400) [pid = 1722] [serial = 2812] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:08:02 INFO - --DOMWINDOW == 36 (0x128702c00) [pid = 1722] [serial = 2814] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:08:02 INFO - ++DOCSHELL 0x112cd7800 == 15 [pid = 1722] [id = 1198] 04:08:02 INFO - ++DOMWINDOW == 37 (0x11288c800) [pid = 1722] [serial = 2823] [outer = 0x0] 04:08:02 INFO - ++DOMWINDOW == 38 (0x113449c00) [pid = 1722] [serial = 2824] [outer = 0x11288c800] 04:08:02 INFO - ++DOMWINDOW == 39 (0x11344e800) [pid = 1722] [serial = 2825] [outer = 0x11288c800] 04:08:02 INFO - ++DOCSHELL 0x112cbc000 == 16 [pid = 1722] [id = 1199] 04:08:02 INFO - ++DOMWINDOW == 40 (0x11e719400) [pid = 1722] [serial = 2826] [outer = 0x0] 04:08:02 INFO - ++DOMWINDOW == 41 (0x11e798400) [pid = 1722] [serial = 2827] [outer = 0x11e719400] 04:08:02 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:02 INFO - ++DOCSHELL 0x122183000 == 17 [pid = 1722] [id = 1200] 04:08:02 INFO - ++DOMWINDOW == 42 (0x122124800) [pid = 1722] [serial = 2828] [outer = 0x0] 04:08:02 INFO - ++DOMWINDOW == 43 (0x1221b4000) [pid = 1722] [serial = 2829] [outer = 0x122124800] 04:08:02 INFO - ++DOCSHELL 0x124864800 == 18 [pid = 1722] [id = 1201] 04:08:02 INFO - ++DOMWINDOW == 44 (0x12232ec00) [pid = 1722] [serial = 2830] [outer = 0x0] 04:08:02 INFO - ++DOCSHELL 0x124867000 == 19 [pid = 1722] [id = 1202] 04:08:02 INFO - ++DOMWINDOW == 45 (0x122336400) [pid = 1722] [serial = 2831] [outer = 0x0] 04:08:02 INFO - ++DOCSHELL 0x124870000 == 20 [pid = 1722] [id = 1203] 04:08:02 INFO - ++DOMWINDOW == 46 (0x1223efc00) [pid = 1722] [serial = 2832] [outer = 0x0] 04:08:02 INFO - ++DOCSHELL 0x124874000 == 21 [pid = 1722] [id = 1204] 04:08:02 INFO - ++DOMWINDOW == 47 (0x1225e1400) [pid = 1722] [serial = 2833] [outer = 0x0] 04:08:02 INFO - ++DOCSHELL 0x124883800 == 22 [pid = 1722] [id = 1205] 04:08:02 INFO - ++DOMWINDOW == 48 (0x122ea6800) [pid = 1722] [serial = 2834] [outer = 0x0] 04:08:02 INFO - ++DOMWINDOW == 49 (0x1286c9c00) [pid = 1722] [serial = 2835] [outer = 0x12232ec00] 04:08:02 INFO - ++DOMWINDOW == 50 (0x1286cb000) [pid = 1722] [serial = 2836] [outer = 0x122336400] 04:08:02 INFO - ++DOMWINDOW == 51 (0x1286cc400) [pid = 1722] [serial = 2837] [outer = 0x1223efc00] 04:08:02 INFO - ++DOMWINDOW == 52 (0x1286cd800) [pid = 1722] [serial = 2838] [outer = 0x1225e1400] 04:08:02 INFO - ++DOMWINDOW == 53 (0x1286cec00) [pid = 1722] [serial = 2839] [outer = 0x122ea6800] 04:08:03 INFO - ++DOCSHELL 0x129675800 == 23 [pid = 1722] [id = 1206] 04:08:03 INFO - ++DOMWINDOW == 54 (0x128733000) [pid = 1722] [serial = 2840] [outer = 0x0] 04:08:03 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:03 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:03 INFO - ++DOCSHELL 0x12469f800 == 24 [pid = 1722] [id = 1207] 04:08:03 INFO - ++DOMWINDOW == 55 (0x128737c00) [pid = 1722] [serial = 2841] [outer = 0x0] 04:08:03 INFO - ++DOMWINDOW == 56 (0x128739000) [pid = 1722] [serial = 2842] [outer = 0x128737c00] 04:08:03 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:03 INFO - ++DOCSHELL 0x12c260000 == 25 [pid = 1722] [id = 1208] 04:08:03 INFO - ++DOMWINDOW == 57 (0x128389000) [pid = 1722] [serial = 2843] [outer = 0x0] 04:08:03 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:03 INFO - ++DOMWINDOW == 58 (0x12873fc00) [pid = 1722] [serial = 2844] [outer = 0x128733000] 04:08:03 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:03 INFO - ++DOCSHELL 0x12ee73000 == 26 [pid = 1722] [id = 1209] 04:08:03 INFO - ++DOMWINDOW == 59 (0x11ebb6c00) [pid = 1722] [serial = 2845] [outer = 0x0] 04:08:03 INFO - ++DOCSHELL 0x12ee74000 == 27 [pid = 1722] [id = 1210] 04:08:03 INFO - ++DOMWINDOW == 60 (0x12e062800) [pid = 1722] [serial = 2846] [outer = 0x0] 04:08:03 INFO - ++DOCSHELL 0x12ee76000 == 28 [pid = 1722] [id = 1211] 04:08:03 INFO - ++DOMWINDOW == 61 (0x12e0ef400) [pid = 1722] [serial = 2847] [outer = 0x0] 04:08:03 INFO - ++DOCSHELL 0x12ee76800 == 29 [pid = 1722] [id = 1212] 04:08:03 INFO - ++DOMWINDOW == 62 (0x12e0f9c00) [pid = 1722] [serial = 2848] [outer = 0x0] 04:08:03 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:03 INFO - ++DOCSHELL 0x12ee77800 == 30 [pid = 1722] [id = 1213] 04:08:03 INFO - ++DOMWINDOW == 63 (0x12ee0ec00) [pid = 1722] [serial = 2849] [outer = 0x0] 04:08:03 INFO - ++DOMWINDOW == 64 (0x12ee16800) [pid = 1722] [serial = 2850] [outer = 0x12ee0ec00] 04:08:03 INFO - ++DOMWINDOW == 65 (0x12f15a800) [pid = 1722] [serial = 2851] [outer = 0x128389000] 04:08:03 INFO - ++DOMWINDOW == 66 (0x12d4f1400) [pid = 1722] [serial = 2852] [outer = 0x11ebb6c00] 04:08:03 INFO - ++DOMWINDOW == 67 (0x12dd14c00) [pid = 1722] [serial = 2853] [outer = 0x12e062800] 04:08:03 INFO - ++DOMWINDOW == 68 (0x12f25b800) [pid = 1722] [serial = 2854] [outer = 0x12e0ef400] 04:08:03 INFO - ++DOMWINDOW == 69 (0x12f25e000) [pid = 1722] [serial = 2855] [outer = 0x12e0f9c00] 04:08:03 INFO - ++DOMWINDOW == 70 (0x12f262c00) [pid = 1722] [serial = 2856] [outer = 0x12ee0ec00] 04:08:04 INFO - --DOCSHELL 0x12ee74000 == 29 [pid = 1722] [id = 1210] 04:08:04 INFO - --DOCSHELL 0x12ee76000 == 28 [pid = 1722] [id = 1211] 04:08:04 INFO - --DOCSHELL 0x12ee73000 == 27 [pid = 1722] [id = 1209] 04:08:04 INFO - --DOCSHELL 0x12ee76800 == 26 [pid = 1722] [id = 1212] 04:08:04 INFO - --DOCSHELL 0x12c260000 == 25 [pid = 1722] [id = 1208] 04:08:04 INFO - --DOCSHELL 0x129675800 == 24 [pid = 1722] [id = 1206] 04:08:05 INFO - --DOCSHELL 0x12ee77800 == 23 [pid = 1722] [id = 1213] 04:08:05 INFO - --DOCSHELL 0x112cbc000 == 22 [pid = 1722] [id = 1199] 04:08:05 INFO - --DOCSHELL 0x122183000 == 21 [pid = 1722] [id = 1200] 04:08:05 INFO - --DOCSHELL 0x12469f800 == 20 [pid = 1722] [id = 1207] 04:08:05 INFO - --DOCSHELL 0x112e7b000 == 19 [pid = 1722] [id = 1186] 04:08:05 INFO - --DOCSHELL 0x124864800 == 18 [pid = 1722] [id = 1201] 04:08:05 INFO - --DOCSHELL 0x124867000 == 17 [pid = 1722] [id = 1202] 04:08:05 INFO - --DOCSHELL 0x124870000 == 16 [pid = 1722] [id = 1203] 04:08:05 INFO - --DOCSHELL 0x124874000 == 15 [pid = 1722] [id = 1204] 04:08:05 INFO - --DOCSHELL 0x128221000 == 14 [pid = 1722] [id = 1193] 04:08:05 INFO - --DOMWINDOW == 69 (0x12f5a1800) [pid = 1722] [serial = 2791] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:08:05 INFO - --DOMWINDOW == 68 (0x12dd19400) [pid = 1722] [serial = 2782] [outer = 0x0] [url = about:blank] 04:08:05 INFO - --DOMWINDOW == 67 (0x128382000) [pid = 1722] [serial = 2811] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:08:05 INFO - --DOMWINDOW == 66 (0x122e99c00) [pid = 1722] [serial = 2766] [outer = 0x0] [url = about:blank] 04:08:05 INFO - --DOMWINDOW == 65 (0x12837d000) [pid = 1722] [serial = 2764] [outer = 0x0] [url = about:blank] 04:08:05 INFO - --DOMWINDOW == 64 (0x120e23400) [pid = 1722] [serial = 2762] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:05 INFO - ++DOCSHELL 0x11261f000 == 15 [pid = 1722] [id = 1214] 04:08:05 INFO - ++DOMWINDOW == 65 (0x110d5ac00) [pid = 1722] [serial = 2857] [outer = 0x0] 04:08:05 INFO - ++DOMWINDOW == 66 (0x112936800) [pid = 1722] [serial = 2858] [outer = 0x110d5ac00] 04:08:05 INFO - --DOMWINDOW == 65 (0x12f157c00) [pid = 1722] [serial = 2819] [outer = 0x0] [url = about:blank] 04:08:05 INFO - --DOMWINDOW == 64 (0x121805800) [pid = 1722] [serial = 2803] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:08:05 INFO - --DOMWINDOW == 63 (0x114bfb400) [pid = 1722] [serial = 2798] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:05 INFO - --DOMWINDOW == 62 (0x128311c00) [pid = 1722] [serial = 2801] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:08:05 INFO - --DOMWINDOW == 61 (0x12ee0ec00) [pid = 1722] [serial = 2849] [outer = 0x0] [url = data:text/html,<html></html>] 04:08:05 INFO - --DOMWINDOW == 60 (0x113449c00) [pid = 1722] [serial = 2824] [outer = 0x0] [url = about:blank] 04:08:05 INFO - --DOMWINDOW == 59 (0x12f262c00) [pid = 1722] [serial = 2856] [outer = 0x0] [url = data:text/html,<html></html>] 04:08:05 INFO - --DOMWINDOW == 58 (0x12ee16800) [pid = 1722] [serial = 2850] [outer = 0x0] [url = about:blank] 04:08:05 INFO - --DOMWINDOW == 57 (0x12232ec00) [pid = 1722] [serial = 2830] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:08:05 INFO - --DOMWINDOW == 56 (0x128733000) [pid = 1722] [serial = 2840] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:08:05 INFO - --DOMWINDOW == 55 (0x122336400) [pid = 1722] [serial = 2831] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:08:05 INFO - --DOMWINDOW == 54 (0x1223efc00) [pid = 1722] [serial = 2832] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:08:05 INFO - --DOMWINDOW == 53 (0x1225e1400) [pid = 1722] [serial = 2833] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:08:05 INFO - --DOMWINDOW == 52 (0x128389000) [pid = 1722] [serial = 2843] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:05 INFO - --DOMWINDOW == 51 (0x11ebb6c00) [pid = 1722] [serial = 2845] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:05 INFO - --DOMWINDOW == 50 (0x12e062800) [pid = 1722] [serial = 2846] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:08:05 INFO - --DOMWINDOW == 49 (0x12e0f9c00) [pid = 1722] [serial = 2848] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:08:05 INFO - --DOMWINDOW == 48 (0x1286cc400) [pid = 1722] [serial = 2837] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:08:05 INFO - ++DOCSHELL 0x11321b800 == 16 [pid = 1722] [id = 1215] 04:08:05 INFO - ++DOMWINDOW == 49 (0x112c9cc00) [pid = 1722] [serial = 2859] [outer = 0x0] 04:08:05 INFO - ++DOMWINDOW == 50 (0x113e10800) [pid = 1722] [serial = 2860] [outer = 0x112c9cc00] 04:08:05 INFO - ++DOMWINDOW == 51 (0x11ef53000) [pid = 1722] [serial = 2861] [outer = 0x112c9cc00] 04:08:06 INFO - ++DOCSHELL 0x112b9d000 == 17 [pid = 1722] [id = 1216] 04:08:06 INFO - ++DOMWINDOW == 52 (0x1286c8000) [pid = 1722] [serial = 2862] [outer = 0x0] 04:08:06 INFO - ++DOMWINDOW == 53 (0x1286c9000) [pid = 1722] [serial = 2863] [outer = 0x1286c8000] 04:08:06 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:06 INFO - ++DOCSHELL 0x12965b000 == 18 [pid = 1722] [id = 1217] 04:08:06 INFO - ++DOMWINDOW == 54 (0x12d4f3000) [pid = 1722] [serial = 2864] [outer = 0x0] 04:08:06 INFO - ++DOMWINDOW == 55 (0x12dd17000) [pid = 1722] [serial = 2865] [outer = 0x12d4f3000] 04:08:06 INFO - ++DOCSHELL 0x129669000 == 19 [pid = 1722] [id = 1218] 04:08:06 INFO - ++DOMWINDOW == 56 (0x12dd19800) [pid = 1722] [serial = 2866] [outer = 0x0] 04:08:06 INFO - ++DOCSHELL 0x12966a800 == 20 [pid = 1722] [id = 1219] 04:08:06 INFO - ++DOMWINDOW == 57 (0x12dd7fc00) [pid = 1722] [serial = 2867] [outer = 0x0] 04:08:06 INFO - ++DOCSHELL 0x12966b000 == 21 [pid = 1722] [id = 1220] 04:08:06 INFO - ++DOMWINDOW == 58 (0x12dd81400) [pid = 1722] [serial = 2868] [outer = 0x0] 04:08:06 INFO - ++DOCSHELL 0x12966b800 == 22 [pid = 1722] [id = 1221] 04:08:06 INFO - ++DOMWINDOW == 59 (0x12dd87c00) [pid = 1722] [serial = 2869] [outer = 0x0] 04:08:06 INFO - ++DOCSHELL 0x12966e000 == 23 [pid = 1722] [id = 1222] 04:08:06 INFO - ++DOMWINDOW == 60 (0x12e05d400) [pid = 1722] [serial = 2870] [outer = 0x0] 04:08:06 INFO - ++DOMWINDOW == 61 (0x12025a000) [pid = 1722] [serial = 2871] [outer = 0x12dd19800] 04:08:06 INFO - ++DOMWINDOW == 62 (0x1202e6000) [pid = 1722] [serial = 2872] [outer = 0x12dd7fc00] 04:08:06 INFO - ++DOMWINDOW == 63 (0x1203dd800) [pid = 1722] [serial = 2873] [outer = 0x12dd81400] 04:08:06 INFO - ++DOMWINDOW == 64 (0x120d18800) [pid = 1722] [serial = 2874] [outer = 0x12dd87c00] 04:08:06 INFO - ++DOMWINDOW == 65 (0x120d25c00) [pid = 1722] [serial = 2875] [outer = 0x12e05d400] 04:08:06 INFO - ++DOCSHELL 0x125065800 == 24 [pid = 1722] [id = 1223] 04:08:06 INFO - ++DOMWINDOW == 66 (0x12ee15c00) [pid = 1722] [serial = 2876] [outer = 0x0] 04:08:06 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:06 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:06 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:06 INFO - ++DOCSHELL 0x12a14f000 == 25 [pid = 1722] [id = 1224] 04:08:06 INFO - ++DOMWINDOW == 67 (0x12f165c00) [pid = 1722] [serial = 2877] [outer = 0x0] 04:08:06 INFO - [1722] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 04:08:06 INFO - ++DOMWINDOW == 68 (0x12f268400) [pid = 1722] [serial = 2878] [outer = 0x12ee15c00] 04:08:06 INFO - ++DOMWINDOW == 69 (0x12f59a800) [pid = 1722] [serial = 2879] [outer = 0x12f165c00] 04:08:07 INFO - --DOCSHELL 0x12f5b9000 == 24 [pid = 1722] [id = 1196] 04:08:07 INFO - --DOCSHELL 0x112cd7800 == 23 [pid = 1722] [id = 1198] 04:08:07 INFO - --DOCSHELL 0x112b9d000 == 22 [pid = 1722] [id = 1216] 04:08:07 INFO - --DOCSHELL 0x12965b000 == 21 [pid = 1722] [id = 1217] 04:08:07 INFO - --DOCSHELL 0x129669000 == 20 [pid = 1722] [id = 1218] 04:08:07 INFO - --DOCSHELL 0x12966a800 == 19 [pid = 1722] [id = 1219] 04:08:07 INFO - --DOCSHELL 0x124883800 == 18 [pid = 1722] [id = 1205] 04:08:07 INFO - --DOMWINDOW == 68 (0x12d4f1400) [pid = 1722] [serial = 2852] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:07 INFO - --DOMWINDOW == 67 (0x12f15a800) [pid = 1722] [serial = 2851] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:07 INFO - --DOMWINDOW == 66 (0x12873fc00) [pid = 1722] [serial = 2844] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:08:07 INFO - --DOMWINDOW == 65 (0x1286cb000) [pid = 1722] [serial = 2836] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:08:07 INFO - --DOMWINDOW == 64 (0x121809c00) [pid = 1722] [serial = 2804] [outer = 0x0] [url = about:blank] 04:08:07 INFO - --DOMWINDOW == 63 (0x128380000) [pid = 1722] [serial = 2802] [outer = 0x0] [url = about:blank] 04:08:07 INFO - --DOMWINDOW == 62 (0x120e2b000) [pid = 1722] [serial = 2800] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:07 INFO - --DOCSHELL 0x12966b800 == 17 [pid = 1722] [id = 1221] 04:08:07 INFO - --DOMWINDOW == 61 (0x12f15b800) [pid = 1722] [serial = 2820] [outer = 0x0] [url = about:blank] 04:08:07 INFO - --DOCSHELL 0x12966b000 == 16 [pid = 1722] [id = 1220] 04:08:07 INFO - --DOCSHELL 0x12a14f000 == 15 [pid = 1722] [id = 1224] 04:08:07 INFO - --DOMWINDOW == 60 (0x1286cd800) [pid = 1722] [serial = 2838] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:08:07 INFO - --DOMWINDOW == 59 (0x1286c9c00) [pid = 1722] [serial = 2835] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:08:07 INFO - --DOMWINDOW == 58 (0x12dd14c00) [pid = 1722] [serial = 2853] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 04:08:07 INFO - --DOMWINDOW == 57 (0x12f25e000) [pid = 1722] [serial = 2855] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 04:08:07 INFO - --DOMWINDOW == 56 (0x12f59a800) [pid = 1722] [serial = 2879] [outer = 0x12f165c00] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:07 INFO - --DOMWINDOW == 55 (0x12f268400) [pid = 1722] [serial = 2878] [outer = 0x12ee15c00] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:08:07 INFO - --DOCSHELL 0x125065800 == 14 [pid = 1722] [id = 1223] 04:08:07 INFO - --DOMWINDOW == 54 (0x12f165c00) [pid = 1722] [serial = 2877] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 04:08:07 INFO - --DOMWINDOW == 53 (0x12ee15c00) [pid = 1722] [serial = 2876] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:08:07 INFO - --DOMWINDOW == 52 (0x113e10800) [pid = 1722] [serial = 2860] [outer = 0x0] [url = about:blank] 04:08:07 INFO - --DOMWINDOW == 51 (0x12e0ef400) [pid = 1722] [serial = 2847] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:08:07 INFO - --DOMWINDOW == 50 (0x122124800) [pid = 1722] [serial = 2828] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:08:07 INFO - --DOMWINDOW == 49 (0x12dd87c00) [pid = 1722] [serial = 2869] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:08:07 INFO - --DOMWINDOW == 48 (0x12dd19800) [pid = 1722] [serial = 2866] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:08:07 INFO - --DOMWINDOW == 47 (0x12dd81400) [pid = 1722] [serial = 2868] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:08:07 INFO - --DOMWINDOW == 46 (0x12e05d400) [pid = 1722] [serial = 2870] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:08:07 INFO - --DOMWINDOW == 45 (0x11e719400) [pid = 1722] [serial = 2826] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:08:07 INFO - --DOMWINDOW == 44 (0x122ea6800) [pid = 1722] [serial = 2834] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:08:07 INFO - --DOMWINDOW == 43 (0x1286cec00) [pid = 1722] [serial = 2839] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:08:07 INFO - --DOMWINDOW == 42 (0x120d25c00) [pid = 1722] [serial = 2875] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 04:08:08 INFO - MEMORY STAT | vsize 3450MB | residentFast 533MB | heapAllocated 126MB 04:08:08 INFO - 469 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split_persist.js | took 8663ms 04:08:08 INFO - ++DOCSHELL 0x11359a000 == 15 [pid = 1722] [id = 1225] 04:08:08 INFO - ++DOMWINDOW == 43 (0x113444800) [pid = 1722] [serial = 2880] [outer = 0x0] 04:08:08 INFO - ++DOMWINDOW == 44 (0x113452400) [pid = 1722] [serial = 2881] [outer = 0x113444800] 04:08:08 INFO - 470 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_start_netmon_first.js 04:08:08 INFO - ++DOCSHELL 0x1203c2800 == 16 [pid = 1722] [id = 1226] 04:08:08 INFO - ++DOMWINDOW == 45 (0x112657c00) [pid = 1722] [serial = 2882] [outer = 0x0] 04:08:08 INFO - ++DOMWINDOW == 46 (0x11e714000) [pid = 1722] [serial = 2883] [outer = 0x112657c00] 04:08:08 INFO - ++DOCSHELL 0x112cb8800 == 17 [pid = 1722] [id = 1227] 04:08:08 INFO - ++DOMWINDOW == 47 (0x120d25400) [pid = 1722] [serial = 2884] [outer = 0x0] 04:08:08 INFO - ++DOMWINDOW == 48 (0x120e25000) [pid = 1722] [serial = 2885] [outer = 0x120d25400] 04:08:08 INFO - ++DOMWINDOW == 49 (0x12152bc00) [pid = 1722] [serial = 2886] [outer = 0x120d25400] 04:08:08 INFO - ++DOCSHELL 0x1252f3000 == 18 [pid = 1722] [id = 1228] 04:08:08 INFO - ++DOMWINDOW == 50 (0x12449a400) [pid = 1722] [serial = 2887] [outer = 0x0] 04:08:08 INFO - ++DOMWINDOW == 51 (0x1247c3c00) [pid = 1722] [serial = 2888] [outer = 0x12449a400] 04:08:10 INFO - --DOCSHELL 0x112cba800 == 17 [pid = 1722] [id = 1197] 04:08:10 INFO - --DOCSHELL 0x11321b800 == 16 [pid = 1722] [id = 1215] 04:08:10 INFO - --DOCSHELL 0x1252f3000 == 15 [pid = 1722] [id = 1228] 04:08:10 INFO - --DOCSHELL 0x11261f000 == 14 [pid = 1722] [id = 1214] 04:08:10 INFO - --DOCSHELL 0x12966e000 == 13 [pid = 1722] [id = 1222] 04:08:10 INFO - --DOMWINDOW == 50 (0x11e798400) [pid = 1722] [serial = 2827] [outer = 0x0] [url = about:blank] 04:08:10 INFO - --DOMWINDOW == 49 (0x120d18800) [pid = 1722] [serial = 2874] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 04:08:10 INFO - --DOMWINDOW == 48 (0x1203dd800) [pid = 1722] [serial = 2873] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 04:08:10 INFO - --DOMWINDOW == 47 (0x12025a000) [pid = 1722] [serial = 2871] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 04:08:10 INFO - --DOMWINDOW == 46 (0x12f25b800) [pid = 1722] [serial = 2854] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 04:08:10 INFO - --DOMWINDOW == 45 (0x1221b4000) [pid = 1722] [serial = 2829] [outer = 0x0] [url = about:blank] 04:08:10 INFO - --DOMWINDOW == 44 (0x112936800) [pid = 1722] [serial = 2858] [outer = 0x0] [url = about:blank] 04:08:10 INFO - --DOMWINDOW == 43 (0x110e32400) [pid = 1722] [serial = 2822] [outer = 0x0] [url = about:blank] 04:08:10 INFO - --DOMWINDOW == 42 (0x114b2a400) [pid = 1722] [serial = 2797] [outer = 0x0] [url = about:blank] 04:08:10 INFO - --DOMWINDOW == 41 (0x1133a1c00) [pid = 1722] [serial = 2795] [outer = 0x0] [url = about:blank] 04:08:10 INFO - --DOMWINDOW == 40 (0x120e25000) [pid = 1722] [serial = 2885] [outer = 0x0] [url = about:blank] 04:08:10 INFO - --DOMWINDOW == 39 (0x12dd7fc00) [pid = 1722] [serial = 2867] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:08:10 INFO - --DOMWINDOW == 38 (0x12d4f3000) [pid = 1722] [serial = 2864] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 04:08:10 INFO - --DOMWINDOW == 37 (0x112c9cc00) [pid = 1722] [serial = 2859] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:10 INFO - --DOMWINDOW == 36 (0x11288c800) [pid = 1722] [serial = 2823] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:10 INFO - --DOMWINDOW == 35 (0x128737c00) [pid = 1722] [serial = 2841] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:08:10 INFO - --DOMWINDOW == 34 (0x1286c8000) [pid = 1722] [serial = 2862] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 04:08:10 INFO - --DOMWINDOW == 33 (0x110d5ac00) [pid = 1722] [serial = 2857] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 04:08:10 INFO - --DOMWINDOW == 32 (0x110d55000) [pid = 1722] [serial = 2821] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 04:08:10 INFO - --DOMWINDOW == 31 (0x113e08400) [pid = 1722] [serial = 2796] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 04:08:10 INFO - --DOMWINDOW == 30 (0x112f4c400) [pid = 1722] [serial = 2794] [outer = 0x0] [url = about:blank] 04:08:10 INFO - MEMORY STAT | vsize 3449MB | residentFast 531MB | heapAllocated 125MB 04:08:10 INFO - 471 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_start_netmon_first.js | took 2294ms 04:08:10 INFO - ++DOCSHELL 0x11321b800 == 14 [pid = 1722] [id = 1229] 04:08:10 INFO - ++DOMWINDOW == 31 (0x112f41000) [pid = 1722] [serial = 2889] [outer = 0x0] 04:08:10 INFO - ++DOMWINDOW == 32 (0x113262800) [pid = 1722] [serial = 2890] [outer = 0x112f41000] 04:08:10 INFO - 472 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_trackingprotection_errors.js 04:08:10 INFO - ++DOCSHELL 0x121555800 == 15 [pid = 1722] [id = 1230] 04:08:10 INFO - ++DOMWINDOW == 33 (0x11f5cd400) [pid = 1722] [serial = 2891] [outer = 0x0] 04:08:10 INFO - ++DOMWINDOW == 34 (0x12015a000) [pid = 1722] [serial = 2892] [outer = 0x11f5cd400] 04:08:10 INFO - ++DOMWINDOW == 35 (0x12180a400) [pid = 1722] [serial = 2893] [outer = 0x11f5cd400] 04:08:10 INFO - ++DOCSHELL 0x11268a800 == 16 [pid = 1722] [id = 1231] 04:08:10 INFO - ++DOMWINDOW == 36 (0x122d43000) [pid = 1722] [serial = 2894] [outer = 0x0] 04:08:10 INFO - ++DOMWINDOW == 37 (0x122e9bc00) [pid = 1722] [serial = 2895] [outer = 0x122d43000] 04:08:11 INFO - ++DOCSHELL 0x128222000 == 17 [pid = 1722] [id = 1232] 04:08:11 INFO - ++DOMWINDOW == 38 (0x120259800) [pid = 1722] [serial = 2896] [outer = 0x0] 04:08:11 INFO - ++DOMWINDOW == 39 (0x124392000) [pid = 1722] [serial = 2897] [outer = 0x120259800] 04:08:11 INFO - [1722] WARNING: NS_ENSURE_TRUE(aSecondURI) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/ThirdPartyUtil.cpp, line 98 04:08:11 INFO - [1722] WARNING: NS_ENSURE_TRUE(aSecondURI) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/dom/base/ThirdPartyUtil.cpp, line 98 04:08:11 INFO - [1722] WARNING: RasterImage::Init failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/image/ImageFactory.cpp, line 109 04:08:11 INFO - [1722] WARNING: Image width or height is non-positive: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6316 04:08:11 INFO - ++DOMWINDOW == 40 (0x1247c5c00) [pid = 1722] [serial = 2898] [outer = 0x120259800] 04:08:11 INFO - ++DOCSHELL 0x129673000 == 18 [pid = 1722] [id = 1233] 04:08:11 INFO - ++DOMWINDOW == 41 (0x12870c800) [pid = 1722] [serial = 2899] [outer = 0x0] 04:08:11 INFO - ++DOMWINDOW == 42 (0x12870fc00) [pid = 1722] [serial = 2900] [outer = 0x12870c800] 04:08:12 INFO - MEMORY STAT | vsize 3451MB | residentFast 534MB | heapAllocated 132MB 04:08:12 INFO - 473 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_trackingprotection_errors.js | took 1784ms 04:08:12 INFO - ++DOCSHELL 0x12156a000 == 19 [pid = 1722] [id = 1234] 04:08:12 INFO - ++DOMWINDOW == 43 (0x12477f400) [pid = 1722] [serial = 2901] [outer = 0x0] 04:08:12 INFO - ++DOMWINDOW == 44 (0x1286d0000) [pid = 1722] [serial = 2902] [outer = 0x12477f400] 04:08:12 INFO - 474 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_view_source.js 04:08:12 INFO - ++DOCSHELL 0x12f124000 == 20 [pid = 1722] [id = 1235] 04:08:12 INFO - ++DOMWINDOW == 45 (0x12870f400) [pid = 1722] [serial = 2903] [outer = 0x0] 04:08:12 INFO - ++DOMWINDOW == 46 (0x12873e800) [pid = 1722] [serial = 2904] [outer = 0x12870f400] 04:08:12 INFO - ++DOMWINDOW == 47 (0x12f5a0800) [pid = 1722] [serial = 2905] [outer = 0x12870f400] 04:08:12 INFO - ++DOCSHELL 0x12f235000 == 21 [pid = 1722] [id = 1236] 04:08:12 INFO - ++DOMWINDOW == 48 (0x12e05dc00) [pid = 1722] [serial = 2906] [outer = 0x0] 04:08:12 INFO - ++DOMWINDOW == 49 (0x12e062800) [pid = 1722] [serial = 2907] [outer = 0x12e05dc00] 04:08:12 INFO - ++DOMWINDOW == 50 (0x12efb8c00) [pid = 1722] [serial = 2908] [outer = 0x12e05dc00] 04:08:12 INFO - ++DOCSHELL 0x12f6dc800 == 22 [pid = 1722] [id = 1237] 04:08:12 INFO - ++DOMWINDOW == 51 (0x12f59a400) [pid = 1722] [serial = 2909] [outer = 0x0] 04:08:12 INFO - ++DOMWINDOW == 52 (0x12f59d400) [pid = 1722] [serial = 2910] [outer = 0x12f59a400] 04:08:13 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-error.html, line 16: ReferenceError: fooBazBaz is not defined 04:08:13 INFO - ++DOCSHELL 0x12f233800 == 23 [pid = 1722] [id = 1238] 04:08:13 INFO - ++DOMWINDOW == 53 (0x12d405000) [pid = 1722] [serial = 2911] [outer = 0x0] 04:08:13 INFO - ++DOMWINDOW == 54 (0x12f25e000) [pid = 1722] [serial = 2912] [outer = 0x12d405000] 04:08:13 INFO - ++DOCSHELL 0x12ff83800 == 24 [pid = 1722] [id = 1239] 04:08:13 INFO - ++DOMWINDOW == 55 (0x13052e800) [pid = 1722] [serial = 2913] [outer = 0x0] 04:08:13 INFO - ++DOMWINDOW == 56 (0x12ff23800) [pid = 1722] [serial = 2914] [outer = 0x13052e800] 04:08:14 INFO - --DOCSHELL 0x11268b800 == 23 [pid = 1722] [id = 1184] 04:08:14 INFO - --DOCSHELL 0x112cb8800 == 22 [pid = 1722] [id = 1227] 04:08:14 INFO - --DOCSHELL 0x11321b800 == 21 [pid = 1722] [id = 1229] 04:08:14 INFO - --DOCSHELL 0x121555800 == 20 [pid = 1722] [id = 1230] 04:08:14 INFO - --DOCSHELL 0x11268a800 == 19 [pid = 1722] [id = 1231] 04:08:14 INFO - --DOCSHELL 0x128222000 == 18 [pid = 1722] [id = 1232] 04:08:14 INFO - --DOCSHELL 0x11359a000 == 17 [pid = 1722] [id = 1225] 04:08:14 INFO - --DOCSHELL 0x129673000 == 16 [pid = 1722] [id = 1233] 04:08:14 INFO - --DOCSHELL 0x1203c2800 == 15 [pid = 1722] [id = 1226] 04:08:14 INFO - --DOCSHELL 0x114b7f000 == 14 [pid = 1722] [id = 1185] 04:08:15 INFO - --DOMWINDOW == 55 (0x1286c9000) [pid = 1722] [serial = 2863] [outer = 0x0] [url = about:blank] 04:08:15 INFO - --DOMWINDOW == 54 (0x11344e800) [pid = 1722] [serial = 2825] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:15 INFO - --DOMWINDOW == 53 (0x128739000) [pid = 1722] [serial = 2842] [outer = 0x0] [url = about:blank] 04:08:15 INFO - --DOMWINDOW == 52 (0x1202e6000) [pid = 1722] [serial = 2872] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 04:08:15 INFO - --DOMWINDOW == 51 (0x12dd17000) [pid = 1722] [serial = 2865] [outer = 0x0] [url = about:blank] 04:08:15 INFO - --DOMWINDOW == 50 (0x11ef53000) [pid = 1722] [serial = 2861] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:15 INFO - ++DOCSHELL 0x112cbf800 == 15 [pid = 1722] [id = 1240] 04:08:15 INFO - ++DOMWINDOW == 51 (0x112bc1800) [pid = 1722] [serial = 2915] [outer = 0x0] 04:08:15 INFO - ++DOMWINDOW == 52 (0x112f4f800) [pid = 1722] [serial = 2916] [outer = 0x112bc1800] 04:08:15 INFO - ++DOMWINDOW == 53 (0x120d20400) [pid = 1722] [serial = 2917] [outer = 0x112bc1800] 04:08:15 INFO - ++DOMWINDOW == 54 (0x120e32000) [pid = 1722] [serial = 2918] [outer = 0x112bc1800] 04:08:15 INFO - [1722] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 04:08:16 INFO - --DOCSHELL 0x12ff83800 == 14 [pid = 1722] [id = 1239] 04:08:16 INFO - --DOCSHELL 0x12f233800 == 13 [pid = 1722] [id = 1238] 04:08:16 INFO - --DOCSHELL 0x12f6dc800 == 12 [pid = 1722] [id = 1237] 04:08:16 INFO - MEMORY STAT | vsize 3443MB | residentFast 526MB | heapAllocated 130MB 04:08:16 INFO - 475 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_view_source.js | took 3949ms 04:08:16 INFO - ++DOCSHELL 0x112698000 == 13 [pid = 1722] [id = 1241] 04:08:16 INFO - ++DOMWINDOW == 55 (0x1203dd800) [pid = 1722] [serial = 2919] [outer = 0x0] 04:08:16 INFO - ++DOMWINDOW == 56 (0x121317000) [pid = 1722] [serial = 2920] [outer = 0x1203dd800] 04:08:16 INFO - ++DOMWINDOW == 57 (0x1215dd400) [pid = 1722] [serial = 2921] [outer = 0x1215e5c00] 04:08:16 INFO - ++DOMWINDOW == 58 (0x121806000) [pid = 1722] [serial = 2922] [outer = 0x1215e6400] 04:08:16 INFO - --DOCSHELL 0x1140c3800 == 12 [pid = 1722] [id = 12] 04:08:16 INFO - ++DOMWINDOW == 59 (0x113444c00) [pid = 1722] [serial = 2923] [outer = 0x1215e5c00] 04:08:16 INFO - ++DOMWINDOW == 60 (0x11eefb000) [pid = 1722] [serial = 2924] [outer = 0x1215e6400] 04:08:17 INFO - --DOCSHELL 0x112ba4800 == 11 [pid = 1722] [id = 15] 04:08:17 INFO - --DOCSHELL 0x12c251800 == 10 [pid = 1722] [id = 8] 04:08:18 INFO - --DOCSHELL 0x12f235000 == 9 [pid = 1722] [id = 1236] 04:08:18 INFO - --DOCSHELL 0x12156a000 == 8 [pid = 1722] [id = 1234] 04:08:18 INFO - --DOCSHELL 0x12f124000 == 7 [pid = 1722] [id = 1235] 04:08:18 INFO - --DOMWINDOW == 59 (0x121806000) [pid = 1722] [serial = 2922] [outer = 0x1215e6400] [url = about:blank] 04:08:18 INFO - --DOMWINDOW == 58 (0x124393800) [pid = 1722] [serial = 10] [outer = 0x1215e6400] [url = about:blank] 04:08:18 INFO - --DOMWINDOW == 57 (0x1215dd400) [pid = 1722] [serial = 2921] [outer = 0x1215e5c00] [url = about:blank] 04:08:18 INFO - --DOMWINDOW == 56 (0x124393000) [pid = 1722] [serial = 9] [outer = 0x1215e5c00] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 55 (0x12f59d400) [pid = 1722] [serial = 2910] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 54 (0x12870fc00) [pid = 1722] [serial = 2900] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 53 (0x1247c5c00) [pid = 1722] [serial = 2898] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:19 INFO - --DOMWINDOW == 52 (0x1247c3c00) [pid = 1722] [serial = 2888] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 51 (0x112bc1800) [pid = 1722] [serial = 2915] [outer = 0x0] [url = view-source:http://example.com/browser/devtools/client/webconsole/test/test-error.html] 04:08:19 INFO - --DOMWINDOW == 50 (0x13052e800) [pid = 1722] [serial = 2913] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:08:19 INFO - --DOMWINDOW == 49 (0x12d405000) [pid = 1722] [serial = 2911] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 04:08:19 INFO - --DOMWINDOW == 48 (0x12f59a400) [pid = 1722] [serial = 2909] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:08:19 INFO - --DOMWINDOW == 47 (0x12ff23800) [pid = 1722] [serial = 2914] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 04:08:19 INFO - --DOMWINDOW == 46 (0x12f25e000) [pid = 1722] [serial = 2912] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 45 (0x12870f400) [pid = 1722] [serial = 2903] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 04:08:19 INFO - --DOMWINDOW == 44 (0x12870c800) [pid = 1722] [serial = 2899] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:08:19 INFO - --DOMWINDOW == 43 (0x120259800) [pid = 1722] [serial = 2896] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:19 INFO - --DOMWINDOW == 42 (0x12449a400) [pid = 1722] [serial = 2887] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 04:08:19 INFO - --DOMWINDOW == 41 (0x120d25400) [pid = 1722] [serial = 2884] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:19 INFO - --DOMWINDOW == 40 (0x12e05dc00) [pid = 1722] [serial = 2906] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:19 INFO - --DOMWINDOW == 39 (0x113444800) [pid = 1722] [serial = 2880] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 38 (0x112657c00) [pid = 1722] [serial = 2882] [outer = 0x0] [url = data:text/html;charset=utf8,<p>hello] 04:08:19 INFO - --DOMWINDOW == 37 (0x112f41000) [pid = 1722] [serial = 2889] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 36 (0x11f5cd400) [pid = 1722] [serial = 2891] [outer = 0x0] [url = http://tracking.example.org/browser/devtools/client/webconsole/test/test-trackingprotection-securityerrors.html] 04:08:19 INFO - --DOMWINDOW == 35 (0x122d43000) [pid = 1722] [serial = 2894] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 34 (0x113d20800) [pid = 1722] [serial = 35] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 33 (0x120e32000) [pid = 1722] [serial = 2918] [outer = 0x0] [url = view-source:http://example.com/browser/devtools/client/webconsole/test/test-error.html] 04:08:19 INFO - --DOMWINDOW == 32 (0x120d20400) [pid = 1722] [serial = 2917] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 31 (0x112f4f800) [pid = 1722] [serial = 2916] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 30 (0x11ec9d000) [pid = 1722] [serial = 34] [outer = 0x0] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,<window%20id='win'/>] 04:08:19 INFO - --DOMWINDOW == 29 (0x12477f400) [pid = 1722] [serial = 2901] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 28 (0x1286d0000) [pid = 1722] [serial = 2902] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 27 (0x113452400) [pid = 1722] [serial = 2881] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 26 (0x11e714000) [pid = 1722] [serial = 2883] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 25 (0x113262800) [pid = 1722] [serial = 2890] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 24 (0x12015a000) [pid = 1722] [serial = 2892] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 23 (0x122e9bc00) [pid = 1722] [serial = 2895] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 22 (0x12873e800) [pid = 1722] [serial = 2904] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 21 (0x12c3a9000) [pid = 1722] [serial = 21] [outer = 0x0] [url = about:newtab] 04:08:19 INFO - --DOMWINDOW == 20 (0x126488c00) [pid = 1722] [serial = 17] [outer = 0x0] [url = about:newtab] 04:08:19 INFO - --DOMWINDOW == 19 (0x114bef800) [pid = 1722] [serial = 28] [outer = 0x0] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,<window%20id='win'/>] 04:08:19 INFO - --DOMWINDOW == 18 (0x11eef7400) [pid = 1722] [serial = 36] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 17 (0x12152bc00) [pid = 1722] [serial = 2886] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:19 INFO - --DOMWINDOW == 16 (0x12efb8c00) [pid = 1722] [serial = 2908] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 04:08:19 INFO - --DOMWINDOW == 15 (0x12e062800) [pid = 1722] [serial = 2907] [outer = 0x0] [url = about:blank] 04:08:19 INFO - --DOMWINDOW == 14 (0x124392000) [pid = 1722] [serial = 2897] [outer = 0x0] [url = about:blank] 04:08:20 INFO - --DOMWINDOW == 13 (0x12f5a0800) [pid = 1722] [serial = 2905] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 04:08:20 INFO - --DOMWINDOW == 12 (0x12180a400) [pid = 1722] [serial = 2893] [outer = 0x0] [url = http://tracking.example.org/browser/devtools/client/webconsole/test/test-trackingprotection-securityerrors.html] 04:08:20 INFO - --DOCSHELL 0x112cbf800 == 6 [pid = 1722] [id = 1240] 04:08:23 INFO - Completed ShutdownLeaks collections in process 1722 04:08:23 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 208: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 04:08:23 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 04:08:23 INFO - --DOCSHELL 0x12663e800 == 5 [pid = 1722] [id = 6] 04:08:23 INFO - --DOCSHELL 0x114dab000 == 4 [pid = 1722] [id = 1] 04:08:23 INFO - --DOCSHELL 0x12184f000 == 3 [pid = 1722] [id = 3] 04:08:23 INFO - --DOCSHELL 0x112698000 == 2 [pid = 1722] [id = 1241] 04:08:23 INFO - --DOCSHELL 0x12188e000 == 1 [pid = 1722] [id = 4] 04:08:23 INFO - --DOCSHELL 0x11eec4800 == 0 [pid = 1722] [id = 2] 04:08:23 INFO - [1722] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 04:08:23 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 492: Error: forget() called twice 04:08:24 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 04:08:24 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 04:08:24 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 04:08:24 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 04:08:24 INFO - [1722] WARNING: nsAppShell::Exit() called redundantly: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/widget/cocoa/nsAppShell.mm, line 679 04:08:24 INFO - [1722] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-cen-m64-d-000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 769 04:08:25 INFO - --DOMWINDOW == 11 (0x11eefb000) [pid = 1722] [serial = 2924] [outer = 0x1215e6400] [url = about:blank] 04:08:25 INFO - --DOMWINDOW == 10 (0x113444c00) [pid = 1722] [serial = 2923] [outer = 0x1215e5c00] [url = about:blank] 04:08:25 INFO - --DOMWINDOW == 9 (0x1215e6400) [pid = 1722] [serial = 6] [outer = 0x0] [url = about:blank] 04:08:25 INFO - --DOMWINDOW == 8 (0x1215e5c00) [pid = 1722] [serial = 5] [outer = 0x0] [url = about:blank] 04:08:26 INFO - --DOMWINDOW == 7 (0x11eefdc00) [pid = 1722] [serial = 4] [outer = 0x0] [url = about:blank] 04:08:26 INFO - --DOMWINDOW == 6 (0x11513ac00) [pid = 1722] [serial = 2] [outer = 0x0] [url = about:blank] 04:08:26 INFO - --DOMWINDOW == 5 (0x114dc1400) [pid = 1722] [serial = 1] [outer = 0x0] [url = chrome://browser/content/hiddenWindow.xul] 04:08:26 INFO - --DOMWINDOW == 4 (0x1266eec00) [pid = 1722] [serial = 14] [outer = 0x0] [url = about:blank] 04:08:26 INFO - --DOMWINDOW == 3 (0x121317000) [pid = 1722] [serial = 2920] [outer = 0x0] [url = about:blank] 04:08:26 INFO - --DOMWINDOW == 2 (0x1203dd800) [pid = 1722] [serial = 2919] [outer = 0x0] [url = about:blank] 04:08:26 INFO - --DOMWINDOW == 1 (0x1266ed800) [pid = 1722] [serial = 13] [outer = 0x0] [url = chrome://mochikit/content/browser-harness.xul] 04:08:26 INFO - --DOMWINDOW == 0 (0x11eefcc00) [pid = 1722] [serial = 3] [outer = 0x0] [url = chrome://browser/content/browser.xul] 04:08:26 INFO - [1722] WARNING: OOPDeinit() without successful OOPInit(): file /builds/slave/m-cen-m64-d-000000000000000000/build/src/toolkit/crashreporter/nsExceptionHandler.cpp, line 2792 04:08:26 INFO - nsStringStats 04:08:26 INFO - => mAllocCount: 3347742 04:08:26 INFO - => mReallocCount: 244480 04:08:26 INFO - => mFreeCount: 3347742 04:08:26 INFO - => mShareCount: 5060207 04:08:26 INFO - => mAdoptCount: 216808 04:08:26 INFO - => mAdoptFreeCount: 216808 04:08:26 INFO - => Process ID: 1722, Thread ID: 140735086404352 04:08:26 INFO - TEST-INFO | Main app process: exit 0 04:08:26 INFO - runtests.py | Application ran for: 0:11:53.182369 04:08:26 INFO - zombiecheck | Reading PID log: /var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/tmpVwpybMpidlog 04:08:26 INFO - Stopping web server 04:08:26 INFO - Stopping web socket server 04:08:26 INFO - Stopping ssltunnel 04:08:26 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 04:08:26 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 04:08:26 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 04:08:26 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 04:08:26 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 1722 04:08:26 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 04:08:26 INFO - | | Per-Inst Leaked| Total Rem| 04:08:26 INFO - 0 |TOTAL | 21 0|231523328 0| 04:08:27 INFO - nsTraceRefcnt::DumpStatistics: 1562 entries 04:08:27 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 04:08:27 INFO - runtests.py | Running tests: end. 04:08:27 INFO - 476 INFO checking window state 04:08:27 INFO - 477 INFO TEST-START | Shutdown 04:08:27 INFO - 478 INFO Browser Chrome Test Summary 04:08:27 INFO - 479 INFO Passed: 2993 04:08:27 INFO - 480 INFO Failed: 0 04:08:27 INFO - 481 INFO Todo: 1 04:08:27 INFO - 482 INFO *** End BrowserChrome Test Results *** 04:08:27 INFO - TEST-INFO | checking window state 04:08:27 INFO - Browser Chrome Test Summary 04:08:27 INFO - Passed: 3729 04:08:27 INFO - Failed: 0 04:08:27 INFO - Todo: 1 04:08:27 INFO - *** End BrowserChrome Test Results *** 04:08:27 INFO - SUITE-END | took 840s 04:08:27 INFO - Return code: 0 04:08:27 INFO - TinderboxPrint: mochitest-mochitest-devtools-chrome-chunked<br/>3729/0/1 04:08:27 INFO - # TBPL SUCCESS # 04:08:27 INFO - The mochitest suite: mochitest-devtools-chrome-chunked ran with return status: SUCCESS 04:08:27 INFO - Running post-action listener: _package_coverage_data 04:08:27 INFO - Running post-action listener: _resource_record_post_action 04:08:27 INFO - Running post-run listener: _resource_record_post_run 04:08:28 INFO - Total resource usage - Wall time: 863s; CPU: 32.0%; Read bytes: 44160000; Write bytes: 414609408; Read time: 6038; Write time: 33648 04:08:28 INFO - install - Wall time: 22s; CPU: 29.0%; Read bytes: 140493312; Write bytes: 139307008; Read time: 16542; Write time: 4642 04:08:28 INFO - run-tests - Wall time: 841s; CPU: 32.0%; Read bytes: 41935872; Write bytes: 264448000; Read time: 5492; Write time: 27918 04:08:28 INFO - Running post-run listener: _upload_blobber_files 04:08:28 INFO - Blob upload gear active. 04:08:28 INFO - Preparing to upload files from /builds/slave/test/build/blobber_upload_dir. 04:08:28 INFO - Files from /builds/slave/test/build/blobber_upload_dir are to be uploaded with <mozilla-central> branch at the following location(s): https://blobupload.elasticbeanstalk.com 04:08:28 INFO - Running command: ['/builds/slave/test/build/venv/bin/python', '/builds/slave/test/build/venv/bin/blobberc.py', '-u', 'https://blobupload.elasticbeanstalk.com', '-a', '/builds/slave/test/oauth.txt', '-b', 'mozilla-central', '-d', '/builds/slave/test/build/blobber_upload_dir', '--output-manifest', '/builds/slave/test/build/uploaded_files.json'] 04:08:28 INFO - Copy/paste: /builds/slave/test/build/venv/bin/python /builds/slave/test/build/venv/bin/blobberc.py -u https://blobupload.elasticbeanstalk.com -a /builds/slave/test/oauth.txt -b mozilla-central -d /builds/slave/test/build/blobber_upload_dir --output-manifest /builds/slave/test/build/uploaded_files.json 04:08:28 INFO - (blobuploader) - INFO - Open directory for files ... 04:08:28 INFO - (blobuploader) - INFO - Uploading /builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log ... 04:08:28 INFO - (blobuploader) - INFO - Using https://blobupload.elasticbeanstalk.com 04:08:28 INFO - (blobuploader) - INFO - Uploading, attempt #1. 04:08:29 INFO - (blobuploader) - INFO - TinderboxPrint: <a href='http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/4bf1ae5164d8b1abaa49ac1cdb1fdade7c38d08e8e585ca6f8fe993e59fe544e780f7ade63765672e848c01791fdc9129c47a203d7bab6d3b1b22ff4e67d60af'>mochitest-devtools-chrome-chunked_errorsummary.log</a>: uploaded 04:08:29 INFO - (blobuploader) - INFO - Blobserver returned 202. File uploaded! 04:08:29 INFO - (blobuploader) - INFO - Done attempting. 04:08:29 INFO - (blobuploader) - INFO - Uploading /builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log ... 04:08:29 INFO - (blobuploader) - INFO - Using https://blobupload.elasticbeanstalk.com 04:08:29 INFO - (blobuploader) - INFO - Uploading, attempt #1. 04:08:30 INFO - (blobuploader) - INFO - TinderboxPrint: <a href='http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/e1c93b3224501c6a1eeda587c920aa54783329061101cd97e1520b7cca3fab59763b91d897d57da6ddb1293b8e002ee5a9d927df1e92ca7b167794a2afeff25c'>mochitest-devtools-chrome-chunked_raw.log</a>: uploaded 04:08:30 INFO - (blobuploader) - INFO - Blobserver returned 202. File uploaded! 04:08:30 INFO - (blobuploader) - INFO - Done attempting. 04:08:30 INFO - (blobuploader) - INFO - Iteration through files over. 04:08:30 INFO - Return code: 0 04:08:30 INFO - rmtree: /builds/slave/test/build/uploaded_files.json 04:08:30 INFO - retry: Calling remove with args: ('/builds/slave/test/build/uploaded_files.json',), kwargs: {}, attempt #1 04:08:30 INFO - Setting buildbot property blobber_files to {"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/e1c93b3224501c6a1eeda587c920aa54783329061101cd97e1520b7cca3fab59763b91d897d57da6ddb1293b8e002ee5a9d927df1e92ca7b167794a2afeff25c", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/4bf1ae5164d8b1abaa49ac1cdb1fdade7c38d08e8e585ca6f8fe993e59fe544e780f7ade63765672e848c01791fdc9129c47a203d7bab6d3b1b22ff4e67d60af"} 04:08:30 INFO - Writing buildbot properties ['blobber_files'] to /builds/slave/test/properties/blobber_files 04:08:30 INFO - Writing to file /builds/slave/test/properties/blobber_files 04:08:30 INFO - Contents: 04:08:30 INFO - blobber_files:{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/e1c93b3224501c6a1eeda587c920aa54783329061101cd97e1520b7cca3fab59763b91d897d57da6ddb1293b8e002ee5a9d927df1e92ca7b167794a2afeff25c", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/4bf1ae5164d8b1abaa49ac1cdb1fdade7c38d08e8e585ca6f8fe993e59fe544e780f7ade63765672e848c01791fdc9129c47a203d7bab6d3b1b22ff4e67d60af"} 04:08:30 INFO - Copying logs to upload dir... 04:08:30 INFO - mkdir: /builds/slave/test/build/upload/logs program finished with exit code 0 elapsedTime=963.690826 ========= master_lag: 0.13 ========= ========= Finished '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' (results: 0, elapsed: 16 mins, 3 secs) (at 2015-11-03 04:08:30.945228) ========= ========= Started set props: build_url blobber_files symbols_url (results: 0, elapsed: 0 secs) (at 2015-11-03 04:08:30.948753) ========= bash -c 'for file in `ls -1`; do cat $file; done' in dir /builds/slave/test/properties (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'for file in `ls -1`; do cat $file; done'] environment: Apple_PubSub_Socket_Render=/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test/properties RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners TMPDIR=/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.7 XPC_FLAGS=0x0 XPC_SERVICE_NAME=0 __CF_USER_TEXT_ENCODING=0x1C:0x0:0x0 using PTY: False blobber_files:{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/e1c93b3224501c6a1eeda587c920aa54783329061101cd97e1520b7cca3fab59763b91d897d57da6ddb1293b8e002ee5a9d927df1e92ca7b167794a2afeff25c", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/4bf1ae5164d8b1abaa49ac1cdb1fdade7c38d08e8e585ca6f8fe993e59fe544e780f7ade63765672e848c01791fdc9129c47a203d7bab6d3b1b22ff4e67d60af"} build_url:https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg symbols_url:https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip program finished with exit code 0 elapsedTime=0.013483 build_url: 'https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg' blobber_files: '{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/e1c93b3224501c6a1eeda587c920aa54783329061101cd97e1520b7cca3fab59763b91d897d57da6ddb1293b8e002ee5a9d927df1e92ca7b167794a2afeff25c", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-central/sha512/4bf1ae5164d8b1abaa49ac1cdb1fdade7c38d08e8e585ca6f8fe993e59fe544e780f7ade63765672e848c01791fdc9129c47a203d7bab6d3b1b22ff4e67d60af"}' symbols_url: 'https://queue.taskcluster.net/v1/task/F8rCFHIiT3q8j3fQzNv42A/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip' ========= master_lag: 0.02 ========= ========= Finished set props: build_url blobber_files symbols_url (results: 0, elapsed: 0 secs) (at 2015-11-03 04:08:30.981743) ========= ========= Started 'rm -f ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 04:08:30.982101) ========= rm -f oauth.txt in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-f', 'oauth.txt'] environment: Apple_PubSub_Socket_Render=/private/tmp/com.apple.launchd.PKOZFpaZ4e/Render GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/private/tmp/com.apple.launchd.2lCFfvk5D8/Listeners TMPDIR=/var/folders/mw/6zfs68z12k9__x92dkhlbk9800000w/T/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.7 XPC_FLAGS=0x0 XPC_SERVICE_NAME=0 __CF_USER_TEXT_ENCODING=0x1C:0x0:0x0 using PTY: False program finished with exit code 0 elapsedTime=0.005342 ========= master_lag: 0.05 ========= ========= Finished 'rm -f ...' (results: 0, elapsed: 0 secs) (at 2015-11-03 04:08:31.034342) ========= ========= Started reboot skipped (results: 3, elapsed: 0 secs) (at 2015-11-03 04:08:31.034703) ========= ========= Finished reboot skipped (results: 3, elapsed: 0 secs) (at 2015-11-03 04:08:31.035187) ========= ========= Total master_lag: 0.62 =========